\n\n return h('div', {\n key: \"modal-outer-\".concat(this._uid),\n style: this.modalOuterStyle,\n attrs: _objectSpread({}, scopedStyleAttrs, {}, this.$attrs, {\n id: this.safeId('__BV_modal_outer_')\n })\n }, [modal, backdrop]);\n }\n },\n render: function render(h) {\n if (this.static) {\n return this.lazy && this.isHidden ? h() : this.makeModal(h);\n } else {\n return this.isHidden ? h() : h(__WEBPACK_IMPORTED_MODULE_10__utils_transporter__[\"a\" /* BTransporterSingle */], {}, [this.makeModal(h)]);\n }\n }\n});\n\n/***/ }),\n\n/***/ \"DuR2\":\n/***/ (function(module, exports) {\n\nvar g;\r\n\r\n// This works in non-strict mode\r\ng = (function() {\r\n\treturn this;\r\n})();\r\n\r\ntry {\r\n\t// This works if eval is allowed (see CSP)\r\n\tg = g || Function(\"return this\")() || (1,eval)(\"this\");\r\n} catch(e) {\r\n\t// This works if the window reference is available\r\n\tif(typeof window === \"object\")\r\n\t\tg = window;\r\n}\r\n\r\n// g can still be undefined, but nothing to do about it...\r\n// We return undefined, instead of nothing here, so it's\r\n// easier to handle this case. if(!global) { ...}\r\n\r\nmodule.exports = g;\r\n\n\n/***/ }),\n\n/***/ \"E4zB\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BRow; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_array__ = __webpack_require__(\"gaHu\");\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\nvar COMMON_ALIGNMENT = ['start', 'end', 'center'];\nvar props = {\n tag: {\n type: String,\n default: 'div'\n },\n noGutters: {\n type: Boolean,\n default: false\n },\n alignV: {\n type: String,\n default: null,\n validator: function validator(str) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_array__[\"c\" /* arrayIncludes */])(COMMON_ALIGNMENT.concat(['baseline', 'stretch']), str);\n }\n },\n alignH: {\n type: String,\n default: null,\n validator: function validator(str) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_array__[\"c\" /* arrayIncludes */])(COMMON_ALIGNMENT.concat(['between', 'around']), str);\n }\n },\n alignContent: {\n type: String,\n default: null,\n validator: function validator(str) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_array__[\"c\" /* arrayIncludes */])(COMMON_ALIGNMENT.concat(['between', 'around', 'stretch']), str);\n }\n } // @vue/component\n\n};\nvar BRow =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BRow',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var _class;\n\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n staticClass: 'row',\n class: (_class = {\n 'no-gutters': props.noGutters\n }, _defineProperty(_class, \"align-items-\".concat(props.alignV), props.alignV), _defineProperty(_class, \"justify-content-\".concat(props.alignH), props.alignH), _defineProperty(_class, \"align-content-\".concat(props.alignContent), props.alignContent), _class)\n }), children);\n }\n});\n\n/***/ }),\n\n/***/ \"EA8u\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BButton; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_pluck_props__ = __webpack_require__(\"yqsc\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_array__ = __webpack_require__(\"gaHu\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__utils_config__ = __webpack_require__(\"UE/W\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__utils_dom__ = __webpack_require__(\"EWS6\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__utils_object__ = __webpack_require__(\"XZTZ\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__link_link__ = __webpack_require__(\"hJU9\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\n\n\n\n\n // --- Constants --\n\nvar NAME = 'BButton';\nvar btnProps = {\n block: {\n type: Boolean,\n default: false\n },\n disabled: {\n type: Boolean,\n default: false\n },\n size: {\n type: String,\n default: function _default() {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_4__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'size');\n }\n },\n variant: {\n type: String,\n default: function _default() {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_4__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'variant');\n }\n },\n type: {\n type: String,\n default: 'button'\n },\n tag: {\n type: String,\n default: 'button'\n },\n pill: {\n type: Boolean,\n default: false\n },\n squared: {\n type: Boolean,\n default: false\n },\n pressed: {\n // tri-state prop: true, false or null\n // => on, off, not a toggle\n type: Boolean,\n default: null\n }\n};\nvar linkProps = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_8__link_link__[\"b\" /* propsFactory */])();\ndelete linkProps.href.default;\ndelete linkProps.to.default;\nvar linkPropKeys = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_7__utils_object__[\"a\" /* keys */])(linkProps);\nvar props = _objectSpread({}, linkProps, {}, btnProps); // --- Helper methods ---\n// Focus handler for toggle buttons. Needs class of 'focus' when focused.\n\nvar handleFocus = function handleFocus(evt) {\n if (evt.type === 'focusin') {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_dom__[\"o\" /* addClass */])(evt.target, 'focus');\n } else if (evt.type === 'focusout') {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_dom__[\"p\" /* removeClass */])(evt.target, 'focus');\n }\n}; // Is the requested button a link?\n\n\nvar isLink = function isLink(props) {\n // If tag prop is set to `a`, we use a b-link to get proper disabled handling\n return Boolean(props.href || props.to || props.tag && String(props.tag).toLowerCase() === 'a');\n}; // Is the button to be a toggle button?\n\n\nvar isToggle = function isToggle(props) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_inspect__[\"l\" /* isBoolean */])(props.pressed);\n}; // Is the button \"really\" a button?\n\n\nvar isButton = function isButton(props) {\n if (isLink(props)) {\n return false;\n } else if (props.tag && String(props.tag).toLowerCase() !== 'button') {\n return false;\n }\n\n return true;\n}; // Is the requested tag not a button or link?\n\n\nvar isNonStandardTag = function isNonStandardTag(props) {\n return !isLink(props) && !isButton(props);\n}; // Compute required classes (non static classes)\n\n\nvar computeClass = function computeClass(props) {\n var _ref;\n\n return [\"btn-\".concat(props.variant || __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_4__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'variant')), (_ref = {}, _defineProperty(_ref, \"btn-\".concat(props.size), Boolean(props.size)), _defineProperty(_ref, 'btn-block', props.block), _defineProperty(_ref, 'rounded-pill', props.pill), _defineProperty(_ref, 'rounded-0', props.squared && !props.pill), _defineProperty(_ref, \"disabled\", props.disabled), _defineProperty(_ref, \"active\", props.pressed), _ref)];\n}; // Compute the link props to pass to b-link (if required)\n\n\nvar computeLinkProps = function computeLinkProps(props) {\n return isLink(props) ? __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_pluck_props__[\"a\" /* default */])(linkPropKeys, props) : null;\n}; // Compute the attributes for a button\n\n\nvar computeAttrs = function computeAttrs(props, data) {\n var button = isButton(props);\n var link = isLink(props);\n var toggle = isToggle(props);\n var nonStdTag = isNonStandardTag(props);\n var role = data.attrs && data.attrs.role ? data.attrs.role : null;\n var tabindex = data.attrs ? data.attrs.tabindex : null;\n\n if (nonStdTag) {\n tabindex = '0';\n }\n\n return {\n // Type only used for \"real\" buttons\n type: button && !link ? props.type : null,\n // Disabled only set on \"real\" buttons\n disabled: button ? props.disabled : null,\n // We add a role of button when the tag is not a link or button for ARIA.\n // Don't bork any role provided in data.attrs when isLink or isButton\n role: nonStdTag ? 'button' : role,\n // We set the aria-disabled state for non-standard tags\n 'aria-disabled': nonStdTag ? String(props.disabled) : null,\n // For toggles, we need to set the pressed state for ARIA\n 'aria-pressed': toggle ? String(props.pressed) : null,\n // autocomplete off is needed in toggle mode to prevent some browsers from\n // remembering the previous setting when using the back button.\n autocomplete: toggle ? 'off' : null,\n // Tab index is used when the component is not a button.\n // Links are tabbable, but don't allow disabled, while non buttons or links\n // are not tabbable, so we mimic that functionality by disabling tabbing\n // when disabled, and adding a tabindex of '0' to non buttons or non links.\n tabindex: props.disabled && !button ? '-1' : tabindex\n };\n}; // @vue/component\n\n\nvar BButton =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: NAME,\n functional: true,\n props: props,\n render: function render(h, _ref2) {\n var props = _ref2.props,\n data = _ref2.data,\n listeners = _ref2.listeners,\n children = _ref2.children;\n var toggle = isToggle(props);\n var link = isLink(props);\n var on = {\n click: function click(evt) {\n /* istanbul ignore if: blink/button disabled should handle this */\n if (props.disabled && __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_inspect__[\"k\" /* isEvent */])(evt)) {\n evt.stopPropagation();\n evt.preventDefault();\n } else if (toggle && listeners && listeners['update:pressed']) {\n // Send .sync updates to any \"pressed\" prop (if .sync listeners)\n // Concat will normalize the value to an array\n // without double wrapping an array value in an array.\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_array__[\"a\" /* concat */])(listeners['update:pressed']).forEach(function (fn) {\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_inspect__[\"b\" /* isFunction */])(fn)) {\n fn(!props.pressed);\n }\n });\n }\n }\n };\n\n if (toggle) {\n on.focusin = handleFocus;\n on.focusout = handleFocus;\n }\n\n var componentData = {\n staticClass: 'btn',\n class: computeClass(props),\n props: computeLinkProps(props),\n attrs: computeAttrs(props, data),\n on: on\n };\n return h(link ? __WEBPACK_IMPORTED_MODULE_8__link_link__[\"a\" /* BLink */] : props.tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, componentData), children);\n }\n});\n\n/***/ }),\n\n/***/ \"EGZi\":\n/***/ (function(module, exports) {\n\nmodule.exports = function (done, value) {\n return { value: value, done: !!done };\n};\n\n\n/***/ }),\n\n/***/ \"ETHv\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var symbolMap = {\n '1': '१',\n '2': '२',\n '3': '३',\n '4': '४',\n '5': '५',\n '6': '६',\n '7': '७',\n '8': '८',\n '9': '९',\n '0': '०'\n },\n numberMap = {\n '१': '1',\n '२': '2',\n '३': '3',\n '४': '4',\n '५': '5',\n '६': '6',\n '७': '7',\n '८': '8',\n '९': '9',\n '०': '0'\n };\n\n var hi = moment.defineLocale('hi', {\n months : 'जनवरी_फ़रवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितम्बर_अक्टूबर_नवम्बर_दिसम्बर'.split('_'),\n monthsShort : 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split('_'),\n monthsParseExact: true,\n weekdays : 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),\n weekdaysShort : 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split('_'),\n weekdaysMin : 'र_सो_मं_बु_गु_शु_श'.split('_'),\n longDateFormat : {\n LT : 'A h:mm बजे',\n LTS : 'A h:mm:ss बजे',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY, A h:mm बजे',\n LLLL : 'dddd, D MMMM YYYY, A h:mm बजे'\n },\n calendar : {\n sameDay : '[आज] LT',\n nextDay : '[कल] LT',\n nextWeek : 'dddd, LT',\n lastDay : '[कल] LT',\n lastWeek : '[पिछले] dddd, LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%s में',\n past : '%s पहले',\n s : 'कुछ ही क्षण',\n ss : '%d सेकंड',\n m : 'एक मिनट',\n mm : '%d मिनट',\n h : 'एक घंटा',\n hh : '%d घंटे',\n d : 'एक दिन',\n dd : '%d दिन',\n M : 'एक महीने',\n MM : '%d महीने',\n y : 'एक वर्ष',\n yy : '%d वर्ष'\n },\n preparse: function (string) {\n return string.replace(/[१२३४५६७८९०]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // Hindi notation for meridiems are quite fuzzy in practice. While there exists\n // a rigid notion of a 'Pahar' it is not used as rigidly in modern Hindi.\n meridiemParse: /रात|सुबह|दोपहर|शाम/,\n meridiemHour : function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'रात') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'सुबह') {\n return hour;\n } else if (meridiem === 'दोपहर') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'शाम') {\n return hour + 12;\n }\n },\n meridiem : function (hour, minute, isLower) {\n if (hour < 4) {\n return 'रात';\n } else if (hour < 10) {\n return 'सुबह';\n } else if (hour < 17) {\n return 'दोपहर';\n } else if (hour < 20) {\n return 'शाम';\n } else {\n return 'रात';\n }\n },\n week : {\n dow : 0, // Sunday is the first day of the week.\n doy : 6 // The week that contains Jan 6th is the first week of the year.\n }\n });\n\n return hi;\n\n})));\n\n\n/***/ }),\n\n/***/ \"EWS6\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export matchesEl */\n/* unused harmony export closestEl */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"w\", function() { return requestAF; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"v\", function() { return MutationObs; });\n/* unused harmony export parseEventOptions */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"k\", function() { return eventOn; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"l\", function() { return eventOff; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"c\", function() { return isElement; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return isVisible; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"m\", function() { return isDisabled; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"z\", function() { return reflow; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"s\", function() { return selectAll; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"f\", function() { return select; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"u\", function() { return matches; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"d\", function() { return closest; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"y\", function() { return contains; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"b\", function() { return getById; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"o\", function() { return addClass; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"p\", function() { return removeClass; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"e\", function() { return hasClass; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"h\", function() { return setAttr; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"i\", function() { return removeAttr; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"g\", function() { return getAttr; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"j\", function() { return hasAttr; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"t\", function() { return getBCR; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"n\", function() { return getCS; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"x\", function() { return getSel; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"r\", function() { return offset; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"q\", function() { return position; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__array__ = __webpack_require__(\"gaHu\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__env__ = __webpack_require__(\"ixoM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_inspect__ = __webpack_require__(\"8Sz2\");\n\n\n // --- Constants ---\n\nvar w = __WEBPACK_IMPORTED_MODULE_1__env__[\"b\" /* hasWindowSupport */] ? window : {};\nvar d = __WEBPACK_IMPORTED_MODULE_1__env__[\"c\" /* hasDocumentSupport */] ? document : {};\nvar elProto = typeof Element !== 'undefined' ? Element.prototype : {}; // --- Normalization utils ---\n// See: https://developer.mozilla.org/en-US/docs/Web/API/Element/matches#Polyfill\n\n/* istanbul ignore next */\n\nvar matchesEl = elProto.matches || elProto.msMatchesSelector || elProto.webkitMatchesSelector; // See: https://developer.mozilla.org/en-US/docs/Web/API/Element/closest\n\n/* istanbul ignore next */\n\nvar closestEl = elProto.closest || function (sel)\n/* istanbul ignore next */\n{\n var el = this;\n\n do {\n // Use our \"patched\" matches function\n if (matches(el, sel)) {\n return el;\n }\n\n el = el.parentElement || el.parentNode;\n } while (!__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_inspect__[\"i\" /* isNull */])(el) && el.nodeType === Node.ELEMENT_NODE);\n\n return null;\n}; // `requestAnimationFrame()` convenience method\n\nvar requestAF = w.requestAnimationFrame || w.webkitRequestAnimationFrame || w.mozRequestAnimationFrame || w.msRequestAnimationFrame || w.oRequestAnimationFrame || // Fallback, but not a true polyfill\n// Only needed for Opera Mini\n\n/* istanbul ignore next */\nfunction (cb) {\n return setTimeout(cb, 16);\n};\nvar MutationObs = w.MutationObserver || w.WebKitMutationObserver || w.MozMutationObserver || null; // --- Utils ---\n// Normalize event options based on support of passive option\n// Exported only for testing purposes\n\nvar parseEventOptions = function parseEventOptions(options) {\n /* istanbul ignore else: can't test in JSDOM, as it supports passive */\n if (__WEBPACK_IMPORTED_MODULE_1__env__[\"d\" /* hasPassiveEventSupport */]) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_inspect__[\"c\" /* isObject */])(options) ? options : {\n useCapture: Boolean(options || false)\n };\n } else {\n // Need to translate to actual Boolean value\n return Boolean(__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_inspect__[\"c\" /* isObject */])(options) ? options.useCapture : options);\n }\n}; // Attach an event listener to an element\n\nvar eventOn = function eventOn(el, evtName, handler, options) {\n if (el && el.addEventListener) {\n el.addEventListener(evtName, handler, parseEventOptions(options));\n }\n}; // Remove an event listener from an element\n\nvar eventOff = function eventOff(el, evtName, handler, options) {\n if (el && el.removeEventListener) {\n el.removeEventListener(evtName, handler, parseEventOptions(options));\n }\n}; // Determine if an element is an HTML Element\n\nvar isElement = function isElement(el) {\n return Boolean(el && el.nodeType === Node.ELEMENT_NODE);\n}; // Determine if an HTML element is visible - Faster than CSS check\n\nvar isVisible = function isVisible(el) {\n if (!isElement(el) || !contains(d.body, el)) {\n return false;\n }\n\n if (el.style.display === 'none') {\n // We do this check to help with vue-test-utils when using v-show\n\n /* istanbul ignore next */\n return false;\n } // All browsers support getBoundingClientRect(), except JSDOM as it returns all 0's for values :(\n // So any tests that need isVisible will fail in JSDOM\n // Except when we override the getBCR prototype in some tests\n\n\n var bcr = getBCR(el);\n return Boolean(bcr && bcr.height > 0 && bcr.width > 0);\n}; // Determine if an element is disabled\n\nvar isDisabled = function isDisabled(el) {\n return !isElement(el) || el.disabled || Boolean(getAttr(el, 'disabled')) || hasClass(el, 'disabled');\n}; // Cause/wait-for an element to reflow it's content (adjusting it's height/width)\n\nvar reflow = function reflow(el) {\n // Requesting an elements offsetHight will trigger a reflow of the element content\n\n /* istanbul ignore next: reflow doesn't happen in JSDOM */\n return isElement(el) && el.offsetHeight;\n}; // Select all elements matching selector. Returns `[]` if none found\n\nvar selectAll = function selectAll(selector, root) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__array__[\"d\" /* from */])((isElement(root) ? root : d).querySelectorAll(selector));\n}; // Select a single element, returns `null` if not found\n\nvar select = function select(selector, root) {\n return (isElement(root) ? root : d).querySelector(selector) || null;\n}; // Determine if an element matches a selector\n\nvar matches = function matches(el, selector) {\n if (!isElement(el)) {\n return false;\n }\n\n return matchesEl.call(el, selector);\n}; // Finds closest element matching selector. Returns `null` if not found\n\nvar closest = function closest(selector, root) {\n if (!isElement(root)) {\n return null;\n }\n\n var el = closestEl.call(root, selector); // Emulate jQuery closest and return `null` if match is the passed in element (root)\n\n return el === root ? null : el;\n}; // Returns true if the parent element contains the child element\n\nvar contains = function contains(parent, child) {\n if (!parent || !__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_inspect__[\"b\" /* isFunction */])(parent.contains)) {\n return false;\n }\n\n return parent.contains(child);\n}; // Get an element given an ID\n\nvar getById = function getById(id) {\n return d.getElementById(/^#/.test(id) ? id.slice(1) : id) || null;\n}; // Add a class to an element\n\nvar addClass = function addClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n el.classList.add(className);\n }\n}; // Remove a class from an element\n\nvar removeClass = function removeClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n el.classList.remove(className);\n }\n}; // Test if an element has a class\n\nvar hasClass = function hasClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n return el.classList.contains(className);\n }\n\n return false;\n}; // Set an attribute on an element\n\nvar setAttr = function setAttr(el, attr, val) {\n if (attr && isElement(el)) {\n el.setAttribute(attr, val);\n }\n}; // Remove an attribute from an element\n\nvar removeAttr = function removeAttr(el, attr) {\n if (attr && isElement(el)) {\n el.removeAttribute(attr);\n }\n}; // Get an attribute value from an element\n// Returns `null` if not found\n\nvar getAttr = function getAttr(el, attr) {\n return attr && isElement(el) ? el.getAttribute(attr) : null;\n}; // Determine if an attribute exists on an element\n// Returns `true` or `false`, or `null` if element not found\n\nvar hasAttr = function hasAttr(el, attr) {\n return attr && isElement(el) ? el.hasAttribute(attr) : null;\n}; // Return the Bounding Client Rect of an element\n// Returns `null` if not an element\n\n/* istanbul ignore next: getBoundingClientRect() doesn't work in JSDOM */\n\nvar getBCR = function getBCR(el) {\n return isElement(el) ? el.getBoundingClientRect() : null;\n}; // Get computed style object for an element\n\n/* istanbul ignore next: getComputedStyle() doesn't work in JSDOM */\n\nvar getCS = function getCS(el) {\n return __WEBPACK_IMPORTED_MODULE_1__env__[\"b\" /* hasWindowSupport */] && isElement(el) ? w.getComputedStyle(el) : {};\n}; // Returns a `Selection` object representing the range of text selected\n// Returns `null` if no window support is given\n\n/* istanbul ignore next: getSelection() doesn't work in JSDOM */\n\nvar getSel = function getSel() {\n return __WEBPACK_IMPORTED_MODULE_1__env__[\"b\" /* hasWindowSupport */] && w.getSelection ? w.getSelection() : null;\n}; // Return an element's offset with respect to document element\n// https://j11y.io/jquery/#v=git&fn=jQuery.fn.offset\n\nvar offset = function offset(el)\n/* istanbul ignore next: getBoundingClientRect(), getClientRects() doesn't work in JSDOM */\n{\n var _offset = {\n top: 0,\n left: 0\n };\n\n if (!isElement(el) || el.getClientRects().length === 0) {\n return _offset;\n }\n\n var bcr = getBCR(el);\n\n if (bcr) {\n var win = el.ownerDocument.defaultView;\n _offset.top = bcr.top + win.pageYOffset;\n _offset.left = bcr.left + win.pageXOffset;\n }\n\n return _offset;\n}; // Return an element's offset with respect to to it's offsetParent\n// https://j11y.io/jquery/#v=git&fn=jQuery.fn.position\n\nvar position = function position(el)\n/* istanbul ignore next: getBoundingClientRect() doesn't work in JSDOM */\n{\n var _offset = {\n top: 0,\n left: 0\n };\n\n if (!isElement(el)) {\n return _offset;\n }\n\n var parentOffset = {\n top: 0,\n left: 0\n };\n var elStyles = getCS(el);\n\n if (elStyles.position === 'fixed') {\n _offset = getBCR(el) || _offset;\n } else {\n _offset = offset(el);\n var doc = el.ownerDocument;\n var offsetParent = el.offsetParent || doc.documentElement;\n\n while (offsetParent && (offsetParent === doc.body || offsetParent === doc.documentElement) && getCS(offsetParent).position === 'static') {\n offsetParent = offsetParent.parentNode;\n }\n\n if (offsetParent && offsetParent !== el && offsetParent.nodeType === Node.ELEMENT_NODE) {\n parentOffset = offset(offsetParent);\n var offsetParentStyles = getCS(offsetParent);\n parentOffset.top += parseFloat(offsetParentStyles.borderTopWidth);\n parentOffset.left += parseFloat(offsetParentStyles.borderLeftWidth);\n }\n }\n\n return {\n top: _offset.top - parentOffset.top - parseFloat(elStyles.marginTop),\n left: _offset.left - parentOffset.left - parseFloat(elStyles.marginLeft)\n };\n};\n\n/***/ }),\n\n/***/ \"EqBC\":\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\n// https://github.com/tc39/proposal-promise-finally\n\nvar $export = __webpack_require__(\"kM2E\");\nvar core = __webpack_require__(\"FeBl\");\nvar global = __webpack_require__(\"7KvD\");\nvar speciesConstructor = __webpack_require__(\"t8x9\");\nvar promiseResolve = __webpack_require__(\"fJUb\");\n\n$export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) {\n var C = speciesConstructor(this, core.Promise || global.Promise);\n var isFunction = typeof onFinally == 'function';\n return this.then(\n isFunction ? function (x) {\n return promiseResolve(C, onFinally()).then(function () { return x; });\n } : onFinally,\n isFunction ? function (e) {\n return promiseResolve(C, onFinally()).then(function () { throw e; });\n } : onFinally\n );\n} });\n\n\n/***/ }),\n\n/***/ \"EqjI\":\n/***/ (function(module, exports) {\n\nmodule.exports = function (it) {\n return typeof it === 'object' ? it !== null : typeof it === 'function';\n};\n\n\n/***/ }),\n\n/***/ \"F+2e\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var symbolMap = {\n '1': '၁',\n '2': '၂',\n '3': '၃',\n '4': '၄',\n '5': '၅',\n '6': '၆',\n '7': '၇',\n '8': '၈',\n '9': '၉',\n '0': '၀'\n }, numberMap = {\n '၁': '1',\n '၂': '2',\n '၃': '3',\n '၄': '4',\n '၅': '5',\n '၆': '6',\n '၇': '7',\n '၈': '8',\n '၉': '9',\n '၀': '0'\n };\n\n var my = moment.defineLocale('my', {\n months: 'ဇန်နဝါရီ_ဖေဖော်ဝါရီ_မတ်_ဧပြီ_မေ_ဇွန်_ဇူလိုင်_သြဂုတ်_စက်တင်ဘာ_အောက်တိုဘာ_နိုဝင်ဘာ_ဒီဇင်ဘာ'.split('_'),\n monthsShort: 'ဇန်_ဖေ_မတ်_ပြီ_မေ_ဇွန်_လိုင်_သြ_စက်_အောက်_နို_ဒီ'.split('_'),\n weekdays: 'တနင်္ဂနွေ_တနင်္လာ_အင်္ဂါ_ဗုဒ္ဓဟူး_ကြာသပတေး_သောကြာ_စနေ'.split('_'),\n weekdaysShort: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n weekdaysMin: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm'\n },\n calendar: {\n sameDay: '[ယနေ.] LT [မှာ]',\n nextDay: '[မနက်ဖြန်] LT [မှာ]',\n nextWeek: 'dddd LT [မှာ]',\n lastDay: '[မနေ.က] LT [မှာ]',\n lastWeek: '[ပြီးခဲ့သော] dddd LT [မှာ]',\n sameElse: 'L'\n },\n relativeTime: {\n future: 'လာမည့် %s မှာ',\n past: 'လွန်ခဲ့သော %s က',\n s: 'စက္ကန်.အနည်းငယ်',\n ss : '%d စက္ကန့်',\n m: 'တစ်မိနစ်',\n mm: '%d မိနစ်',\n h: 'တစ်နာရီ',\n hh: '%d နာရီ',\n d: 'တစ်ရက်',\n dd: '%d ရက်',\n M: 'တစ်လ',\n MM: '%d လ',\n y: 'တစ်နှစ်',\n yy: '%d နှစ်'\n },\n preparse: function (string) {\n return string.replace(/[၁၂၃၄၅၆၇၈၉၀]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return my;\n\n})));\n\n\n/***/ }),\n\n/***/ \"FAPV\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_html__ = __webpack_require__(\"qaYk\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_object__ = __webpack_require__(\"XZTZ\");\n\n\n // @vue/component\n\n/* harmony default export */ __webpack_exports__[\"a\"] = ({\n props: {\n options: {\n type: [Array, Object],\n default: function _default() {\n return [];\n }\n },\n valueField: {\n type: String,\n default: 'value'\n },\n textField: {\n type: String,\n default: 'text'\n },\n htmlField: {\n type: String,\n default: 'html'\n },\n disabledField: {\n type: String,\n default: 'disabled'\n }\n },\n computed: {\n formOptions: function formOptions() {\n var options = this.options;\n var valueField = this.valueField;\n var textField = this.textField;\n var htmlField = this.htmlField;\n var disabledField = this.disabledField;\n\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"f\" /* isArray */])(options)) {\n // Normalize flat-ish arrays to Array of Objects\n return options.map(function (option) {\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"g\" /* isPlainObject */])(option)) {\n var value = option[valueField];\n var text = String(option[textField]);\n return {\n value: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"d\" /* isUndefined */])(value) ? text : value,\n text: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_html__[\"b\" /* stripTags */])(text),\n html: option[htmlField],\n disabled: Boolean(option[disabledField])\n };\n }\n\n return {\n value: option,\n text: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_html__[\"b\" /* stripTags */])(String(option)),\n disabled: false\n };\n });\n } else {\n // options is Object\n // Normalize Objects to Array of Objects\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_object__[\"a\" /* keys */])(options).map(function (key) {\n var option = options[key] || {};\n\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"g\" /* isPlainObject */])(option)) {\n var value = option[valueField];\n var text = option[textField];\n return {\n value: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"d\" /* isUndefined */])(value) ? key : value,\n text: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"d\" /* isUndefined */])(text) ? __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_html__[\"b\" /* stripTags */])(String(key)) : __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_html__[\"b\" /* stripTags */])(String(text)),\n html: option[htmlField],\n disabled: Boolean(option[disabledField])\n };\n }\n\n return {\n value: key,\n text: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_html__[\"b\" /* stripTags */])(String(option)),\n disabled: false\n };\n });\n }\n }\n }\n});\n\n/***/ }),\n\n/***/ \"FKXc\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var it = moment.defineLocale('it', {\n months : 'gennaio_febbraio_marzo_aprile_maggio_giugno_luglio_agosto_settembre_ottobre_novembre_dicembre'.split('_'),\n monthsShort : 'gen_feb_mar_apr_mag_giu_lug_ago_set_ott_nov_dic'.split('_'),\n weekdays : 'domenica_lunedì_martedì_mercoledì_giovedì_venerdì_sabato'.split('_'),\n weekdaysShort : 'dom_lun_mar_mer_gio_ven_sab'.split('_'),\n weekdaysMin : 'do_lu_ma_me_gi_ve_sa'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY HH:mm',\n LLLL : 'dddd D MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[Oggi alle] LT',\n nextDay: '[Domani alle] LT',\n nextWeek: 'dddd [alle] LT',\n lastDay: '[Ieri alle] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[la scorsa] dddd [alle] LT';\n default:\n return '[lo scorso] dddd [alle] LT';\n }\n },\n sameElse: 'L'\n },\n relativeTime : {\n future : function (s) {\n return ((/^[0-9].+$/).test(s) ? 'tra' : 'in') + ' ' + s;\n },\n past : '%s fa',\n s : 'alcuni secondi',\n ss : '%d secondi',\n m : 'un minuto',\n mm : '%d minuti',\n h : 'un\\'ora',\n hh : '%d ore',\n d : 'un giorno',\n dd : '%d giorni',\n M : 'un mese',\n MM : '%d mesi',\n y : 'un anno',\n yy : '%d anni'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal: '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return it;\n\n})));\n\n\n/***/ }),\n\n/***/ \"FMWT\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony default export */ __webpack_exports__[\"a\"] = ({\n props: {\n perPage: {\n type: [Number, String],\n default: 0\n },\n currentPage: {\n type: [Number, String],\n default: 1\n }\n },\n computed: {\n localPaging: function localPaging() {\n return this.hasProvider ? !!this.noProviderPaging : true;\n },\n paginatedItems: function paginatedItems() {\n var items = this.sortedItems || this.filteredItems || this.localItems || [];\n var currentPage = Math.max(parseInt(this.currentPage, 10) || 1, 1);\n var perPage = Math.max(parseInt(this.perPage, 10) || 0, 0); // Apply local pagination\n\n if (this.localPaging && !!perPage) {\n // Grab the current page of data (which may be past filtered items limit)\n items = items.slice((currentPage - 1) * perPage, currentPage * perPage);\n } // Return the items to display in the table\n\n\n return items;\n }\n }\n});\n\n/***/ }),\n\n/***/ \"FQrH\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return FormCheckboxPlugin; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__form_checkbox__ = __webpack_require__(\"136D\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__form_checkbox_group__ = __webpack_require__(\"IIow\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_plugins__ = __webpack_require__(\"20SD\");\n/* unused harmony reexport BFormCheckbox */\n/* unused harmony reexport BFormCheckboxGroup */\n\n\n\nvar FormCheckboxPlugin =\n/*#__PURE__*/\n__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_plugins__[\"b\" /* pluginFactory */])({\n components: {\n BFormCheckbox: __WEBPACK_IMPORTED_MODULE_0__form_checkbox__[\"a\" /* BFormCheckbox */],\n BCheckbox: __WEBPACK_IMPORTED_MODULE_0__form_checkbox__[\"a\" /* BFormCheckbox */],\n BCheck: __WEBPACK_IMPORTED_MODULE_0__form_checkbox__[\"a\" /* BFormCheckbox */],\n BFormCheckboxGroup: __WEBPACK_IMPORTED_MODULE_1__form_checkbox_group__[\"a\" /* BFormCheckboxGroup */],\n BCheckboxGroup: __WEBPACK_IMPORTED_MODULE_1__form_checkbox_group__[\"a\" /* BFormCheckboxGroup */],\n BCheckGroup: __WEBPACK_IMPORTED_MODULE_1__form_checkbox_group__[\"a\" /* BFormCheckboxGroup */]\n }\n});\n\n\n/***/ }),\n\n/***/ \"FQxg\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BMedia; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_normalize_slot__ = __webpack_require__(\"1Cid\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__media_body__ = __webpack_require__(\"6rSb\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__media_aside__ = __webpack_require__(\"UxaK\");\n\n\n\n\n\nvar props = {\n tag: {\n type: String,\n default: 'div'\n },\n rightAlign: {\n type: Boolean,\n default: false\n },\n verticalAlign: {\n type: String,\n default: 'top'\n },\n noBody: {\n type: Boolean,\n default: false\n } // @vue/component\n\n};\nvar BMedia =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BMedia',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n slots = _ref.slots,\n scopedSlots = _ref.scopedSlots,\n children = _ref.children;\n var childNodes = props.noBody ? children : [];\n\n if (!props.noBody) {\n var $slots = slots();\n var $scopedSlots = scopedSlots || {};\n var $aside = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_normalize_slot__[\"b\" /* normalizeSlot */])('aside', {}, $scopedSlots, $slots);\n var $default = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_normalize_slot__[\"b\" /* normalizeSlot */])('default', {}, $scopedSlots, $slots);\n\n if ($aside && !props.rightAlign) {\n childNodes.push(h(__WEBPACK_IMPORTED_MODULE_4__media_aside__[\"a\" /* BMediaAside */], {\n staticClass: 'mr-3',\n props: {\n verticalAlign: props.verticalAlign\n }\n }, $aside));\n }\n\n childNodes.push(h(__WEBPACK_IMPORTED_MODULE_3__media_body__[\"a\" /* BMediaBody */], {}, $default));\n\n if ($aside && props.rightAlign) {\n childNodes.push(h(__WEBPACK_IMPORTED_MODULE_4__media_aside__[\"a\" /* BMediaAside */], {\n staticClass: 'ml-3',\n props: {\n verticalAlign: props.verticalAlign\n }\n }, $aside));\n }\n }\n\n return h(props.tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n staticClass: 'media'\n }), childNodes);\n }\n});\n\n/***/ }),\n\n/***/ \"FRPF\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var tzm = moment.defineLocale('tzm', {\n months : 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split('_'),\n monthsShort : 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split('_'),\n weekdays : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysShort : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysMin : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS: 'HH:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY HH:mm',\n LLLL : 'dddd D MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[ⴰⵙⴷⵅ ⴴ] LT',\n nextDay: '[ⴰⵙⴽⴰ ⴴ] LT',\n nextWeek: 'dddd [ⴴ] LT',\n lastDay: '[ⴰⵚⴰⵏⵜ ⴴ] LT',\n lastWeek: 'dddd [ⴴ] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'ⴷⴰⴷⵅ ⵙ ⵢⴰⵏ %s',\n past : 'ⵢⴰⵏ %s',\n s : 'ⵉⵎⵉⴽ',\n ss : '%d ⵉⵎⵉⴽ',\n m : 'ⵎⵉⵏⵓⴺ',\n mm : '%d ⵎⵉⵏⵓⴺ',\n h : 'ⵙⴰⵄⴰ',\n hh : '%d ⵜⴰⵙⵙⴰⵄⵉⵏ',\n d : 'ⴰⵙⵙ',\n dd : '%d oⵙⵙⴰⵏ',\n M : 'ⴰⵢoⵓⵔ',\n MM : '%d ⵉⵢⵢⵉⵔⵏ',\n y : 'ⴰⵙⴳⴰⵙ',\n yy : '%d ⵉⵙⴳⴰⵙⵏ'\n },\n week : {\n dow : 6, // Saturday is the first day of the week.\n doy : 12 // The week that contains Jan 12th is the first week of the year.\n }\n });\n\n return tzm;\n\n})));\n\n\n/***/ }),\n\n/***/ \"FZ+f\":\n/***/ (function(module, exports) {\n\n/*\n\tMIT License http://www.opensource.org/licenses/mit-license.php\n\tAuthor Tobias Koppers @sokra\n*/\n// css base code, injected by the css-loader\nmodule.exports = function(useSourceMap) {\n\tvar list = [];\n\n\t// return the list of modules as css string\n\tlist.toString = function toString() {\n\t\treturn this.map(function (item) {\n\t\t\tvar content = cssWithMappingToString(item, useSourceMap);\n\t\t\tif(item[2]) {\n\t\t\t\treturn \"@media \" + item[2] + \"{\" + content + \"}\";\n\t\t\t} else {\n\t\t\t\treturn content;\n\t\t\t}\n\t\t}).join(\"\");\n\t};\n\n\t// import a list of modules into the list\n\tlist.i = function(modules, mediaQuery) {\n\t\tif(typeof modules === \"string\")\n\t\t\tmodules = [[null, modules, \"\"]];\n\t\tvar alreadyImportedModules = {};\n\t\tfor(var i = 0; i < this.length; i++) {\n\t\t\tvar id = this[i][0];\n\t\t\tif(typeof id === \"number\")\n\t\t\t\talreadyImportedModules[id] = true;\n\t\t}\n\t\tfor(i = 0; i < modules.length; i++) {\n\t\t\tvar item = modules[i];\n\t\t\t// skip already imported module\n\t\t\t// this implementation is not 100% perfect for weird media query combinations\n\t\t\t// when a module is imported multiple times with different media queries.\n\t\t\t// I hope this will never occur (Hey this way we have smaller bundles)\n\t\t\tif(typeof item[0] !== \"number\" || !alreadyImportedModules[item[0]]) {\n\t\t\t\tif(mediaQuery && !item[2]) {\n\t\t\t\t\titem[2] = mediaQuery;\n\t\t\t\t} else if(mediaQuery) {\n\t\t\t\t\titem[2] = \"(\" + item[2] + \") and (\" + mediaQuery + \")\";\n\t\t\t\t}\n\t\t\t\tlist.push(item);\n\t\t\t}\n\t\t}\n\t};\n\treturn list;\n};\n\nfunction cssWithMappingToString(item, useSourceMap) {\n\tvar content = item[1] || '';\n\tvar cssMapping = item[3];\n\tif (!cssMapping) {\n\t\treturn content;\n\t}\n\n\tif (useSourceMap && typeof btoa === 'function') {\n\t\tvar sourceMapping = toComment(cssMapping);\n\t\tvar sourceURLs = cssMapping.sources.map(function (source) {\n\t\t\treturn '/*# sourceURL=' + cssMapping.sourceRoot + source + ' */'\n\t\t});\n\n\t\treturn [content].concat(sourceURLs).concat([sourceMapping]).join('\\n');\n\t}\n\n\treturn [content].join('\\n');\n}\n\n// Adapted from convert-source-map (MIT)\nfunction toComment(sourceMap) {\n\t// eslint-disable-next-line no-undef\n\tvar base64 = btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap))));\n\tvar data = 'sourceMappingURL=data:application/json;charset=utf-8;base64,' + base64;\n\n\treturn '/*# ' + data + ' */';\n}\n\n\n/***/ }),\n\n/***/ \"FeBl\":\n/***/ (function(module, exports) {\n\nvar core = module.exports = { version: '2.6.9' };\nif (typeof __e == 'number') __e = core; // eslint-disable-line no-undef\n\n\n/***/ }),\n\n/***/ \"FlzV\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var nb = moment.defineLocale('nb', {\n months : 'januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember'.split('_'),\n monthsShort : 'jan._feb._mars_april_mai_juni_juli_aug._sep._okt._nov._des.'.split('_'),\n monthsParseExact : true,\n weekdays : 'søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag'.split('_'),\n weekdaysShort : 'sø._ma._ti._on._to._fr._lø.'.split('_'),\n weekdaysMin : 'sø_ma_ti_on_to_fr_lø'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY [kl.] HH:mm',\n LLLL : 'dddd D. MMMM YYYY [kl.] HH:mm'\n },\n calendar : {\n sameDay: '[i dag kl.] LT',\n nextDay: '[i morgen kl.] LT',\n nextWeek: 'dddd [kl.] LT',\n lastDay: '[i går kl.] LT',\n lastWeek: '[forrige] dddd [kl.] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'om %s',\n past : '%s siden',\n s : 'noen sekunder',\n ss : '%d sekunder',\n m : 'ett minutt',\n mm : '%d minutter',\n h : 'en time',\n hh : '%d timer',\n d : 'en dag',\n dd : '%d dager',\n M : 'en måned',\n MM : '%d måneder',\n y : 'ett år',\n yy : '%d år'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return nb;\n\n})));\n\n\n/***/ }),\n\n/***/ \"Fpqq\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var sv = moment.defineLocale('sv', {\n months : 'januari_februari_mars_april_maj_juni_juli_augusti_september_oktober_november_december'.split('_'),\n monthsShort : 'jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec'.split('_'),\n weekdays : 'söndag_måndag_tisdag_onsdag_torsdag_fredag_lördag'.split('_'),\n weekdaysShort : 'sön_mån_tis_ons_tor_fre_lör'.split('_'),\n weekdaysMin : 'sö_må_ti_on_to_fr_lö'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'YYYY-MM-DD',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [kl.] HH:mm',\n LLLL : 'dddd D MMMM YYYY [kl.] HH:mm',\n lll : 'D MMM YYYY HH:mm',\n llll : 'ddd D MMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[Idag] LT',\n nextDay: '[Imorgon] LT',\n lastDay: '[Igår] LT',\n nextWeek: '[På] dddd LT',\n lastWeek: '[I] dddd[s] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'om %s',\n past : 'för %s sedan',\n s : 'några sekunder',\n ss : '%d sekunder',\n m : 'en minut',\n mm : '%d minuter',\n h : 'en timme',\n hh : '%d timmar',\n d : 'en dag',\n dd : '%d dagar',\n M : 'en månad',\n MM : '%d månader',\n y : 'ett år',\n yy : '%d år'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(e|a)/,\n ordinal : function (number) {\n var b = number % 10,\n output = (~~(number % 100 / 10) === 1) ? 'e' :\n (b === 1) ? 'a' :\n (b === 2) ? 'a' :\n (b === 3) ? 'e' : 'e';\n return number + output;\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return sv;\n\n})));\n\n\n/***/ }),\n\n/***/ \"Frex\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n 'm': ['eine Minute', 'einer Minute'],\n 'h': ['eine Stunde', 'einer Stunde'],\n 'd': ['ein Tag', 'einem Tag'],\n 'dd': [number + ' Tage', number + ' Tagen'],\n 'M': ['ein Monat', 'einem Monat'],\n 'MM': [number + ' Monate', number + ' Monaten'],\n 'y': ['ein Jahr', 'einem Jahr'],\n 'yy': [number + ' Jahre', number + ' Jahren']\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var deCh = moment.defineLocale('de-ch', {\n months : 'Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split('_'),\n monthsShort : 'Jan._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split('_'),\n monthsParseExact : true,\n weekdays : 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split('_'),\n weekdaysShort : 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysMin : 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY HH:mm',\n LLLL : 'dddd, D. MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]'\n },\n relativeTime : {\n future : 'in %s',\n past : 'vor %s',\n s : 'ein paar Sekunden',\n ss : '%d Sekunden',\n m : processRelativeTime,\n mm : '%d Minuten',\n h : processRelativeTime,\n hh : '%d Stunden',\n d : processRelativeTime,\n dd : processRelativeTime,\n M : processRelativeTime,\n MM : processRelativeTime,\n y : processRelativeTime,\n yy : processRelativeTime\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return deCh;\n\n})));\n\n\n/***/ }),\n\n/***/ \"FtD3\":\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\n\n\nvar enhanceError = __webpack_require__(\"t8qj\");\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n/***/ }),\n\n/***/ \"FuaP\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var gl = moment.defineLocale('gl', {\n months : 'xaneiro_febreiro_marzo_abril_maio_xuño_xullo_agosto_setembro_outubro_novembro_decembro'.split('_'),\n monthsShort : 'xan._feb._mar._abr._mai._xuñ._xul._ago._set._out._nov._dec.'.split('_'),\n monthsParseExact: true,\n weekdays : 'domingo_luns_martes_mércores_xoves_venres_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mér._xov._ven._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mé_xo_ve_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'H:mm',\n LTS : 'H:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY H:mm',\n LLLL : 'dddd, D [de] MMMM [de] YYYY H:mm'\n },\n calendar : {\n sameDay : function () {\n return '[hoxe ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT';\n },\n nextDay : function () {\n return '[mañá ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT';\n },\n lastDay : function () {\n return '[onte ' + ((this.hours() !== 1) ? 'á' : 'a') + '] LT';\n },\n lastWeek : function () {\n return '[o] dddd [pasado ' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : function (str) {\n if (str.indexOf('un') === 0) {\n return 'n' + str;\n }\n return 'en ' + str;\n },\n past : 'hai %s',\n s : 'uns segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'unha hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un ano',\n yy : '%d anos'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return gl;\n\n})));\n\n\n/***/ }),\n\n/***/ \"Fuc2\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BTab; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__mixins_id__ = __webpack_require__(\"6Ecx\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__mixins_normalize_slot__ = __webpack_require__(\"BnsU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_bv_transition__ = __webpack_require__(\"2fLV\");\n\n\n\n // @vue/component\n\nvar BTab =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BTab',\n mixins: [__WEBPACK_IMPORTED_MODULE_1__mixins_id__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_2__mixins_normalize_slot__[\"a\" /* default */]],\n inject: {\n bvTabs: {\n default: function _default() {\n return {\n // Don't set a tab index if not rendered inside
\n noKeyNav: true\n };\n }\n }\n },\n props: {\n active: {\n type: Boolean,\n default: false\n },\n tag: {\n type: String,\n default: 'div'\n },\n buttonId: {\n type: String,\n default: ''\n },\n title: {\n type: String,\n default: ''\n },\n titleItemClass: {\n // Sniffed by tabs.js and added to nav 'li.nav-item'\n type: [String, Array, Object],\n default: null\n },\n titleLinkClass: {\n // Sniffed by tabs.js and added to nav 'a.nav-link'\n type: [String, Array, Object],\n default: null\n },\n headHtml: {\n // Is this actually ever used?\n type: String,\n default: null\n },\n disabled: {\n type: Boolean,\n default: false\n },\n noBody: {\n type: Boolean,\n default: false\n },\n lazy: {\n type: Boolean,\n default: false\n }\n },\n data: function data() {\n return {\n localActive: this.active && !this.disabled,\n show: false\n };\n },\n computed: {\n tabClasses: function tabClasses() {\n return [{\n active: this.localActive,\n disabled: this.disabled,\n 'card-body': this.bvTabs.card && !this.noBody\n }, // Apply `activeTabClass` styles when this tab is active\n this.localActive ? this.bvTabs.activeTabClass : null];\n },\n controlledBy: function controlledBy() {\n return this.buttonId || this.safeId('__BV_tab_button__');\n },\n computedNoFade: function computedNoFade() {\n return !(this.bvTabs.fade || false);\n },\n computedLazy: function computedLazy() {\n return this.bvTabs.lazy || this.lazy;\n },\n _isTab: function _isTab() {\n // For parent sniffing of child\n return true;\n }\n },\n watch: {\n localActive: function localActive(newVal, oldVal) {\n // Make 'active' prop work with `.sync` modifier\n this.$emit('update:active', newVal);\n },\n active: function active(newVal, oldVal) {\n if (newVal !== oldVal) {\n if (newVal) {\n // If activated post mount\n this.activate();\n } else {\n /* istanbul ignore next */\n if (!this.deactivate()) {\n // Tab couldn't be deactivated, so we reset the synced active prop\n // Deactivation will fail if no other tabs to activate\n this.$emit('update:active', this.localActive);\n }\n }\n }\n },\n disabled: function disabled(newVal, oldVal) {\n if (newVal !== oldVal) {\n if (newVal && this.localActive && this.bvTabs.firstTab) {\n this.localActive = false;\n this.bvTabs.firstTab();\n }\n }\n }\n },\n mounted: function mounted() {\n // Inform b-tabs of our presence\n this.registerTab(); // Initially show on mount if active and not disabled\n\n this.show = this.localActive;\n },\n updated: function updated() {\n // Force the tab button content to update (since slots are not reactive)\n // Only done if we have a title slot, as the title prop is reactive\n if (this.hasNormalizedSlot('title') && this.bvTabs.updateButton) {\n this.bvTabs.updateButton(this);\n }\n },\n destroyed: function destroyed() {\n // inform b-tabs of our departure\n this.unregisterTab();\n },\n methods: {\n // Private methods\n registerTab: function registerTab() {\n // Inform `b-tabs` of our presence\n this.bvTabs.registerTab && this.bvTabs.registerTab(this);\n },\n unregisterTab: function unregisterTab() {\n // Inform `b-tabs` of our departure\n this.bvTabs.unregisterTab && this.bvTabs.unregisterTab(this);\n },\n // Public methods\n activate: function activate() {\n if (this.bvTabs.activateTab && !this.disabled) {\n return this.bvTabs.activateTab(this);\n } else {\n // Not inside a component or tab is disabled\n return false;\n }\n },\n deactivate: function deactivate() {\n if (this.bvTabs.deactivateTab && this.localActive) {\n return this.bvTabs.deactivateTab(this);\n } else {\n // Not inside a component or not active to begin with\n return false;\n }\n }\n },\n render: function render(h) {\n var content = h(this.tag, {\n ref: 'panel',\n staticClass: 'tab-pane',\n class: this.tabClasses,\n directives: [{\n name: 'show',\n rawName: 'v-show',\n value: this.localActive,\n expression: 'localActive'\n }],\n attrs: {\n role: 'tabpanel',\n id: this.safeId(),\n tabindex: this.localActive && !this.bvTabs.noKeyNav ? '-1' : null,\n 'aria-hidden': this.localActive ? 'false' : 'true',\n 'aria-labelledby': this.controlledBy || null\n }\n }, // Render content lazily if requested\n [this.localActive || !this.computedLazy ? this.normalizeSlot('default') : h()]);\n return h(__WEBPACK_IMPORTED_MODULE_3__utils_bv_transition__[\"b\" /* default */], {\n props: {\n mode: 'out-in',\n noFade: this.computedNoFade\n }\n }, [content]);\n }\n});\n\n/***/ }),\n\n/***/ \"G++c\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var msMy = moment.defineLocale('ms-my', {\n months : 'Januari_Februari_Mac_April_Mei_Jun_Julai_Ogos_September_Oktober_November_Disember'.split('_'),\n monthsShort : 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ogs_Sep_Okt_Nov_Dis'.split('_'),\n weekdays : 'Ahad_Isnin_Selasa_Rabu_Khamis_Jumaat_Sabtu'.split('_'),\n weekdaysShort : 'Ahd_Isn_Sel_Rab_Kha_Jum_Sab'.split('_'),\n weekdaysMin : 'Ah_Is_Sl_Rb_Km_Jm_Sb'.split('_'),\n longDateFormat : {\n LT : 'HH.mm',\n LTS : 'HH.mm.ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [pukul] HH.mm',\n LLLL : 'dddd, D MMMM YYYY [pukul] HH.mm'\n },\n meridiemParse: /pagi|tengahari|petang|malam/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'pagi') {\n return hour;\n } else if (meridiem === 'tengahari') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'petang' || meridiem === 'malam') {\n return hour + 12;\n }\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'pagi';\n } else if (hours < 15) {\n return 'tengahari';\n } else if (hours < 19) {\n return 'petang';\n } else {\n return 'malam';\n }\n },\n calendar : {\n sameDay : '[Hari ini pukul] LT',\n nextDay : '[Esok pukul] LT',\n nextWeek : 'dddd [pukul] LT',\n lastDay : '[Kelmarin pukul] LT',\n lastWeek : 'dddd [lepas pukul] LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : 'dalam %s',\n past : '%s yang lepas',\n s : 'beberapa saat',\n ss : '%d saat',\n m : 'seminit',\n mm : '%d minit',\n h : 'sejam',\n hh : '%d jam',\n d : 'sehari',\n dd : '%d hari',\n M : 'sebulan',\n MM : '%d bulan',\n y : 'setahun',\n yy : '%d tahun'\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return msMy;\n\n})));\n\n\n/***/ }),\n\n/***/ \"GHBc\":\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\n\n\nvar utils = __webpack_require__(\"cGG2\");\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n/***/ }),\n\n/***/ \"GNgv\":\n/***/ (function(module, exports, __webpack_require__) {\n\n/**\n * Lo-Dash 2.3.0 (Custom Build) \n * Build: `lodash modularize modern exports=\"npm\" -o ./npm/`\n * Copyright 2012-2013 The Dojo Foundation \n * Based on Underscore.js 1.5.2 \n * Copyright 2009-2013 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n * Available under MIT license \n */\nvar objectTypes = __webpack_require__(\"zQZ8\");\n\n/** Used for native method references */\nvar objectProto = Object.prototype;\n\n/** Native method shortcuts */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * A fallback implementation of `Object.keys` which produces an array of the\n * given object's own enumerable property names.\n *\n * @private\n * @type Function\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns an array of property names.\n */\nvar shimKeys = function(object) {\n var index, iterable = object, result = [];\n if (!iterable) return result;\n if (!(objectTypes[typeof object])) return result;\n for (index in iterable) {\n if (hasOwnProperty.call(iterable, index)) {\n result.push(index);\n }\n }\n return result\n};\n\nmodule.exports = shimKeys;\n\n\n/***/ }),\n\n/***/ \"GVLL\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return TooltipPlugin; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tooltip__ = __webpack_require__(\"aOZQ\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__directives_tooltip_tooltip__ = __webpack_require__(\"JmX5\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_plugins__ = __webpack_require__(\"20SD\");\n/* unused harmony reexport BTooltip */\n\n\n\nvar TooltipPlugin =\n/*#__PURE__*/\n__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_plugins__[\"b\" /* pluginFactory */])({\n components: {\n BTooltip: __WEBPACK_IMPORTED_MODULE_0__tooltip__[\"a\" /* BTooltip */]\n },\n directives: {\n VBTooltip: __WEBPACK_IMPORTED_MODULE_1__directives_tooltip_tooltip__[\"a\" /* VBTooltip */]\n }\n});\n\n\n/***/ }),\n\n/***/ \"GXWi\":\n/***/ (function(module, exports, __webpack_require__) {\n\nvar convert\n , keys = __webpack_require__(\"6anS\")\n , each = __webpack_require__(\"P/uL\")\n , measures = {\n length: __webpack_require__(\"27HY\")\n , area: __webpack_require__(\"lQii\")\n , mass: __webpack_require__(\"MVwX\")\n , volume: __webpack_require__(\"B7VH\")\n , each: __webpack_require__(\"bixk\")\n , temperature: __webpack_require__(\"jwT8\")\n , time: __webpack_require__(\"wewp\")\n , digital: __webpack_require__(\"W4Dw\")\n , partsPer: __webpack_require__(\"tEX9\")\n , speed: __webpack_require__(\"CRqz\")\n , pace: __webpack_require__(\"rKWZ\")\n , pressure: __webpack_require__(\"VpO0\")\n , current: __webpack_require__(\"vHwy\")\n , voltage: __webpack_require__(\"PUON\")\n , power: __webpack_require__(\"ohCi\")\n , reactivePower: __webpack_require__(\"BrlR\")\n , apparentPower: __webpack_require__(\"WtAL\")\n , energy: __webpack_require__(\"fr2p\")\n , reactiveEnergy: __webpack_require__(\"cyrt\")\n , volumeFlowRate: __webpack_require__(\"DWek\")\n , illuminance: __webpack_require__(\"w8VD\")\n , frequency: __webpack_require__(\"abhI\")\n , angle : __webpack_require__(\"bt0W\")\n }\n , Converter;\n\nConverter = function (numerator, denominator) {\n if(denominator)\n this.val = numerator / denominator;\n else\n this.val = numerator;\n};\n\n/**\n* Lets the converter know the source unit abbreviation\n*/\nConverter.prototype.from = function (from) {\n if(this.destination)\n throw new Error('.from must be called before .to');\n\n this.origin = this.getUnit(from);\n\n if(!this.origin) {\n this.throwUnsupportedUnitError(from);\n }\n\n return this;\n};\n\n/**\n* Converts the unit and returns the value\n*/\nConverter.prototype.to = function (to) {\n if(!this.origin)\n throw new Error('.to must be called after .from');\n\n this.destination = this.getUnit(to);\n\n var result\n , transform;\n\n if(!this.destination) {\n this.throwUnsupportedUnitError(to);\n }\n\n // Don't change the value if origin and destination are the same\n if (this.origin.abbr === this.destination.abbr) {\n return this.val;\n }\n\n // You can't go from liquid to mass, for example\n if(this.destination.measure != this.origin.measure) {\n throw new Error('Cannot convert incompatible measures of '\n + this.destination.measure + ' and ' + this.origin.measure);\n }\n\n /**\n * Convert from the source value to its anchor inside the system\n */\n result = this.val * this.origin.unit.to_anchor;\n\n /**\n * For some changes it's a simple shift (C to K)\n * So we'll add it when convering into the unit (later)\n * and subtract it when converting from the unit\n */\n if (this.origin.unit.anchor_shift) {\n result -= this.origin.unit.anchor_shift\n }\n\n /**\n * Convert from one system to another through the anchor ratio. Some conversions\n * aren't ratio based or require more than a simple shift. We can provide a custom\n * transform here to provide the direct result\n */\n if(this.origin.system != this.destination.system) {\n transform = measures[this.origin.measure]._anchors[this.origin.system].transform;\n if (typeof transform === 'function') {\n result = transform(result)\n }\n else {\n result *= measures[this.origin.measure]._anchors[this.origin.system].ratio;\n }\n }\n\n /**\n * This shift has to be done after the system conversion business\n */\n if (this.destination.unit.anchor_shift) {\n result += this.destination.unit.anchor_shift;\n }\n\n /**\n * Convert to another unit inside the destination system\n */\n return result / this.destination.unit.to_anchor;\n};\n\n/**\n* Converts the unit to the best available unit.\n*/\nConverter.prototype.toBest = function(options) {\n if(!this.origin)\n throw new Error('.toBest must be called after .from');\n\n var options = Object.assign({\n exclude: [],\n cutOffNumber: 1,\n }, options)\n\n var best;\n /**\n Looks through every possibility for the 'best' available unit.\n i.e. Where the value has the fewest numbers before the decimal point,\n but is still higher than 1.\n */\n each(this.possibilities(), function(possibility) {\n var unit = this.describe(possibility);\n var isIncluded = options.exclude.indexOf(possibility) === -1;\n\n if (isIncluded && unit.system === this.origin.system) {\n var result = this.to(possibility);\n if (!best || (result >= options.cutOffNumber && result < best.val)) {\n best = {\n val: result,\n unit: possibility,\n singular: unit.singular,\n plural: unit.plural\n };\n }\n }\n }.bind(this));\n\n return best;\n}\n\n/**\n* Finds the unit\n*/\nConverter.prototype.getUnit = function (abbr) {\n var found;\n\n each(measures, function (systems, measure) {\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n each(units, function (unit, testAbbr) {\n if(testAbbr == abbr) {\n found = {\n abbr: abbr\n , measure: measure\n , system: system\n , unit: unit\n };\n return false;\n }\n });\n\n if(found)\n return false;\n });\n\n if(found)\n return false;\n });\n\n return found;\n};\n\nvar describe = function(resp) {\n return {\n abbr: resp.abbr\n , measure: resp.measure\n , system: resp.system\n , singular: resp.unit.name.singular\n , plural: resp.unit.name.plural\n };\n}\n\n/**\n* An alias for getUnit\n*/\nConverter.prototype.describe = function (abbr) {\n var resp = Converter.prototype.getUnit(abbr);\n var desc = null;\n\n try {\n desc = describe(resp);\n } catch(err) {\n this.throwUnsupportedUnitError(abbr);\n }\n\n return desc;\n};\n\n/**\n* Detailed list of all supported units\n*/\nConverter.prototype.list = function (measure) {\n var list = [];\n\n each(measures, function (systems, testMeasure) {\n if(measure && measure !== testMeasure)\n return;\n\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n each(units, function (unit, abbr) {\n list = list.concat(describe({\n abbr: abbr,\n measure: testMeasure\n , system: system\n , unit: unit\n }));\n });\n });\n });\n\n return list;\n};\n\nConverter.prototype.throwUnsupportedUnitError = function (what) {\n var validUnits = [];\n\n each(measures, function (systems, measure) {\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n validUnits = validUnits.concat(keys(units));\n });\n });\n\n throw new Error('Unsupported unit ' + what + ', use one of: ' + validUnits.join(', '));\n}\n\n/**\n* Returns the abbreviated measures that the value can be\n* converted to.\n*/\nConverter.prototype.possibilities = function (measure) {\n var possibilities = [];\n if(!this.origin && !measure) {\n\t each(keys(measures), function (measure){\n\t\t each(measures[measure], function (units, system) {\n\t\t if(system == '_anchors')\n\t\t return false;\n\n\t\t possibilities = possibilities.concat(keys(units));\n\t\t });\n\t });\n } else {\n\t measure = measure || this.origin.measure;\n\t each(measures[measure], function (units, system) {\n\t if(system == '_anchors')\n\t return false;\n\n\t possibilities = possibilities.concat(keys(units));\n\t });\n }\n\n return possibilities;\n};\n\n/**\n* Returns the abbreviated measures that the value can be\n* converted to.\n*/\nConverter.prototype.measures = function () {\n return keys(measures);\n};\n\nconvert = function (value) {\n return new Converter(value);\n};\n\nmodule.exports = convert;\n\n\n/***/ }),\n\n/***/ \"Ggy4\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BNavText; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n\n\nvar props = {\n tag: {\n type: String,\n default: 'span'\n } // @vue/component\n\n};\nvar BNavText =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BNavText',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n staticClass: 'navbar-text'\n }), children);\n }\n});\n\n/***/ }),\n\n/***/ \"GrS7\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var hyAm = moment.defineLocale('hy-am', {\n months : {\n format: 'հունվարի_փետրվարի_մարտի_ապրիլի_մայիսի_հունիսի_հուլիսի_օգոստոսի_սեպտեմբերի_հոկտեմբերի_նոյեմբերի_դեկտեմբերի'.split('_'),\n standalone: 'հունվար_փետրվար_մարտ_ապրիլ_մայիս_հունիս_հուլիս_օգոստոս_սեպտեմբեր_հոկտեմբեր_նոյեմբեր_դեկտեմբեր'.split('_')\n },\n monthsShort : 'հնվ_փտր_մրտ_ապր_մյս_հնս_հլս_օգս_սպտ_հկտ_նմբ_դկտ'.split('_'),\n weekdays : 'կիրակի_երկուշաբթի_երեքշաբթի_չորեքշաբթի_հինգշաբթի_ուրբաթ_շաբաթ'.split('_'),\n weekdaysShort : 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n weekdaysMin : 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D MMMM YYYY թ.',\n LLL : 'D MMMM YYYY թ., HH:mm',\n LLLL : 'dddd, D MMMM YYYY թ., HH:mm'\n },\n calendar : {\n sameDay: '[այսօր] LT',\n nextDay: '[վաղը] LT',\n lastDay: '[երեկ] LT',\n nextWeek: function () {\n return 'dddd [օրը ժամը] LT';\n },\n lastWeek: function () {\n return '[անցած] dddd [օրը ժամը] LT';\n },\n sameElse: 'L'\n },\n relativeTime : {\n future : '%s հետո',\n past : '%s առաջ',\n s : 'մի քանի վայրկյան',\n ss : '%d վայրկյան',\n m : 'րոպե',\n mm : '%d րոպե',\n h : 'ժամ',\n hh : '%d ժամ',\n d : 'օր',\n dd : '%d օր',\n M : 'ամիս',\n MM : '%d ամիս',\n y : 'տարի',\n yy : '%d տարի'\n },\n meridiemParse: /գիշերվա|առավոտվա|ցերեկվա|երեկոյան/,\n isPM: function (input) {\n return /^(ցերեկվա|երեկոյան)$/.test(input);\n },\n meridiem : function (hour) {\n if (hour < 4) {\n return 'գիշերվա';\n } else if (hour < 12) {\n return 'առավոտվա';\n } else if (hour < 17) {\n return 'ցերեկվա';\n } else {\n return 'երեկոյան';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}|\\d{1,2}-(ին|րդ)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'DDD':\n case 'w':\n case 'W':\n case 'DDDo':\n if (number === 1) {\n return number + '-ին';\n }\n return number + '-րդ';\n default:\n return number;\n }\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return hyAm;\n\n})));\n\n\n/***/ }),\n\n/***/ \"Gst8\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return VBToggle; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_loose_equal__ = __webpack_require__(\"vk4e\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_dom__ = __webpack_require__(\"EWS6\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_env__ = __webpack_require__(\"ixoM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_target__ = __webpack_require__(\"uUWD\");\n\n\n\n // Target listen types\n\nvar listenTypes = {\n click: true // Property key for handler storage\n\n};\nvar BV_TOGGLE = '__BV_toggle__';\nvar BV_TOGGLE_STATE = '__BV_toggle_STATE__';\nvar BV_TOGGLE_CONTROLS = '__BV_toggle_CONTROLS__';\nvar BV_TOGGLE_TARGETS = '__BV_toggle_TARGETS__'; // Emitted control event for collapse (emitted to collapse)\n\nvar EVENT_TOGGLE = 'bv::toggle::collapse'; // Listen to event for toggle state update (emitted by collapse)\n\nvar EVENT_STATE = 'bv::collapse::state'; // Private event emitted on $root to ensure the toggle state is always synced.\n// Gets emitted even if the state of b-collapse has not changed.\n// This event is NOT to be documented as people should not be using it.\n\nvar EVENT_STATE_SYNC = 'bv::collapse::sync::state'; // Private event we send to collapse to request state update sync event\n\nvar EVENT_STATE_REQUEST = 'bv::request::collapse::state'; // Reset and remove a property from the provided element\n\nvar resetProp = function resetProp(el, prop) {\n el[prop] = null;\n delete el[prop];\n}; // Handle targets update\n\n\nvar handleTargets = function handleTargets(_ref) {\n var targets = _ref.targets,\n vnode = _ref.vnode;\n targets.forEach(function (target) {\n vnode.context.$root.$emit(EVENT_TOGGLE, target);\n });\n}; // Handle directive updates\n\n/* istanbul ignore next: not easy to test */\n\n\nvar handleUpdate = function handleUpdate(el, binding, vnode) {\n if (!__WEBPACK_IMPORTED_MODULE_2__utils_env__[\"a\" /* isBrowser */]) {\n return;\n }\n\n if (!__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_loose_equal__[\"a\" /* default */])(__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_target__[\"a\" /* getTargets */])(binding), el[BV_TOGGLE_TARGETS])) {\n // Targets have changed, so update accordingly\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_target__[\"b\" /* unbindTargets */])(vnode, binding, listenTypes);\n var targets = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_target__[\"c\" /* bindTargets */])(vnode, binding, listenTypes, handleTargets); // Update targets array to element\n\n el[BV_TOGGLE_TARGETS] = targets; // Add aria attributes to element\n\n el[BV_TOGGLE_CONTROLS] = targets.join(' '); // ensure aria-controls is up to date\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]); // Request a state update from targets so that we can ensure\n // expanded state is correct\n\n targets.forEach(function (target) {\n vnode.context.$root.$emit(EVENT_STATE_REQUEST, target);\n });\n } // Ensure the collapse class and aria-* attributes persist\n // after element is updated (either by parent re-rendering\n // or changes to this element or it's contents\n\n\n if (el[BV_TOGGLE_STATE] === true) {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"o\" /* addClass */])(el, 'collapsed');\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-expanded', 'true');\n } else if (el[BV_TOGGLE_STATE] === false) {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"p\" /* removeClass */])(el, 'collapsed');\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-expanded', 'false');\n }\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]);\n};\n/*\n * Export our directive\n */\n\n\nvar VBToggle = {\n bind: function bind(el, binding, vnode) {\n var targets = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_target__[\"c\" /* bindTargets */])(vnode, binding, listenTypes, handleTargets);\n\n if (__WEBPACK_IMPORTED_MODULE_2__utils_env__[\"a\" /* isBrowser */] && vnode.context && targets.length > 0) {\n // Add targets array to element\n el[BV_TOGGLE_TARGETS] = targets; // Add aria attributes to element\n\n el[BV_TOGGLE_CONTROLS] = targets.join(' '); // State is initially collapsed until we receive a state event\n\n el[BV_TOGGLE_STATE] = false;\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]);\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-expanded', 'false'); // If element is not a button, we add `role=\"button\"` for accessibility\n\n if (el.tagName !== 'BUTTON' && !__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"j\" /* hasAttr */])(el, 'role')) {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'role', 'button');\n } // Toggle state handler\n\n\n var toggleDirectiveHandler = function toggleDirectiveHandler(id, state) {\n var targets = el[BV_TOGGLE_TARGETS] || [];\n\n if (targets.indexOf(id) !== -1) {\n // Set aria-expanded state\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"h\" /* setAttr */])(el, 'aria-expanded', state ? 'true' : 'false'); // Set/Clear 'collapsed' class state\n\n el[BV_TOGGLE_STATE] = state;\n\n if (state) {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"p\" /* removeClass */])(el, 'collapsed');\n } else {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"o\" /* addClass */])(el, 'collapsed');\n }\n }\n }; // Store the toggle handler on the element\n\n\n el[BV_TOGGLE] = toggleDirectiveHandler; // Listen for toggle state changes (public)\n\n vnode.context.$root.$on(EVENT_STATE, el[BV_TOGGLE]); // Listen for toggle state sync (private)\n\n vnode.context.$root.$on(EVENT_STATE_SYNC, el[BV_TOGGLE]);\n }\n },\n componentUpdated: handleUpdate,\n updated: handleUpdate,\n unbind: function unbind(el, binding, vnode)\n /* istanbul ignore next */\n {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_target__[\"b\" /* unbindTargets */])(vnode, binding, listenTypes); // Remove our $root listener\n\n if (el[BV_TOGGLE]) {\n vnode.context.$root.$off(EVENT_STATE, el[BV_TOGGLE]);\n vnode.context.$root.$off(EVENT_STATE_SYNC, el[BV_TOGGLE]);\n } // Reset custom props\n\n\n resetProp(el, BV_TOGGLE);\n resetProp(el, BV_TOGGLE_STATE);\n resetProp(el, BV_TOGGLE_CONTROLS);\n resetProp(el, BV_TOGGLE_TARGETS); // Reset classes/attrs\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"p\" /* removeClass */])(el, 'collapsed');\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"i\" /* removeAttr */])(el, 'aria-expanded');\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"i\" /* removeAttr */])(el, 'aria-controls');\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_dom__[\"i\" /* removeAttr */])(el, 'role');\n }\n};\n\n/***/ }),\n\n/***/ \"HTQ3\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BNavbarBrand; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_pluck_props__ = __webpack_require__(\"yqsc\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__link_link__ = __webpack_require__(\"hJU9\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\nvar linkProps = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__link_link__[\"b\" /* propsFactory */])();\nlinkProps.href.default = undefined;\nlinkProps.to.default = undefined;\nvar props = _objectSpread({}, linkProps, {\n tag: {\n type: String,\n default: 'div'\n } // @vue/component\n\n});\nvar BNavbarBrand =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BNavbarBrand',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var isLink = Boolean(props.to || props.href);\n var tag = isLink ? __WEBPACK_IMPORTED_MODULE_3__link_link__[\"a\" /* BLink */] : props.tag;\n return h(tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n staticClass: 'navbar-brand',\n props: isLink ? __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_pluck_props__[\"a\" /* default */])(linkProps, props) : {}\n }), children);\n }\n});\n\n/***/ }),\n\n/***/ \"HhN8\":\n/***/ (function(module, exports) {\n\n/**\n * Copyright (c) 2014-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\n!(function(global) {\n \"use strict\";\n\n var Op = Object.prototype;\n var hasOwn = Op.hasOwnProperty;\n var undefined; // More compressible than void 0.\n var $Symbol = typeof Symbol === \"function\" ? Symbol : {};\n var iteratorSymbol = $Symbol.iterator || \"@@iterator\";\n var asyncIteratorSymbol = $Symbol.asyncIterator || \"@@asyncIterator\";\n var toStringTagSymbol = $Symbol.toStringTag || \"@@toStringTag\";\n\n var inModule = typeof module === \"object\";\n var runtime = global.regeneratorRuntime;\n if (runtime) {\n if (inModule) {\n // If regeneratorRuntime is defined globally and we're in a module,\n // make the exports object identical to regeneratorRuntime.\n module.exports = runtime;\n }\n // Don't bother evaluating the rest of this file if the runtime was\n // already defined globally.\n return;\n }\n\n // Define the runtime globally (as expected by generated code) as either\n // module.exports (if we're in a module) or a new, empty object.\n runtime = global.regeneratorRuntime = inModule ? module.exports : {};\n\n function wrap(innerFn, outerFn, self, tryLocsList) {\n // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.\n var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;\n var generator = Object.create(protoGenerator.prototype);\n var context = new Context(tryLocsList || []);\n\n // The ._invoke method unifies the implementations of the .next,\n // .throw, and .return methods.\n generator._invoke = makeInvokeMethod(innerFn, self, context);\n\n return generator;\n }\n runtime.wrap = wrap;\n\n // Try/catch helper to minimize deoptimizations. Returns a completion\n // record like context.tryEntries[i].completion. This interface could\n // have been (and was previously) designed to take a closure to be\n // invoked without arguments, but in all the cases we care about we\n // already have an existing method we want to call, so there's no need\n // to create a new function object. We can even get away with assuming\n // the method takes exactly one argument, since that happens to be true\n // in every case, so we don't have to touch the arguments object. The\n // only additional allocation required is the completion record, which\n // has a stable shape and so hopefully should be cheap to allocate.\n function tryCatch(fn, obj, arg) {\n try {\n return { type: \"normal\", arg: fn.call(obj, arg) };\n } catch (err) {\n return { type: \"throw\", arg: err };\n }\n }\n\n var GenStateSuspendedStart = \"suspendedStart\";\n var GenStateSuspendedYield = \"suspendedYield\";\n var GenStateExecuting = \"executing\";\n var GenStateCompleted = \"completed\";\n\n // Returning this object from the innerFn has the same effect as\n // breaking out of the dispatch switch statement.\n var ContinueSentinel = {};\n\n // Dummy constructor functions that we use as the .constructor and\n // .constructor.prototype properties for functions that return Generator\n // objects. For full spec compliance, you may wish to configure your\n // minifier not to mangle the names of these two functions.\n function Generator() {}\n function GeneratorFunction() {}\n function GeneratorFunctionPrototype() {}\n\n // This is a polyfill for %IteratorPrototype% for environments that\n // don't natively support it.\n var IteratorPrototype = {};\n IteratorPrototype[iteratorSymbol] = function () {\n return this;\n };\n\n var getProto = Object.getPrototypeOf;\n var NativeIteratorPrototype = getProto && getProto(getProto(values([])));\n if (NativeIteratorPrototype &&\n NativeIteratorPrototype !== Op &&\n hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {\n // This environment has a native %IteratorPrototype%; use it instead\n // of the polyfill.\n IteratorPrototype = NativeIteratorPrototype;\n }\n\n var Gp = GeneratorFunctionPrototype.prototype =\n Generator.prototype = Object.create(IteratorPrototype);\n GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;\n GeneratorFunctionPrototype.constructor = GeneratorFunction;\n GeneratorFunctionPrototype[toStringTagSymbol] =\n GeneratorFunction.displayName = \"GeneratorFunction\";\n\n // Helper for defining the .next, .throw, and .return methods of the\n // Iterator interface in terms of a single ._invoke method.\n function defineIteratorMethods(prototype) {\n [\"next\", \"throw\", \"return\"].forEach(function(method) {\n prototype[method] = function(arg) {\n return this._invoke(method, arg);\n };\n });\n }\n\n runtime.isGeneratorFunction = function(genFun) {\n var ctor = typeof genFun === \"function\" && genFun.constructor;\n return ctor\n ? ctor === GeneratorFunction ||\n // For the native GeneratorFunction constructor, the best we can\n // do is to check its .name property.\n (ctor.displayName || ctor.name) === \"GeneratorFunction\"\n : false;\n };\n\n runtime.mark = function(genFun) {\n if (Object.setPrototypeOf) {\n Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);\n } else {\n genFun.__proto__ = GeneratorFunctionPrototype;\n if (!(toStringTagSymbol in genFun)) {\n genFun[toStringTagSymbol] = \"GeneratorFunction\";\n }\n }\n genFun.prototype = Object.create(Gp);\n return genFun;\n };\n\n // Within the body of any async function, `await x` is transformed to\n // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test\n // `hasOwn.call(value, \"__await\")` to determine if the yielded value is\n // meant to be awaited.\n runtime.awrap = function(arg) {\n return { __await: arg };\n };\n\n function AsyncIterator(generator) {\n function invoke(method, arg, resolve, reject) {\n var record = tryCatch(generator[method], generator, arg);\n if (record.type === \"throw\") {\n reject(record.arg);\n } else {\n var result = record.arg;\n var value = result.value;\n if (value &&\n typeof value === \"object\" &&\n hasOwn.call(value, \"__await\")) {\n return Promise.resolve(value.__await).then(function(value) {\n invoke(\"next\", value, resolve, reject);\n }, function(err) {\n invoke(\"throw\", err, resolve, reject);\n });\n }\n\n return Promise.resolve(value).then(function(unwrapped) {\n // When a yielded Promise is resolved, its final value becomes\n // the .value of the Promise<{value,done}> result for the\n // current iteration. If the Promise is rejected, however, the\n // result for this iteration will be rejected with the same\n // reason. Note that rejections of yielded Promises are not\n // thrown back into the generator function, as is the case\n // when an awaited Promise is rejected. This difference in\n // behavior between yield and await is important, because it\n // allows the consumer to decide what to do with the yielded\n // rejection (swallow it and continue, manually .throw it back\n // into the generator, abandon iteration, whatever). With\n // await, by contrast, there is no opportunity to examine the\n // rejection reason outside the generator function, so the\n // only option is to throw it from the await expression, and\n // let the generator function handle the exception.\n result.value = unwrapped;\n resolve(result);\n }, reject);\n }\n }\n\n var previousPromise;\n\n function enqueue(method, arg) {\n function callInvokeWithMethodAndArg() {\n return new Promise(function(resolve, reject) {\n invoke(method, arg, resolve, reject);\n });\n }\n\n return previousPromise =\n // If enqueue has been called before, then we want to wait until\n // all previous Promises have been resolved before calling invoke,\n // so that results are always delivered in the correct order. If\n // enqueue has not been called before, then it is important to\n // call invoke immediately, without waiting on a callback to fire,\n // so that the async generator function has the opportunity to do\n // any necessary setup in a predictable way. This predictability\n // is why the Promise constructor synchronously invokes its\n // executor callback, and why async functions synchronously\n // execute code before the first await. Since we implement simple\n // async functions in terms of async generators, it is especially\n // important to get this right, even though it requires care.\n previousPromise ? previousPromise.then(\n callInvokeWithMethodAndArg,\n // Avoid propagating failures to Promises returned by later\n // invocations of the iterator.\n callInvokeWithMethodAndArg\n ) : callInvokeWithMethodAndArg();\n }\n\n // Define the unified helper method that is used to implement .next,\n // .throw, and .return (see defineIteratorMethods).\n this._invoke = enqueue;\n }\n\n defineIteratorMethods(AsyncIterator.prototype);\n AsyncIterator.prototype[asyncIteratorSymbol] = function () {\n return this;\n };\n runtime.AsyncIterator = AsyncIterator;\n\n // Note that simple async functions are implemented on top of\n // AsyncIterator objects; they just return a Promise for the value of\n // the final result produced by the iterator.\n runtime.async = function(innerFn, outerFn, self, tryLocsList) {\n var iter = new AsyncIterator(\n wrap(innerFn, outerFn, self, tryLocsList)\n );\n\n return runtime.isGeneratorFunction(outerFn)\n ? iter // If outerFn is a generator, return the full iterator.\n : iter.next().then(function(result) {\n return result.done ? result.value : iter.next();\n });\n };\n\n function makeInvokeMethod(innerFn, self, context) {\n var state = GenStateSuspendedStart;\n\n return function invoke(method, arg) {\n if (state === GenStateExecuting) {\n throw new Error(\"Generator is already running\");\n }\n\n if (state === GenStateCompleted) {\n if (method === \"throw\") {\n throw arg;\n }\n\n // Be forgiving, per 25.3.3.3.3 of the spec:\n // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume\n return doneResult();\n }\n\n context.method = method;\n context.arg = arg;\n\n while (true) {\n var delegate = context.delegate;\n if (delegate) {\n var delegateResult = maybeInvokeDelegate(delegate, context);\n if (delegateResult) {\n if (delegateResult === ContinueSentinel) continue;\n return delegateResult;\n }\n }\n\n if (context.method === \"next\") {\n // Setting context._sent for legacy support of Babel's\n // function.sent implementation.\n context.sent = context._sent = context.arg;\n\n } else if (context.method === \"throw\") {\n if (state === GenStateSuspendedStart) {\n state = GenStateCompleted;\n throw context.arg;\n }\n\n context.dispatchException(context.arg);\n\n } else if (context.method === \"return\") {\n context.abrupt(\"return\", context.arg);\n }\n\n state = GenStateExecuting;\n\n var record = tryCatch(innerFn, self, context);\n if (record.type === \"normal\") {\n // If an exception is thrown from innerFn, we leave state ===\n // GenStateExecuting and loop back for another invocation.\n state = context.done\n ? GenStateCompleted\n : GenStateSuspendedYield;\n\n if (record.arg === ContinueSentinel) {\n continue;\n }\n\n return {\n value: record.arg,\n done: context.done\n };\n\n } else if (record.type === \"throw\") {\n state = GenStateCompleted;\n // Dispatch the exception by looping back around to the\n // context.dispatchException(context.arg) call above.\n context.method = \"throw\";\n context.arg = record.arg;\n }\n }\n };\n }\n\n // Call delegate.iterator[context.method](context.arg) and handle the\n // result, either by returning a { value, done } result from the\n // delegate iterator, or by modifying context.method and context.arg,\n // setting context.delegate to null, and returning the ContinueSentinel.\n function maybeInvokeDelegate(delegate, context) {\n var method = delegate.iterator[context.method];\n if (method === undefined) {\n // A .throw or .return when the delegate iterator has no .throw\n // method always terminates the yield* loop.\n context.delegate = null;\n\n if (context.method === \"throw\") {\n if (delegate.iterator.return) {\n // If the delegate iterator has a return method, give it a\n // chance to clean up.\n context.method = \"return\";\n context.arg = undefined;\n maybeInvokeDelegate(delegate, context);\n\n if (context.method === \"throw\") {\n // If maybeInvokeDelegate(context) changed context.method from\n // \"return\" to \"throw\", let that override the TypeError below.\n return ContinueSentinel;\n }\n }\n\n context.method = \"throw\";\n context.arg = new TypeError(\n \"The iterator does not provide a 'throw' method\");\n }\n\n return ContinueSentinel;\n }\n\n var record = tryCatch(method, delegate.iterator, context.arg);\n\n if (record.type === \"throw\") {\n context.method = \"throw\";\n context.arg = record.arg;\n context.delegate = null;\n return ContinueSentinel;\n }\n\n var info = record.arg;\n\n if (! info) {\n context.method = \"throw\";\n context.arg = new TypeError(\"iterator result is not an object\");\n context.delegate = null;\n return ContinueSentinel;\n }\n\n if (info.done) {\n // Assign the result of the finished delegate to the temporary\n // variable specified by delegate.resultName (see delegateYield).\n context[delegate.resultName] = info.value;\n\n // Resume execution at the desired location (see delegateYield).\n context.next = delegate.nextLoc;\n\n // If context.method was \"throw\" but the delegate handled the\n // exception, let the outer generator proceed normally. If\n // context.method was \"next\", forget context.arg since it has been\n // \"consumed\" by the delegate iterator. If context.method was\n // \"return\", allow the original .return call to continue in the\n // outer generator.\n if (context.method !== \"return\") {\n context.method = \"next\";\n context.arg = undefined;\n }\n\n } else {\n // Re-yield the result returned by the delegate method.\n return info;\n }\n\n // The delegate iterator is finished, so forget it and continue with\n // the outer generator.\n context.delegate = null;\n return ContinueSentinel;\n }\n\n // Define Generator.prototype.{next,throw,return} in terms of the\n // unified ._invoke helper method.\n defineIteratorMethods(Gp);\n\n Gp[toStringTagSymbol] = \"Generator\";\n\n // A Generator should always return itself as the iterator object when the\n // @@iterator function is called on it. Some browsers' implementations of the\n // iterator prototype chain incorrectly implement this, causing the Generator\n // object to not be returned from this call. This ensures that doesn't happen.\n // See https://github.com/facebook/regenerator/issues/274 for more details.\n Gp[iteratorSymbol] = function() {\n return this;\n };\n\n Gp.toString = function() {\n return \"[object Generator]\";\n };\n\n function pushTryEntry(locs) {\n var entry = { tryLoc: locs[0] };\n\n if (1 in locs) {\n entry.catchLoc = locs[1];\n }\n\n if (2 in locs) {\n entry.finallyLoc = locs[2];\n entry.afterLoc = locs[3];\n }\n\n this.tryEntries.push(entry);\n }\n\n function resetTryEntry(entry) {\n var record = entry.completion || {};\n record.type = \"normal\";\n delete record.arg;\n entry.completion = record;\n }\n\n function Context(tryLocsList) {\n // The root entry object (effectively a try statement without a catch\n // or a finally block) gives us a place to store values thrown from\n // locations where there is no enclosing try statement.\n this.tryEntries = [{ tryLoc: \"root\" }];\n tryLocsList.forEach(pushTryEntry, this);\n this.reset(true);\n }\n\n runtime.keys = function(object) {\n var keys = [];\n for (var key in object) {\n keys.push(key);\n }\n keys.reverse();\n\n // Rather than returning an object with a next method, we keep\n // things simple and return the next function itself.\n return function next() {\n while (keys.length) {\n var key = keys.pop();\n if (key in object) {\n next.value = key;\n next.done = false;\n return next;\n }\n }\n\n // To avoid creating an additional object, we just hang the .value\n // and .done properties off the next function object itself. This\n // also ensures that the minifier will not anonymize the function.\n next.done = true;\n return next;\n };\n };\n\n function values(iterable) {\n if (iterable) {\n var iteratorMethod = iterable[iteratorSymbol];\n if (iteratorMethod) {\n return iteratorMethod.call(iterable);\n }\n\n if (typeof iterable.next === \"function\") {\n return iterable;\n }\n\n if (!isNaN(iterable.length)) {\n var i = -1, next = function next() {\n while (++i < iterable.length) {\n if (hasOwn.call(iterable, i)) {\n next.value = iterable[i];\n next.done = false;\n return next;\n }\n }\n\n next.value = undefined;\n next.done = true;\n\n return next;\n };\n\n return next.next = next;\n }\n }\n\n // Return an iterator with no values.\n return { next: doneResult };\n }\n runtime.values = values;\n\n function doneResult() {\n return { value: undefined, done: true };\n }\n\n Context.prototype = {\n constructor: Context,\n\n reset: function(skipTempReset) {\n this.prev = 0;\n this.next = 0;\n // Resetting context._sent for legacy support of Babel's\n // function.sent implementation.\n this.sent = this._sent = undefined;\n this.done = false;\n this.delegate = null;\n\n this.method = \"next\";\n this.arg = undefined;\n\n this.tryEntries.forEach(resetTryEntry);\n\n if (!skipTempReset) {\n for (var name in this) {\n // Not sure about the optimal order of these conditions:\n if (name.charAt(0) === \"t\" &&\n hasOwn.call(this, name) &&\n !isNaN(+name.slice(1))) {\n this[name] = undefined;\n }\n }\n }\n },\n\n stop: function() {\n this.done = true;\n\n var rootEntry = this.tryEntries[0];\n var rootRecord = rootEntry.completion;\n if (rootRecord.type === \"throw\") {\n throw rootRecord.arg;\n }\n\n return this.rval;\n },\n\n dispatchException: function(exception) {\n if (this.done) {\n throw exception;\n }\n\n var context = this;\n function handle(loc, caught) {\n record.type = \"throw\";\n record.arg = exception;\n context.next = loc;\n\n if (caught) {\n // If the dispatched exception was caught by a catch block,\n // then let that catch block handle the exception normally.\n context.method = \"next\";\n context.arg = undefined;\n }\n\n return !! caught;\n }\n\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n var record = entry.completion;\n\n if (entry.tryLoc === \"root\") {\n // Exception thrown outside of any try block that could handle\n // it, so set the completion value of the entire function to\n // throw the exception.\n return handle(\"end\");\n }\n\n if (entry.tryLoc <= this.prev) {\n var hasCatch = hasOwn.call(entry, \"catchLoc\");\n var hasFinally = hasOwn.call(entry, \"finallyLoc\");\n\n if (hasCatch && hasFinally) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n } else if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else if (hasCatch) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n }\n\n } else if (hasFinally) {\n if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else {\n throw new Error(\"try statement without catch or finally\");\n }\n }\n }\n },\n\n abrupt: function(type, arg) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc <= this.prev &&\n hasOwn.call(entry, \"finallyLoc\") &&\n this.prev < entry.finallyLoc) {\n var finallyEntry = entry;\n break;\n }\n }\n\n if (finallyEntry &&\n (type === \"break\" ||\n type === \"continue\") &&\n finallyEntry.tryLoc <= arg &&\n arg <= finallyEntry.finallyLoc) {\n // Ignore the finally entry if control is not jumping to a\n // location outside the try/catch block.\n finallyEntry = null;\n }\n\n var record = finallyEntry ? finallyEntry.completion : {};\n record.type = type;\n record.arg = arg;\n\n if (finallyEntry) {\n this.method = \"next\";\n this.next = finallyEntry.finallyLoc;\n return ContinueSentinel;\n }\n\n return this.complete(record);\n },\n\n complete: function(record, afterLoc) {\n if (record.type === \"throw\") {\n throw record.arg;\n }\n\n if (record.type === \"break\" ||\n record.type === \"continue\") {\n this.next = record.arg;\n } else if (record.type === \"return\") {\n this.rval = this.arg = record.arg;\n this.method = \"return\";\n this.next = \"end\";\n } else if (record.type === \"normal\" && afterLoc) {\n this.next = afterLoc;\n }\n\n return ContinueSentinel;\n },\n\n finish: function(finallyLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.finallyLoc === finallyLoc) {\n this.complete(entry.completion, entry.afterLoc);\n resetTryEntry(entry);\n return ContinueSentinel;\n }\n }\n },\n\n \"catch\": function(tryLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc === tryLoc) {\n var record = entry.completion;\n if (record.type === \"throw\") {\n var thrown = record.arg;\n resetTryEntry(entry);\n }\n return thrown;\n }\n }\n\n // The context.catch method must only be called with a location\n // argument that corresponds to a known catch block.\n throw new Error(\"illegal catch attempt\");\n },\n\n delegateYield: function(iterable, resultName, nextLoc) {\n this.delegate = {\n iterator: values(iterable),\n resultName: resultName,\n nextLoc: nextLoc\n };\n\n if (this.method === \"next\") {\n // Deliberately forget the last sent value so that we don't\n // accidentally pass it on to the delegate.\n this.arg = undefined;\n }\n\n return ContinueSentinel;\n }\n };\n})(\n // In sloppy mode, unbound `this` refers to the global object, fallback to\n // Function constructor if we're in global strict mode. That is sadly a form\n // of indirect eval which violates Content Security Policy.\n (function() { return this })() || Function(\"return this\")()\n);\n\n\n/***/ }),\n\n/***/ \"HmuJ\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BTfoot; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__mixins_normalize_slot__ = __webpack_require__(\"BnsU\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\nvar props = {\n footVariant: {\n type: String,\n // supported values: 'lite', 'dark', or null\n default: null\n } // @vue/component\n\n};\nvar BTfoot =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BTfoot',\n mixins: [__WEBPACK_IMPORTED_MODULE_1__mixins_normalize_slot__[\"a\" /* default */]],\n inheritAttrs: false,\n provide: function provide() {\n return {\n bvTableTfoot: this\n };\n },\n inject: {\n bvTable: {\n default: null\n }\n },\n props: props,\n computed: {\n tfootClasses: function tfootClasses() {\n return [this.footVariant ? \"thead-\".concat(this.footVariant) : null];\n },\n tfootAttrs: function tfootAttrs() {\n return _objectSpread({\n role: 'rowgroup'\n }, this.$attrs);\n }\n },\n render: function render(h) {\n return h('tfoot', {\n class: this.tfootClasses,\n attrs: this.tfootAttrs,\n // Pass down any native listeners\n on: this.$listeners\n }, this.normalizeSlot('default', {}));\n }\n});\n\n/***/ }),\n\n/***/ \"I/xj\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BvModalEvent; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_bv_event_class__ = __webpack_require__(\"Qrha\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_object__ = __webpack_require__(\"XZTZ\");\nfunction _typeof(obj) { if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _get(target, property, receiver) { if (typeof Reflect !== \"undefined\" && Reflect.get) { _get = Reflect.get; } else { _get = function _get(target, property, receiver) { var base = _superPropBase(target, property); if (!base) return; var desc = Object.getOwnPropertyDescriptor(base, property); if (desc.get) { return desc.get.call(receiver); } return desc.value; }; } return _get(target, property, receiver || target); }\n\nfunction _superPropBase(object, property) { while (!Object.prototype.hasOwnProperty.call(object, property)) { object = _getPrototypeOf(object); if (object === null) break; } return object; }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\n\n\n\nvar BvModalEvent =\n/*#__PURE__*/\nfunction (_BvEvent) {\n _inherits(BvModalEvent, _BvEvent);\n\n function BvModalEvent(type) {\n var _this;\n\n var eventInit = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n\n _classCallCheck(this, BvModalEvent);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(BvModalEvent).call(this, type, eventInit)); // Freeze our new props as readonly, but leave them enumerable\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_object__[\"e\" /* defineProperties */])(_assertThisInitialized(_this), {\n trigger: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_object__[\"f\" /* readonlyDescriptor */])()\n });\n return _this;\n }\n\n _createClass(BvModalEvent, null, [{\n key: \"Defaults\",\n get: function get() {\n return _objectSpread({}, _get(_getPrototypeOf(BvModalEvent), \"Defaults\", this), {\n trigger: null\n });\n }\n }]);\n\n return BvModalEvent;\n}(__WEBPACK_IMPORTED_MODULE_0__utils_bv_event_class__[\"a\" /* BvEvent */]); // Named exports\n\n\n\n\n/***/ }),\n\n/***/ \"I9lN\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BBadge; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_config__ = __webpack_require__(\"UE/W\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_pluck_props__ = __webpack_require__(\"yqsc\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__link_link__ = __webpack_require__(\"hJU9\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\n\nvar NAME = 'BBadge';\nvar linkProps = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_4__link_link__[\"b\" /* propsFactory */])();\ndelete linkProps.href.default;\ndelete linkProps.to.default;\nvar props = _objectSpread({}, linkProps, {\n tag: {\n type: String,\n default: 'span'\n },\n variant: {\n type: String,\n default: function _default() {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'variant');\n }\n },\n pill: {\n type: Boolean,\n default: false\n } // @vue/component\n\n});\nvar BBadge =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: NAME,\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var tag = !props.href && !props.to ? props.tag : __WEBPACK_IMPORTED_MODULE_4__link_link__[\"a\" /* BLink */];\n var componentData = {\n staticClass: 'badge',\n class: [props.variant ? \"badge-\".concat(props.variant) : 'badge-secondary', {\n 'badge-pill': Boolean(props.pill),\n active: props.active,\n disabled: props.disabled\n }],\n props: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_pluck_props__[\"a\" /* default */])(linkProps, props)\n };\n return h(tag, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, componentData), children);\n }\n});\n\n/***/ }),\n\n/***/ \"IIow\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BFormCheckboxGroup; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__mixins_id__ = __webpack_require__(\"6Ecx\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__mixins_form__ = __webpack_require__(\"NRzj\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__mixins_form_options__ = __webpack_require__(\"FAPV\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__mixins_form_radio_check_group__ = __webpack_require__(\"5jgX\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__mixins_form_size__ = __webpack_require__(\"Oa/M\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__mixins_form_state__ = __webpack_require__(\"yWDY\");\n\n\n\n\n\n\n\nvar props = {\n switches: {\n // Custom switch styling\n type: Boolean,\n default: false\n },\n checked: {\n type: [String, Number, Object, Array, Boolean],\n default: null\n } // @vue/component\n\n};\nvar BFormCheckboxGroup =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BFormCheckboxGroup',\n mixins: [__WEBPACK_IMPORTED_MODULE_1__mixins_id__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_2__mixins_form__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_4__mixins_form_radio_check_group__[\"a\" /* default */], // Includes render function\n __WEBPACK_IMPORTED_MODULE_3__mixins_form_options__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_5__mixins_form_size__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_6__mixins_form_state__[\"a\" /* default */]],\n provide: function provide() {\n return {\n bvCheckGroup: this\n };\n },\n props: props,\n data: function data() {\n return {\n localChecked: this.checked || []\n };\n },\n computed: {\n isRadioGroup: function isRadioGroup() {\n return false;\n }\n }\n});\n\n/***/ }),\n\n/***/ \"INcR\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split('_'),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_');\n\n var monthsParse = [/^ene/i, /^feb/i, /^mar/i, /^abr/i, /^may/i, /^jun/i, /^jul/i, /^ago/i, /^sep/i, /^oct/i, /^nov/i, /^dic/i];\n var monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var esUs = moment.defineLocale('es-us', {\n months : 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split('_'),\n monthsShort : function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays : 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'h:mm A',\n LTS : 'h:mm:ss A',\n L : 'MM/DD/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY h:mm A',\n LLLL : 'dddd, D [de] MMMM [de] YYYY h:mm A'\n },\n calendar : {\n sameDay : function () {\n return '[hoy a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextDay : function () {\n return '[mañana a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastDay : function () {\n return '[ayer a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastWeek : function () {\n return '[el] dddd [pasado a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : 'en %s',\n past : 'hace %s',\n s : 'unos segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'una hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un año',\n yy : '%d años'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 0, // Sunday is the first day of the week.\n doy : 6 // The week that contains Jan 6th is the first week of the year.\n }\n });\n\n return esUs;\n\n})));\n\n\n/***/ }),\n\n/***/ \"IZMb\":\n/***/ (function(module, exports, __webpack_require__) {\n\n!function(t,e){if(true)module.exports=e();else if(\"function\"==typeof define&&define.amd)define([],e);else{var n=e();for(var r in n)(\"object\"==typeof exports?exports:t)[r]=n[r]}}(this,function(){return function(t){function e(r){if(n[r])return n[r].exports;var i=n[r]={i:r,l:!1,exports:{}};return t[r].call(i.exports,i,i.exports,e),i.l=!0,i.exports}var n={};return e.m=t,e.c=n,e.i=function(t){return t},e.d=function(t,n,r){e.o(t,n)||Object.defineProperty(t,n,{configurable:!1,enumerable:!0,get:r})},e.n=function(t){var n=t&&t.__esModule?function(){return t.default}:function(){return t};return e.d(n,\"a\",n),n},e.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},e.p=\"/dist/\",e(e.s=6)}([function(t,e,n){\"use strict\";function r(){d=!1}function i(t){if(!t)return void(f!==m&&(f=m,r()));if(t!==f){if(t.length!==m.length)throw new Error(\"Custom alphabet for shortid must be \"+m.length+\" unique characters. You submitted \"+t.length+\" characters: \"+t);var e=t.split(\"\").filter(function(t,e,n){return e!==n.lastIndexOf(t)});if(e.length)throw new Error(\"Custom alphabet for shortid must be \"+m.length+\" unique characters. These characters were not unique: \"+e.join(\", \"));f=t,r()}}function o(t){return i(t),f}function a(t){h.seed(t),p!==t&&(r(),p=t)}function s(){f||i(m);for(var t,e=f.split(\"\"),n=[],r=h.nextValue();e.length>0;)r=h.nextValue(),t=Math.floor(r*e.length),n.push(e.splice(t,1)[0]);return n.join(\"\")}function c(){return d||(d=s())}function u(t){return c()[t]}function l(){return f||m}var f,p,d,h=n(19),m=\"0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ_-\";t.exports={get:l,characters:o,seed:a,lookup:u,shuffled:c}},function(t,e,n){\"use strict\";var r=n(5),i=n.n(r);e.a={animateIn:function(t){i()({targets:t,translateY:\"-35px\",opacity:1,duration:300,easing:\"easeOutCubic\"})},animateOut:function(t,e){i()({targets:t,opacity:0,marginTop:\"-40px\",duration:300,easing:\"easeOutExpo\",complete:e})},animateOutBottom:function(t,e){i()({targets:t,opacity:0,marginBottom:\"-40px\",duration:300,easing:\"easeOutExpo\",complete:e})},animateReset:function(t){i()({targets:t,left:0,opacity:1,duration:300,easing:\"easeOutExpo\"})},animatePanning:function(t,e,n){i()({targets:t,duration:10,easing:\"easeOutQuad\",left:e,opacity:n})},animatePanEnd:function(t,e){i()({targets:t,opacity:0,duration:300,easing:\"easeOutExpo\",complete:e})},clearAnimation:function(t){var e=i.a.timeline();t.forEach(function(t){e.add({targets:t.el,opacity:0,right:\"-40px\",duration:300,offset:\"-=150\",easing:\"easeOutExpo\",complete:function(){t.remove()}})})}}},function(t,e,n){\"use strict\";t.exports=n(16)},function(t,e,n){\"use strict\";n.d(e,\"a\",function(){return s});var r=n(8),i=n(1),o=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},a=n(2);n(11).polyfill();var s=function t(e){var n=this;return this.id=a.generate(),this.options=e,this.cached_options={},this.global={},this.groups=[],this.toasts=[],this.container=null,l(this),u(this),this.group=function(e){e||(e={}),e.globalToasts||(e.globalToasts={}),Object.assign(e.globalToasts,n.global);var r=new t(e);return n.groups.push(r),r},this.register=function(t,e,r){return r=r||{},f(n,t,e,r)},this.show=function(t,e){return c(n,t,e)},this.success=function(t,e){return e=e||{},e.type=\"success\",c(n,t,e)},this.info=function(t,e){return e=e||{},e.type=\"info\",c(n,t,e)},this.error=function(t,e){return e=e||{},e.type=\"error\",c(n,t,e)},this.remove=function(t){n.toasts=n.toasts.filter(function(e){return e.el.hash!==t.hash}),t.parentNode&&t.parentNode.removeChild(t)},this.clear=function(t){return i.a.clearAnimation(n.toasts,function(){t&&t()}),n.toasts=[],!0},this},c=function(t,e,i){i=i||{};var a=null;if(\"object\"!==(void 0===i?\"undefined\":o(i)))return console.error(\"Options should be a type of object. given : \"+i),null;t.options.singleton&&t.toasts.length>0&&(t.cached_options=i,t.toasts[t.toasts.length-1].goAway(0));var s=Object.assign({},t.options);return Object.assign(s,i),a=n.i(r.a)(t,e,s),t.toasts.push(a),a},u=function(t){var e=t.options.globalToasts,n=function(e,n){return\"string\"==typeof n&&t[n]?t[n].apply(t,[e,{}]):c(t,e,n)};e&&(t.global={},Object.keys(e).forEach(function(r){t.global[r]=function(){var t=arguments.length>0&&void 0!==arguments[0]?arguments[0]:{};return e[r].apply(null,[t,n])}}))},l=function(t){var e=document.createElement(\"div\");e.id=t.id,e.setAttribute(\"role\",\"status\"),e.setAttribute(\"aria-live\",\"polite\"),e.setAttribute(\"aria-atomic\",\"false\"),document.body.appendChild(e),t.container=e},f=function(t,e,n,r){t.options.globalToasts||(t.options.globalToasts={}),t.options.globalToasts[e]=function(t,e){var i=null;return\"string\"==typeof n&&(i=n),\"function\"==typeof n&&(i=n(t)),e(i,r)},u(t)}},function(t,e,n){n(22);var r=n(21)(null,null,null,null);t.exports=r.exports},function(t,e,n){(function(n){var r,i,o,a={scope:{}};a.defineProperty=\"function\"==typeof Object.defineProperties?Object.defineProperty:function(t,e,n){if(n.get||n.set)throw new TypeError(\"ES3 does not support getters and setters.\");t!=Array.prototype&&t!=Object.prototype&&(t[e]=n.value)},a.getGlobal=function(t){return\"undefined\"!=typeof window&&window===t?t:void 0!==n&&null!=n?n:t},a.global=a.getGlobal(this),a.SYMBOL_PREFIX=\"jscomp_symbol_\",a.initSymbol=function(){a.initSymbol=function(){},a.global.Symbol||(a.global.Symbol=a.Symbol)},a.symbolCounter_=0,a.Symbol=function(t){return a.SYMBOL_PREFIX+(t||\"\")+a.symbolCounter_++},a.initSymbolIterator=function(){a.initSymbol();var t=a.global.Symbol.iterator;t||(t=a.global.Symbol.iterator=a.global.Symbol(\"iterator\")),\"function\"!=typeof Array.prototype[t]&&a.defineProperty(Array.prototype,t,{configurable:!0,writable:!0,value:function(){return a.arrayIterator(this)}}),a.initSymbolIterator=function(){}},a.arrayIterator=function(t){var e=0;return a.iteratorPrototype(function(){return en&&(n+=1),1n?e:n<2/3?t+(e-t)*(2/3-n)*6:t}var n=/hsl\\((\\d+),\\s*([\\d.]+)%,\\s*([\\d.]+)%\\)/g.exec(t)||/hsla\\((\\d+),\\s*([\\d.]+)%,\\s*([\\d.]+)%,\\s*([\\d.]+)\\)/g.exec(t);t=parseInt(n[1])/360;var r=parseInt(n[2])/100,i=parseInt(n[3])/100,n=n[4]||1;if(0==r)i=r=t=i;else{var o=.5>i?i*(1+r):i+r-i*r,a=2*i-o,i=e(a,o,t+1/3),r=e(a,o,t);t=e(a,o,t-1/3)}return\"rgba(\"+255*i+\",\"+255*r+\",\"+255*t+\",\"+n+\")\"}function f(t){if(t=/([\\+\\-]?[0-9#\\.]+)(%|px|pt|em|rem|in|cm|mm|ex|ch|pc|vw|vh|vmin|vmax|deg|rad|turn)?$/.exec(t))return t[2]}function p(t){return-1=d.currentTime)for(var x=0;x=h||!e)&&(d.began||(d.began=!0,o(\"begin\")),o(\"run\")),g>s&&g=e&&m!==e||!e)&&(i(e),v||a())),o(\"update\"),t>=e&&(d.remaining?(u=c,\"alternate\"===d.direction&&(d.reversed=!d.reversed)):(d.pause(),d.completed||(d.completed=!0,o(\"complete\"),\"Promise\"in window&&(f(),p=n()))),l=0)}t=void 0===t?{}:t;var c,u,l=0,f=null,p=n(),d=L(t);return d.reset=function(){var t=d.direction,e=d.loop;for(d.currentTime=0,d.progress=0,d.paused=!0,d.began=!1,d.completed=!1,d.reversed=\"reverse\"===t,d.remaining=\"alternate\"===t&&1===e?2:e,i(0),t=d.children.length;t--;)d.children[t].reset()},d.tick=function(t){c=t,u||(u=c),s((l+c-u)*j.speed)},d.seek=function(t){s(r(t))},d.pause=function(){var t=H.indexOf(d);-1=e&&0<=r&&1>=r){var o=new Float32Array(11);if(e!==n||r!==i)for(var a=0;11>a;++a)o[a]=t(.1*a,e,r);return function(a){if(e===n&&r===i)return a;if(0===a)return 0;if(1===a)return 1;for(var s=0,c=1;10!==c&&o[c]<=a;++c)s+=.1;--c;var c=s+(a-o[c])/(o[c+1]-o[c])*.1,u=3*(1-3*r+3*e)*c*c+2*(3*r-6*e)*c+3*e;if(.001<=u){for(s=0;4>s&&0!==(u=3*(1-3*r+3*e)*c*c+2*(3*r-6*e)*c+3*e);++s)var l=t(c,e,r)-a,c=c-l/u;a=c}else if(0===u)a=c;else{var c=s,s=s+.1,f=0;do{l=c+(s-c)/2,u=t(l,e,r)-a,0++f);a=l}return t(a,n,i)}}}}(),z=function(){function t(t,e){return 0===t||1===t?t:-Math.pow(2,10*(t-1))*Math.sin(2*(t-1-e/(2*Math.PI)*Math.asin(1))*Math.PI/e)}var e,n=\"Quad Cubic Quart Quint Sine Expo Circ Back Elastic\".split(\" \"),r={In:[[.55,.085,.68,.53],[.55,.055,.675,.19],[.895,.03,.685,.22],[.755,.05,.855,.06],[.47,0,.745,.715],[.95,.05,.795,.035],[.6,.04,.98,.335],[.6,-.28,.735,.045],t],Out:[[.25,.46,.45,.94],[.215,.61,.355,1],[.165,.84,.44,1],[.23,1,.32,1],[.39,.575,.565,1],[.19,1,.22,1],[.075,.82,.165,1],[.175,.885,.32,1.275],function(e,n){return 1-t(1-e,n)}],InOut:[[.455,.03,.515,.955],[.645,.045,.355,1],[.77,0,.175,1],[.86,0,.07,1],[.445,.05,.55,.95],[1,0,0,1],[.785,.135,.15,.86],[.68,-.55,.265,1.55],function(e,n){return.5>e?t(2*e,n)/2:1-t(-2*e+2,n)/2}]},i={linear:F(.25,.25,.75,.75)},o={};for(e in r)o.type=e,r[o.type].forEach(function(t){return function(e,r){i[\"ease\"+t.type+n[r]]=R.fnc(e)?e:F.apply(s,e)}}(o)),o={type:o.type};return i}(),Y={css:function(t,e,n){return t.style[e]=n},attribute:function(t,e,n){return t.setAttribute(e,n)},object:function(t,e,n){return t[e]=n},transform:function(t,e,n,r,i){r[i]||(r[i]=[]),r[i].push(e+\"(\"+n+\")\")}},H=[],q=0,V=function(){function t(){q=requestAnimationFrame(e)}function e(e){var n=H.length;if(n){for(var r=0;rn&&(e.duration=r.duration),e.children.push(r)}),e.seek(0),e.reset(),e.autoplay&&e.restart(),e},e},j.random=function(t,e){return Math.floor(Math.random()*(e-t+1))+t},j})}).call(e,n(25))},function(t,e,n){\"use strict\";Object.defineProperty(e,\"__esModule\",{value:!0});var r=n(3),i=n(4),o=n.n(i),a={install:function(t,e){e||(e={});var n=new r.a(e);t.component(\"toasted\",o.a),t.toasted=t.prototype.$toasted=n}};\"undefined\"!=typeof window&&window.Vue&&(window.Toasted=a),e.default=a},function(t,e,n){\"use strict\";n.d(e,\"a\",function(){return c});var r=n(1),i=this,o=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},a=function(t,e,n){return setTimeout(function(){if(n.cached_options.position&&n.cached_options.position.includes(\"bottom\"))return void r.a.animateOutBottom(t,function(){n.remove(t)});r.a.animateOut(t,function(){n.remove(t)})},e),!0},s=function(t,e){return(\"object\"===(\"undefined\"==typeof HTMLElement?\"undefined\":o(HTMLElement))?e instanceof HTMLElement:e&&\"object\"===(void 0===e?\"undefined\":o(e))&&null!==e&&1===e.nodeType&&\"string\"==typeof e.nodeName)?t.appendChild(e):t.innerHTML=e,i},c=function(t,e){var n=!1;return{el:t,text:function(e){return s(t,e),this},goAway:function(){var r=arguments.length>0&&void 0!==arguments[0]?arguments[0]:800;return n=!0,a(t,r,e)},remove:function(){e.remove(t)},disposed:function(){return n}}}},function(t,e,n){\"use strict\";var r=n(12),i=n.n(r),o=n(1),a=n(7),s=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},c=n(2);String.prototype.includes||Object.defineProperty(String.prototype,\"includes\",{value:function(t,e){return\"number\"!=typeof e&&(e=0),!(e+t.length>this.length)&&-1!==this.indexOf(t,e)}});var u={},l=null,f=function(t){return t.className=t.className||null,t.onComplete=t.onComplete||null,t.position=t.position||\"top-right\",t.duration=t.duration||null,t.keepOnHover=t.keepOnHover||!1,t.theme=t.theme||\"toasted-primary\",t.type=t.type||\"default\",t.containerClass=t.containerClass||null,t.fullWidth=t.fullWidth||!1,t.icon=t.icon||null,t.action=t.action||null,t.fitToScreen=t.fitToScreen||null,t.closeOnSwipe=void 0===t.closeOnSwipe||t.closeOnSwipe,t.iconPack=t.iconPack||\"material\",t.className&&\"string\"==typeof t.className&&(t.className=t.className.split(\" \")),t.className||(t.className=[]),t.theme&&t.className.push(t.theme.trim()),t.type&&t.className.push(t.type),t.containerClass&&\"string\"==typeof t.containerClass&&(t.containerClass=t.containerClass.split(\" \")),t.containerClass||(t.containerClass=[]),t.position&&t.containerClass.push(t.position.trim()),t.fullWidth&&t.containerClass.push(\"full-width\"),t.fitToScreen&&t.containerClass.push(\"fit-to-screen\"),u=t,t},p=function(t,e){var r=document.createElement(\"div\");if(r.classList.add(\"toasted\"),r.hash=c.generate(),e.className&&e.className.forEach(function(t){r.classList.add(t)}),(\"object\"===(\"undefined\"==typeof HTMLElement?\"undefined\":s(HTMLElement))?t instanceof HTMLElement:t&&\"object\"===(void 0===t?\"undefined\":s(t))&&null!==t&&1===t.nodeType&&\"string\"==typeof t.nodeName)?r.appendChild(t):r.innerHTML=t,d(e,r),e.closeOnSwipe){var u=new i.a(r,{prevent_default:!1});u.on(\"pan\",function(t){var e=t.deltaX;r.classList.contains(\"panning\")||r.classList.add(\"panning\");var n=1-Math.abs(e/80);n<0&&(n=0),o.a.animatePanning(r,e,n)}),u.on(\"panend\",function(t){var n=t.deltaX;Math.abs(n)>80?o.a.animatePanEnd(r,function(){\"function\"==typeof e.onComplete&&e.onComplete(),r.parentNode&&l.remove(r)}):(r.classList.remove(\"panning\"),o.a.animateReset(r))})}if(Array.isArray(e.action))e.action.forEach(function(t){var e=m(t,n.i(a.a)(r,l));e&&r.appendChild(e)});else if(\"object\"===s(e.action)){var f=m(e.action,n.i(a.a)(r,l));f&&r.appendChild(f)}return r},d=function(t,e){if(t.icon){var n=document.createElement(\"i\");switch(n.setAttribute(\"aria-hidden\",\"true\"),t.iconPack){case\"fontawesome\":n.classList.add(\"fa\");var r=t.icon.name?t.icon.name:t.icon;r.includes(\"fa-\")?n.classList.add(r.trim()):n.classList.add(\"fa-\"+r.trim());break;case\"mdi\":n.classList.add(\"mdi\");var i=t.icon.name?t.icon.name:t.icon;i.includes(\"mdi-\")?n.classList.add(i.trim()):n.classList.add(\"mdi-\"+i.trim());break;case\"custom-class\":var o=t.icon.name?t.icon.name:t.icon;\"string\"==typeof o?o.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(o)&&o.forEach(function(t){n.classList.add(t.trim())});break;case\"callback\":var a=t.icon&&t.icon instanceof Function?t.icon:null;a&&(n=a(n));break;default:n.classList.add(\"material-icons\"),n.textContent=t.icon.name?t.icon.name:t.icon}t.icon.after&&n.classList.add(\"after\"),h(t,n,e)}},h=function(t,e,n){t.icon&&(t.icon.after&&t.icon.name?n.appendChild(e):(t.icon.name,n.insertBefore(e,n.firstChild)))},m=function(t,e){if(!t)return null;var n=document.createElement(\"a\");if(n.classList.add(\"action\"),n.classList.add(\"ripple\"),t.text&&(n.text=t.text),t.href&&(n.href=t.href),t.target&&(n.target=t.target),t.icon){n.classList.add(\"icon\");var r=document.createElement(\"i\");switch(u.iconPack){case\"fontawesome\":r.classList.add(\"fa\"),t.icon.includes(\"fa-\")?r.classList.add(t.icon.trim()):r.classList.add(\"fa-\"+t.icon.trim());break;case\"mdi\":r.classList.add(\"mdi\"),t.icon.includes(\"mdi-\")?r.classList.add(t.icon.trim()):r.classList.add(\"mdi-\"+t.icon.trim());break;case\"custom-class\":\"string\"==typeof t.icon?t.icon.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(t.icon)&&t.icon.forEach(function(t){n.classList.add(t.trim())});break;default:r.classList.add(\"material-icons\"),r.textContent=t.icon}n.appendChild(r)}return t.class&&(\"string\"==typeof t.class?t.class.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(t.class)&&t.class.forEach(function(t){n.classList.add(t.trim())})),t.push&&n.addEventListener(\"click\",function(n){if(n.preventDefault(),!u.router)return void console.warn(\"[vue-toasted] : Vue Router instance is not attached. please check the docs\");u.router.push(t.push),t.push.dontClose||e.goAway(0)}),t.onClick&&\"function\"==typeof t.onClick&&n.addEventListener(\"click\",function(n){t.onClick&&(n.preventDefault(),t.onClick(n,e))}),n};e.a=function(t,e,r){l=t,r=f(r);var i=l.container;r.containerClass.unshift(\"toasted-container\"),i.className!==r.containerClass.join(\" \")&&(i.className=\"\",r.containerClass.forEach(function(t){i.classList.add(t)}));var s=p(e,r);e&&i.appendChild(s),s.style.opacity=0,o.a.animateIn(s);var c=r.duration,u=void 0;if(null!==c){var d=function(){return setInterval(function(){null===s.parentNode&&window.clearInterval(u),s.classList.contains(\"panning\")||(c-=20),c<=0&&(o.a.animateOut(s,function(){\"function\"==typeof r.onComplete&&r.onComplete(),s.parentNode&&l.remove(s)}),window.clearInterval(u))},20)};u=d(),r.keepOnHover&&(s.addEventListener(\"mouseover\",function(){window.clearInterval(u)}),s.addEventListener(\"mouseout\",function(){u=d()}))}return n.i(a.a)(s,l)}},function(t,e,n){e=t.exports=n(10)(),e.push([t.i,\".toasted{padding:0 20px}.toasted.rounded{border-radius:24px}.toasted .primary,.toasted.toasted-primary{border-radius:2px;min-height:38px;line-height:1.1em;background-color:#353535;padding:6px 20px;font-size:15px;font-weight:300;color:#fff;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24)}.toasted .primary.success,.toasted.toasted-primary.success{background:#4caf50}.toasted .primary.error,.toasted.toasted-primary.error{background:#f44336}.toasted .primary.info,.toasted.toasted-primary.info{background:#3f51b5}.toasted .primary .action,.toasted.toasted-primary .action{color:#a1c2fa}.toasted.bubble{border-radius:30px;min-height:38px;line-height:1.1em;background-color:#ff7043;padding:0 20px;font-size:15px;font-weight:300;color:#fff;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24)}.toasted.bubble.success{background:#4caf50}.toasted.bubble.error{background:#f44336}.toasted.bubble.info{background:#3f51b5}.toasted.bubble .action{color:#8e2b0c}.toasted.outline{border-radius:30px;min-height:38px;line-height:1.1em;background-color:#fff;border:1px solid #676767;padding:0 20px;font-size:15px;color:#676767;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24);font-weight:700}.toasted.outline.success{color:#4caf50;border-color:#4caf50}.toasted.outline.error{color:#f44336;border-color:#f44336}.toasted.outline.info{color:#3f51b5;border-color:#3f51b5}.toasted.outline .action{color:#607d8b}.toasted-container{position:fixed;z-index:10000}.toasted-container,.toasted-container.full-width{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.toasted-container.full-width{max-width:86%;width:100%}.toasted-container.full-width.fit-to-screen{min-width:100%}.toasted-container.full-width.fit-to-screen .toasted:first-child{margin-top:0}.toasted-container.full-width.fit-to-screen.top-right{top:0;right:0}.toasted-container.full-width.fit-to-screen.top-left{top:0;left:0}.toasted-container.full-width.fit-to-screen.top-center{top:0;left:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.full-width.fit-to-screen.bottom-right{right:0;bottom:0}.toasted-container.full-width.fit-to-screen.bottom-left{left:0;bottom:0}.toasted-container.full-width.fit-to-screen.bottom-center{left:0;bottom:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.top-right{top:10%;right:7%}.toasted-container.top-left{top:10%;left:7%}.toasted-container.top-center{top:10%;left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}.toasted-container.bottom-right{right:5%;bottom:7%}.toasted-container.bottom-left{left:5%;bottom:7%}.toasted-container.bottom-center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%);bottom:7%}.toasted-container.bottom-left .toasted,.toasted-container.top-left .toasted{float:left}.toasted-container.bottom-right .toasted,.toasted-container.top-right .toasted{float:right}.toasted-container .toasted{top:35px;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;word-break:normal;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;box-sizing:inherit}.toasted-container .toasted .fa,.toasted-container .toasted .fab,.toasted-container .toasted .far,.toasted-container .toasted .fas,.toasted-container .toasted .material-icons,.toasted-container .toasted .mdi{margin-right:.5rem;margin-left:-.4rem}.toasted-container .toasted .fa.after,.toasted-container .toasted .fab.after,.toasted-container .toasted .far.after,.toasted-container .toasted .fas.after,.toasted-container .toasted .material-icons.after,.toasted-container .toasted .mdi.after{margin-left:.5rem;margin-right:-.4rem}.toasted-container .toasted .action{text-decoration:none;font-size:.8rem;padding:8px;margin:5px -7px 5px 7px;border-radius:3px;text-transform:uppercase;letter-spacing:.03em;font-weight:600;cursor:pointer}.toasted-container .toasted .action.icon{padding:4px;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.toasted-container .toasted .action.icon .fa,.toasted-container .toasted .action.icon .material-icons,.toasted-container .toasted .action.icon .mdi{margin-right:0;margin-left:4px}.toasted-container .toasted .action.icon:hover{text-decoration:none}.toasted-container .toasted .action:hover{text-decoration:underline}@media only screen and (max-width:600px){.toasted-container{min-width:100%}.toasted-container .toasted:first-child{margin-top:0}.toasted-container.top-right{top:0;right:0}.toasted-container.top-left{top:0;left:0}.toasted-container.top-center{top:0;left:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.bottom-right{right:0;bottom:0}.toasted-container.bottom-left{left:0;bottom:0}.toasted-container.bottom-center{left:0;bottom:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.bottom-center,.toasted-container.top-center{-ms-flex-align:stretch!important;align-items:stretch!important}.toasted-container.bottom-left .toasted,.toasted-container.bottom-right .toasted,.toasted-container.top-left .toasted,.toasted-container.top-right .toasted{float:none}.toasted-container .toasted{border-radius:0}}\",\"\"])},function(t,e){t.exports=function(){var t=[];return t.toString=function(){for(var t=[],e=0;e\\s*\\(/gm,\"{anonymous}()@\"):\"Unknown Stack Trace\",o=i.console&&(i.console.warn||i.console.log);return o&&o.call(i.console,r,n),t.apply(this,arguments)}}function p(t,e,n){var r,i=e.prototype;r=t.prototype=Object.create(i),r.constructor=t,r._super=i,n&&ht(r,n)}function d(t,e){return function(){return t.apply(e,arguments)}}function h(t,e){return typeof t==gt?t.apply(e?e[0]||s:s,e):t}function m(t,e){return t===s?e:t}function v(t,e,n){l(x(e),function(e){t.addEventListener(e,n,!1)})}function g(t,e,n){l(x(e),function(e){t.removeEventListener(e,n,!1)})}function y(t,e){for(;t;){if(t==e)return!0;t=t.parentNode}return!1}function b(t,e){return t.indexOf(e)>-1}function x(t){return t.trim().split(/\\s+/g)}function T(t,e,n){if(t.indexOf&&!n)return t.indexOf(e);for(var r=0;rn[e]}):r.sort()),r}function C(t,e){for(var n,r,i=e[0].toUpperCase()+e.slice(1),o=0;o1&&!n.firstMultiple?n.firstMultiple=j(e):1===i&&(n.firstMultiple=!1);var o=n.firstInput,a=n.firstMultiple,s=a?a.center:o.center,c=e.center=N(r);e.timeStamp=xt(),e.deltaTime=e.timeStamp-o.timeStamp,e.angle=R(s,c),e.distance=D(s,c),P(n,e),e.offsetDirection=X(e.deltaX,e.deltaY);var u=_(e.deltaTime,e.deltaX,e.deltaY);e.overallVelocityX=u.x,e.overallVelocityY=u.y,e.overallVelocity=bt(u.x)>bt(u.y)?u.x:u.y,e.scale=a?z(a.pointers,r):1,e.rotation=a?F(a.pointers,r):0,e.maxPointers=n.prevInput?e.pointers.length>n.prevInput.maxPointers?e.pointers.length:n.prevInput.maxPointers:e.pointers.length,L(n,e);var l=t.element;y(e.srcEvent.target,l)&&(l=e.srcEvent.target),e.target=l}function P(t,e){var n=e.center,r=t.offsetDelta||{},i=t.prevDelta||{},o=t.prevInput||{};e.eventType!==Mt&&o.eventType!==Pt||(i=t.prevDelta={x:o.deltaX||0,y:o.deltaY||0},r=t.offsetDelta={x:n.x,y:n.y}),e.deltaX=i.x+(n.x-r.x),e.deltaY=i.y+(n.y-r.y)}function L(t,e){var n,r,i,o,a=t.lastInterval||e,c=e.timeStamp-a.timeStamp;if(e.eventType!=Lt&&(c>It||a.velocity===s)){var u=e.deltaX-a.deltaX,l=e.deltaY-a.deltaY,f=_(c,u,l);r=f.x,i=f.y,n=bt(f.x)>bt(f.y)?f.x:f.y,o=X(u,l),t.lastInterval=e}else n=a.velocity,r=a.velocityX,i=a.velocityY,o=a.direction;e.velocity=n,e.velocityX=r,e.velocityY=i,e.direction=o}function j(t){for(var e=[],n=0;n=bt(e)?t<0?Nt:_t:e<0?Xt:Dt}function D(t,e,n){n||(n=Yt);var r=e[n[0]]-t[n[0]],i=e[n[1]]-t[n[1]];return Math.sqrt(r*r+i*i)}function R(t,e,n){n||(n=Yt);var r=e[n[0]]-t[n[0]],i=e[n[1]]-t[n[1]];return 180*Math.atan2(i,r)/Math.PI}function F(t,e){return R(e[1],e[0],Ht)+R(t[1],t[0],Ht)}function z(t,e){return D(e[0],e[1],Ht)/D(t[0],t[1],Ht)}function Y(){this.evEl=Vt,this.evWin=Wt,this.pressed=!1,A.apply(this,arguments)}function H(){this.evEl=$t,this.evWin=Gt,A.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function q(){this.evTarget=Qt,this.evWin=Jt,this.started=!1,A.apply(this,arguments)}function V(t,e){var n=w(t.touches),r=w(t.changedTouches);return e&(Pt|Lt)&&(n=E(n.concat(r),\"identifier\",!0)),[n,r]}function W(){this.evTarget=te,this.targetIds={},A.apply(this,arguments)}function U(t,e){var n=w(t.touches),r=this.targetIds;if(e&(Mt|kt)&&1===n.length)return r[n[0].identifier]=!0,[n,n];var i,o,a=w(t.changedTouches),s=[],c=this.target;if(o=n.filter(function(t){return y(t.target,c)}),e===Mt)for(i=0;i-1&&r.splice(t,1)};setTimeout(i,ee)}}function Z(t){for(var e=t.srcEvent.clientX,n=t.srcEvent.clientY,r=0;r-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){n.manager.emit(e,t)}var n=this,r=this.state;r=he&&e(n.options.event+tt(r))},tryEmit:function(t){if(this.canEmit())return this.emit(t);this.state=32},canEmit:function(){for(var t=0;te.threshold&&i&e.direction},attrTest:function(t){return rt.prototype.attrTest.call(this,t)&&(this.state&pe||!(this.state&pe)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=et(t.direction);e&&(t.additionalEvent=this.options.event+e),this._super.emit.call(this,t)}}),p(ot,rt,{defaults:{event:\"pinch\",threshold:0,pointers:2},getTouchAction:function(){return[se]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&pe)},emit:function(t){if(1!==t.scale){var e=t.scale<1?\"in\":\"out\";t.additionalEvent=this.options.event+e}this._super.emit.call(this,t)}}),p(at,K,{defaults:{event:\"press\",pointers:1,time:251,threshold:9},getTouchAction:function(){return[oe]},process:function(t){var e=this.options,n=t.pointers.length===e.pointers,r=t.distancee.time;if(this._input=t,!r||!n||t.eventType&(Pt|Lt)&&!i)this.reset();else if(t.eventType&Mt)this.reset(),this._timer=c(function(){this.state=me,this.tryEmit()},e.time,this);else if(t.eventType&Pt)return me;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===me&&(t&&t.eventType&Pt?this.manager.emit(this.options.event+\"up\",t):(this._input.timeStamp=xt(),this.manager.emit(this.options.event,this._input)))}}),p(st,rt,{defaults:{event:\"rotate\",threshold:0,pointers:2},getTouchAction:function(){return[se]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&pe)}}),p(ct,rt,{defaults:{event:\"swipe\",threshold:10,velocity:.3,direction:Rt|Ft,pointers:1},getTouchAction:function(){return it.prototype.getTouchAction.call(this)},attrTest:function(t){var e,n=this.options.direction;return n&(Rt|Ft)?e=t.overallVelocity:n&Rt?e=t.overallVelocityX:n&Ft&&(e=t.overallVelocityY),this._super.attrTest.call(this,t)&&n&t.offsetDirection&&t.distance>this.options.threshold&&t.maxPointers==this.options.pointers&&bt(e)>this.options.velocity&&t.eventType&Pt},emit:function(t){var e=et(t.offsetDirection);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),p(ut,K,{defaults:{event:\"tap\",pointers:1,taps:1,interval:300,time:250,threshold:9,posThreshold:10},getTouchAction:function(){return[ae]},process:function(t){var e=this.options,n=t.pointers.length===e.pointers,r=t.distance0&&(e+=a(i)),e+=a(n)}var i,o,a=n(15),s=(n(0),1459707606518),c=6;t.exports=r},function(t,e,n){\"use strict\";function r(t){for(var e,n=0,r=\"\";!e;)r+=a(o,i.get(),1),e=tn.parts.length&&(r.parts.length=n.parts.length)}else{for(var a=[],i=0;i i) if (has(O, key = names[i++])) {\n ~arrayIndexOf(result, key) || result.push(key);\n }\n return result;\n};\n\n\n/***/ }),\n\n/***/ \"IinW\":\n/***/ (function(module, exports, __webpack_require__) {\n\n/*!\n * Viewer.js v1.3.5\n * https://fengyuanchen.github.io/viewerjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2019-07-04T11:00:16.790Z\n */\n\n(function (global, factory) {\n true ? module.exports = factory() :\n typeof define === 'function' && define.amd ? define(factory) :\n (global = global || self, global.Viewer = factory());\n}(this, function () { 'use strict';\n\n function _typeof(obj) {\n if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") {\n _typeof = function (obj) {\n return typeof obj;\n };\n } else {\n _typeof = function (obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj;\n };\n }\n\n return _typeof(obj);\n }\n\n function _classCallCheck(instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n }\n\n function _defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, descriptor.key, descriptor);\n }\n }\n\n function _createClass(Constructor, protoProps, staticProps) {\n if (protoProps) _defineProperties(Constructor.prototype, protoProps);\n if (staticProps) _defineProperties(Constructor, staticProps);\n return Constructor;\n }\n\n var DEFAULTS = {\n /**\n * Enable a modal backdrop, specify `static` for a backdrop\n * which doesn't close the modal on click.\n * @type {boolean}\n */\n backdrop: true,\n\n /**\n * Show the button on the top-right of the viewer.\n * @type {boolean}\n */\n button: true,\n\n /**\n * Show the navbar.\n * @type {boolean | number}\n */\n navbar: true,\n\n /**\n * Specify the visibility and the content of the title.\n * @type {boolean | number | Function | Array}\n */\n title: true,\n\n /**\n * Show the toolbar.\n * @type {boolean | number | Object}\n */\n toolbar: true,\n\n /**\n * Custom class name(s) to add to the viewer's root element.\n * @type {string}\n */\n className: '',\n\n /**\n * Define where to put the viewer in modal mode.\n * @type {string | Element}\n */\n container: 'body',\n\n /**\n * Filter the images for viewing. Return true if the image is viewable.\n * @type {Function}\n */\n filter: null,\n\n /**\n * Enable to request fullscreen when play.\n * @type {boolean}\n */\n fullscreen: true,\n\n /**\n * Define the initial index of image for viewing.\n * @type {number}\n */\n initialViewIndex: 0,\n\n /**\n * Enable inline mode.\n * @type {boolean}\n */\n inline: false,\n\n /**\n * The amount of time to delay between automatically cycling an image when playing.\n * @type {number}\n */\n interval: 5000,\n\n /**\n * Enable keyboard support.\n * @type {boolean}\n */\n keyboard: true,\n\n /**\n * Indicate if show a loading spinner when load image or not.\n * @type {boolean}\n */\n loading: true,\n\n /**\n * Indicate if enable loop viewing or not.\n * @type {boolean}\n */\n loop: true,\n\n /**\n * Min width of the viewer in inline mode.\n * @type {number}\n */\n minWidth: 200,\n\n /**\n * Min height of the viewer in inline mode.\n * @type {number}\n */\n minHeight: 100,\n\n /**\n * Enable to move the image.\n * @type {boolean}\n */\n movable: true,\n\n /**\n * Enable to zoom the image.\n * @type {boolean}\n */\n zoomable: true,\n\n /**\n * Enable to rotate the image.\n * @type {boolean}\n */\n rotatable: true,\n\n /**\n * Enable to scale the image.\n * @type {boolean}\n */\n scalable: true,\n\n /**\n * Indicate if toggle the image size between its natural size\n * and initial size when double click on the image or not.\n * @type {boolean}\n */\n toggleOnDblclick: true,\n\n /**\n * Show the tooltip with image ratio (percentage) when zoom in or zoom out.\n * @type {boolean}\n */\n tooltip: true,\n\n /**\n * Enable CSS3 Transition for some special elements.\n * @type {boolean}\n */\n transition: true,\n\n /**\n * Define the CSS `z-index` value of viewer in modal mode.\n * @type {number}\n */\n zIndex: 2015,\n\n /**\n * Define the CSS `z-index` value of viewer in inline mode.\n * @type {number}\n */\n zIndexInline: 0,\n\n /**\n * Define the ratio when zoom the image by wheeling mouse.\n * @type {number}\n */\n zoomRatio: 0.1,\n\n /**\n * Define the min ratio of the image when zoom out.\n * @type {number}\n */\n minZoomRatio: 0.01,\n\n /**\n * Define the max ratio of the image when zoom in.\n * @type {number}\n */\n maxZoomRatio: 100,\n\n /**\n * Define where to get the original image URL for viewing.\n * @type {string | Function}\n */\n url: 'src',\n\n /**\n * Event shortcuts.\n * @type {Function}\n */\n ready: null,\n show: null,\n shown: null,\n hide: null,\n hidden: null,\n view: null,\n viewed: null,\n zoom: null,\n zoomed: null\n };\n\n var TEMPLATE = '' + '
' + '' + '
' + '
' + '
' + '
';\n\n var IS_BROWSER = typeof window !== 'undefined';\n var WINDOW = IS_BROWSER ? window : {};\n var IS_TOUCH_DEVICE = IS_BROWSER ? 'ontouchstart' in WINDOW.document.documentElement : false;\n var HAS_POINTER_EVENT = IS_BROWSER ? 'PointerEvent' in WINDOW : false;\n var NAMESPACE = 'viewer'; // Actions\n\n var ACTION_MOVE = 'move';\n var ACTION_SWITCH = 'switch';\n var ACTION_ZOOM = 'zoom'; // Classes\n\n var CLASS_ACTIVE = \"\".concat(NAMESPACE, \"-active\");\n var CLASS_CLOSE = \"\".concat(NAMESPACE, \"-close\");\n var CLASS_FADE = \"\".concat(NAMESPACE, \"-fade\");\n var CLASS_FIXED = \"\".concat(NAMESPACE, \"-fixed\");\n var CLASS_FULLSCREEN = \"\".concat(NAMESPACE, \"-fullscreen\");\n var CLASS_FULLSCREEN_EXIT = \"\".concat(NAMESPACE, \"-fullscreen-exit\");\n var CLASS_HIDE = \"\".concat(NAMESPACE, \"-hide\");\n var CLASS_HIDE_MD_DOWN = \"\".concat(NAMESPACE, \"-hide-md-down\");\n var CLASS_HIDE_SM_DOWN = \"\".concat(NAMESPACE, \"-hide-sm-down\");\n var CLASS_HIDE_XS_DOWN = \"\".concat(NAMESPACE, \"-hide-xs-down\");\n var CLASS_IN = \"\".concat(NAMESPACE, \"-in\");\n var CLASS_INVISIBLE = \"\".concat(NAMESPACE, \"-invisible\");\n var CLASS_LOADING = \"\".concat(NAMESPACE, \"-loading\");\n var CLASS_MOVE = \"\".concat(NAMESPACE, \"-move\");\n var CLASS_OPEN = \"\".concat(NAMESPACE, \"-open\");\n var CLASS_SHOW = \"\".concat(NAMESPACE, \"-show\");\n var CLASS_TRANSITION = \"\".concat(NAMESPACE, \"-transition\"); // Events\n\n var EVENT_CLICK = 'click';\n var EVENT_DBLCLICK = 'dblclick';\n var EVENT_DRAG_START = 'dragstart';\n var EVENT_HIDDEN = 'hidden';\n var EVENT_HIDE = 'hide';\n var EVENT_KEY_DOWN = 'keydown';\n var EVENT_LOAD = 'load';\n var EVENT_TOUCH_START = IS_TOUCH_DEVICE ? 'touchstart' : 'mousedown';\n var EVENT_TOUCH_MOVE = IS_TOUCH_DEVICE ? 'touchmove' : 'mousemove';\n var EVENT_TOUCH_END = IS_TOUCH_DEVICE ? 'touchend touchcancel' : 'mouseup';\n var EVENT_POINTER_DOWN = HAS_POINTER_EVENT ? 'pointerdown' : EVENT_TOUCH_START;\n var EVENT_POINTER_MOVE = HAS_POINTER_EVENT ? 'pointermove' : EVENT_TOUCH_MOVE;\n var EVENT_POINTER_UP = HAS_POINTER_EVENT ? 'pointerup pointercancel' : EVENT_TOUCH_END;\n var EVENT_READY = 'ready';\n var EVENT_RESIZE = 'resize';\n var EVENT_SHOW = 'show';\n var EVENT_SHOWN = 'shown';\n var EVENT_TRANSITION_END = 'transitionend';\n var EVENT_VIEW = 'view';\n var EVENT_VIEWED = 'viewed';\n var EVENT_WHEEL = 'wheel';\n var EVENT_ZOOM = 'zoom';\n var EVENT_ZOOMED = 'zoomed'; // Data keys\n\n var DATA_ACTION = \"\".concat(NAMESPACE, \"Action\"); // RegExps\n\n var REGEXP_SPACES = /\\s\\s*/; // Misc\n\n var BUTTONS = ['zoom-in', 'zoom-out', 'one-to-one', 'reset', 'prev', 'play', 'next', 'rotate-left', 'rotate-right', 'flip-horizontal', 'flip-vertical'];\n\n /**\n * Check if the given value is a string.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a string, else `false`.\n */\n\n function isString(value) {\n return typeof value === 'string';\n }\n /**\n * Check if the given value is not a number.\n */\n\n var isNaN = Number.isNaN || WINDOW.isNaN;\n /**\n * Check if the given value is a number.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a number, else `false`.\n */\n\n function isNumber(value) {\n return typeof value === 'number' && !isNaN(value);\n }\n /**\n * Check if the given value is undefined.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is undefined, else `false`.\n */\n\n function isUndefined(value) {\n return typeof value === 'undefined';\n }\n /**\n * Check if the given value is an object.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is an object, else `false`.\n */\n\n function isObject(value) {\n return _typeof(value) === 'object' && value !== null;\n }\n var hasOwnProperty = Object.prototype.hasOwnProperty;\n /**\n * Check if the given value is a plain object.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a plain object, else `false`.\n */\n\n function isPlainObject(value) {\n if (!isObject(value)) {\n return false;\n }\n\n try {\n var _constructor = value.constructor;\n var prototype = _constructor.prototype;\n return _constructor && prototype && hasOwnProperty.call(prototype, 'isPrototypeOf');\n } catch (error) {\n return false;\n }\n }\n /**\n * Check if the given value is a function.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a function, else `false`.\n */\n\n function isFunction(value) {\n return typeof value === 'function';\n }\n /**\n * Iterate the given data.\n * @param {*} data - The data to iterate.\n * @param {Function} callback - The process function for each element.\n * @returns {*} The original data.\n */\n\n function forEach(data, callback) {\n if (data && isFunction(callback)) {\n if (Array.isArray(data) || isNumber(data.length)\n /* array-like */\n ) {\n var length = data.length;\n var i;\n\n for (i = 0; i < length; i += 1) {\n if (callback.call(data, data[i], i, data) === false) {\n break;\n }\n }\n } else if (isObject(data)) {\n Object.keys(data).forEach(function (key) {\n callback.call(data, data[key], key, data);\n });\n }\n }\n\n return data;\n }\n /**\n * Extend the given object.\n * @param {*} obj - The object to be extended.\n * @param {*} args - The rest objects which will be merged to the first object.\n * @returns {Object} The extended object.\n */\n\n var assign = Object.assign || function assign(obj) {\n for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n args[_key - 1] = arguments[_key];\n }\n\n if (isObject(obj) && args.length > 0) {\n args.forEach(function (arg) {\n if (isObject(arg)) {\n Object.keys(arg).forEach(function (key) {\n obj[key] = arg[key];\n });\n }\n });\n }\n\n return obj;\n };\n var REGEXP_SUFFIX = /^(?:width|height|left|top|marginLeft|marginTop)$/;\n /**\n * Apply styles to the given element.\n * @param {Element} element - The target element.\n * @param {Object} styles - The styles for applying.\n */\n\n function setStyle(element, styles) {\n var style = element.style;\n forEach(styles, function (value, property) {\n if (REGEXP_SUFFIX.test(property) && isNumber(value)) {\n value += 'px';\n }\n\n style[property] = value;\n });\n }\n /**\n * Escape a string for using in HTML.\n * @param {String} value - The string to escape.\n * @returns {String} Returns the escaped string.\n */\n\n function escapeHTMLEntities(value) {\n return isString(value) ? value.replace(/&(?!amp;|quot;|#39;|lt;|gt;)/g, '&').replace(/\"/g, '"').replace(/'/g, ''').replace(//g, '>') : value;\n }\n /**\n * Check if the given element has a special class.\n * @param {Element} element - The element to check.\n * @param {string} value - The class to search.\n * @returns {boolean} Returns `true` if the special class was found.\n */\n\n function hasClass(element, value) {\n return element.classList ? element.classList.contains(value) : element.className.indexOf(value) > -1;\n }\n /**\n * Add classes to the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be added.\n */\n\n function addClass(element, value) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n addClass(elem, value);\n });\n return;\n }\n\n if (element.classList) {\n element.classList.add(value);\n return;\n }\n\n var className = element.className.trim();\n\n if (!className) {\n element.className = value;\n } else if (className.indexOf(value) < 0) {\n element.className = \"\".concat(className, \" \").concat(value);\n }\n }\n /**\n * Remove classes from the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be removed.\n */\n\n function removeClass(element, value) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n removeClass(elem, value);\n });\n return;\n }\n\n if (element.classList) {\n element.classList.remove(value);\n return;\n }\n\n if (element.className.indexOf(value) >= 0) {\n element.className = element.className.replace(value, '');\n }\n }\n /**\n * Add or remove classes from the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be toggled.\n * @param {boolean} added - Add only.\n */\n\n function toggleClass(element, value, added) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n toggleClass(elem, value, added);\n });\n return;\n } // IE10-11 doesn't support the second parameter of `classList.toggle`\n\n\n if (added) {\n addClass(element, value);\n } else {\n removeClass(element, value);\n }\n }\n var REGEXP_HYPHENATE = /([a-z\\d])([A-Z])/g;\n /**\n * Transform the given string from camelCase to kebab-case\n * @param {string} value - The value to transform.\n * @returns {string} The transformed value.\n */\n\n function hyphenate(value) {\n return value.replace(REGEXP_HYPHENATE, '$1-$2').toLowerCase();\n }\n /**\n * Get data from the given element.\n * @param {Element} element - The target element.\n * @param {string} name - The data key to get.\n * @returns {string} The data value.\n */\n\n function getData(element, name) {\n if (isObject(element[name])) {\n return element[name];\n }\n\n if (element.dataset) {\n return element.dataset[name];\n }\n\n return element.getAttribute(\"data-\".concat(hyphenate(name)));\n }\n /**\n * Set data to the given element.\n * @param {Element} element - The target element.\n * @param {string} name - The data key to set.\n * @param {string} data - The data value.\n */\n\n function setData(element, name, data) {\n if (isObject(data)) {\n element[name] = data;\n } else if (element.dataset) {\n element.dataset[name] = data;\n } else {\n element.setAttribute(\"data-\".concat(hyphenate(name)), data);\n }\n }\n\n var onceSupported = function () {\n var supported = false;\n\n if (IS_BROWSER) {\n var once = false;\n\n var listener = function listener() {};\n\n var options = Object.defineProperty({}, 'once', {\n get: function get() {\n supported = true;\n return once;\n },\n\n /**\n * This setter can fix a `TypeError` in strict mode\n * {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Errors/Getter_only}\n * @param {boolean} value - The value to set\n */\n set: function set(value) {\n once = value;\n }\n });\n WINDOW.addEventListener('test', listener, options);\n WINDOW.removeEventListener('test', listener, options);\n }\n\n return supported;\n }();\n /**\n * Remove event listener from the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Function} listener - The event listener.\n * @param {Object} options - The event options.\n */\n\n\n function removeListener(element, type, listener) {\n var options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {};\n var handler = listener;\n type.trim().split(REGEXP_SPACES).forEach(function (event) {\n if (!onceSupported) {\n var listeners = element.listeners;\n\n if (listeners && listeners[event] && listeners[event][listener]) {\n handler = listeners[event][listener];\n delete listeners[event][listener];\n\n if (Object.keys(listeners[event]).length === 0) {\n delete listeners[event];\n }\n\n if (Object.keys(listeners).length === 0) {\n delete element.listeners;\n }\n }\n }\n\n element.removeEventListener(event, handler, options);\n });\n }\n /**\n * Add event listener to the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Function} listener - The event listener.\n * @param {Object} options - The event options.\n */\n\n function addListener(element, type, listener) {\n var options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {};\n var _handler = listener;\n type.trim().split(REGEXP_SPACES).forEach(function (event) {\n if (options.once && !onceSupported) {\n var _element$listeners = element.listeners,\n listeners = _element$listeners === void 0 ? {} : _element$listeners;\n\n _handler = function handler() {\n delete listeners[event][listener];\n element.removeEventListener(event, _handler, options);\n\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n\n listener.apply(element, args);\n };\n\n if (!listeners[event]) {\n listeners[event] = {};\n }\n\n if (listeners[event][listener]) {\n element.removeEventListener(event, listeners[event][listener], options);\n }\n\n listeners[event][listener] = _handler;\n element.listeners = listeners;\n }\n\n element.addEventListener(event, _handler, options);\n });\n }\n /**\n * Dispatch event on the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Object} data - The additional event data.\n * @returns {boolean} Indicate if the event is default prevented or not.\n */\n\n function dispatchEvent(element, type, data) {\n var event; // Event and CustomEvent on IE9-11 are global objects, not constructors\n\n if (isFunction(Event) && isFunction(CustomEvent)) {\n event = new CustomEvent(type, {\n detail: data,\n bubbles: true,\n cancelable: true\n });\n } else {\n event = document.createEvent('CustomEvent');\n event.initCustomEvent(type, true, true, data);\n }\n\n return element.dispatchEvent(event);\n }\n /**\n * Get the offset base on the document.\n * @param {Element} element - The target element.\n * @returns {Object} The offset data.\n */\n\n function getOffset(element) {\n var box = element.getBoundingClientRect();\n return {\n left: box.left + (window.pageXOffset - document.documentElement.clientLeft),\n top: box.top + (window.pageYOffset - document.documentElement.clientTop)\n };\n }\n /**\n * Get transforms base on the given object.\n * @param {Object} obj - The target object.\n * @returns {string} A string contains transform values.\n */\n\n function getTransforms(_ref) {\n var rotate = _ref.rotate,\n scaleX = _ref.scaleX,\n scaleY = _ref.scaleY,\n translateX = _ref.translateX,\n translateY = _ref.translateY;\n var values = [];\n\n if (isNumber(translateX) && translateX !== 0) {\n values.push(\"translateX(\".concat(translateX, \"px)\"));\n }\n\n if (isNumber(translateY) && translateY !== 0) {\n values.push(\"translateY(\".concat(translateY, \"px)\"));\n } // Rotate should come first before scale to match orientation transform\n\n\n if (isNumber(rotate) && rotate !== 0) {\n values.push(\"rotate(\".concat(rotate, \"deg)\"));\n }\n\n if (isNumber(scaleX) && scaleX !== 1) {\n values.push(\"scaleX(\".concat(scaleX, \")\"));\n }\n\n if (isNumber(scaleY) && scaleY !== 1) {\n values.push(\"scaleY(\".concat(scaleY, \")\"));\n }\n\n var transform = values.length ? values.join(' ') : 'none';\n return {\n WebkitTransform: transform,\n msTransform: transform,\n transform: transform\n };\n }\n /**\n * Get an image name from an image url.\n * @param {string} url - The target url.\n * @example\n * // picture.jpg\n * getImageNameFromURL('http://domain.com/path/to/picture.jpg?size=1280×960')\n * @returns {string} A string contains the image name.\n */\n\n function getImageNameFromURL(url) {\n return isString(url) ? decodeURIComponent(url.replace(/^.*\\//, '').replace(/[?].*$/, '')) : '';\n }\n var IS_SAFARI = WINDOW.navigator && /(Macintosh|iPhone|iPod|iPad).*AppleWebKit/i.test(WINDOW.navigator.userAgent);\n /**\n * Get an image's natural sizes.\n * @param {string} image - The target image.\n * @param {Function} callback - The callback function.\n * @returns {HTMLImageElement} The new image.\n */\n\n function getImageNaturalSizes(image, callback) {\n var newImage = document.createElement('img'); // Modern browsers (except Safari)\n\n if (image.naturalWidth && !IS_SAFARI) {\n callback(image.naturalWidth, image.naturalHeight);\n return newImage;\n }\n\n var body = document.body || document.documentElement;\n\n newImage.onload = function () {\n callback(newImage.width, newImage.height);\n\n if (!IS_SAFARI) {\n body.removeChild(newImage);\n }\n };\n\n newImage.src = image.src; // iOS Safari will convert the image automatically\n // with its orientation once append it into DOM\n\n if (!IS_SAFARI) {\n newImage.style.cssText = 'left:0;' + 'max-height:none!important;' + 'max-width:none!important;' + 'min-height:0!important;' + 'min-width:0!important;' + 'opacity:0;' + 'position:absolute;' + 'top:0;' + 'z-index:-1;';\n body.appendChild(newImage);\n }\n\n return newImage;\n }\n /**\n * Get the related class name of a responsive type number.\n * @param {string} type - The responsive type.\n * @returns {string} The related class name.\n */\n\n function getResponsiveClass(type) {\n switch (type) {\n case 2:\n return CLASS_HIDE_XS_DOWN;\n\n case 3:\n return CLASS_HIDE_SM_DOWN;\n\n case 4:\n return CLASS_HIDE_MD_DOWN;\n\n default:\n return '';\n }\n }\n /**\n * Get the max ratio of a group of pointers.\n * @param {string} pointers - The target pointers.\n * @returns {number} The result ratio.\n */\n\n function getMaxZoomRatio(pointers) {\n var pointers2 = assign({}, pointers);\n var ratios = [];\n forEach(pointers, function (pointer, pointerId) {\n delete pointers2[pointerId];\n forEach(pointers2, function (pointer2) {\n var x1 = Math.abs(pointer.startX - pointer2.startX);\n var y1 = Math.abs(pointer.startY - pointer2.startY);\n var x2 = Math.abs(pointer.endX - pointer2.endX);\n var y2 = Math.abs(pointer.endY - pointer2.endY);\n var z1 = Math.sqrt(x1 * x1 + y1 * y1);\n var z2 = Math.sqrt(x2 * x2 + y2 * y2);\n var ratio = (z2 - z1) / z1;\n ratios.push(ratio);\n });\n });\n ratios.sort(function (a, b) {\n return Math.abs(a) < Math.abs(b);\n });\n return ratios[0];\n }\n /**\n * Get a pointer from an event object.\n * @param {Object} event - The target event object.\n * @param {boolean} endOnly - Indicates if only returns the end point coordinate or not.\n * @returns {Object} The result pointer contains start and/or end point coordinates.\n */\n\n function getPointer(_ref2, endOnly) {\n var pageX = _ref2.pageX,\n pageY = _ref2.pageY;\n var end = {\n endX: pageX,\n endY: pageY\n };\n return endOnly ? end : assign({\n timeStamp: Date.now(),\n startX: pageX,\n startY: pageY\n }, end);\n }\n /**\n * Get the center point coordinate of a group of pointers.\n * @param {Object} pointers - The target pointers.\n * @returns {Object} The center point coordinate.\n */\n\n function getPointersCenter(pointers) {\n var pageX = 0;\n var pageY = 0;\n var count = 0;\n forEach(pointers, function (_ref3) {\n var startX = _ref3.startX,\n startY = _ref3.startY;\n pageX += startX;\n pageY += startY;\n count += 1;\n });\n pageX /= count;\n pageY /= count;\n return {\n pageX: pageX,\n pageY: pageY\n };\n }\n\n var render = {\n render: function render() {\n this.initContainer();\n this.initViewer();\n this.initList();\n this.renderViewer();\n },\n initContainer: function initContainer() {\n this.containerData = {\n width: window.innerWidth,\n height: window.innerHeight\n };\n },\n initViewer: function initViewer() {\n var options = this.options,\n parent = this.parent;\n var viewerData;\n\n if (options.inline) {\n viewerData = {\n width: Math.max(parent.offsetWidth, options.minWidth),\n height: Math.max(parent.offsetHeight, options.minHeight)\n };\n this.parentData = viewerData;\n }\n\n if (this.fulled || !viewerData) {\n viewerData = this.containerData;\n }\n\n this.viewerData = assign({}, viewerData);\n },\n renderViewer: function renderViewer() {\n if (this.options.inline && !this.fulled) {\n setStyle(this.viewer, this.viewerData);\n }\n },\n initList: function initList() {\n var _this = this;\n\n var element = this.element,\n options = this.options,\n list = this.list;\n var items = [];\n forEach(this.images, function (image, index) {\n var src = image.src;\n var alt = escapeHTMLEntities(image.alt || getImageNameFromURL(src));\n var url = options.url;\n\n if (isString(url)) {\n url = image.getAttribute(url);\n } else if (isFunction(url)) {\n url = url.call(_this, image);\n }\n\n if (src || url) {\n var item = document.createElement('li');\n var img = document.createElement('img');\n img.src = src || url;\n img.alt = alt;\n img.setAttribute('data-index', index);\n img.setAttribute('data-original-url', url || src);\n img.setAttribute('data-viewer-action', 'view');\n img.setAttribute('role', 'button');\n item.appendChild(img);\n list.appendChild(item);\n items.push(item);\n }\n });\n this.items = items;\n forEach(items, function (item) {\n var image = item.firstElementChild;\n setData(image, 'filled', true);\n\n if (options.loading) {\n addClass(item, CLASS_LOADING);\n }\n\n addListener(image, EVENT_LOAD, function (event) {\n if (options.loading) {\n removeClass(item, CLASS_LOADING);\n }\n\n _this.loadImage(event);\n }, {\n once: true\n });\n });\n\n if (options.transition) {\n addListener(element, EVENT_VIEWED, function () {\n addClass(list, CLASS_TRANSITION);\n }, {\n once: true\n });\n }\n },\n renderList: function renderList(index) {\n var i = index || this.index;\n var width = this.items[i].offsetWidth || 30;\n var outerWidth = width + 1; // 1 pixel of `margin-left` width\n // Place the active item in the center of the screen\n\n setStyle(this.list, assign({\n width: outerWidth * this.length\n }, getTransforms({\n translateX: (this.viewerData.width - width) / 2 - outerWidth * i\n })));\n },\n resetList: function resetList() {\n var list = this.list;\n list.innerHTML = '';\n removeClass(list, CLASS_TRANSITION);\n setStyle(list, getTransforms({\n translateX: 0\n }));\n },\n initImage: function initImage(done) {\n var _this2 = this;\n\n var options = this.options,\n image = this.image,\n viewerData = this.viewerData;\n var footerHeight = this.footer.offsetHeight;\n var viewerWidth = viewerData.width;\n var viewerHeight = Math.max(viewerData.height - footerHeight, footerHeight);\n var oldImageData = this.imageData || {};\n var sizingImage;\n this.imageInitializing = {\n abort: function abort() {\n sizingImage.onload = null;\n }\n };\n sizingImage = getImageNaturalSizes(image, function (naturalWidth, naturalHeight) {\n var aspectRatio = naturalWidth / naturalHeight;\n var width = viewerWidth;\n var height = viewerHeight;\n _this2.imageInitializing = false;\n\n if (viewerHeight * aspectRatio > viewerWidth) {\n height = viewerWidth / aspectRatio;\n } else {\n width = viewerHeight * aspectRatio;\n }\n\n width = Math.min(width * 0.9, naturalWidth);\n height = Math.min(height * 0.9, naturalHeight);\n var imageData = {\n naturalWidth: naturalWidth,\n naturalHeight: naturalHeight,\n aspectRatio: aspectRatio,\n ratio: width / naturalWidth,\n width: width,\n height: height,\n left: (viewerWidth - width) / 2,\n top: (viewerHeight - height) / 2\n };\n var initialImageData = assign({}, imageData);\n\n if (options.rotatable) {\n imageData.rotate = oldImageData.rotate || 0;\n initialImageData.rotate = 0;\n }\n\n if (options.scalable) {\n imageData.scaleX = oldImageData.scaleX || 1;\n imageData.scaleY = oldImageData.scaleY || 1;\n initialImageData.scaleX = 1;\n initialImageData.scaleY = 1;\n }\n\n _this2.imageData = imageData;\n _this2.initialImageData = initialImageData;\n\n if (done) {\n done();\n }\n });\n },\n renderImage: function renderImage(done) {\n var _this3 = this;\n\n var image = this.image,\n imageData = this.imageData;\n setStyle(image, assign({\n width: imageData.width,\n height: imageData.height,\n // XXX: Not to use translateX/Y to avoid image shaking when zooming\n marginLeft: imageData.left,\n marginTop: imageData.top\n }, getTransforms(imageData)));\n\n if (done) {\n if ((this.viewing || this.zooming) && this.options.transition) {\n var onTransitionEnd = function onTransitionEnd() {\n _this3.imageRendering = false;\n done();\n };\n\n this.imageRendering = {\n abort: function abort() {\n removeListener(image, EVENT_TRANSITION_END, onTransitionEnd);\n }\n };\n addListener(image, EVENT_TRANSITION_END, onTransitionEnd, {\n once: true\n });\n } else {\n done();\n }\n }\n },\n resetImage: function resetImage() {\n // this.image only defined after viewed\n if (this.viewing || this.viewed) {\n var image = this.image;\n\n if (this.viewing) {\n this.viewing.abort();\n }\n\n image.parentNode.removeChild(image);\n this.image = null;\n }\n }\n };\n\n var events = {\n bind: function bind() {\n var options = this.options,\n viewer = this.viewer,\n canvas = this.canvas;\n var document = this.element.ownerDocument;\n addListener(viewer, EVENT_CLICK, this.onClick = this.click.bind(this));\n addListener(viewer, EVENT_WHEEL, this.onWheel = this.wheel.bind(this), {\n passive: false,\n capture: true\n });\n addListener(viewer, EVENT_DRAG_START, this.onDragStart = this.dragstart.bind(this));\n addListener(canvas, EVENT_POINTER_DOWN, this.onPointerDown = this.pointerdown.bind(this));\n addListener(document, EVENT_POINTER_MOVE, this.onPointerMove = this.pointermove.bind(this));\n addListener(document, EVENT_POINTER_UP, this.onPointerUp = this.pointerup.bind(this));\n addListener(document, EVENT_KEY_DOWN, this.onKeyDown = this.keydown.bind(this));\n addListener(window, EVENT_RESIZE, this.onResize = this.resize.bind(this));\n\n if (options.toggleOnDblclick) {\n addListener(canvas, EVENT_DBLCLICK, this.onDblclick = this.dblclick.bind(this));\n }\n },\n unbind: function unbind() {\n var options = this.options,\n viewer = this.viewer,\n canvas = this.canvas;\n var document = this.element.ownerDocument;\n removeListener(viewer, EVENT_CLICK, this.onClick);\n removeListener(viewer, EVENT_WHEEL, this.onWheel, {\n passive: false,\n capture: true\n });\n removeListener(viewer, EVENT_DRAG_START, this.onDragStart);\n removeListener(canvas, EVENT_POINTER_DOWN, this.onPointerDown);\n removeListener(document, EVENT_POINTER_MOVE, this.onPointerMove);\n removeListener(document, EVENT_POINTER_UP, this.onPointerUp);\n removeListener(document, EVENT_KEY_DOWN, this.onKeyDown);\n removeListener(window, EVENT_RESIZE, this.onResize);\n\n if (options.toggleOnDblclick) {\n removeListener(canvas, EVENT_DBLCLICK, this.onDblclick);\n }\n }\n };\n\n var handlers = {\n click: function click(event) {\n var target = event.target;\n var options = this.options,\n imageData = this.imageData;\n var action = getData(target, DATA_ACTION); // Cancel the emulated click when the native click event was triggered.\n\n if (IS_TOUCH_DEVICE && event.isTrusted && target === this.canvas) {\n clearTimeout(this.clickCanvasTimeout);\n }\n\n switch (action) {\n case 'mix':\n if (this.played) {\n this.stop();\n } else if (options.inline) {\n if (this.fulled) {\n this.exit();\n } else {\n this.full();\n }\n } else {\n this.hide();\n }\n\n break;\n\n case 'hide':\n this.hide();\n break;\n\n case 'view':\n this.view(getData(target, 'index'));\n break;\n\n case 'zoom-in':\n this.zoom(0.1, true);\n break;\n\n case 'zoom-out':\n this.zoom(-0.1, true);\n break;\n\n case 'one-to-one':\n this.toggle();\n break;\n\n case 'reset':\n this.reset();\n break;\n\n case 'prev':\n this.prev(options.loop);\n break;\n\n case 'play':\n this.play(options.fullscreen);\n break;\n\n case 'next':\n this.next(options.loop);\n break;\n\n case 'rotate-left':\n this.rotate(-90);\n break;\n\n case 'rotate-right':\n this.rotate(90);\n break;\n\n case 'flip-horizontal':\n this.scaleX(-imageData.scaleX || -1);\n break;\n\n case 'flip-vertical':\n this.scaleY(-imageData.scaleY || -1);\n break;\n\n default:\n if (this.played) {\n this.stop();\n }\n\n }\n },\n dblclick: function dblclick(event) {\n event.preventDefault();\n\n if (this.viewed && event.target === this.image) {\n // Cancel the emulated double click when the native dblclick event was triggered.\n if (IS_TOUCH_DEVICE && event.isTrusted) {\n clearTimeout(this.doubleClickImageTimeout);\n }\n\n this.toggle();\n }\n },\n load: function load() {\n var _this = this;\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n this.timeout = false;\n }\n\n var element = this.element,\n options = this.options,\n image = this.image,\n index = this.index,\n viewerData = this.viewerData;\n removeClass(image, CLASS_INVISIBLE);\n\n if (options.loading) {\n removeClass(this.canvas, CLASS_LOADING);\n }\n\n image.style.cssText = 'height:0;' + \"margin-left:\".concat(viewerData.width / 2, \"px;\") + \"margin-top:\".concat(viewerData.height / 2, \"px;\") + 'max-width:none!important;' + 'position:absolute;' + 'width:0;';\n this.initImage(function () {\n toggleClass(image, CLASS_MOVE, options.movable);\n toggleClass(image, CLASS_TRANSITION, options.transition);\n\n _this.renderImage(function () {\n _this.viewed = true;\n _this.viewing = false;\n\n if (isFunction(options.viewed)) {\n addListener(element, EVENT_VIEWED, options.viewed, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_VIEWED, {\n originalImage: _this.images[index],\n index: index,\n image: image\n });\n });\n });\n },\n loadImage: function loadImage(event) {\n var image = event.target;\n var parent = image.parentNode;\n var parentWidth = parent.offsetWidth || 30;\n var parentHeight = parent.offsetHeight || 50;\n var filled = !!getData(image, 'filled');\n getImageNaturalSizes(image, function (naturalWidth, naturalHeight) {\n var aspectRatio = naturalWidth / naturalHeight;\n var width = parentWidth;\n var height = parentHeight;\n\n if (parentHeight * aspectRatio > parentWidth) {\n if (filled) {\n width = parentHeight * aspectRatio;\n } else {\n height = parentWidth / aspectRatio;\n }\n } else if (filled) {\n height = parentWidth / aspectRatio;\n } else {\n width = parentHeight * aspectRatio;\n }\n\n setStyle(image, assign({\n width: width,\n height: height\n }, getTransforms({\n translateX: (parentWidth - width) / 2,\n translateY: (parentHeight - height) / 2\n })));\n });\n },\n keydown: function keydown(event) {\n var options = this.options;\n\n if (!this.fulled || !options.keyboard) {\n return;\n }\n\n switch (event.keyCode || event.which || event.charCode) {\n // Escape\n case 27:\n if (this.played) {\n this.stop();\n } else if (options.inline) {\n if (this.fulled) {\n this.exit();\n }\n } else {\n this.hide();\n }\n\n break;\n // Space\n\n case 32:\n if (this.played) {\n this.stop();\n }\n\n break;\n // ArrowLeft\n\n case 37:\n this.prev(options.loop);\n break;\n // ArrowUp\n\n case 38:\n // Prevent scroll on Firefox\n event.preventDefault(); // Zoom in\n\n this.zoom(options.zoomRatio, true);\n break;\n // ArrowRight\n\n case 39:\n this.next(options.loop);\n break;\n // ArrowDown\n\n case 40:\n // Prevent scroll on Firefox\n event.preventDefault(); // Zoom out\n\n this.zoom(-options.zoomRatio, true);\n break;\n // Ctrl + 0\n\n case 48: // Fall through\n // Ctrl + 1\n // eslint-disable-next-line no-fallthrough\n\n case 49:\n if (event.ctrlKey) {\n event.preventDefault();\n this.toggle();\n }\n\n break;\n\n default:\n }\n },\n dragstart: function dragstart(event) {\n if (event.target.tagName.toLowerCase() === 'img') {\n event.preventDefault();\n }\n },\n pointerdown: function pointerdown(event) {\n var options = this.options,\n pointers = this.pointers;\n var buttons = event.buttons,\n button = event.button;\n\n if (!this.viewed || this.showing || this.viewing || this.hiding // No primary button (Usually the left button)\n // Note that touch events have no `buttons` or `button` property\n || isNumber(buttons) && buttons !== 1 || isNumber(button) && button !== 0 // Open context menu\n || event.ctrlKey) {\n return;\n } // Prevent default behaviours as page zooming in touch devices.\n\n\n event.preventDefault();\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n pointers[touch.identifier] = getPointer(touch);\n });\n } else {\n pointers[event.pointerId || 0] = getPointer(event);\n }\n\n var action = options.movable ? ACTION_MOVE : false;\n\n if (Object.keys(pointers).length > 1) {\n action = ACTION_ZOOM;\n } else if ((event.pointerType === 'touch' || event.type === 'touchstart') && this.isSwitchable()) {\n action = ACTION_SWITCH;\n }\n\n if (options.transition && (action === ACTION_MOVE || action === ACTION_ZOOM)) {\n removeClass(this.image, CLASS_TRANSITION);\n }\n\n this.action = action;\n },\n pointermove: function pointermove(event) {\n var pointers = this.pointers,\n action = this.action;\n\n if (!this.viewed || !action) {\n return;\n }\n\n event.preventDefault();\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n assign(pointers[touch.identifier] || {}, getPointer(touch, true));\n });\n } else {\n assign(pointers[event.pointerId || 0] || {}, getPointer(event, true));\n }\n\n this.change(event);\n },\n pointerup: function pointerup(event) {\n var _this2 = this;\n\n var options = this.options,\n action = this.action,\n pointers = this.pointers;\n var pointer;\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n pointer = pointers[touch.identifier];\n delete pointers[touch.identifier];\n });\n } else {\n pointer = pointers[event.pointerId || 0];\n delete pointers[event.pointerId || 0];\n }\n\n if (!action) {\n return;\n }\n\n event.preventDefault();\n\n if (options.transition && (action === ACTION_MOVE || action === ACTION_ZOOM)) {\n addClass(this.image, CLASS_TRANSITION);\n }\n\n this.action = false; // Emulate click and double click in touch devices to support backdrop and image zooming (#210).\n\n if (IS_TOUCH_DEVICE && action !== ACTION_ZOOM && pointer && Date.now() - pointer.timeStamp < 500) {\n clearTimeout(this.clickCanvasTimeout);\n clearTimeout(this.doubleClickImageTimeout);\n\n if (options.toggleOnDblclick && this.viewed && event.target === this.image) {\n if (this.imageClicked) {\n this.imageClicked = false; // This timeout will be cleared later when a native dblclick event is triggering\n\n this.doubleClickImageTimeout = setTimeout(function () {\n dispatchEvent(_this2.image, EVENT_DBLCLICK);\n }, 50);\n } else {\n this.imageClicked = true; // The default timing of a double click in Windows is 500 ms\n\n this.doubleClickImageTimeout = setTimeout(function () {\n _this2.imageClicked = false;\n }, 500);\n }\n } else {\n this.imageClicked = false;\n\n if (options.backdrop && options.backdrop !== 'static' && event.target === this.canvas) {\n // This timeout will be cleared later when a native click event is triggering\n this.clickCanvasTimeout = setTimeout(function () {\n dispatchEvent(_this2.canvas, EVENT_CLICK);\n }, 50);\n }\n }\n }\n },\n resize: function resize() {\n var _this3 = this;\n\n if (!this.isShown || this.hiding) {\n return;\n }\n\n this.initContainer();\n this.initViewer();\n this.renderViewer();\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this3.renderImage();\n });\n }\n\n if (this.played) {\n if (this.options.fullscreen && this.fulled && !(document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n this.stop();\n return;\n }\n\n forEach(this.player.getElementsByTagName('img'), function (image) {\n addListener(image, EVENT_LOAD, _this3.loadImage.bind(_this3), {\n once: true\n });\n dispatchEvent(image, EVENT_LOAD);\n });\n }\n },\n wheel: function wheel(event) {\n var _this4 = this;\n\n if (!this.viewed) {\n return;\n }\n\n event.preventDefault(); // Limit wheel speed to prevent zoom too fast\n\n if (this.wheeling) {\n return;\n }\n\n this.wheeling = true;\n setTimeout(function () {\n _this4.wheeling = false;\n }, 50);\n var ratio = Number(this.options.zoomRatio) || 0.1;\n var delta = 1;\n\n if (event.deltaY) {\n delta = event.deltaY > 0 ? 1 : -1;\n } else if (event.wheelDelta) {\n delta = -event.wheelDelta / 120;\n } else if (event.detail) {\n delta = event.detail > 0 ? 1 : -1;\n }\n\n this.zoom(-delta * ratio, true, event);\n }\n };\n\n var methods = {\n /** Show the viewer (only available in modal mode)\n * @param {boolean} [immediate=false] - Indicates if show the viewer immediately or not.\n * @returns {Viewer} this\n */\n show: function show() {\n var immediate = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var element = this.element,\n options = this.options;\n\n if (options.inline || this.showing || this.isShown || this.showing) {\n return this;\n }\n\n if (!this.ready) {\n this.build();\n\n if (this.ready) {\n this.show(immediate);\n }\n\n return this;\n }\n\n if (isFunction(options.show)) {\n addListener(element, EVENT_SHOW, options.show, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_SHOW) === false || !this.ready) {\n return this;\n }\n\n if (this.hiding) {\n this.transitioning.abort();\n }\n\n this.showing = true;\n this.open();\n var viewer = this.viewer;\n removeClass(viewer, CLASS_HIDE);\n\n if (options.transition && !immediate) {\n var shown = this.shown.bind(this);\n this.transitioning = {\n abort: function abort() {\n removeListener(viewer, EVENT_TRANSITION_END, shown);\n removeClass(viewer, CLASS_IN);\n }\n };\n addClass(viewer, CLASS_TRANSITION); // Force reflow to enable CSS3 transition\n // eslint-disable-next-line\n\n viewer.offsetWidth;\n addListener(viewer, EVENT_TRANSITION_END, shown, {\n once: true\n });\n addClass(viewer, CLASS_IN);\n } else {\n addClass(viewer, CLASS_IN);\n this.shown();\n }\n\n return this;\n },\n\n /**\n * Hide the viewer (only available in modal mode)\n * @param {boolean} [immediate=false] - Indicates if hide the viewer immediately or not.\n * @returns {Viewer} this\n */\n hide: function hide() {\n var immediate = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var element = this.element,\n options = this.options;\n\n if (options.inline || this.hiding || !(this.isShown || this.showing)) {\n return this;\n }\n\n if (isFunction(options.hide)) {\n addListener(element, EVENT_HIDE, options.hide, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_HIDE) === false) {\n return this;\n }\n\n if (this.showing) {\n this.transitioning.abort();\n }\n\n this.hiding = true;\n\n if (this.played) {\n this.stop();\n } else if (this.viewing) {\n this.viewing.abort();\n }\n\n var viewer = this.viewer;\n\n if (options.transition && !immediate) {\n var hidden = this.hidden.bind(this);\n\n var hide = function hide() {\n // XXX: It seems the `event.stopPropagation()` method does not work here\n setTimeout(function () {\n addListener(viewer, EVENT_TRANSITION_END, hidden, {\n once: true\n });\n removeClass(viewer, CLASS_IN);\n }, 0);\n };\n\n this.transitioning = {\n abort: function abort() {\n if (this.viewed) {\n removeListener(this.image, EVENT_TRANSITION_END, hide);\n } else {\n removeListener(viewer, EVENT_TRANSITION_END, hidden);\n }\n }\n }; // Note that the `CLASS_TRANSITION` class will be removed on pointer down (#255)\n\n if (this.viewed && hasClass(this.image, CLASS_TRANSITION)) {\n addListener(this.image, EVENT_TRANSITION_END, hide, {\n once: true\n });\n this.zoomTo(0, false, false, true);\n } else {\n hide();\n }\n } else {\n removeClass(viewer, CLASS_IN);\n this.hidden();\n }\n\n return this;\n },\n\n /**\n * View one of the images with image's index\n * @param {number} index - The index of the image to view.\n * @returns {Viewer} this\n */\n view: function view() {\n var _this = this;\n\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.options.initialViewIndex;\n index = Number(index) || 0;\n\n if (!this.isShown) {\n this.index = index;\n return this.show();\n }\n\n if (this.hiding || this.played || index < 0 || index >= this.length || this.viewed && index === this.index) {\n return this;\n }\n\n if (this.viewing) {\n this.viewing.abort();\n }\n\n var element = this.element,\n options = this.options,\n title = this.title,\n canvas = this.canvas;\n var item = this.items[index];\n var img = item.querySelector('img');\n var url = getData(img, 'originalUrl');\n var alt = escapeHTMLEntities(img.getAttribute('alt'));\n var image = document.createElement('img');\n image.src = url;\n image.alt = alt;\n\n if (isFunction(options.view)) {\n addListener(element, EVENT_VIEW, options.view, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_VIEW, {\n originalImage: this.images[index],\n index: index,\n image: image\n }) === false || !this.isShown || this.hiding || this.played) {\n return this;\n }\n\n this.image = image;\n removeClass(this.items[this.index], CLASS_ACTIVE);\n addClass(item, CLASS_ACTIVE);\n this.viewed = false;\n this.index = index;\n this.imageData = {};\n addClass(image, CLASS_INVISIBLE);\n\n if (options.loading) {\n addClass(canvas, CLASS_LOADING);\n }\n\n canvas.innerHTML = '';\n canvas.appendChild(image); // Center current item\n\n this.renderList(); // Clear title\n\n title.innerHTML = ''; // Generate title after viewed\n\n var onViewed = function onViewed() {\n var imageData = _this.imageData;\n var render = Array.isArray(options.title) ? options.title[1] : options.title;\n title.innerHTML = escapeHTMLEntities(isFunction(render) ? render.call(_this, image, imageData) : \"\".concat(alt, \" (\").concat(imageData.naturalWidth, \" \\xD7 \").concat(imageData.naturalHeight, \")\"));\n };\n\n var onLoad;\n addListener(element, EVENT_VIEWED, onViewed, {\n once: true\n });\n this.viewing = {\n abort: function abort() {\n removeListener(element, EVENT_VIEWED, onViewed);\n\n if (image.complete) {\n if (this.imageRendering) {\n this.imageRendering.abort();\n } else if (this.imageInitializing) {\n this.imageInitializing.abort();\n }\n } else {\n // Cancel download to save bandwidth.\n image.src = '';\n removeListener(image, EVENT_LOAD, onLoad);\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n }\n }\n }\n };\n\n if (image.complete) {\n this.load();\n } else {\n addListener(image, EVENT_LOAD, onLoad = this.load.bind(this), {\n once: true\n });\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n } // Make the image visible if it fails to load within 1s\n\n\n this.timeout = setTimeout(function () {\n removeClass(image, CLASS_INVISIBLE);\n _this.timeout = false;\n }, 1000);\n }\n\n return this;\n },\n\n /**\n * View the previous image\n * @param {boolean} [loop=false] - Indicate if view the last one\n * when it is the first one at present.\n * @returns {Viewer} this\n */\n prev: function prev() {\n var loop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var index = this.index - 1;\n\n if (index < 0) {\n index = loop ? this.length - 1 : 0;\n }\n\n this.view(index);\n return this;\n },\n\n /**\n * View the next image\n * @param {boolean} [loop=false] - Indicate if view the first one\n * when it is the last one at present.\n * @returns {Viewer} this\n */\n next: function next() {\n var loop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var maxIndex = this.length - 1;\n var index = this.index + 1;\n\n if (index > maxIndex) {\n index = loop ? 0 : maxIndex;\n }\n\n this.view(index);\n return this;\n },\n\n /**\n * Move the image with relative offsets.\n * @param {number} offsetX - The relative offset distance on the x-axis.\n * @param {number} offsetY - The relative offset distance on the y-axis.\n * @returns {Viewer} this\n */\n move: function move(offsetX, offsetY) {\n var imageData = this.imageData;\n this.moveTo(isUndefined(offsetX) ? offsetX : imageData.left + Number(offsetX), isUndefined(offsetY) ? offsetY : imageData.top + Number(offsetY));\n return this;\n },\n\n /**\n * Move the image to an absolute point.\n * @param {number} x - The x-axis coordinate.\n * @param {number} [y=x] - The y-axis coordinate.\n * @returns {Viewer} this\n */\n moveTo: function moveTo(x) {\n var y = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : x;\n var imageData = this.imageData;\n x = Number(x);\n y = Number(y);\n\n if (this.viewed && !this.played && this.options.movable) {\n var changed = false;\n\n if (isNumber(x)) {\n imageData.left = x;\n changed = true;\n }\n\n if (isNumber(y)) {\n imageData.top = y;\n changed = true;\n }\n\n if (changed) {\n this.renderImage();\n }\n }\n\n return this;\n },\n\n /**\n * Zoom the image with a relative ratio.\n * @param {number} ratio - The target ratio.\n * @param {boolean} [hasTooltip=false] - Indicates if it has a tooltip or not.\n * @param {Event} [_originalEvent=null] - The original event if any.\n * @returns {Viewer} this\n */\n zoom: function zoom(ratio) {\n var hasTooltip = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var _originalEvent = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;\n\n var imageData = this.imageData;\n ratio = Number(ratio);\n\n if (ratio < 0) {\n ratio = 1 / (1 - ratio);\n } else {\n ratio = 1 + ratio;\n }\n\n this.zoomTo(imageData.width * ratio / imageData.naturalWidth, hasTooltip, _originalEvent);\n return this;\n },\n\n /**\n * Zoom the image to an absolute ratio.\n * @param {number} ratio - The target ratio.\n * @param {boolean} [hasTooltip=false] - Indicates if it has a tooltip or not.\n * @param {Event} [_originalEvent=null] - The original event if any.\n * @param {Event} [_zoomable=false] - Indicates if the current zoom is available or not.\n * @returns {Viewer} this\n */\n zoomTo: function zoomTo(ratio) {\n var _this2 = this;\n\n var hasTooltip = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var _originalEvent = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;\n\n var _zoomable = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false;\n\n var element = this.element,\n options = this.options,\n pointers = this.pointers,\n imageData = this.imageData;\n var width = imageData.width,\n height = imageData.height,\n left = imageData.left,\n top = imageData.top,\n naturalWidth = imageData.naturalWidth,\n naturalHeight = imageData.naturalHeight;\n ratio = Math.max(0, ratio);\n\n if (isNumber(ratio) && this.viewed && !this.played && (_zoomable || options.zoomable)) {\n if (!_zoomable) {\n var minZoomRatio = Math.max(0.01, options.minZoomRatio);\n var maxZoomRatio = Math.min(100, options.maxZoomRatio);\n ratio = Math.min(Math.max(ratio, minZoomRatio), maxZoomRatio);\n }\n\n if (_originalEvent && ratio > 0.95 && ratio < 1.05) {\n ratio = 1;\n }\n\n var newWidth = naturalWidth * ratio;\n var newHeight = naturalHeight * ratio;\n var offsetWidth = newWidth - width;\n var offsetHeight = newHeight - height;\n var oldRatio = width / naturalWidth;\n\n if (isFunction(options.zoom)) {\n addListener(element, EVENT_ZOOM, options.zoom, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_ZOOM, {\n ratio: ratio,\n oldRatio: oldRatio,\n originalEvent: _originalEvent\n }) === false) {\n return this;\n }\n\n this.zooming = true;\n\n if (_originalEvent) {\n var offset = getOffset(this.viewer);\n var center = pointers && Object.keys(pointers).length ? getPointersCenter(pointers) : {\n pageX: _originalEvent.pageX,\n pageY: _originalEvent.pageY\n }; // Zoom from the triggering point of the event\n\n imageData.left -= offsetWidth * ((center.pageX - offset.left - left) / width);\n imageData.top -= offsetHeight * ((center.pageY - offset.top - top) / height);\n } else {\n // Zoom from the center of the image\n imageData.left -= offsetWidth / 2;\n imageData.top -= offsetHeight / 2;\n }\n\n imageData.width = newWidth;\n imageData.height = newHeight;\n imageData.ratio = ratio;\n this.renderImage(function () {\n _this2.zooming = false;\n\n if (isFunction(options.zoomed)) {\n addListener(element, EVENT_ZOOMED, options.zoomed, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_ZOOMED, {\n ratio: ratio,\n oldRatio: oldRatio,\n originalEvent: _originalEvent\n });\n });\n\n if (hasTooltip) {\n this.tooltip();\n }\n }\n\n return this;\n },\n\n /**\n * Rotate the image with a relative degree.\n * @param {number} degree - The rotate degree.\n * @returns {Viewer} this\n */\n rotate: function rotate(degree) {\n this.rotateTo((this.imageData.rotate || 0) + Number(degree));\n return this;\n },\n\n /**\n * Rotate the image to an absolute degree.\n * @param {number} degree - The rotate degree.\n * @returns {Viewer} this\n */\n rotateTo: function rotateTo(degree) {\n var imageData = this.imageData;\n degree = Number(degree);\n\n if (isNumber(degree) && this.viewed && !this.played && this.options.rotatable) {\n imageData.rotate = degree;\n this.renderImage();\n }\n\n return this;\n },\n\n /**\n * Scale the image on the x-axis.\n * @param {number} scaleX - The scale ratio on the x-axis.\n * @returns {Viewer} this\n */\n scaleX: function scaleX(_scaleX) {\n this.scale(_scaleX, this.imageData.scaleY);\n return this;\n },\n\n /**\n * Scale the image on the y-axis.\n * @param {number} scaleY - The scale ratio on the y-axis.\n * @returns {Viewer} this\n */\n scaleY: function scaleY(_scaleY) {\n this.scale(this.imageData.scaleX, _scaleY);\n return this;\n },\n\n /**\n * Scale the image.\n * @param {number} scaleX - The scale ratio on the x-axis.\n * @param {number} [scaleY=scaleX] - The scale ratio on the y-axis.\n * @returns {Viewer} this\n */\n scale: function scale(scaleX) {\n var scaleY = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : scaleX;\n var imageData = this.imageData;\n scaleX = Number(scaleX);\n scaleY = Number(scaleY);\n\n if (this.viewed && !this.played && this.options.scalable) {\n var changed = false;\n\n if (isNumber(scaleX)) {\n imageData.scaleX = scaleX;\n changed = true;\n }\n\n if (isNumber(scaleY)) {\n imageData.scaleY = scaleY;\n changed = true;\n }\n\n if (changed) {\n this.renderImage();\n }\n }\n\n return this;\n },\n\n /**\n * Play the images\n * @param {boolean} [fullscreen=false] - Indicate if request fullscreen or not.\n * @returns {Viewer} this\n */\n play: function play() {\n var _this3 = this;\n\n var fullscreen = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n\n if (!this.isShown || this.played) {\n return this;\n }\n\n var options = this.options,\n player = this.player;\n var onLoad = this.loadImage.bind(this);\n var list = [];\n var total = 0;\n var index = 0;\n this.played = true;\n this.onLoadWhenPlay = onLoad;\n\n if (fullscreen) {\n this.requestFullscreen();\n }\n\n addClass(player, CLASS_SHOW);\n forEach(this.items, function (item, i) {\n var img = item.querySelector('img');\n var image = document.createElement('img');\n image.src = getData(img, 'originalUrl');\n image.alt = escapeHTMLEntities(img.getAttribute('alt'));\n total += 1;\n addClass(image, CLASS_FADE);\n toggleClass(image, CLASS_TRANSITION, options.transition);\n\n if (hasClass(item, CLASS_ACTIVE)) {\n addClass(image, CLASS_IN);\n index = i;\n }\n\n list.push(image);\n addListener(image, EVENT_LOAD, onLoad, {\n once: true\n });\n player.appendChild(image);\n });\n\n if (isNumber(options.interval) && options.interval > 0) {\n var play = function play() {\n _this3.playing = setTimeout(function () {\n removeClass(list[index], CLASS_IN);\n index += 1;\n index = index < total ? index : 0;\n addClass(list[index], CLASS_IN);\n play();\n }, options.interval);\n };\n\n if (total > 1) {\n play();\n }\n }\n\n return this;\n },\n // Stop play\n stop: function stop() {\n var _this4 = this;\n\n if (!this.played) {\n return this;\n }\n\n var player = this.player;\n this.played = false;\n clearTimeout(this.playing);\n forEach(player.getElementsByTagName('img'), function (image) {\n removeListener(image, EVENT_LOAD, _this4.onLoadWhenPlay);\n });\n removeClass(player, CLASS_SHOW);\n player.innerHTML = '';\n this.exitFullscreen();\n return this;\n },\n // Enter modal mode (only available in inline mode)\n full: function full() {\n var _this5 = this;\n\n var options = this.options,\n viewer = this.viewer,\n image = this.image,\n list = this.list;\n\n if (!this.isShown || this.played || this.fulled || !options.inline) {\n return this;\n }\n\n this.fulled = true;\n this.open();\n addClass(this.button, CLASS_FULLSCREEN_EXIT);\n\n if (options.transition) {\n removeClass(list, CLASS_TRANSITION);\n\n if (this.viewed) {\n removeClass(image, CLASS_TRANSITION);\n }\n }\n\n addClass(viewer, CLASS_FIXED);\n viewer.setAttribute('style', '');\n setStyle(viewer, {\n zIndex: options.zIndex\n });\n this.initContainer();\n this.viewerData = assign({}, this.containerData);\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this5.renderImage(function () {\n if (options.transition) {\n setTimeout(function () {\n addClass(image, CLASS_TRANSITION);\n addClass(list, CLASS_TRANSITION);\n }, 0);\n }\n });\n });\n }\n\n return this;\n },\n // Exit modal mode (only available in inline mode)\n exit: function exit() {\n var _this6 = this;\n\n var options = this.options,\n viewer = this.viewer,\n image = this.image,\n list = this.list;\n\n if (!this.isShown || this.played || !this.fulled || !options.inline) {\n return this;\n }\n\n this.fulled = false;\n this.close();\n removeClass(this.button, CLASS_FULLSCREEN_EXIT);\n\n if (options.transition) {\n removeClass(list, CLASS_TRANSITION);\n\n if (this.viewed) {\n removeClass(image, CLASS_TRANSITION);\n }\n }\n\n removeClass(viewer, CLASS_FIXED);\n setStyle(viewer, {\n zIndex: options.zIndexInline\n });\n this.viewerData = assign({}, this.parentData);\n this.renderViewer();\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this6.renderImage(function () {\n if (options.transition) {\n setTimeout(function () {\n addClass(image, CLASS_TRANSITION);\n addClass(list, CLASS_TRANSITION);\n }, 0);\n }\n });\n });\n }\n\n return this;\n },\n // Show the current ratio of the image with percentage\n tooltip: function tooltip() {\n var _this7 = this;\n\n var options = this.options,\n tooltipBox = this.tooltipBox,\n imageData = this.imageData;\n\n if (!this.viewed || this.played || !options.tooltip) {\n return this;\n }\n\n tooltipBox.textContent = \"\".concat(Math.round(imageData.ratio * 100), \"%\");\n\n if (!this.tooltipping) {\n if (options.transition) {\n if (this.fading) {\n dispatchEvent(tooltipBox, EVENT_TRANSITION_END);\n }\n\n addClass(tooltipBox, CLASS_SHOW);\n addClass(tooltipBox, CLASS_FADE);\n addClass(tooltipBox, CLASS_TRANSITION); // Force reflow to enable CSS3 transition\n // eslint-disable-next-line\n\n tooltipBox.offsetWidth;\n addClass(tooltipBox, CLASS_IN);\n } else {\n addClass(tooltipBox, CLASS_SHOW);\n }\n } else {\n clearTimeout(this.tooltipping);\n }\n\n this.tooltipping = setTimeout(function () {\n if (options.transition) {\n addListener(tooltipBox, EVENT_TRANSITION_END, function () {\n removeClass(tooltipBox, CLASS_SHOW);\n removeClass(tooltipBox, CLASS_FADE);\n removeClass(tooltipBox, CLASS_TRANSITION);\n _this7.fading = false;\n }, {\n once: true\n });\n removeClass(tooltipBox, CLASS_IN);\n _this7.fading = true;\n } else {\n removeClass(tooltipBox, CLASS_SHOW);\n }\n\n _this7.tooltipping = false;\n }, 1000);\n return this;\n },\n // Toggle the image size between its natural size and initial size\n toggle: function toggle() {\n if (this.imageData.ratio === 1) {\n this.zoomTo(this.initialImageData.ratio, true);\n } else {\n this.zoomTo(1, true);\n }\n\n return this;\n },\n // Reset the image to its initial state\n reset: function reset() {\n if (this.viewed && !this.played) {\n this.imageData = assign({}, this.initialImageData);\n this.renderImage();\n }\n\n return this;\n },\n // Update viewer when images changed\n update: function update() {\n var element = this.element,\n options = this.options,\n isImg = this.isImg; // Destroy viewer if the target image was deleted\n\n if (isImg && !element.parentNode) {\n return this.destroy();\n }\n\n var images = [];\n forEach(isImg ? [element] : element.querySelectorAll('img'), function (image) {\n if (options.filter) {\n if (options.filter(image)) {\n images.push(image);\n }\n } else {\n images.push(image);\n }\n });\n\n if (!images.length) {\n return this;\n }\n\n this.images = images;\n this.length = images.length;\n\n if (this.ready) {\n var indexes = [];\n forEach(this.items, function (item, i) {\n var img = item.querySelector('img');\n var image = images[i];\n\n if (image) {\n if (image.src !== img.src) {\n indexes.push(i);\n }\n } else {\n indexes.push(i);\n }\n });\n setStyle(this.list, {\n width: 'auto'\n });\n this.initList();\n\n if (this.isShown) {\n if (this.length) {\n if (this.viewed) {\n var index = indexes.indexOf(this.index);\n\n if (index >= 0) {\n this.viewed = false;\n this.view(Math.max(this.index - (index + 1), 0));\n } else {\n addClass(this.items[this.index], CLASS_ACTIVE);\n }\n }\n } else {\n this.image = null;\n this.viewed = false;\n this.index = 0;\n this.imageData = {};\n this.canvas.innerHTML = '';\n this.title.innerHTML = '';\n }\n }\n } else {\n this.build();\n }\n\n return this;\n },\n // Destroy the viewer\n destroy: function destroy() {\n var element = this.element,\n options = this.options;\n\n if (!element[NAMESPACE]) {\n return this;\n }\n\n this.destroyed = true;\n\n if (this.ready) {\n if (this.played) {\n this.stop();\n }\n\n if (options.inline) {\n if (this.fulled) {\n this.exit();\n }\n\n this.unbind();\n } else if (this.isShown) {\n if (this.viewing) {\n if (this.imageRendering) {\n this.imageRendering.abort();\n } else if (this.imageInitializing) {\n this.imageInitializing.abort();\n }\n }\n\n if (this.hiding) {\n this.transitioning.abort();\n }\n\n this.hidden();\n } else if (this.showing) {\n this.transitioning.abort();\n this.hidden();\n }\n\n this.ready = false;\n this.viewer.parentNode.removeChild(this.viewer);\n } else if (options.inline) {\n if (this.delaying) {\n this.delaying.abort();\n } else if (this.initializing) {\n this.initializing.abort();\n }\n }\n\n if (!options.inline) {\n removeListener(element, EVENT_CLICK, this.onStart);\n }\n\n element[NAMESPACE] = undefined;\n return this;\n }\n };\n\n var others = {\n open: function open() {\n var body = this.body;\n addClass(body, CLASS_OPEN);\n body.style.paddingRight = \"\".concat(this.scrollbarWidth + (parseFloat(this.initialBodyPaddingRight) || 0), \"px\");\n },\n close: function close() {\n var body = this.body;\n removeClass(body, CLASS_OPEN);\n body.style.paddingRight = this.initialBodyPaddingRight;\n },\n shown: function shown() {\n var element = this.element,\n options = this.options;\n this.fulled = true;\n this.isShown = true;\n this.render();\n this.bind();\n this.showing = false;\n\n if (isFunction(options.shown)) {\n addListener(element, EVENT_SHOWN, options.shown, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_SHOWN) === false) {\n return;\n }\n\n if (this.ready && this.isShown && !this.hiding) {\n this.view(this.index);\n }\n },\n hidden: function hidden() {\n var element = this.element,\n options = this.options;\n this.fulled = false;\n this.viewed = false;\n this.isShown = false;\n this.close();\n this.unbind();\n addClass(this.viewer, CLASS_HIDE);\n this.resetList();\n this.resetImage();\n this.hiding = false;\n\n if (!this.destroyed) {\n if (isFunction(options.hidden)) {\n addListener(element, EVENT_HIDDEN, options.hidden, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_HIDDEN);\n }\n },\n requestFullscreen: function requestFullscreen() {\n var document = this.element.ownerDocument;\n\n if (this.fulled && !(document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n var documentElement = document.documentElement; // Element.requestFullscreen()\n\n if (documentElement.requestFullscreen) {\n documentElement.requestFullscreen();\n } else if (documentElement.webkitRequestFullscreen) {\n documentElement.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);\n } else if (documentElement.mozRequestFullScreen) {\n documentElement.mozRequestFullScreen();\n } else if (documentElement.msRequestFullscreen) {\n documentElement.msRequestFullscreen();\n }\n }\n },\n exitFullscreen: function exitFullscreen() {\n var document = this.element.ownerDocument;\n\n if (this.fulled && (document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n // Document.exitFullscreen()\n if (document.exitFullscreen) {\n document.exitFullscreen();\n } else if (document.webkitExitFullscreen) {\n document.webkitExitFullscreen();\n } else if (document.mozCancelFullScreen) {\n document.mozCancelFullScreen();\n } else if (document.msExitFullscreen) {\n document.msExitFullscreen();\n }\n }\n },\n change: function change(event) {\n var options = this.options,\n pointers = this.pointers;\n var pointer = pointers[Object.keys(pointers)[0]];\n var offsetX = pointer.endX - pointer.startX;\n var offsetY = pointer.endY - pointer.startY;\n\n switch (this.action) {\n // Move the current image\n case ACTION_MOVE:\n this.move(offsetX, offsetY);\n break;\n // Zoom the current image\n\n case ACTION_ZOOM:\n this.zoom(getMaxZoomRatio(pointers), false, event);\n break;\n\n case ACTION_SWITCH:\n {\n this.action = 'switched';\n var absoluteOffsetX = Math.abs(offsetX);\n\n if (absoluteOffsetX > 1 && absoluteOffsetX > Math.abs(offsetY)) {\n // Empty `pointers` as `touchend` event will not be fired after swiped in iOS browsers.\n this.pointers = {};\n\n if (offsetX > 1) {\n this.prev(options.loop);\n } else if (offsetX < -1) {\n this.next(options.loop);\n }\n }\n\n break;\n }\n\n default:\n } // Override\n\n\n forEach(pointers, function (p) {\n p.startX = p.endX;\n p.startY = p.endY;\n });\n },\n isSwitchable: function isSwitchable() {\n var imageData = this.imageData,\n viewerData = this.viewerData;\n return this.length > 1 && imageData.left >= 0 && imageData.top >= 0 && imageData.width <= viewerData.width && imageData.height <= viewerData.height;\n }\n };\n\n var AnotherViewer = WINDOW.Viewer;\n\n var Viewer =\n /*#__PURE__*/\n function () {\n /**\n * Create a new Viewer.\n * @param {Element} element - The target element for viewing.\n * @param {Object} [options={}] - The configuration options.\n */\n function Viewer(element) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n\n _classCallCheck(this, Viewer);\n\n if (!element || element.nodeType !== 1) {\n throw new Error('The first argument is required and must be an element.');\n }\n\n this.element = element;\n this.options = assign({}, DEFAULTS, isPlainObject(options) && options);\n this.action = false;\n this.fading = false;\n this.fulled = false;\n this.hiding = false;\n this.imageClicked = false;\n this.imageData = {};\n this.index = this.options.initialViewIndex;\n this.isImg = false;\n this.isShown = false;\n this.length = 0;\n this.played = false;\n this.playing = false;\n this.pointers = {};\n this.ready = false;\n this.showing = false;\n this.timeout = false;\n this.tooltipping = false;\n this.viewed = false;\n this.viewing = false;\n this.wheeling = false;\n this.zooming = false;\n this.init();\n }\n\n _createClass(Viewer, [{\n key: \"init\",\n value: function init() {\n var _this = this;\n\n var element = this.element,\n options = this.options;\n\n if (element[NAMESPACE]) {\n return;\n }\n\n element[NAMESPACE] = this;\n var isImg = element.tagName.toLowerCase() === 'img';\n var images = [];\n forEach(isImg ? [element] : element.querySelectorAll('img'), function (image) {\n if (isFunction(options.filter)) {\n if (options.filter.call(_this, image)) {\n images.push(image);\n }\n } else {\n images.push(image);\n }\n });\n this.isImg = isImg;\n this.length = images.length;\n this.images = images;\n var ownerDocument = element.ownerDocument;\n var body = ownerDocument.body || ownerDocument.documentElement;\n this.body = body;\n this.scrollbarWidth = window.innerWidth - ownerDocument.documentElement.clientWidth;\n this.initialBodyPaddingRight = window.getComputedStyle(body).paddingRight; // Override `transition` option if it is not supported\n\n if (isUndefined(document.createElement(NAMESPACE).style.transition)) {\n options.transition = false;\n }\n\n if (options.inline) {\n var count = 0;\n\n var progress = function progress() {\n count += 1;\n\n if (count === _this.length) {\n var timeout;\n _this.initializing = false;\n _this.delaying = {\n abort: function abort() {\n clearTimeout(timeout);\n }\n }; // build asynchronously to keep `this.viewer` is accessible in `ready` event handler.\n\n timeout = setTimeout(function () {\n _this.delaying = false;\n\n _this.build();\n }, 0);\n }\n };\n\n this.initializing = {\n abort: function abort() {\n forEach(images, function (image) {\n if (!image.complete) {\n removeListener(image, EVENT_LOAD, progress);\n }\n });\n }\n };\n forEach(images, function (image) {\n if (image.complete) {\n progress();\n } else {\n addListener(image, EVENT_LOAD, progress, {\n once: true\n });\n }\n });\n } else {\n addListener(element, EVENT_CLICK, this.onStart = function (_ref) {\n var target = _ref.target;\n\n if (target.tagName.toLowerCase() === 'img' && (!isFunction(options.filter) || options.filter.call(_this, target))) {\n _this.view(_this.images.indexOf(target));\n }\n });\n }\n }\n }, {\n key: \"build\",\n value: function build() {\n if (this.ready) {\n return;\n }\n\n var element = this.element,\n options = this.options;\n var parent = element.parentNode;\n var template = document.createElement('div');\n template.innerHTML = TEMPLATE;\n var viewer = template.querySelector(\".\".concat(NAMESPACE, \"-container\"));\n var title = viewer.querySelector(\".\".concat(NAMESPACE, \"-title\"));\n var toolbar = viewer.querySelector(\".\".concat(NAMESPACE, \"-toolbar\"));\n var navbar = viewer.querySelector(\".\".concat(NAMESPACE, \"-navbar\"));\n var button = viewer.querySelector(\".\".concat(NAMESPACE, \"-button\"));\n var canvas = viewer.querySelector(\".\".concat(NAMESPACE, \"-canvas\"));\n this.parent = parent;\n this.viewer = viewer;\n this.title = title;\n this.toolbar = toolbar;\n this.navbar = navbar;\n this.button = button;\n this.canvas = canvas;\n this.footer = viewer.querySelector(\".\".concat(NAMESPACE, \"-footer\"));\n this.tooltipBox = viewer.querySelector(\".\".concat(NAMESPACE, \"-tooltip\"));\n this.player = viewer.querySelector(\".\".concat(NAMESPACE, \"-player\"));\n this.list = viewer.querySelector(\".\".concat(NAMESPACE, \"-list\"));\n addClass(title, !options.title ? CLASS_HIDE : getResponsiveClass(Array.isArray(options.title) ? options.title[0] : options.title));\n addClass(navbar, !options.navbar ? CLASS_HIDE : getResponsiveClass(options.navbar));\n toggleClass(button, CLASS_HIDE, !options.button);\n\n if (options.backdrop) {\n addClass(viewer, \"\".concat(NAMESPACE, \"-backdrop\"));\n\n if (!options.inline && options.backdrop !== 'static') {\n setData(canvas, DATA_ACTION, 'hide');\n }\n }\n\n if (isString(options.className) && options.className) {\n // In case there are multiple class names\n options.className.split(REGEXP_SPACES).forEach(function (className) {\n addClass(viewer, className);\n });\n }\n\n if (options.toolbar) {\n var list = document.createElement('ul');\n var custom = isPlainObject(options.toolbar);\n var zoomButtons = BUTTONS.slice(0, 3);\n var rotateButtons = BUTTONS.slice(7, 9);\n var scaleButtons = BUTTONS.slice(9);\n\n if (!custom) {\n addClass(toolbar, getResponsiveClass(options.toolbar));\n }\n\n forEach(custom ? options.toolbar : BUTTONS, function (value, index) {\n var deep = custom && isPlainObject(value);\n var name = custom ? hyphenate(index) : value;\n var show = deep && !isUndefined(value.show) ? value.show : value;\n\n if (!show || !options.zoomable && zoomButtons.indexOf(name) !== -1 || !options.rotatable && rotateButtons.indexOf(name) !== -1 || !options.scalable && scaleButtons.indexOf(name) !== -1) {\n return;\n }\n\n var size = deep && !isUndefined(value.size) ? value.size : value;\n var click = deep && !isUndefined(value.click) ? value.click : value;\n var item = document.createElement('li');\n item.setAttribute('role', 'button');\n addClass(item, \"\".concat(NAMESPACE, \"-\").concat(name));\n\n if (!isFunction(click)) {\n setData(item, DATA_ACTION, name);\n }\n\n if (isNumber(show)) {\n addClass(item, getResponsiveClass(show));\n }\n\n if (['small', 'large'].indexOf(size) !== -1) {\n addClass(item, \"\".concat(NAMESPACE, \"-\").concat(size));\n } else if (name === 'play') {\n addClass(item, \"\".concat(NAMESPACE, \"-large\"));\n }\n\n if (isFunction(click)) {\n addListener(item, EVENT_CLICK, click);\n }\n\n list.appendChild(item);\n });\n toolbar.appendChild(list);\n } else {\n addClass(toolbar, CLASS_HIDE);\n }\n\n if (!options.rotatable) {\n var rotates = toolbar.querySelectorAll('li[class*=\"rotate\"]');\n addClass(rotates, CLASS_INVISIBLE);\n forEach(rotates, function (rotate) {\n toolbar.appendChild(rotate);\n });\n }\n\n if (options.inline) {\n addClass(button, CLASS_FULLSCREEN);\n setStyle(viewer, {\n zIndex: options.zIndexInline\n });\n\n if (window.getComputedStyle(parent).position === 'static') {\n setStyle(parent, {\n position: 'relative'\n });\n }\n\n parent.insertBefore(viewer, element.nextSibling);\n } else {\n addClass(button, CLASS_CLOSE);\n addClass(viewer, CLASS_FIXED);\n addClass(viewer, CLASS_FADE);\n addClass(viewer, CLASS_HIDE);\n setStyle(viewer, {\n zIndex: options.zIndex\n });\n var container = options.container;\n\n if (isString(container)) {\n container = element.ownerDocument.querySelector(container);\n }\n\n if (!container) {\n container = this.body;\n }\n\n container.appendChild(viewer);\n }\n\n if (options.inline) {\n this.render();\n this.bind();\n this.isShown = true;\n }\n\n this.ready = true;\n\n if (isFunction(options.ready)) {\n addListener(element, EVENT_READY, options.ready, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_READY) === false) {\n this.ready = false;\n return;\n }\n\n if (this.ready && options.inline) {\n this.view(this.index);\n }\n }\n /**\n * Get the no conflict viewer class.\n * @returns {Viewer} The viewer class.\n */\n\n }], [{\n key: \"noConflict\",\n value: function noConflict() {\n window.Viewer = AnotherViewer;\n return Viewer;\n }\n /**\n * Change the default options.\n * @param {Object} options - The new default options.\n */\n\n }, {\n key: \"setDefaults\",\n value: function setDefaults(options) {\n assign(DEFAULTS, isPlainObject(options) && options);\n }\n }]);\n\n return Viewer;\n }();\n\n assign(Viewer.prototype, render, events, handlers, methods, others);\n\n return Viewer;\n\n}));\n\n\n/***/ }),\n\n/***/ \"It76\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BAlert; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_config__ = __webpack_require__(\"UE/W\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_dom__ = __webpack_require__(\"EWS6\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__utils_bv_transition__ = __webpack_require__(\"2fLV\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__mixins_normalize_slot__ = __webpack_require__(\"BnsU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__button_button_close__ = __webpack_require__(\"W5/r\");\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\n\n\n\nvar NAME = 'BAlert'; // Convert `show` value to a number\n\nvar parseCountDown = function parseCountDown(show) {\n if (show === '' || __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_inspect__[\"l\" /* isBoolean */])(show)) {\n return 0;\n }\n\n show = parseInt(show, 10);\n return show > 0 ? show : 0;\n}; // Convert `show` value to a boolean\n\n\nvar parseShow = function parseShow(show) {\n if (show === '' || show === true) {\n return true;\n }\n\n if (parseInt(show, 10) < 1) {\n // Boolean will always return false for the above comparison\n return false;\n }\n\n return Boolean(show);\n}; // Is a value number like (i.e. a number or a number as string)\n\n\nvar isNumericLike = function isNumericLike(value) {\n return !isNaN(parseInt(value, 10));\n}; // @vue/component\n\n\nvar BAlert =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: NAME,\n mixins: [__WEBPACK_IMPORTED_MODULE_5__mixins_normalize_slot__[\"a\" /* default */]],\n model: {\n prop: 'show',\n event: 'input'\n },\n props: {\n variant: {\n type: String,\n default: function _default() {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'variant');\n }\n },\n dismissible: {\n type: Boolean,\n default: false\n },\n dismissLabel: {\n type: String,\n default: function _default() {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'dismissLabel');\n }\n },\n show: {\n type: [Boolean, Number, String],\n default: false\n },\n fade: {\n type: Boolean,\n default: false\n }\n },\n data: function data() {\n return {\n countDownTimerId: null,\n countDown: 0,\n // If initially shown, we need to set these for SSR\n localShow: parseShow(this.show)\n };\n },\n watch: {\n show: function show(newVal) {\n this.countDown = parseCountDown(newVal);\n this.localShow = parseShow(newVal);\n },\n countDown: function countDown(newVal) {\n var _this = this;\n\n this.clearTimer();\n\n if (isNumericLike(this.show)) {\n // Ignore if this.show transitions to a boolean value.\n this.$emit('dismiss-count-down', newVal);\n\n if (this.show !== newVal) {\n // Update the v-model if needed\n this.$emit('input', newVal);\n }\n\n if (newVal > 0) {\n this.localShow = true;\n this.countDownTimerId = setTimeout(function () {\n _this.countDown--;\n }, 1000);\n } else {\n // Slightly delay the hide to allow any UI updates\n this.$nextTick(function () {\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_dom__[\"w\" /* requestAF */])(function () {\n _this.localShow = false;\n });\n });\n }\n }\n },\n localShow: function localShow(newVal) {\n if (!newVal && (this.dismissible || isNumericLike(this.show))) {\n // Only emit dismissed events for dismissible or auto dismissing alerts\n this.$emit('dismissed');\n }\n\n if (!isNumericLike(this.show) && this.show !== newVal) {\n // Only emit booleans if we weren't passed a number via `this.show`\n this.$emit('input', newVal);\n }\n }\n },\n created: function created() {\n this.countDown = parseCountDown(this.show);\n this.localShow = parseShow(this.show);\n },\n mounted: function mounted() {\n this.countDown = parseCountDown(this.show);\n this.localShow = parseShow(this.show);\n },\n beforeDestroy: function beforeDestroy() {\n this.clearTimer();\n },\n methods: {\n dismiss: function dismiss() {\n this.clearTimer();\n this.countDown = 0;\n this.localShow = false;\n },\n clearTimer: function clearTimer() {\n if (this.countDownTimerId) {\n clearInterval(this.countDownTimerId);\n this.countDownTimerId = null;\n }\n }\n },\n render: function render(h) {\n var $alert; // undefined\n\n if (this.localShow) {\n var $dismissBtn = h();\n\n if (this.dismissible) {\n // Add dismiss button\n $dismissBtn = h(__WEBPACK_IMPORTED_MODULE_6__button_button_close__[\"a\" /* BButtonClose */], {\n attrs: {\n 'aria-label': this.dismissLabel\n },\n on: {\n click: this.dismiss\n }\n }, [this.normalizeSlot('dismiss')]);\n }\n\n $alert = h('div', {\n key: this._uid,\n staticClass: 'alert',\n class: _defineProperty({\n 'alert-dismissible': this.dismissible\n }, \"alert-\".concat(this.variant), this.variant),\n attrs: {\n role: 'alert',\n 'aria-live': 'polite',\n 'aria-atomic': true\n }\n }, [$dismissBtn, this.normalizeSlot('default')]);\n $alert = [$alert];\n }\n\n return h(__WEBPACK_IMPORTED_MODULE_4__utils_bv_transition__[\"b\" /* default */], {\n props: {\n noFade: !this.fade\n }\n }, $alert);\n }\n});\n\n/***/ }),\n\n/***/ \"IwQL\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return DropdownPlugin; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__dropdown__ = __webpack_require__(\"yE5P\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__dropdown_item__ = __webpack_require__(\"B7Cu\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__dropdown_item_button__ = __webpack_require__(\"4HLh\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__dropdown_header__ = __webpack_require__(\"oD3s\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__dropdown_divider__ = __webpack_require__(\"v1u8\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__dropdown_form__ = __webpack_require__(\"Jfy9\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__dropdown_text__ = __webpack_require__(\"/TCd\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__dropdown_group__ = __webpack_require__(\"8bTy\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_plugins__ = __webpack_require__(\"20SD\");\n/* unused harmony reexport BDropdown */\n/* unused harmony reexport BDropdownItem */\n/* unused harmony reexport BDropdownItemButton */\n/* unused harmony reexport BDropdownHeader */\n/* unused harmony reexport BDropdownDivider */\n/* unused harmony reexport BDropdownForm */\n/* unused harmony reexport BDropdownText */\n/* unused harmony reexport BDropdownGroup */\n\n\n\n\n\n\n\n\n\nvar DropdownPlugin =\n/*#__PURE__*/\n__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_8__utils_plugins__[\"b\" /* pluginFactory */])({\n components: {\n BDropdown: __WEBPACK_IMPORTED_MODULE_0__dropdown__[\"a\" /* BDropdown */],\n BDd: __WEBPACK_IMPORTED_MODULE_0__dropdown__[\"a\" /* BDropdown */],\n BDropdownItem: __WEBPACK_IMPORTED_MODULE_1__dropdown_item__[\"a\" /* BDropdownItem */],\n BDdItem: __WEBPACK_IMPORTED_MODULE_1__dropdown_item__[\"a\" /* BDropdownItem */],\n BDropdownItemButton: __WEBPACK_IMPORTED_MODULE_2__dropdown_item_button__[\"a\" /* BDropdownItemButton */],\n BDropdownItemBtn: __WEBPACK_IMPORTED_MODULE_2__dropdown_item_button__[\"a\" /* BDropdownItemButton */],\n BDdItemButton: __WEBPACK_IMPORTED_MODULE_2__dropdown_item_button__[\"a\" /* BDropdownItemButton */],\n BDdItemBtn: __WEBPACK_IMPORTED_MODULE_2__dropdown_item_button__[\"a\" /* BDropdownItemButton */],\n BDropdownHeader: __WEBPACK_IMPORTED_MODULE_3__dropdown_header__[\"a\" /* BDropdownHeader */],\n BDdHeader: __WEBPACK_IMPORTED_MODULE_3__dropdown_header__[\"a\" /* BDropdownHeader */],\n BDropdownDivider: __WEBPACK_IMPORTED_MODULE_4__dropdown_divider__[\"a\" /* BDropdownDivider */],\n BDdDivider: __WEBPACK_IMPORTED_MODULE_4__dropdown_divider__[\"a\" /* BDropdownDivider */],\n BDropdownForm: __WEBPACK_IMPORTED_MODULE_5__dropdown_form__[\"a\" /* BDropdownForm */],\n BDdForm: __WEBPACK_IMPORTED_MODULE_5__dropdown_form__[\"a\" /* BDropdownForm */],\n BDropdownText: __WEBPACK_IMPORTED_MODULE_6__dropdown_text__[\"a\" /* BDropdownText */],\n BDdText: __WEBPACK_IMPORTED_MODULE_6__dropdown_text__[\"a\" /* BDropdownText */],\n BDropdownGroup: __WEBPACK_IMPORTED_MODULE_7__dropdown_group__[\"a\" /* BDropdownGroup */],\n BDdGroup: __WEBPACK_IMPORTED_MODULE_7__dropdown_group__[\"a\" /* BDropdownGroup */]\n }\n});\n\n\n/***/ }),\n\n/***/ \"JCoq\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__sanitize_row__ = __webpack_require__(\"8hL2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__stringify_object_values__ = __webpack_require__(\"6a9z\");\n\n\n // Stringifies the values of a record, ignoring any special top level field keys\n// TODO: Add option to stringify `scopedSlot` items\n\nvar stringifyRecordValues = function stringifyRecordValues(row, ignoreFields, includeFields, fieldsObj) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_inspect__[\"c\" /* isObject */])(row) ? __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__stringify_object_values__[\"a\" /* default */])(__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__sanitize_row__[\"a\" /* default */])(row, ignoreFields, includeFields, fieldsObj)) : '';\n};\n\n/* harmony default export */ __webpack_exports__[\"a\"] = (stringifyRecordValues);\n\n/***/ }),\n\n/***/ \"JKMF\":\n/***/ (function(module, exports, __webpack_require__) {\n\n/**\n * Lo-Dash 2.3.0 (Custom Build) \n * Build: `lodash modularize modern exports=\"npm\" -o ./npm/`\n * Copyright 2012-2013 The Dojo Foundation \n * Based on Underscore.js 1.5.2 \n * Copyright 2009-2013 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n * Available under MIT license \n */\nvar bind = __webpack_require__(\"QZRH\"),\n identity = __webpack_require__(\"BKC+\"),\n setBindData = __webpack_require__(\"PlkO\"),\n support = __webpack_require__(\"MFKq\");\n\n/** Used to detected named functions */\nvar reFuncName = /^\\s*function[ \\n\\r\\t]+\\w/;\n\n/** Used to detect functions containing a `this` reference */\nvar reThis = /\\bthis\\b/;\n\n/** Native method shortcuts */\nvar fnToString = Function.prototype.toString;\n\n/**\n * The base implementation of `_.createCallback` without support for creating\n * \"_.pluck\" or \"_.where\" style callbacks.\n *\n * @private\n * @param {*} [func=identity] The value to convert to a callback.\n * @param {*} [thisArg] The `this` binding of the created callback.\n * @param {number} [argCount] The number of arguments the callback accepts.\n * @returns {Function} Returns a callback function.\n */\nfunction baseCreateCallback(func, thisArg, argCount) {\n if (typeof func != 'function') {\n return identity;\n }\n // exit early for no `thisArg` or already bound by `Function#bind`\n if (typeof thisArg == 'undefined' || !('prototype' in func)) {\n return func;\n }\n var bindData = func.__bindData__;\n if (typeof bindData == 'undefined') {\n if (support.funcNames) {\n bindData = !func.name;\n }\n bindData = bindData || !support.funcDecomp;\n if (!bindData) {\n var source = fnToString.call(func);\n if (!support.funcNames) {\n bindData = !reFuncName.test(source);\n }\n if (!bindData) {\n // checks if `func` references the `this` keyword and stores the result\n bindData = reThis.test(source);\n setBindData(func, bindData);\n }\n }\n }\n // exit early if there are no `this` references or `func` is bound\n if (bindData === false || (bindData !== true && bindData[1] & 1)) {\n return func;\n }\n switch (argCount) {\n case 1: return function(value) {\n return func.call(thisArg, value);\n };\n case 2: return function(a, b) {\n return func.call(thisArg, a, b);\n };\n case 3: return function(value, index, collection) {\n return func.call(thisArg, value, index, collection);\n };\n case 4: return function(accumulator, value, index, collection) {\n return func.call(thisArg, accumulator, value, index, collection);\n };\n }\n return bind(func, thisArg);\n}\n\nmodule.exports = baseCreateCallback;\n\n\n/***/ }),\n\n/***/ \"JP+z\":\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\n\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n/***/ }),\n\n/***/ \"Jfy9\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BDropdownForm; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__form_form__ = __webpack_require__(\"Mu2P\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\nvar BDropdownForm =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BDropdownForm',\n functional: true,\n props: _objectSpread({}, __WEBPACK_IMPORTED_MODULE_2__form_form__[\"a\" /* props */], {\n disabled: {\n type: Boolean,\n default: false\n }\n }),\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var $attrs = data.attrs || {};\n var $listeners = data.on || {};\n data.attrs = {};\n data.on = {};\n return h('li', __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n attrs: {\n role: 'presentation'\n }\n }), [h(__WEBPACK_IMPORTED_MODULE_2__form_form__[\"b\" /* BForm */], {\n ref: 'form',\n staticClass: 'b-dropdown-form',\n class: {\n disabled: props.disabled\n },\n props: props,\n attrs: _objectSpread({}, $attrs, {\n disabled: props.disabled,\n // Tab index of -1 for keyboard navigation\n tabindex: props.disabled ? null : '-1'\n }),\n on: $listeners\n }, children)]);\n }\n});\n\n/***/ }),\n\n/***/ \"JmX5\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return VBTooltip; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_get_scope_id__ = __webpack_require__(\"zkG5\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_loose_equal__ = __webpack_require__(\"vk4e\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_array__ = __webpack_require__(\"gaHu\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils_config__ = __webpack_require__(\"UE/W\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__utils_env__ = __webpack_require__(\"ixoM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__utils_object__ = __webpack_require__(\"XZTZ\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__components_tooltip_helpers_bv_tooltip__ = __webpack_require__(\"D/ty\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\n\n\n\n // Key which we use to store tooltip object on element\n\nvar BV_TOOLTIP = '__BV_Tooltip__'; // Default trigger\n\nvar DefaultTrigger = 'hover focus'; // Valid event triggers\n\nvar validTriggers = {\n focus: true,\n hover: true,\n click: true,\n blur: true,\n manual: true // Directive modifier test regular expressions. Pre-compile for performance\n\n};\nvar htmlRE = /^html$/i;\nvar noFadeRE = /^nofade$/i;\nvar placementRE = /^(auto|top(left|right)?|bottom(left|right)?|left(top|bottom)?|right(top|bottom)?)$/i;\nvar boundaryRE = /^(window|viewport|scrollParent)$/i;\nvar delayRE = /^d\\d+$/i;\nvar delayShowRE = /^ds\\d+$/i;\nvar delayHideRE = /^dh\\d+$/i;\nvar offsetRE = /^o-?\\d+$/i;\nvar variantRE = /^v-.+$/i; // Build a Tooltip config based on bindings (if any)\n// Arguments and modifiers take precedence over passed value config object\n\nvar parseBindings = function parseBindings(bindings, vnode)\n/* istanbul ignore next: not easy to test */\n{\n // We start out with a basic config\n var NAME = 'BTooltip'; // Default config\n\n var config = {\n title: undefined,\n trigger: '',\n // Default set below if needed\n placement: 'top',\n fallbackPlacement: 'flip',\n container: false,\n // Default of body\n animation: true,\n offset: 0,\n id: null,\n html: false,\n delay: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'delay'),\n boundary: String(__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'boundary')),\n boundaryPadding: parseInt(__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'boundaryPadding'), 10) || 0,\n variant: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'variant'),\n customClass: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__utils_config__[\"a\" /* getComponentConfig */])(NAME, 'customClass') // Process `bindings.value`\n\n };\n\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"a\" /* isString */])(bindings.value)) {\n // Value is tooltip content (HTML optionally supported)\n config.title = bindings.value;\n } else if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"b\" /* isFunction */])(bindings.value)) {\n // Title generator function\n config.title = bindings.value;\n } else if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"c\" /* isObject */])(bindings.value)) {\n // Value is config object, so merge\n config = _objectSpread({}, config, {}, bindings.value);\n } // If title is not provided, try title attribute\n\n\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"d\" /* isUndefined */])(config.title)) {\n // Try attribute\n var data = vnode.data || {};\n config.title = data.attrs && data.attrs.title ? data.attrs.title : '';\n } // Normalize delay\n\n\n if (!__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"c\" /* isObject */])(config.delay)) {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n } // If argument, assume element ID of container element\n\n\n if (bindings.arg) {\n // Element ID specified as arg\n // We must prepend '#' to become a CSS selector\n config.container = \"#\".concat(bindings.arg);\n } // Process modifiers\n\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_object__[\"a\" /* keys */])(bindings.modifiers).forEach(function (mod) {\n if (htmlRE.test(mod)) {\n // Title allows HTML\n config.html = true;\n } else if (noFadeRE.test(mod)) {\n // No animation\n config.animation = false;\n } else if (placementRE.test(mod)) {\n // Placement of tooltip\n config.placement = mod;\n } else if (boundaryRE.test(mod)) {\n // Boundary of tooltip\n mod = mod === 'scrollparent' ? 'scrollParent' : mod;\n config.boundary = mod;\n } else if (delayRE.test(mod)) {\n // Delay value\n var delay = parseInt(mod.slice(1), 10) || 0;\n config.delay.show = delay;\n config.delay.hide = delay;\n } else if (delayShowRE.test(mod)) {\n // Delay show value\n config.delay.show = parseInt(mod.slice(2), 10) || 0;\n } else if (delayHideRE.test(mod)) {\n // Delay hide value\n config.delay.hide = parseInt(mod.slice(2), 10) || 0;\n } else if (offsetRE.test(mod)) {\n // Offset value, negative allowed\n config.offset = parseInt(mod.slice(1), 10) || 0;\n } else if (variantRE.test(mod)) {\n // Variant\n config.variant = mod.slice(2) || null;\n }\n }); // Special handling of event trigger modifiers trigger is\n // a space separated list\n\n var selectedTriggers = {}; // Parse current config object trigger\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_array__[\"a\" /* concat */])(config.trigger || '').filter(Boolean).join(' ').trim().toLowerCase().split(/\\s+/).forEach(function (trigger) {\n if (validTriggers[trigger]) {\n selectedTriggers[trigger] = true;\n }\n }); // Parse modifiers for triggers\n\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_object__[\"a\" /* keys */])(bindings.modifiers).forEach(function (mod) {\n mod = mod.toLowerCase();\n\n if (validTriggers[mod]) {\n // If modifier is a valid trigger\n selectedTriggers[mod] = true;\n }\n }); // Sanitize triggers\n\n config.trigger = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_object__[\"a\" /* keys */])(selectedTriggers).join(' ');\n\n if (config.trigger === 'blur') {\n // Blur by itself is useless, so convert it to 'focus'\n config.trigger = 'focus';\n }\n\n if (!config.trigger) {\n // Use default trigger\n config.trigger = DefaultTrigger;\n } // Return the config\n\n\n return config;\n}; // Add/update Tooltip on our element\n\n\nvar applyTooltip = function applyTooltip(el, bindings, vnode) {\n if (!__WEBPACK_IMPORTED_MODULE_4__utils_env__[\"a\" /* isBrowser */]) {\n /* istanbul ignore next */\n return;\n }\n\n var config = parseBindings(bindings, vnode);\n\n if (!el[BV_TOOLTIP]) {\n var $parent = vnode.context;\n el[BV_TOOLTIP] = new __WEBPACK_IMPORTED_MODULE_7__components_tooltip_helpers_bv_tooltip__[\"a\" /* BVTooltip */]({\n parent: $parent,\n // Add the parent's scoped style attribute data\n _scopeId: __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_get_scope_id__[\"a\" /* default */])($parent, undefined)\n });\n el[BV_TOOLTIP].__bv_prev_data__ = {};\n el[BV_TOOLTIP].$on('show', function ()\n /* istanbul ignore next: for now */\n {\n // Before showing the tooltip, we update the title if it is a function\n if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"b\" /* isFunction */])(config.title)) {\n el[BV_TOOLTIP].updateData({\n title: config.title()\n });\n }\n });\n }\n\n var data = {\n title: config.title,\n triggers: config.trigger,\n placement: config.placement,\n fallbackPlacement: config.fallbackPlacement,\n variant: config.variant,\n customClass: config.customClass,\n container: config.container,\n boundary: config.boundary,\n delay: config.delay,\n offset: config.offset,\n noFade: !config.animation,\n id: config.id,\n html: config.html\n };\n var oldData = el[BV_TOOLTIP].__bv_prev_data__;\n el[BV_TOOLTIP].__bv_prev_data__ = data;\n\n if (!__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_loose_equal__[\"a\" /* default */])(data, oldData)) {\n // We only update the instance if data has changed\n var newData = {\n target: el\n };\n __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__utils_object__[\"a\" /* keys */])(data).forEach(function (prop) {\n // We only pass data properties that have changed\n if (data[prop] !== oldData[prop]) {\n // if title is a function, we execute it here\n newData[prop] = prop === 'title' && __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_5__utils_inspect__[\"b\" /* isFunction */])(data[prop]) ? data[prop]() : data[prop];\n }\n });\n el[BV_TOOLTIP].updateData(newData);\n }\n}; // Remove Tooltip on our element\n\n\nvar removeTooltip = function removeTooltip(el) {\n if (el[BV_TOOLTIP]) {\n el[BV_TOOLTIP].$destroy();\n el[BV_TOOLTIP] = null;\n }\n\n delete el[BV_TOOLTIP];\n}; // Export our directive\n\n\nvar VBTooltip = {\n bind: function bind(el, bindings, vnode) {\n applyTooltip(el, bindings, vnode);\n },\n // We use `componentUpdated` here instead of `update`, as the former\n // waits until the containing component and children have finished updating\n componentUpdated: function componentUpdated(el, bindings, vnode) {\n // Performed in a `$nextTick()` to prevent render update loops\n vnode.context.$nextTick(function () {\n applyTooltip(el, bindings, vnode);\n });\n },\n unbind: function unbind(el) {\n removeTooltip(el);\n }\n};\n\n/***/ }),\n\n/***/ \"JwiF\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var jv = moment.defineLocale('jv', {\n months : 'Januari_Februari_Maret_April_Mei_Juni_Juli_Agustus_September_Oktober_Nopember_Desember'.split('_'),\n monthsShort : 'Jan_Feb_Mar_Apr_Mei_Jun_Jul_Ags_Sep_Okt_Nop_Des'.split('_'),\n weekdays : 'Minggu_Senen_Seloso_Rebu_Kemis_Jemuwah_Septu'.split('_'),\n weekdaysShort : 'Min_Sen_Sel_Reb_Kem_Jem_Sep'.split('_'),\n weekdaysMin : 'Mg_Sn_Sl_Rb_Km_Jm_Sp'.split('_'),\n longDateFormat : {\n LT : 'HH.mm',\n LTS : 'HH.mm.ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [pukul] HH.mm',\n LLLL : 'dddd, D MMMM YYYY [pukul] HH.mm'\n },\n meridiemParse: /enjing|siyang|sonten|ndalu/,\n meridiemHour : function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'enjing') {\n return hour;\n } else if (meridiem === 'siyang') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'sonten' || meridiem === 'ndalu') {\n return hour + 12;\n }\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'enjing';\n } else if (hours < 15) {\n return 'siyang';\n } else if (hours < 19) {\n return 'sonten';\n } else {\n return 'ndalu';\n }\n },\n calendar : {\n sameDay : '[Dinten puniko pukul] LT',\n nextDay : '[Mbenjang pukul] LT',\n nextWeek : 'dddd [pukul] LT',\n lastDay : '[Kala wingi pukul] LT',\n lastWeek : 'dddd [kepengker pukul] LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : 'wonten ing %s',\n past : '%s ingkang kepengker',\n s : 'sawetawis detik',\n ss : '%d detik',\n m : 'setunggal menit',\n mm : '%d menit',\n h : 'setunggal jam',\n hh : '%d jam',\n d : 'sedinten',\n dd : '%d dinten',\n M : 'sewulan',\n MM : '%d wulan',\n y : 'setaun',\n yy : '%d taun'\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return jv;\n\n})));\n\n\n/***/ }),\n\n/***/ \"KB1b\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__upper_first__ = __webpack_require__(\"9AlE\");\n\n/**\n * Suffix can be a falsey value so nothing is appended to string.\n * (helps when looping over props & some shouldn't change)\n * Use data last parameters to allow for currying.\n * @param {string} suffix\n * @param {string} str\n */\n\nvar suffixPropName = function suffixPropName(suffix, str) {\n return str + (suffix ? __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__upper_first__[\"a\" /* default */])(suffix) : '');\n};\n\n/* harmony default export */ __webpack_exports__[\"a\"] = (suffixPropName);\n\n/***/ }),\n\n/***/ \"KCLY\":\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\n/* WEBPACK VAR INJECTION */(function(process) {\n\nvar utils = __webpack_require__(\"cGG2\");\nvar normalizeHeaderName = __webpack_require__(\"5VQ+\");\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = __webpack_require__(\"7GwW\");\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = __webpack_require__(\"7GwW\");\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(\"W2nU\")))\n\n/***/ }),\n\n/***/ \"KcC9\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return directivesPlugin; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_plugins__ = __webpack_require__(\"20SD\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__modal__ = __webpack_require__(\"g8cA\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__popover__ = __webpack_require__(\"AWms\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__scrollspy__ = __webpack_require__(\"fpB4\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__toggle__ = __webpack_require__(\"pY3y\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__tooltip__ = __webpack_require__(\"qM8d\");\n\n\n\n\n\n // Main plugin for installing all directive plugins\n\nvar directivesPlugin =\n/*#__PURE__*/\n__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__utils_plugins__[\"b\" /* pluginFactory */])({\n plugins: {\n VBModalPlugin: __WEBPACK_IMPORTED_MODULE_1__modal__[\"a\" /* VBModalPlugin */],\n VBPopoverPlugin: __WEBPACK_IMPORTED_MODULE_2__popover__[\"a\" /* VBPopoverPlugin */],\n VBScrollspyPlugin: __WEBPACK_IMPORTED_MODULE_3__scrollspy__[\"a\" /* VBScrollspyPlugin */],\n VBTogglePlugin: __WEBPACK_IMPORTED_MODULE_4__toggle__[\"a\" /* VBTogglePlugin */],\n VBTooltipPlugin: __WEBPACK_IMPORTED_MODULE_5__tooltip__[\"a\" /* VBTooltipPlugin */]\n }\n});\n\n/***/ }),\n\n/***/ \"KoNO\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return FormGroupPlugin; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__form_group__ = __webpack_require__(\"N+zn\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_plugins__ = __webpack_require__(\"20SD\");\n/* unused harmony reexport BFormGroup */\n\n\nvar FormGroupPlugin =\n/*#__PURE__*/\n__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_plugins__[\"b\" /* pluginFactory */])({\n components: {\n BFormGroup: __WEBPACK_IMPORTED_MODULE_0__form_group__[\"a\" /* BFormGroup */],\n BFormFieldset: __WEBPACK_IMPORTED_MODULE_0__form_group__[\"a\" /* BFormGroup */]\n }\n});\n\n\n/***/ }),\n\n/***/ \"L42u\":\n/***/ (function(module, exports, __webpack_require__) {\n\nvar ctx = __webpack_require__(\"+ZMJ\");\nvar invoke = __webpack_require__(\"knuC\");\nvar html = __webpack_require__(\"RPLV\");\nvar cel = __webpack_require__(\"ON07\");\nvar global = __webpack_require__(\"7KvD\");\nvar process = global.process;\nvar setTask = global.setImmediate;\nvar clearTask = global.clearImmediate;\nvar MessageChannel = global.MessageChannel;\nvar Dispatch = global.Dispatch;\nvar counter = 0;\nvar queue = {};\nvar ONREADYSTATECHANGE = 'onreadystatechange';\nvar defer, channel, port;\nvar run = function () {\n var id = +this;\n // eslint-disable-next-line no-prototype-builtins\n if (queue.hasOwnProperty(id)) {\n var fn = queue[id];\n delete queue[id];\n fn();\n }\n};\nvar listener = function (event) {\n run.call(event.data);\n};\n// Node.js 0.9+ & IE10+ has setImmediate, otherwise:\nif (!setTask || !clearTask) {\n setTask = function setImmediate(fn) {\n var args = [];\n var i = 1;\n while (arguments.length > i) args.push(arguments[i++]);\n queue[++counter] = function () {\n // eslint-disable-next-line no-new-func\n invoke(typeof fn == 'function' ? fn : Function(fn), args);\n };\n defer(counter);\n return counter;\n };\n clearTask = function clearImmediate(id) {\n delete queue[id];\n };\n // Node.js 0.8-\n if (__webpack_require__(\"R9M2\")(process) == 'process') {\n defer = function (id) {\n process.nextTick(ctx(run, id, 1));\n };\n // Sphere (JS game engine) Dispatch API\n } else if (Dispatch && Dispatch.now) {\n defer = function (id) {\n Dispatch.now(ctx(run, id, 1));\n };\n // Browsers with MessageChannel, includes WebWorkers\n } else if (MessageChannel) {\n channel = new MessageChannel();\n port = channel.port2;\n channel.port1.onmessage = listener;\n defer = ctx(port.postMessage, port, 1);\n // Browsers with postMessage, skip WebWorkers\n // IE8 has postMessage, but it's sync & typeof its postMessage is 'object'\n } else if (global.addEventListener && typeof postMessage == 'function' && !global.importScripts) {\n defer = function (id) {\n global.postMessage(id + '', '*');\n };\n global.addEventListener('message', listener, false);\n // IE8-\n } else if (ONREADYSTATECHANGE in cel('script')) {\n defer = function (id) {\n html.appendChild(cel('script'))[ONREADYSTATECHANGE] = function () {\n html.removeChild(this);\n run.call(id);\n };\n };\n // Rest old browsers\n } else {\n defer = function (id) {\n setTimeout(ctx(run, id, 1), 0);\n };\n }\n}\nmodule.exports = {\n set: setTask,\n clear: clearTask\n};\n\n\n/***/ }),\n\n/***/ \"LHzE\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BVPopoverTemplate; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_inspect__ = __webpack_require__(\"8Sz2\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__tooltip_helpers_bv_tooltip_template__ = __webpack_require__(\"BpfR\");\n\n\n\nvar NAME = 'BVPopoverTemplate'; // @vue/component\n\nvar BVPopoverTemplate =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: NAME,\n extends: __WEBPACK_IMPORTED_MODULE_2__tooltip_helpers_bv_tooltip_template__[\"a\" /* BVTooltipTemplate */],\n computed: {\n templateType: function templateType() {\n return 'popover';\n }\n },\n methods: {\n renderTemplate: function renderTemplate(h) {\n // Title and content could be a scoped slot function\n var $title = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"b\" /* isFunction */])(this.title) ? this.title({}) : this.title;\n var $content = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"b\" /* isFunction */])(this.content) ? this.content({}) : this.content; // Directive usage only\n\n var titleDomProps = this.html && !__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"b\" /* isFunction */])(this.title) ? {\n innerHTML: this.title\n } : {};\n var contentDomProps = this.html && !__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"b\" /* isFunction */])(this.content) ? {\n innerHTML: this.content\n } : {};\n return h('div', {\n staticClass: 'popover b-popover',\n class: this.templateClasses,\n attrs: this.templateAttributes,\n on: this.templateListeners\n }, [h('div', {\n ref: 'arrow',\n staticClass: 'arrow'\n }), __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"j\" /* isUndefinedOrNull */])($title) ? h() : h('h3', {\n staticClass: 'popover-header',\n domProps: titleDomProps\n }, [$title]), __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__utils_inspect__[\"j\" /* isUndefinedOrNull */])($content) ? h() : h('div', {\n staticClass: 'popover-body',\n domProps: contentDomProps\n }, [$content])]);\n }\n }\n});\n\n/***/ }),\n\n/***/ \"LT9G\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split('_'),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_');\n\n var monthsParse = [/^ene/i, /^feb/i, /^mar/i, /^abr/i, /^may/i, /^jun/i, /^jul/i, /^ago/i, /^sep/i, /^oct/i, /^nov/i, /^dic/i];\n var monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var es = moment.defineLocale('es', {\n months : 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split('_'),\n monthsShort : function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex : monthsRegex,\n monthsShortRegex : monthsRegex,\n monthsStrictRegex : /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex : /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse : monthsParse,\n longMonthsParse : monthsParse,\n shortMonthsParse : monthsParse,\n weekdays : 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'H:mm',\n LTS : 'H:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY H:mm',\n LLLL : 'dddd, D [de] MMMM [de] YYYY H:mm'\n },\n calendar : {\n sameDay : function () {\n return '[hoy a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextDay : function () {\n return '[mañana a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastDay : function () {\n return '[ayer a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastWeek : function () {\n return '[el] dddd [pasado a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : 'en %s',\n past : 'hace %s',\n s : 'unos segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'una hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un año',\n yy : '%d años'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return es;\n\n})));\n\n\n/***/ }),\n\n/***/ \"Lb6b\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BFormSelect; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__mixins_id__ = __webpack_require__(\"6Ecx\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__mixins_form_options__ = __webpack_require__(\"FAPV\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__mixins_form__ = __webpack_require__(\"NRzj\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__mixins_form_size__ = __webpack_require__(\"Oa/M\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__mixins_form_state__ = __webpack_require__(\"yWDY\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__mixins_form_custom__ = __webpack_require__(\"MKMm\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__mixins_normalize_slot__ = __webpack_require__(\"BnsU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_array__ = __webpack_require__(\"gaHu\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_html__ = __webpack_require__(\"qaYk\");\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\n\n\n\n\n\n\n // @vue/component\n\nvar BFormSelect =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BFormSelect',\n mixins: [__WEBPACK_IMPORTED_MODULE_1__mixins_id__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_7__mixins_normalize_slot__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_3__mixins_form__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_4__mixins_form_size__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_5__mixins_form_state__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_6__mixins_form_custom__[\"a\" /* default */], __WEBPACK_IMPORTED_MODULE_2__mixins_form_options__[\"a\" /* default */]],\n model: {\n prop: 'value',\n event: 'input'\n },\n props: {\n value: {// type: [Object, Array, String, Number, Boolean],\n // default: undefined\n },\n multiple: {\n type: Boolean,\n default: false\n },\n selectSize: {\n // Browsers default size to 0, which shows 4 rows in most browsers in multiple mode\n // Size of 1 can bork out Firefox\n type: Number,\n default: 0\n },\n ariaInvalid: {\n type: [Boolean, String],\n default: false\n }\n },\n data: function data() {\n return {\n localValue: this.value\n };\n },\n computed: {\n computedSelectSize: function computedSelectSize() {\n // Custom selects with a size of zero causes the arrows to be hidden,\n // so dont render the size attribute in this case\n return !this.plain && this.selectSize === 0 ? null : this.selectSize;\n },\n inputClass: function inputClass() {\n return [this.plain ? 'form-control' : 'custom-select', this.size && this.plain ? \"form-control-\".concat(this.size) : null, this.size && !this.plain ? \"custom-select-\".concat(this.size) : null, this.stateClass];\n },\n computedAriaInvalid: function computedAriaInvalid() {\n if (this.ariaInvalid === true || this.ariaInvalid === 'true') {\n return 'true';\n }\n\n return this.stateClass === 'is-invalid' ? 'true' : null;\n }\n },\n watch: {\n value: function value(newVal, oldVal) {\n this.localValue = newVal;\n },\n localValue: function localValue(newVal, oldVal) {\n this.$emit('input', this.localValue);\n }\n },\n methods: {\n focus: function focus() {\n this.$refs.input.focus();\n },\n blur: function blur() {\n this.$refs.input.blur();\n }\n },\n render: function render(h) {\n var _this = this;\n\n var options = this.formOptions.map(function (option, index) {\n return h('option', {\n key: \"option_\".concat(index, \"_opt\"),\n attrs: {\n disabled: Boolean(option.disabled)\n },\n domProps: _objectSpread({}, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_9__utils_html__[\"a\" /* htmlOrText */])(option.html, option.text), {\n value: option.value\n })\n });\n });\n return h('select', {\n ref: 'input',\n class: this.inputClass,\n directives: [{\n name: 'model',\n rawName: 'v-model',\n value: this.localValue,\n expression: 'localValue'\n }],\n attrs: {\n id: this.safeId(),\n name: this.name,\n form: this.form || null,\n multiple: this.multiple || null,\n size: this.computedSelectSize,\n disabled: this.disabled,\n required: this.required,\n 'aria-required': this.required ? 'true' : null,\n 'aria-invalid': this.computedAriaInvalid\n },\n on: {\n change: function change(evt) {\n var target = evt.target;\n var selectedVal = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_8__utils_array__[\"d\" /* from */])(target.options).filter(function (o) {\n return o.selected;\n }).map(function (o) {\n return '_value' in o ? o._value : o.value;\n });\n _this.localValue = target.multiple ? selectedVal : selectedVal[0];\n\n _this.$nextTick(function () {\n _this.$emit('change', _this.localValue);\n });\n }\n }\n }, [this.normalizeSlot('first'), options, this.normalizeSlot('default')]);\n }\n});\n\n/***/ }),\n\n/***/ \"LdD8\":\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\n/* unused harmony export props */\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"a\", function() { return BEmbed; });\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_vue__ = __webpack_require__(\"kRIU\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__ = __webpack_require__(\"2PZM\");\n/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_array__ = __webpack_require__(\"gaHu\");\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n\n\n\nvar props = {\n type: {\n type: String,\n default: 'iframe',\n validator: function validator(str) {\n return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__utils_array__[\"c\" /* arrayIncludes */])(['iframe', 'embed', 'video', 'object', 'img', 'b-img', 'b-img-lazy'], str);\n }\n },\n tag: {\n type: String,\n default: 'div'\n },\n aspect: {\n type: String,\n default: '16by9'\n } // @vue/component\n\n};\nvar BEmbed =\n/*#__PURE__*/\n__WEBPACK_IMPORTED_MODULE_0__utils_vue__[\"a\" /* default */].extend({\n name: 'BEmbed',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, {\n ref: data.ref,\n staticClass: 'embed-responsive',\n class: _defineProperty({}, \"embed-responsive-\".concat(props.aspect), Boolean(props.aspect))\n }, [h(props.type, __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1_vue_functional_data_merge__[\"a\" /* mergeData */])(data, {\n ref: '',\n staticClass: 'embed-responsive-item'\n }), children)]);\n }\n});\n\n/***/ }),\n\n/***/ \"Lgqo\":\n/***/ (function(module, exports, __webpack_require__) {\n\n//! moment.js locale configuration\n\n;(function (global, factory) {\n true ? factory(__webpack_require__(\"PJh5\")) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n /*jshint -W100*/\n var si = moment.defineLocale('si', {\n months : 'ජනවාරි_පෙබරවාරි_මාර්තු_අප්රේල්_මැයි_ජූනි_ජූලි_අගෝස්තු_සැප්තැම්බර්_ඔක්තෝබර්_නොවැම්බර්_දෙසැම්බර්'.split('_'),\n monthsShort : 'ජන_පෙබ_මාර්_අප්_මැයි_ජූනි_ජූලි_අගෝ_සැප්_ඔක්_නොවැ_දෙසැ'.split('_'),\n weekdays : 'ඉරිදා_සඳුදා_අඟහරුවාදා_බදාදා_බ්රහස්පතින්දා_සිකුරාදා_සෙනසුරාදා'.split('_'),\n weekdaysShort : 'ඉරි_සඳු_අඟ_බදා_බ්රහ_සිකු_සෙන'.split('_'),\n weekdaysMin : 'ඉ_ස_අ_බ_බ්ර_සි_සෙ'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'a h:mm',\n LTS : 'a h:mm:ss',\n L : 'YYYY/MM/DD',\n LL : 'YYYY MMMM D',\n LLL : 'YYYY MMMM D, a h:mm',\n LLLL : 'YYYY MMMM D [වැනි] dddd, a h:mm:ss'\n },\n calendar : {\n sameDay : '[අද] LT[ට]',\n nextDay : '[හෙට] LT[ට]',\n nextWeek : 'dddd LT[ට]',\n lastDay : '[ඊයේ] LT[ට]',\n lastWeek : '[පසුගිය] dddd LT[ට]',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%sකින්',\n past : '%sකට පෙර',\n s : 'තත්පර කිහිපය',\n ss : 'තත්පර %d',\n m : 'මිනිත්තුව',\n mm : 'මිනිත්තු %d',\n h : 'පැය',\n hh : 'පැය %d',\n d : 'දිනය',\n dd : 'දින %d',\n M : 'මාසය',\n MM : 'මාස %d',\n y : 'වසර',\n yy : 'වසර %d'\n },\n dayOfMonthOrdinalParse: /\\d{1,2} වැනි/,\n ordinal : function (number) {\n return number + ' වැනි';\n },\n meridiemParse : /පෙර වරු|පස් වරු|පෙ.ව|ප.ව./,\n isPM : function (input) {\n return input === 'ප.ව.' || input === 'පස් වරු';\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'ප.ව.' : 'පස් වරු';\n } else {\n return isLower ? 'පෙ.ව.' : 'පෙර වරු';\n }\n }\n });\n\n return si;\n\n})));\n\n\n/***/ }),\n\n/***/ \"M4fF\":\n/***/ (function(module, exports, __webpack_require__) {\n\n/* WEBPACK VAR INJECTION */(function(global, module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**\n * @license\n * Lodash \n * Copyright OpenJS Foundation and other contributors \n * Released under MIT license \n * Based on Underscore.js 1.8.3 \n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n;(function() {\n\n /** Used as a safe reference for `undefined` in pre-ES5 environments. */\n var undefined;\n\n /** Used as the semantic version number. */\n var VERSION = '4.17.15';\n\n /** Used as the size to enable large array optimizations. */\n var LARGE_ARRAY_SIZE = 200;\n\n /** Error message constants. */\n var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',\n FUNC_ERROR_TEXT = 'Expected a function';\n\n /** Used to stand-in for `undefined` hash values. */\n var HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n /** Used as the maximum memoize cache size. */\n var MAX_MEMOIZE_SIZE = 500;\n\n /** Used as the internal argument placeholder. */\n var PLACEHOLDER = '__lodash_placeholder__';\n\n /** Used to compose bitmasks for cloning. */\n var CLONE_DEEP_FLAG = 1,\n CLONE_FLAT_FLAG = 2,\n CLONE_SYMBOLS_FLAG = 4;\n\n /** Used to compose bitmasks for value comparisons. */\n var COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n /** Used to compose bitmasks for function metadata. */\n var WRAP_BIND_FLAG = 1,\n WRAP_BIND_KEY_FLAG = 2,\n WRAP_CURRY_BOUND_FLAG = 4,\n WRAP_CURRY_FLAG = 8,\n WRAP_CURRY_RIGHT_FLAG = 16,\n WRAP_PARTIAL_FLAG = 32,\n WRAP_PARTIAL_RIGHT_FLAG = 64,\n WRAP_ARY_FLAG = 128,\n WRAP_REARG_FLAG = 256,\n WRAP_FLIP_FLAG = 512;\n\n /** Used as default options for `_.truncate`. */\n var DEFAULT_TRUNC_LENGTH = 30,\n DEFAULT_TRUNC_OMISSION = '...';\n\n /** Used to detect hot functions by number of calls within a span of milliseconds. */\n var HOT_COUNT = 800,\n HOT_SPAN = 16;\n\n /** Used to indicate the type of lazy iteratees. */\n var LAZY_FILTER_FLAG = 1,\n LAZY_MAP_FLAG = 2,\n LAZY_WHILE_FLAG = 3;\n\n /** Used as references for various `Number` constants. */\n var INFINITY = 1 / 0,\n MAX_SAFE_INTEGER = 9007199254740991,\n MAX_INTEGER = 1.7976931348623157e+308,\n NAN = 0 / 0;\n\n /** Used as references for the maximum length and index of an array. */\n var MAX_ARRAY_LENGTH = 4294967295,\n MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,\n HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;\n\n /** Used to associate wrap methods with their bit flags. */\n var wrapFlags = [\n ['ary', WRAP_ARY_FLAG],\n ['bind', WRAP_BIND_FLAG],\n ['bindKey', WRAP_BIND_KEY_FLAG],\n ['curry', WRAP_CURRY_FLAG],\n ['curryRight', WRAP_CURRY_RIGHT_FLAG],\n ['flip', WRAP_FLIP_FLAG],\n ['partial', WRAP_PARTIAL_FLAG],\n ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],\n ['rearg', WRAP_REARG_FLAG]\n ];\n\n /** `Object#toString` result references. */\n var argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n asyncTag = '[object AsyncFunction]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n domExcTag = '[object DOMException]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n nullTag = '[object Null]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n proxyTag = '[object Proxy]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]',\n undefinedTag = '[object Undefined]',\n weakMapTag = '[object WeakMap]',\n weakSetTag = '[object WeakSet]';\n\n var arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n /** Used to match empty string literals in compiled template source. */\n var reEmptyStringLeading = /\\b__p \\+= '';/g,\n reEmptyStringMiddle = /\\b(__p \\+=) '' \\+/g,\n reEmptyStringTrailing = /(__e\\(.*?\\)|\\b__t\\)) \\+\\n'';/g;\n\n /** Used to match HTML entities and HTML characters. */\n var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,\n reUnescapedHtml = /[&<>\"']/g,\n reHasEscapedHtml = RegExp(reEscapedHtml.source),\n reHasUnescapedHtml = RegExp(reUnescapedHtml.source);\n\n /** Used to match template delimiters. */\n var reEscape = /<%-([\\s\\S]+?)%>/g,\n reEvaluate = /<%([\\s\\S]+?)%>/g,\n reInterpolate = /<%=([\\s\\S]+?)%>/g;\n\n /** Used to match property names within property paths. */\n var reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n reIsPlainProp = /^\\w*$/,\n rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n /**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\n var reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g,\n reHasRegExpChar = RegExp(reRegExpChar.source);\n\n /** Used to match leading and trailing whitespace. */\n var reTrim = /^\\s+|\\s+$/g,\n reTrimStart = /^\\s+/,\n reTrimEnd = /\\s+$/;\n\n /** Used to match wrap detail comments. */\n var reWrapComment = /\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,\n reWrapDetails = /\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,\n reSplitDetails = /,? & /;\n\n /** Used to match words composed of alphanumeric characters. */\n var reAsciiWord = /[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g;\n\n /** Used to match backslashes in property paths. */\n var reEscapeChar = /\\\\(\\\\)?/g;\n\n /**\n * Used to match\n * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).\n */\n var reEsTemplate = /\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g;\n\n /** Used to match `RegExp` flags from their coerced string values. */\n var reFlags = /\\w*$/;\n\n /** Used to detect bad signed hexadecimal string values. */\n var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n /** Used to detect binary string values. */\n var reIsBinary = /^0b[01]+$/i;\n\n /** Used to detect host constructors (Safari). */\n var reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n /** Used to detect octal string values. */\n var reIsOctal = /^0o[0-7]+$/i;\n\n /** Used to detect unsigned integer values. */\n var reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n /** Used to match Latin Unicode letters (excluding mathematical operators). */\n var reLatin = /[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g;\n\n /** Used to ensure capturing order of template delimiters. */\n var reNoMatch = /($^)/;\n\n /** Used to match unescaped characters in compiled string literals. */\n var reUnescapedString = /['\\n\\r\\u2028\\u2029\\\\]/g;\n\n /** Used to compose unicode character classes. */\n var rsAstralRange = '\\\\ud800-\\\\udfff',\n rsComboMarksRange = '\\\\u0300-\\\\u036f',\n reComboHalfMarksRange = '\\\\ufe20-\\\\ufe2f',\n rsComboSymbolsRange = '\\\\u20d0-\\\\u20ff',\n rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,\n rsDingbatRange = '\\\\u2700-\\\\u27bf',\n rsLowerRange = 'a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff',\n rsMathOpRange = '\\\\xac\\\\xb1\\\\xd7\\\\xf7',\n rsNonCharRange = '\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf',\n rsPunctuationRange = '\\\\u2000-\\\\u206f',\n rsSpaceRange = ' \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000',\n rsUpperRange = 'A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde',\n rsVarRange = '\\\\ufe0e\\\\ufe0f',\n rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;\n\n /** Used to compose unicode capture groups. */\n var rsApos = \"['\\u2019]\",\n rsAstral = '[' + rsAstralRange + ']',\n rsBreak = '[' + rsBreakRange + ']',\n rsCombo = '[' + rsComboRange + ']',\n rsDigits = '\\\\d+',\n rsDingbat = '[' + rsDingbatRange + ']',\n rsLower = '[' + rsLowerRange + ']',\n rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',\n rsFitz = '\\\\ud83c[\\\\udffb-\\\\udfff]',\n rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',\n rsNonAstral = '[^' + rsAstralRange + ']',\n rsRegional = '(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}',\n rsSurrPair = '[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]',\n rsUpper = '[' + rsUpperRange + ']',\n rsZWJ = '\\\\u200d';\n\n /** Used to compose unicode regexes. */\n var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',\n rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',\n rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',\n rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',\n reOptMod = rsModifier + '?',\n rsOptVar = '[' + rsVarRange + ']?',\n rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',\n rsOrdLower = '\\\\d*(?:1st|2nd|3rd|(?![123])\\\\dth)(?=\\\\b|[A-Z_])',\n rsOrdUpper = '\\\\d*(?:1ST|2ND|3RD|(?![123])\\\\dTH)(?=\\\\b|[a-z_])',\n rsSeq = rsOptVar + reOptMod + rsOptJoin,\n rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,\n rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';\n\n /** Used to match apostrophes. */\n var reApos = RegExp(rsApos, 'g');\n\n /**\n * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and\n * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).\n */\n var reComboMark = RegExp(rsCombo, 'g');\n\n /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */\n var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');\n\n /** Used to match complex or compound words. */\n var reUnicodeWord = RegExp([\n rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',\n rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',\n rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,\n rsUpper + '+' + rsOptContrUpper,\n rsOrdUpper,\n rsOrdLower,\n rsDigits,\n rsEmoji\n ].join('|'), 'g');\n\n /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */\n var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');\n\n /** Used to detect strings that need a more robust regexp to match words. */\n var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;\n\n /** Used to assign default `context` object properties. */\n var contextProps = [\n 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',\n 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',\n 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',\n 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',\n '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'\n ];\n\n /** Used to make template sourceURLs easier to identify. */\n var templateCounter = -1;\n\n /** Used to identify `toStringTag` values of typed arrays. */\n var typedArrayTags = {};\n typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\n typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\n typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\n typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\n typedArrayTags[uint32Tag] = true;\n typedArrayTags[argsTag] = typedArrayTags[arrayTag] =\n typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\n typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\n typedArrayTags[errorTag] = typedArrayTags[funcTag] =\n typedArrayTags[mapTag] = typedArrayTags[numberTag] =\n typedArrayTags[objectTag] = typedArrayTags[regexpTag] =\n typedArrayTags[setTag] = typedArrayTags[stringTag] =\n typedArrayTags[weakMapTag] = false;\n\n /** Used to identify `toStringTag` values supported by `_.clone`. */\n var cloneableTags = {};\n cloneableTags[argsTag] = cloneableTags[arrayTag] =\n cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\n cloneableTags[boolTag] = cloneableTags[dateTag] =\n cloneableTags[float32Tag] = cloneableTags[float64Tag] =\n cloneableTags[int8Tag] = cloneableTags[int16Tag] =\n cloneableTags[int32Tag] = cloneableTags[mapTag] =\n cloneableTags[numberTag] = cloneableTags[objectTag] =\n cloneableTags[regexpTag] = cloneableTags[setTag] =\n cloneableTags[stringTag] = cloneableTags[symbolTag] =\n cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\n cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\n cloneableTags[errorTag] = cloneableTags[funcTag] =\n cloneableTags[weakMapTag] = false;\n\n /** Used to map Latin Unicode letters to basic Latin letters. */\n var deburredLetters = {\n // Latin-1 Supplement block.\n '\\xc0': 'A', '\\xc1': 'A', '\\xc2': 'A', '\\xc3': 'A', '\\xc4': 'A', '\\xc5': 'A',\n '\\xe0': 'a', '\\xe1': 'a', '\\xe2': 'a', '\\xe3': 'a', '\\xe4': 'a', '\\xe5': 'a',\n '\\xc7': 'C', '\\xe7': 'c',\n '\\xd0': 'D', '\\xf0': 'd',\n '\\xc8': 'E', '\\xc9': 'E', '\\xca': 'E', '\\xcb': 'E',\n '\\xe8': 'e', '\\xe9': 'e', '\\xea': 'e', '\\xeb': 'e',\n '\\xcc': 'I', '\\xcd': 'I', '\\xce': 'I', '\\xcf': 'I',\n '\\xec': 'i', '\\xed': 'i', '\\xee': 'i', '\\xef': 'i',\n '\\xd1': 'N', '\\xf1': 'n',\n '\\xd2': 'O', '\\xd3': 'O', '\\xd4': 'O', '\\xd5': 'O', '\\xd6': 'O', '\\xd8': 'O',\n '\\xf2': 'o', '\\xf3': 'o', '\\xf4': 'o', '\\xf5': 'o', '\\xf6': 'o', '\\xf8': 'o',\n '\\xd9': 'U', '\\xda': 'U', '\\xdb': 'U', '\\xdc': 'U',\n '\\xf9': 'u', '\\xfa': 'u', '\\xfb': 'u', '\\xfc': 'u',\n '\\xdd': 'Y', '\\xfd': 'y', '\\xff': 'y',\n '\\xc6': 'Ae', '\\xe6': 'ae',\n '\\xde': 'Th', '\\xfe': 'th',\n '\\xdf': 'ss',\n // Latin Extended-A block.\n '\\u0100': 'A', '\\u0102': 'A', '\\u0104': 'A',\n '\\u0101': 'a', '\\u0103': 'a', '\\u0105': 'a',\n '\\u0106': 'C', '\\u0108': 'C', '\\u010a': 'C', '\\u010c': 'C',\n '\\u0107': 'c', '\\u0109': 'c', '\\u010b': 'c', '\\u010d': 'c',\n '\\u010e': 'D', '\\u0110': 'D', '\\u010f': 'd', '\\u0111': 'd',\n '\\u0112': 'E', '\\u0114': 'E', '\\u0116': 'E', '\\u0118': 'E', '\\u011a': 'E',\n '\\u0113': 'e', '\\u0115': 'e', '\\u0117': 'e', '\\u0119': 'e', '\\u011b': 'e',\n '\\u011c': 'G', '\\u011e': 'G', '\\u0120': 'G', '\\u0122': 'G',\n '\\u011d': 'g', '\\u011f': 'g', '\\u0121': 'g', '\\u0123': 'g',\n '\\u0124': 'H', '\\u0126': 'H', '\\u0125': 'h', '\\u0127': 'h',\n '\\u0128': 'I', '\\u012a': 'I', '\\u012c': 'I', '\\u012e': 'I', '\\u0130': 'I',\n '\\u0129': 'i', '\\u012b': 'i', '\\u012d': 'i', '\\u012f': 'i', '\\u0131': 'i',\n '\\u0134': 'J', '\\u0135': 'j',\n '\\u0136': 'K', '\\u0137': 'k', '\\u0138': 'k',\n '\\u0139': 'L', '\\u013b': 'L', '\\u013d': 'L', '\\u013f': 'L', '\\u0141': 'L',\n '\\u013a': 'l', '\\u013c': 'l', '\\u013e': 'l', '\\u0140': 'l', '\\u0142': 'l',\n '\\u0143': 'N', '\\u0145': 'N', '\\u0147': 'N', '\\u014a': 'N',\n '\\u0144': 'n', '\\u0146': 'n', '\\u0148': 'n', '\\u014b': 'n',\n '\\u014c': 'O', '\\u014e': 'O', '\\u0150': 'O',\n '\\u014d': 'o', '\\u014f': 'o', '\\u0151': 'o',\n '\\u0154': 'R', '\\u0156': 'R', '\\u0158': 'R',\n '\\u0155': 'r', '\\u0157': 'r', '\\u0159': 'r',\n '\\u015a': 'S', '\\u015c': 'S', '\\u015e': 'S', '\\u0160': 'S',\n '\\u015b': 's', '\\u015d': 's', '\\u015f': 's', '\\u0161': 's',\n '\\u0162': 'T', '\\u0164': 'T', '\\u0166': 'T',\n '\\u0163': 't', '\\u0165': 't', '\\u0167': 't',\n '\\u0168': 'U', '\\u016a': 'U', '\\u016c': 'U', '\\u016e': 'U', '\\u0170': 'U', '\\u0172': 'U',\n '\\u0169': 'u', '\\u016b': 'u', '\\u016d': 'u', '\\u016f': 'u', '\\u0171': 'u', '\\u0173': 'u',\n '\\u0174': 'W', '\\u0175': 'w',\n '\\u0176': 'Y', '\\u0177': 'y', '\\u0178': 'Y',\n '\\u0179': 'Z', '\\u017b': 'Z', '\\u017d': 'Z',\n '\\u017a': 'z', '\\u017c': 'z', '\\u017e': 'z',\n '\\u0132': 'IJ', '\\u0133': 'ij',\n '\\u0152': 'Oe', '\\u0153': 'oe',\n '\\u0149': \"'n\", '\\u017f': 's'\n };\n\n /** Used to map characters to HTML entities. */\n var htmlEscapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '\"': '"',\n \"'\": '''\n };\n\n /** Used to map HTML entities to characters. */\n var htmlUnescapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '"': '\"',\n ''': \"'\"\n };\n\n /** Used to escape characters for inclusion in compiled string literals. */\n var stringEscapes = {\n '\\\\': '\\\\',\n \"'\": \"'\",\n '\\n': 'n',\n '\\r': 'r',\n '\\u2028': 'u2028',\n '\\u2029': 'u2029'\n };\n\n /** Built-in method references without a dependency on `root`. */\n var freeParseFloat = parseFloat,\n freeParseInt = parseInt;\n\n /** Detect free variable `global` from Node.js. */\n var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n /** Detect free variable `self`. */\n var freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n /** Used as a reference to the global object. */\n var root = freeGlobal || freeSelf || Function('return this')();\n\n /** Detect free variable `exports`. */\n var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n /** Detect free variable `module`. */\n var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n /** Detect the popular CommonJS extension `module.exports`. */\n var moduleExports = freeModule && freeModule.exports === freeExports;\n\n /** Detect free variable `process` from Node.js. */\n var freeProcess = moduleExports && freeGlobal.process;\n\n /** Used to access faster Node.js helpers. */\n var nodeUtil = (function() {\n try {\n // Use `util.types` for Node.js 10+.\n var types = freeModule && freeModule.require && freeModule.require('util').types;\n\n if (types) {\n return types;\n }\n\n // Legacy `process.binding('util')` for Node.js < 10.\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n }());\n\n /* Node.js helper references. */\n var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,\n nodeIsDate = nodeUtil && nodeUtil.isDate,\n nodeIsMap = nodeUtil && nodeUtil.isMap,\n nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,\n nodeIsSet = nodeUtil && nodeUtil.isSet,\n nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * A faster alternative to `Function#apply`, this function invokes `func`\n * with the `this` binding of `thisArg` and the arguments of `args`.\n *\n * @private\n * @param {Function} func The function to invoke.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} args The arguments to invoke `func` with.\n * @returns {*} Returns the result of `func`.\n */\n function apply(func, thisArg, args) {\n switch (args.length) {\n case 0: return func.call(thisArg);\n case 1: return func.call(thisArg, args[0]);\n case 2: return func.call(thisArg, args[0], args[1]);\n case 3: return func.call(thisArg, args[0], args[1], args[2]);\n }\n return func.apply(thisArg, args);\n }\n\n /**\n * A specialized version of `baseAggregator` for arrays.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function arrayAggregator(array, setter, iteratee, accumulator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n var value = array[index];\n setter(accumulator, value, iteratee(value), array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEach(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (iteratee(array[index], index, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.forEachRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEachRight(array, iteratee) {\n var length = array == null ? 0 : array.length;\n\n while (length--) {\n if (iteratee(array[length], length, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.every` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n */\n function arrayEvery(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (!predicate(array[index], index, array)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.includes` for arrays without support for\n * specifying an index to search from.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludes(array, value) {\n var length = array == null ? 0 : array.length;\n return !!length && baseIndexOf(array, value, 0) > -1;\n }\n\n /**\n * This function is like `arrayIncludes` except that it accepts a comparator.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludesWith(array, value, comparator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (comparator(value, array[index])) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `_.map` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function arrayMap(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length,\n result = Array(length);\n\n while (++index < length) {\n result[index] = iteratee(array[index], index, array);\n }\n return result;\n }\n\n /**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\n function arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n }\n\n /**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduce(array, iteratee, accumulator, initAccum) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n if (initAccum && length) {\n accumulator = array[++index];\n }\n while (++index < length) {\n accumulator = iteratee(accumulator, array[index], index, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.reduceRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the last element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduceRight(array, iteratee, accumulator, initAccum) {\n var length = array == null ? 0 : array.length;\n if (initAccum && length) {\n accumulator = array[--length];\n }\n while (length--) {\n accumulator = iteratee(accumulator, array[length], length, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * Gets the size of an ASCII `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n var asciiSize = baseProperty('length');\n\n /**\n * Converts an ASCII `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function asciiToArray(string) {\n return string.split('');\n }\n\n /**\n * Splits an ASCII `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function asciiWords(string) {\n return string.match(reAsciiWord) || [];\n }\n\n /**\n * The base implementation of methods like `_.findKey` and `_.findLastKey`,\n * without support for iteratee shorthands, which iterates over `collection`\n * using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the found element or its key, else `undefined`.\n */\n function baseFindKey(collection, predicate, eachFunc) {\n var result;\n eachFunc(collection, function(value, key, collection) {\n if (predicate(value, key, collection)) {\n result = key;\n return false;\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.findIndex` and `_.findLastIndex` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {number} fromIndex The index to search from.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseFindIndex(array, predicate, fromIndex, fromRight) {\n var length = array.length,\n index = fromIndex + (fromRight ? 1 : -1);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (predicate(array[index], index, array)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.indexOf` without `fromIndex` bounds checks.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOf(array, value, fromIndex) {\n return value === value\n ? strictIndexOf(array, value, fromIndex)\n : baseFindIndex(array, baseIsNaN, fromIndex);\n }\n\n /**\n * This function is like `baseIndexOf` except that it accepts a comparator.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOfWith(array, value, fromIndex, comparator) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (comparator(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.isNaN` without support for number objects.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n */\n function baseIsNaN(value) {\n return value !== value;\n }\n\n /**\n * The base implementation of `_.mean` and `_.meanBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the mean.\n */\n function baseMean(array, iteratee) {\n var length = array == null ? 0 : array.length;\n return length ? (baseSum(array, iteratee) / length) : NAN;\n }\n\n /**\n * The base implementation of `_.property` without support for deep paths.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function baseProperty(key) {\n return function(object) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.propertyOf` without support for deep paths.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyOf(object) {\n return function(key) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.reduce` and `_.reduceRight`, without support\n * for iteratee shorthands, which iterates over `collection` using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} accumulator The initial value.\n * @param {boolean} initAccum Specify using the first or last element of\n * `collection` as the initial value.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the accumulated value.\n */\n function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {\n eachFunc(collection, function(value, index, collection) {\n accumulator = initAccum\n ? (initAccum = false, value)\n : iteratee(accumulator, value, index, collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.sortBy` which uses `comparer` to define the\n * sort order of `array` and replaces criteria objects with their corresponding\n * values.\n *\n * @private\n * @param {Array} array The array to sort.\n * @param {Function} comparer The function to define sort order.\n * @returns {Array} Returns `array`.\n */\n function baseSortBy(array, comparer) {\n var length = array.length;\n\n array.sort(comparer);\n while (length--) {\n array[length] = array[length].value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.sum` and `_.sumBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the sum.\n */\n function baseSum(array, iteratee) {\n var result,\n index = -1,\n length = array.length;\n\n while (++index < length) {\n var current = iteratee(array[index]);\n if (current !== undefined) {\n result = result === undefined ? current : (result + current);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\n function baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array\n * of key-value pairs for `object` corresponding to the property names of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the key-value pairs.\n */\n function baseToPairs(object, props) {\n return arrayMap(props, function(key) {\n return [key, object[key]];\n });\n }\n\n /**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\n function baseUnary(func) {\n return function(value) {\n return func(value);\n };\n }\n\n /**\n * The base implementation of `_.values` and `_.valuesIn` which creates an\n * array of `object` property values corresponding to the property names\n * of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the array of property values.\n */\n function baseValues(object, props) {\n return arrayMap(props, function(key) {\n return object[key];\n });\n }\n\n /**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function cacheHas(cache, key) {\n return cache.has(key);\n }\n\n /**\n * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the first unmatched string symbol.\n */\n function charsStartIndex(strSymbols, chrSymbols) {\n var index = -1,\n length = strSymbols.length;\n\n while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the last unmatched string symbol.\n */\n function charsEndIndex(strSymbols, chrSymbols) {\n var index = strSymbols.length;\n\n while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Gets the number of `placeholder` occurrences in `array`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} placeholder The placeholder to search for.\n * @returns {number} Returns the placeholder count.\n */\n function countHolders(array, placeholder) {\n var length = array.length,\n result = 0;\n\n while (length--) {\n if (array[length] === placeholder) {\n ++result;\n }\n }\n return result;\n }\n\n /**\n * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A\n * letters to basic Latin letters.\n *\n * @private\n * @param {string} letter The matched letter to deburr.\n * @returns {string} Returns the deburred letter.\n */\n var deburrLetter = basePropertyOf(deburredLetters);\n\n /**\n * Used by `_.escape` to convert characters to HTML entities.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n var escapeHtmlChar = basePropertyOf(htmlEscapes);\n\n /**\n * Used by `_.template` to escape characters for inclusion in compiled string literals.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n function escapeStringChar(chr) {\n return '\\\\' + stringEscapes[chr];\n }\n\n /**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function getValue(object, key) {\n return object == null ? undefined : object[key];\n }\n\n /**\n * Checks if `string` contains Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a symbol is found, else `false`.\n */\n function hasUnicode(string) {\n return reHasUnicode.test(string);\n }\n\n /**\n * Checks if `string` contains a word composed of Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a word is found, else `false`.\n */\n function hasUnicodeWord(string) {\n return reHasUnicodeWord.test(string);\n }\n\n /**\n * Converts `iterator` to an array.\n *\n * @private\n * @param {Object} iterator The iterator to convert.\n * @returns {Array} Returns the converted array.\n */\n function iteratorToArray(iterator) {\n var data,\n result = [];\n\n while (!(data = iterator.next()).done) {\n result.push(data.value);\n }\n return result;\n }\n\n /**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\n function mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n }\n\n /**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n }\n\n /**\n * Replaces all `placeholder` elements in `array` with an internal placeholder\n * and returns an array of their indexes.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {*} placeholder The placeholder to replace.\n * @returns {Array} Returns the new array of placeholder indexes.\n */\n function replaceHolders(array, placeholder) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value === placeholder || value === PLACEHOLDER) {\n array[index] = PLACEHOLDER;\n result[resIndex++] = index;\n }\n }\n return result;\n }\n\n /**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\n function setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n }\n\n /**\n * Converts `set` to its value-value pairs.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the value-value pairs.\n */\n function setToPairs(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = [value, value];\n });\n return result;\n }\n\n /**\n * A specialized version of `_.indexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictIndexOf(array, value, fromIndex) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (array[index] === value) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * A specialized version of `_.lastIndexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictLastIndexOf(array, value, fromIndex) {\n var index = fromIndex + 1;\n while (index--) {\n if (array[index] === value) {\n return index;\n }\n }\n return index;\n }\n\n /**\n * Gets the number of symbols in `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the string size.\n */\n function stringSize(string) {\n return hasUnicode(string)\n ? unicodeSize(string)\n : asciiSize(string);\n }\n\n /**\n * Converts `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function stringToArray(string) {\n return hasUnicode(string)\n ? unicodeToArray(string)\n : asciiToArray(string);\n }\n\n /**\n * Used by `_.unescape` to convert HTML entities to characters.\n *\n * @private\n * @param {string} chr The matched character to unescape.\n * @returns {string} Returns the unescaped character.\n */\n var unescapeHtmlChar = basePropertyOf(htmlUnescapes);\n\n /**\n * Gets the size of a Unicode `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n function unicodeSize(string) {\n var result = reUnicode.lastIndex = 0;\n while (reUnicode.test(string)) {\n ++result;\n }\n return result;\n }\n\n /**\n * Converts a Unicode `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function unicodeToArray(string) {\n return string.match(reUnicode) || [];\n }\n\n /**\n * Splits a Unicode `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function unicodeWords(string) {\n return string.match(reUnicodeWord) || [];\n }\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Create a new pristine `lodash` function using the `context` object.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Util\n * @param {Object} [context=root] The context object.\n * @returns {Function} Returns a new `lodash` function.\n * @example\n *\n * _.mixin({ 'foo': _.constant('foo') });\n *\n * var lodash = _.runInContext();\n * lodash.mixin({ 'bar': lodash.constant('bar') });\n *\n * _.isFunction(_.foo);\n * // => true\n * _.isFunction(_.bar);\n * // => false\n *\n * lodash.isFunction(lodash.foo);\n * // => false\n * lodash.isFunction(lodash.bar);\n * // => true\n *\n * // Create a suped-up `defer` in Node.js.\n * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;\n */\n var runInContext = (function runInContext(context) {\n context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));\n\n /** Built-in constructor references. */\n var Array = context.Array,\n Date = context.Date,\n Error = context.Error,\n Function = context.Function,\n Math = context.Math,\n Object = context.Object,\n RegExp = context.RegExp,\n String = context.String,\n TypeError = context.TypeError;\n\n /** Used for built-in method references. */\n var arrayProto = Array.prototype,\n funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n /** Used to detect overreaching core-js shims. */\n var coreJsData = context['__core-js_shared__'];\n\n /** Used to resolve the decompiled source of functions. */\n var funcToString = funcProto.toString;\n\n /** Used to check objects for own properties. */\n var hasOwnProperty = objectProto.hasOwnProperty;\n\n /** Used to generate unique IDs. */\n var idCounter = 0;\n\n /** Used to detect methods masquerading as native. */\n var maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n }());\n\n /**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\n var nativeObjectToString = objectProto.toString;\n\n /** Used to infer the `Object` constructor. */\n var objectCtorString = funcToString.call(Object);\n\n /** Used to restore the original `_` reference in `_.noConflict`. */\n var oldDash = root._;\n\n /** Used to detect if a method is native. */\n var reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n );\n\n /** Built-in value references. */\n var Buffer = moduleExports ? context.Buffer : undefined,\n Symbol = context.Symbol,\n Uint8Array = context.Uint8Array,\n allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,\n getPrototype = overArg(Object.getPrototypeOf, Object),\n objectCreate = Object.create,\n propertyIsEnumerable = objectProto.propertyIsEnumerable,\n splice = arrayProto.splice,\n spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,\n symIterator = Symbol ? Symbol.iterator : undefined,\n symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n var defineProperty = (function() {\n try {\n var func = getNative(Object, 'defineProperty');\n func({}, '', {});\n return func;\n } catch (e) {}\n }());\n\n /** Mocked built-ins. */\n var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,\n ctxNow = Date && Date.now !== root.Date.now && Date.now,\n ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;\n\n /* Built-in method references for those with the same name as other `lodash` methods. */\n var nativeCeil = Math.ceil,\n nativeFloor = Math.floor,\n nativeGetSymbols = Object.getOwnPropertySymbols,\n nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n nativeIsFinite = context.isFinite,\n nativeJoin = arrayProto.join,\n nativeKeys = overArg(Object.keys, Object),\n nativeMax = Math.max,\n nativeMin = Math.min,\n nativeNow = Date.now,\n nativeParseInt = context.parseInt,\n nativeRandom = Math.random,\n nativeReverse = arrayProto.reverse;\n\n /* Built-in method references that are verified to be native. */\n var DataView = getNative(context, 'DataView'),\n Map = getNative(context, 'Map'),\n Promise = getNative(context, 'Promise'),\n Set = getNative(context, 'Set'),\n WeakMap = getNative(context, 'WeakMap'),\n nativeCreate = getNative(Object, 'create');\n\n /** Used to store function metadata. */\n var metaMap = WeakMap && new WeakMap;\n\n /** Used to lookup unminified function names. */\n var realNames = {};\n\n /** Used to detect maps, sets, and weakmaps. */\n var dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n /** Used to convert symbols to primitives and strings. */\n var symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,\n symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` object which wraps `value` to enable implicit method\n * chain sequences. Methods that operate on and return arrays, collections,\n * and functions can be chained together. Methods that retrieve a single value\n * or may return a primitive value will automatically end the chain sequence\n * and return the unwrapped value. Otherwise, the value must be unwrapped\n * with `_#value`.\n *\n * Explicit chain sequences, which must be unwrapped with `_#value`, may be\n * enabled using `_.chain`.\n *\n * The execution of chained methods is lazy, that is, it's deferred until\n * `_#value` is implicitly or explicitly called.\n *\n * Lazy evaluation allows several methods to support shortcut fusion.\n * Shortcut fusion is an optimization to merge iteratee calls; this avoids\n * the creation of intermediate arrays and can greatly reduce the number of\n * iteratee executions. Sections of a chain sequence qualify for shortcut\n * fusion if the section is applied to an array and iteratees accept only\n * one argument. The heuristic for whether a section qualifies for shortcut\n * fusion is subject to change.\n *\n * Chaining is supported in custom builds as long as the `_#value` method is\n * directly or indirectly included in the build.\n *\n * In addition to lodash methods, wrappers have `Array` and `String` methods.\n *\n * The wrapper `Array` methods are:\n * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`\n *\n * The wrapper `String` methods are:\n * `replace` and `split`\n *\n * The wrapper methods that support shortcut fusion are:\n * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,\n * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,\n * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`\n *\n * The chainable wrapper methods are:\n * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,\n * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,\n * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,\n * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,\n * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,\n * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,\n * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,\n * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,\n * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,\n * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,\n * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,\n * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,\n * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,\n * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,\n * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,\n * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,\n * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,\n * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,\n * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,\n * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,\n * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,\n * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,\n * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,\n * `zipObject`, `zipObjectDeep`, and `zipWith`\n *\n * The wrapper methods that are **not** chainable by default are:\n * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,\n * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,\n * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,\n * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,\n * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,\n * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,\n * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,\n * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,\n * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,\n * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,\n * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,\n * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,\n * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,\n * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,\n * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,\n * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,\n * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,\n * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,\n * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,\n * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,\n * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,\n * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,\n * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,\n * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,\n * `upperFirst`, `value`, and `words`\n *\n * @name _\n * @constructor\n * @category Seq\n * @param {*} value The value to wrap in a `lodash` instance.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2, 3]);\n *\n * // Returns an unwrapped value.\n * wrapped.reduce(_.add);\n * // => 6\n *\n * // Returns a wrapped value.\n * var squares = wrapped.map(square);\n *\n * _.isArray(squares);\n * // => false\n *\n * _.isArray(squares.value());\n * // => true\n */\n function lodash(value) {\n if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {\n if (value instanceof LodashWrapper) {\n return value;\n }\n if (hasOwnProperty.call(value, '__wrapped__')) {\n return wrapperClone(value);\n }\n }\n return new LodashWrapper(value);\n }\n\n /**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} proto The object to inherit from.\n * @returns {Object} Returns the new object.\n */\n var baseCreate = (function() {\n function object() {}\n return function(proto) {\n if (!isObject(proto)) {\n return {};\n }\n if (objectCreate) {\n return objectCreate(proto);\n }\n object.prototype = proto;\n var result = new object;\n object.prototype = undefined;\n return result;\n };\n }());\n\n /**\n * The function whose prototype chain sequence wrappers inherit from.\n *\n * @private\n */\n function baseLodash() {\n // No operation performed.\n }\n\n /**\n * The base constructor for creating `lodash` wrapper objects.\n *\n * @private\n * @param {*} value The value to wrap.\n * @param {boolean} [chainAll] Enable explicit method chain sequences.\n */\n function LodashWrapper(value, chainAll) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__chain__ = !!chainAll;\n this.__index__ = 0;\n this.__values__ = undefined;\n }\n\n /**\n * By default, the template delimiters used by lodash are like those in\n * embedded Ruby (ERB) as well as ES2015 template strings. Change the\n * following template settings to use alternative delimiters.\n *\n * @static\n * @memberOf _\n * @type {Object}\n */\n lodash.templateSettings = {\n\n /**\n * Used to detect `data` property values to be HTML-escaped.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'escape': reEscape,\n\n /**\n * Used to detect code to be evaluated.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'evaluate': reEvaluate,\n\n /**\n * Used to detect `data` property values to inject.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'interpolate': reInterpolate,\n\n /**\n * Used to reference the data object in the template text.\n *\n * @memberOf _.templateSettings\n * @type {string}\n */\n 'variable': '',\n\n /**\n * Used to import variables into the compiled template.\n *\n * @memberOf _.templateSettings\n * @type {Object}\n */\n 'imports': {\n\n /**\n * A reference to the `lodash` function.\n *\n * @memberOf _.templateSettings.imports\n * @type {Function}\n */\n '_': lodash\n }\n };\n\n // Ensure wrappers are instances of `baseLodash`.\n lodash.prototype = baseLodash.prototype;\n lodash.prototype.constructor = lodash;\n\n LodashWrapper.prototype = baseCreate(baseLodash.prototype);\n LodashWrapper.prototype.constructor = LodashWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.\n *\n * @private\n * @constructor\n * @param {*} value The value to wrap.\n */\n function LazyWrapper(value) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__dir__ = 1;\n this.__filtered__ = false;\n this.__iteratees__ = [];\n this.__takeCount__ = MAX_ARRAY_LENGTH;\n this.__views__ = [];\n }\n\n /**\n * Creates a clone of the lazy wrapper object.\n *\n * @private\n * @name clone\n * @memberOf LazyWrapper\n * @returns {Object} Returns the cloned `LazyWrapper` object.\n */\n function lazyClone() {\n var result = new LazyWrapper(this.__wrapped__);\n result.__actions__ = copyArray(this.__actions__);\n result.__dir__ = this.__dir__;\n result.__filtered__ = this.__filtered__;\n result.__iteratees__ = copyArray(this.__iteratees__);\n result.__takeCount__ = this.__takeCount__;\n result.__views__ = copyArray(this.__views__);\n return result;\n }\n\n /**\n * Reverses the direction of lazy iteration.\n *\n * @private\n * @name reverse\n * @memberOf LazyWrapper\n * @returns {Object} Returns the new reversed `LazyWrapper` object.\n */\n function lazyReverse() {\n if (this.__filtered__) {\n var result = new LazyWrapper(this);\n result.__dir__ = -1;\n result.__filtered__ = true;\n } else {\n result = this.clone();\n result.__dir__ *= -1;\n }\n return result;\n }\n\n /**\n * Extracts the unwrapped value from its lazy wrapper.\n *\n * @private\n * @name value\n * @memberOf LazyWrapper\n * @returns {*} Returns the unwrapped value.\n */\n function lazyValue() {\n var array = this.__wrapped__.value(),\n dir = this.__dir__,\n isArr = isArray(array),\n isRight = dir < 0,\n arrLength = isArr ? array.length : 0,\n view = getView(0, arrLength, this.__views__),\n start = view.start,\n end = view.end,\n length = end - start,\n index = isRight ? end : (start - 1),\n iteratees = this.__iteratees__,\n iterLength = iteratees.length,\n resIndex = 0,\n takeCount = nativeMin(length, this.__takeCount__);\n\n if (!isArr || (!isRight && arrLength == length && takeCount == length)) {\n return baseWrapperValue(array, this.__actions__);\n }\n var result = [];\n\n outer:\n while (length-- && resIndex < takeCount) {\n index += dir;\n\n var iterIndex = -1,\n value = array[index];\n\n while (++iterIndex < iterLength) {\n var data = iteratees[iterIndex],\n iteratee = data.iteratee,\n type = data.type,\n computed = iteratee(value);\n\n if (type == LAZY_MAP_FLAG) {\n value = computed;\n } else if (!computed) {\n if (type == LAZY_FILTER_FLAG) {\n continue outer;\n } else {\n break outer;\n }\n }\n }\n result[resIndex++] = value;\n }\n return result;\n }\n\n // Ensure `LazyWrapper` is an instance of `baseLodash`.\n LazyWrapper.prototype = baseCreate(baseLodash.prototype);\n LazyWrapper.prototype.constructor = LazyWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\n function hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n }\n\n /**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n }\n\n /**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\n function hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n }\n\n // Add methods to `Hash`.\n Hash.prototype.clear = hashClear;\n Hash.prototype['delete'] = hashDelete;\n Hash.prototype.get = hashGet;\n Hash.prototype.has = hashHas;\n Hash.prototype.set = hashSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\n function listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n }\n\n /**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n }\n\n /**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n }\n\n /**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\n function listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n }\n\n // Add methods to `ListCache`.\n ListCache.prototype.clear = listCacheClear;\n ListCache.prototype['delete'] = listCacheDelete;\n ListCache.prototype.get = listCacheGet;\n ListCache.prototype.has = listCacheHas;\n ListCache.prototype.set = listCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\n function mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n }\n\n /**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function mapCacheGet(key) {\n return getMapData(this, key).get(key);\n }\n\n /**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function mapCacheHas(key) {\n return getMapData(this, key).has(key);\n }\n\n /**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\n function mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n }\n\n // Add methods to `MapCache`.\n MapCache.prototype.clear = mapCacheClear;\n MapCache.prototype['delete'] = mapCacheDelete;\n MapCache.prototype.get = mapCacheGet;\n MapCache.prototype.has = mapCacheHas;\n MapCache.prototype.set = mapCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\n function SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n }\n\n /**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\n function setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n }\n\n /**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\n function setCacheHas(value) {\n return this.__data__.has(value);\n }\n\n // Add methods to `SetCache`.\n SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\n SetCache.prototype.has = setCacheHas;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n }\n\n /**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\n function stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n }\n\n /**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function stackGet(key) {\n return this.__data__.get(key);\n }\n\n /**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function stackHas(key) {\n return this.__data__.has(key);\n }\n\n /**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\n function stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n }\n\n // Add methods to `Stack`.\n Stack.prototype.clear = stackClear;\n Stack.prototype['delete'] = stackDelete;\n Stack.prototype.get = stackGet;\n Stack.prototype.has = stackHas;\n Stack.prototype.set = stackSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\n function arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.sample` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @returns {*} Returns the random element.\n */\n function arraySample(array) {\n var length = array.length;\n return length ? array[baseRandom(0, length - 1)] : undefined;\n }\n\n /**\n * A specialized version of `_.sampleSize` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function arraySampleSize(array, n) {\n return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));\n }\n\n /**\n * A specialized version of `_.shuffle` for arrays.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function arrayShuffle(array) {\n return shuffleSelf(copyArray(array));\n }\n\n /**\n * This function is like `assignValue` except that it doesn't assign\n * `undefined` values.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignMergeValue(object, key, value) {\n if ((value !== undefined && !eq(object[key], value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignValue(object, key, value) {\n var objValue = object[key];\n if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n }\n\n /**\n * Aggregates elements of `collection` on `accumulator` with keys transformed\n * by `iteratee` and values set by `setter`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseAggregator(collection, setter, iteratee, accumulator) {\n baseEach(collection, function(value, key, collection) {\n setter(accumulator, value, iteratee(value), collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssign(object, source) {\n return object && copyObject(source, keys(source), object);\n }\n\n /**\n * The base implementation of `_.assignIn` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssignIn(object, source) {\n return object && copyObject(source, keysIn(source), object);\n }\n\n /**\n * The base implementation of `assignValue` and `assignMergeValue` without\n * value checks.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function baseAssignValue(object, key, value) {\n if (key == '__proto__' && defineProperty) {\n defineProperty(object, key, {\n 'configurable': true,\n 'enumerable': true,\n 'value': value,\n 'writable': true\n });\n } else {\n object[key] = value;\n }\n }\n\n /**\n * The base implementation of `_.at` without support for individual paths.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {string[]} paths The property paths to pick.\n * @returns {Array} Returns the picked elements.\n */\n function baseAt(object, paths) {\n var index = -1,\n length = paths.length,\n result = Array(length),\n skip = object == null;\n\n while (++index < length) {\n result[index] = skip ? undefined : get(object, paths[index]);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.clamp` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n */\n function baseClamp(number, lower, upper) {\n if (number === number) {\n if (upper !== undefined) {\n number = number <= upper ? number : upper;\n }\n if (lower !== undefined) {\n number = number >= lower ? number : lower;\n }\n }\n return number;\n }\n\n /**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Deep clone\n * 2 - Flatten inherited properties\n * 4 - Clone symbols\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\n function baseClone(value, bitmask, customizer, key, object, stack) {\n var result,\n isDeep = bitmask & CLONE_DEEP_FLAG,\n isFlat = bitmask & CLONE_FLAT_FLAG,\n isFull = bitmask & CLONE_SYMBOLS_FLAG;\n\n if (customizer) {\n result = object ? customizer(value, key, object, stack) : customizer(value);\n }\n if (result !== undefined) {\n return result;\n }\n if (!isObject(value)) {\n return value;\n }\n var isArr = isArray(value);\n if (isArr) {\n result = initCloneArray(value);\n if (!isDeep) {\n return copyArray(value, result);\n }\n } else {\n var tag = getTag(value),\n isFunc = tag == funcTag || tag == genTag;\n\n if (isBuffer(value)) {\n return cloneBuffer(value, isDeep);\n }\n if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n result = (isFlat || isFunc) ? {} : initCloneObject(value);\n if (!isDeep) {\n return isFlat\n ? copySymbolsIn(value, baseAssignIn(result, value))\n : copySymbols(value, baseAssign(result, value));\n }\n } else {\n if (!cloneableTags[tag]) {\n return object ? value : {};\n }\n result = initCloneByTag(value, tag, isDeep);\n }\n }\n // Check for circular references and return its corresponding clone.\n stack || (stack = new Stack);\n var stacked = stack.get(value);\n if (stacked) {\n return stacked;\n }\n stack.set(value, result);\n\n if (isSet(value)) {\n value.forEach(function(subValue) {\n result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));\n });\n } else if (isMap(value)) {\n value.forEach(function(subValue, key) {\n result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n }\n\n var keysFunc = isFull\n ? (isFlat ? getAllKeysIn : getAllKeys)\n : (isFlat ? keysIn : keys);\n\n var props = isArr ? undefined : keysFunc(value);\n arrayEach(props || value, function(subValue, key) {\n if (props) {\n key = subValue;\n subValue = value[key];\n }\n // Recursively populate clone (susceptible to call stack limits).\n assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n return result;\n }\n\n /**\n * The base implementation of `_.conforms` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n */\n function baseConforms(source) {\n var props = keys(source);\n return function(object) {\n return baseConformsTo(object, source, props);\n };\n }\n\n /**\n * The base implementation of `_.conformsTo` which accepts `props` to check.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n */\n function baseConformsTo(object, source, props) {\n var length = props.length;\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (length--) {\n var key = props[length],\n predicate = source[key],\n value = object[key];\n\n if ((value === undefined && !(key in object)) || !predicate(value)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.delay` and `_.defer` which accepts `args`\n * to provide to `func`.\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {Array} args The arguments to provide to `func`.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n function baseDelay(func, wait, args) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return setTimeout(function() { func.apply(undefined, args); }, wait);\n }\n\n /**\n * The base implementation of methods like `_.difference` without support\n * for excluding multiple arrays or iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Array} values The values to exclude.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n */\n function baseDifference(array, values, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n isCommon = true,\n length = array.length,\n result = [],\n valuesLength = values.length;\n\n if (!length) {\n return result;\n }\n if (iteratee) {\n values = arrayMap(values, baseUnary(iteratee));\n }\n if (comparator) {\n includes = arrayIncludesWith;\n isCommon = false;\n }\n else if (values.length >= LARGE_ARRAY_SIZE) {\n includes = cacheHas;\n isCommon = false;\n values = new SetCache(values);\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee == null ? value : iteratee(value);\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var valuesIndex = valuesLength;\n while (valuesIndex--) {\n if (values[valuesIndex] === computed) {\n continue outer;\n }\n }\n result.push(value);\n }\n else if (!includes(values, computed, comparator)) {\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEach = createBaseEach(baseForOwn);\n\n /**\n * The base implementation of `_.forEachRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEachRight = createBaseEach(baseForOwnRight, true);\n\n /**\n * The base implementation of `_.every` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`\n */\n function baseEvery(collection, predicate) {\n var result = true;\n baseEach(collection, function(value, index, collection) {\n result = !!predicate(value, index, collection);\n return result;\n });\n return result;\n }\n\n /**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\n function baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.fill` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n */\n function baseFill(array, value, start, end) {\n var length = array.length;\n\n start = toInteger(start);\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = (end === undefined || end > length) ? length : toInteger(end);\n if (end < 0) {\n end += length;\n }\n end = start > end ? 0 : toLength(end);\n while (start < end) {\n array[start++] = value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.filter` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function baseFilter(collection, predicate) {\n var result = [];\n baseEach(collection, function(value, index, collection) {\n if (predicate(value, index, collection)) {\n result.push(value);\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.flatten` with support for restricting flattening.\n *\n * @private\n * @param {Array} array The array to flatten.\n * @param {number} depth The maximum recursion depth.\n * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.\n * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.\n * @param {Array} [result=[]] The initial result value.\n * @returns {Array} Returns the new flattened array.\n */\n function baseFlatten(array, depth, predicate, isStrict, result) {\n var index = -1,\n length = array.length;\n\n predicate || (predicate = isFlattenable);\n result || (result = []);\n\n while (++index < length) {\n var value = array[index];\n if (depth > 0 && predicate(value)) {\n if (depth > 1) {\n // Recursively flatten arrays (susceptible to call stack limits).\n baseFlatten(value, depth - 1, predicate, isStrict, result);\n } else {\n arrayPush(result, value);\n }\n } else if (!isStrict) {\n result[result.length] = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `baseForOwn` which iterates over `object`\n * properties returned by `keysFunc` and invokes `iteratee` for each property.\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseFor = createBaseFor();\n\n /**\n * This function is like `baseFor` except that it iterates over properties\n * in the opposite order.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseForRight = createBaseFor(true);\n\n /**\n * The base implementation of `_.forOwn` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwn(object, iteratee) {\n return object && baseFor(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.forOwnRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwnRight(object, iteratee) {\n return object && baseForRight(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.functions` which creates an array of\n * `object` function property names filtered from `props`.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Array} props The property names to filter.\n * @returns {Array} Returns the function names.\n */\n function baseFunctions(object, props) {\n return arrayFilter(props, function(key) {\n return isFunction(object[key]);\n });\n }\n\n /**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\n function baseGet(object, path) {\n path = castPath(path, object);\n\n var index = 0,\n length = path.length;\n\n while (object != null && index < length) {\n object = object[toKey(path[index++])];\n }\n return (index && index == length) ? object : undefined;\n }\n\n /**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n }\n\n /**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n function baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n }\n\n /**\n * The base implementation of `_.gt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n */\n function baseGt(value, other) {\n return value > other;\n }\n\n /**\n * The base implementation of `_.has` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHas(object, key) {\n return object != null && hasOwnProperty.call(object, key);\n }\n\n /**\n * The base implementation of `_.hasIn` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHasIn(object, key) {\n return object != null && key in Object(object);\n }\n\n /**\n * The base implementation of `_.inRange` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to check.\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n */\n function baseInRange(number, start, end) {\n return number >= nativeMin(start, end) && number < nativeMax(start, end);\n }\n\n /**\n * The base implementation of methods like `_.intersection`, without support\n * for iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of shared values.\n */\n function baseIntersection(arrays, iteratee, comparator) {\n var includes = comparator ? arrayIncludesWith : arrayIncludes,\n length = arrays[0].length,\n othLength = arrays.length,\n othIndex = othLength,\n caches = Array(othLength),\n maxLength = Infinity,\n result = [];\n\n while (othIndex--) {\n var array = arrays[othIndex];\n if (othIndex && iteratee) {\n array = arrayMap(array, baseUnary(iteratee));\n }\n maxLength = nativeMin(array.length, maxLength);\n caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))\n ? new SetCache(othIndex && array)\n : undefined;\n }\n array = arrays[0];\n\n var index = -1,\n seen = caches[0];\n\n outer:\n while (++index < length && result.length < maxLength) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (!(seen\n ? cacheHas(seen, computed)\n : includes(result, computed, comparator)\n )) {\n othIndex = othLength;\n while (--othIndex) {\n var cache = caches[othIndex];\n if (!(cache\n ? cacheHas(cache, computed)\n : includes(arrays[othIndex], computed, comparator))\n ) {\n continue outer;\n }\n }\n if (seen) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.invert` and `_.invertBy` which inverts\n * `object` with values transformed by `iteratee` and set by `setter`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform values.\n * @param {Object} accumulator The initial inverted object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseInverter(object, setter, iteratee, accumulator) {\n baseForOwn(object, function(value, key, object) {\n setter(accumulator, iteratee(value), key, object);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.invoke` without support for individual\n * method arguments.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {Array} args The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n */\n function baseInvoke(object, path, args) {\n path = castPath(path, object);\n object = parent(object, path);\n var func = object == null ? object : object[toKey(last(path))];\n return func == null ? undefined : apply(func, object, args);\n }\n\n /**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\n function baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n }\n\n /**\n * The base implementation of `_.isArrayBuffer` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n */\n function baseIsArrayBuffer(value) {\n return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;\n }\n\n /**\n * The base implementation of `_.isDate` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n */\n function baseIsDate(value) {\n return isObjectLike(value) && baseGetTag(value) == dateTag;\n }\n\n /**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\n function baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n }\n\n /**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n }\n\n /**\n * The base implementation of `_.isMap` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n */\n function baseIsMap(value) {\n return isObjectLike(value) && getTag(value) == mapTag;\n }\n\n /**\n * The base implementation of `_.isMatch` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Array} matchData The property names, values, and compare flags to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n */\n function baseIsMatch(object, source, matchData, customizer) {\n var index = matchData.length,\n length = index,\n noCustomizer = !customizer;\n\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (index--) {\n var data = matchData[index];\n if ((noCustomizer && data[2])\n ? data[1] !== object[data[0]]\n : !(data[0] in object)\n ) {\n return false;\n }\n }\n while (++index < length) {\n data = matchData[index];\n var key = data[0],\n objValue = object[key],\n srcValue = data[1];\n\n if (noCustomizer && data[2]) {\n if (objValue === undefined && !(key in object)) {\n return false;\n }\n } else {\n var stack = new Stack;\n if (customizer) {\n var result = customizer(objValue, srcValue, key, object, source, stack);\n }\n if (!(result === undefined\n ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)\n : result\n )) {\n return false;\n }\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\n function baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n }\n\n /**\n * The base implementation of `_.isRegExp` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n */\n function baseIsRegExp(value) {\n return isObjectLike(value) && baseGetTag(value) == regexpTag;\n }\n\n /**\n * The base implementation of `_.isSet` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n */\n function baseIsSet(value) {\n return isObjectLike(value) && getTag(value) == setTag;\n }\n\n /**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\n function baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n }\n\n /**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\n function baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n }\n\n /**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeysIn(object) {\n if (!isObject(object)) {\n return nativeKeysIn(object);\n }\n var isProto = isPrototype(object),\n result = [];\n\n for (var key in object) {\n if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.lt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n */\n function baseLt(value, other) {\n return value < other;\n }\n\n /**\n * The base implementation of `_.map` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function baseMap(collection, iteratee) {\n var index = -1,\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value, key, collection) {\n result[++index] = iteratee(value, key, collection);\n });\n return result;\n }\n\n /**\n * The base implementation of `_.matches` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatches(source) {\n var matchData = getMatchData(source);\n if (matchData.length == 1 && matchData[0][2]) {\n return matchesStrictComparable(matchData[0][0], matchData[0][1]);\n }\n return function(object) {\n return object === source || baseIsMatch(object, source, matchData);\n };\n }\n\n /**\n * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.\n *\n * @private\n * @param {string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatchesProperty(path, srcValue) {\n if (isKey(path) && isStrictComparable(srcValue)) {\n return matchesStrictComparable(toKey(path), srcValue);\n }\n return function(object) {\n var objValue = get(object, path);\n return (objValue === undefined && objValue === srcValue)\n ? hasIn(object, path)\n : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);\n };\n }\n\n /**\n * The base implementation of `_.merge` without support for multiple sources.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} [customizer] The function to customize merged values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMerge(object, source, srcIndex, customizer, stack) {\n if (object === source) {\n return;\n }\n baseFor(source, function(srcValue, key) {\n stack || (stack = new Stack);\n if (isObject(srcValue)) {\n baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);\n }\n else {\n var newValue = customizer\n ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)\n : undefined;\n\n if (newValue === undefined) {\n newValue = srcValue;\n }\n assignMergeValue(object, key, newValue);\n }\n }, keysIn);\n }\n\n /**\n * A specialized version of `baseMerge` for arrays and objects which performs\n * deep merges and tracks traversed objects enabling objects with circular\n * references to be merged.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {string} key The key of the value to merge.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} mergeFunc The function to merge values.\n * @param {Function} [customizer] The function to customize assigned values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {\n var objValue = safeGet(object, key),\n srcValue = safeGet(source, key),\n stacked = stack.get(srcValue);\n\n if (stacked) {\n assignMergeValue(object, key, stacked);\n return;\n }\n var newValue = customizer\n ? customizer(objValue, srcValue, (key + ''), object, source, stack)\n : undefined;\n\n var isCommon = newValue === undefined;\n\n if (isCommon) {\n var isArr = isArray(srcValue),\n isBuff = !isArr && isBuffer(srcValue),\n isTyped = !isArr && !isBuff && isTypedArray(srcValue);\n\n newValue = srcValue;\n if (isArr || isBuff || isTyped) {\n if (isArray(objValue)) {\n newValue = objValue;\n }\n else if (isArrayLikeObject(objValue)) {\n newValue = copyArray(objValue);\n }\n else if (isBuff) {\n isCommon = false;\n newValue = cloneBuffer(srcValue, true);\n }\n else if (isTyped) {\n isCommon = false;\n newValue = cloneTypedArray(srcValue, true);\n }\n else {\n newValue = [];\n }\n }\n else if (isPlainObject(srcValue) || isArguments(srcValue)) {\n newValue = objValue;\n if (isArguments(objValue)) {\n newValue = toPlainObject(objValue);\n }\n else if (!isObject(objValue) || isFunction(objValue)) {\n newValue = initCloneObject(srcValue);\n }\n }\n else {\n isCommon = false;\n }\n }\n if (isCommon) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, newValue);\n mergeFunc(newValue, srcValue, srcIndex, customizer, stack);\n stack['delete'](srcValue);\n }\n assignMergeValue(object, key, newValue);\n }\n\n /**\n * The base implementation of `_.nth` which doesn't coerce arguments.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {number} n The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n */\n function baseNth(array, n) {\n var length = array.length;\n if (!length) {\n return;\n }\n n += n < 0 ? length : 0;\n return isIndex(n, length) ? array[n] : undefined;\n }\n\n /**\n * The base implementation of `_.orderBy` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.\n * @param {string[]} orders The sort orders of `iteratees`.\n * @returns {Array} Returns the new sorted array.\n */\n function baseOrderBy(collection, iteratees, orders) {\n var index = -1;\n iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));\n\n var result = baseMap(collection, function(value, key, collection) {\n var criteria = arrayMap(iteratees, function(iteratee) {\n return iteratee(value);\n });\n return { 'criteria': criteria, 'index': ++index, 'value': value };\n });\n\n return baseSortBy(result, function(object, other) {\n return compareMultiple(object, other, orders);\n });\n }\n\n /**\n * The base implementation of `_.pick` without support for individual\n * property identifiers.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @returns {Object} Returns the new object.\n */\n function basePick(object, paths) {\n return basePickBy(object, paths, function(value, path) {\n return hasIn(object, path);\n });\n }\n\n /**\n * The base implementation of `_.pickBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @param {Function} predicate The function invoked per property.\n * @returns {Object} Returns the new object.\n */\n function basePickBy(object, paths, predicate) {\n var index = -1,\n length = paths.length,\n result = {};\n\n while (++index < length) {\n var path = paths[index],\n value = baseGet(object, path);\n\n if (predicate(value, path)) {\n baseSet(result, castPath(path, object), value);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `baseProperty` which supports deep paths.\n *\n * @private\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyDeep(path) {\n return function(object) {\n return baseGet(object, path);\n };\n }\n\n /**\n * The base implementation of `_.pullAllBy` without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n */\n function basePullAll(array, values, iteratee, comparator) {\n var indexOf = comparator ? baseIndexOfWith : baseIndexOf,\n index = -1,\n length = values.length,\n seen = array;\n\n if (array === values) {\n values = copyArray(values);\n }\n if (iteratee) {\n seen = arrayMap(array, baseUnary(iteratee));\n }\n while (++index < length) {\n var fromIndex = 0,\n value = values[index],\n computed = iteratee ? iteratee(value) : value;\n\n while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {\n if (seen !== array) {\n splice.call(seen, fromIndex, 1);\n }\n splice.call(array, fromIndex, 1);\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.pullAt` without support for individual\n * indexes or capturing the removed elements.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {number[]} indexes The indexes of elements to remove.\n * @returns {Array} Returns `array`.\n */\n function basePullAt(array, indexes) {\n var length = array ? indexes.length : 0,\n lastIndex = length - 1;\n\n while (length--) {\n var index = indexes[length];\n if (length == lastIndex || index !== previous) {\n var previous = index;\n if (isIndex(index)) {\n splice.call(array, index, 1);\n } else {\n baseUnset(array, index);\n }\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.random` without support for returning\n * floating-point numbers.\n *\n * @private\n * @param {number} lower The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the random number.\n */\n function baseRandom(lower, upper) {\n return lower + nativeFloor(nativeRandom() * (upper - lower + 1));\n }\n\n /**\n * The base implementation of `_.range` and `_.rangeRight` which doesn't\n * coerce arguments.\n *\n * @private\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @param {number} step The value to increment or decrement by.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the range of numbers.\n */\n function baseRange(start, end, step, fromRight) {\n var index = -1,\n length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),\n result = Array(length);\n\n while (length--) {\n result[fromRight ? length : ++index] = start;\n start += step;\n }\n return result;\n }\n\n /**\n * The base implementation of `_.repeat` which doesn't coerce arguments.\n *\n * @private\n * @param {string} string The string to repeat.\n * @param {number} n The number of times to repeat the string.\n * @returns {string} Returns the repeated string.\n */\n function baseRepeat(string, n) {\n var result = '';\n if (!string || n < 1 || n > MAX_SAFE_INTEGER) {\n return result;\n }\n // Leverage the exponentiation by squaring algorithm for a faster repeat.\n // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.\n do {\n if (n % 2) {\n result += string;\n }\n n = nativeFloor(n / 2);\n if (n) {\n string += string;\n }\n } while (n);\n\n return result;\n }\n\n /**\n * The base implementation of `_.rest` which doesn't validate or coerce arguments.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n */\n function baseRest(func, start) {\n return setToString(overRest(func, start, identity), func + '');\n }\n\n /**\n * The base implementation of `_.sample`.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n */\n function baseSample(collection) {\n return arraySample(values(collection));\n }\n\n /**\n * The base implementation of `_.sampleSize` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function baseSampleSize(collection, n) {\n var array = values(collection);\n return shuffleSelf(array, baseClamp(n, 0, array.length));\n }\n\n /**\n * The base implementation of `_.set`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseSet(object, path, value, customizer) {\n if (!isObject(object)) {\n return object;\n }\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n nested = object;\n\n while (nested != null && ++index < length) {\n var key = toKey(path[index]),\n newValue = value;\n\n if (index != lastIndex) {\n var objValue = nested[key];\n newValue = customizer ? customizer(objValue, key, nested) : undefined;\n if (newValue === undefined) {\n newValue = isObject(objValue)\n ? objValue\n : (isIndex(path[index + 1]) ? [] : {});\n }\n }\n assignValue(nested, key, newValue);\n nested = nested[key];\n }\n return object;\n }\n\n /**\n * The base implementation of `setData` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var baseSetData = !metaMap ? identity : function(func, data) {\n metaMap.set(func, data);\n return func;\n };\n\n /**\n * The base implementation of `setToString` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var baseSetToString = !defineProperty ? identity : function(func, string) {\n return defineProperty(func, 'toString', {\n 'configurable': true,\n 'enumerable': false,\n 'value': constant(string),\n 'writable': true\n });\n };\n\n /**\n * The base implementation of `_.shuffle`.\n *\n * @private\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function baseShuffle(collection) {\n return shuffleSelf(values(collection));\n }\n\n /**\n * The base implementation of `_.slice` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseSlice(array, start, end) {\n var index = -1,\n length = array.length;\n\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = end > length ? length : end;\n if (end < 0) {\n end += length;\n }\n length = start > end ? 0 : ((end - start) >>> 0);\n start >>>= 0;\n\n var result = Array(length);\n while (++index < length) {\n result[index] = array[index + start];\n }\n return result;\n }\n\n /**\n * The base implementation of `_.some` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function baseSome(collection, predicate) {\n var result;\n\n baseEach(collection, function(value, index, collection) {\n result = predicate(value, index, collection);\n return !result;\n });\n return !!result;\n }\n\n /**\n * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which\n * performs a binary search of `array` to determine the index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndex(array, value, retHighest) {\n var low = 0,\n high = array == null ? low : array.length;\n\n if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {\n while (low < high) {\n var mid = (low + high) >>> 1,\n computed = array[mid];\n\n if (computed !== null && !isSymbol(computed) &&\n (retHighest ? (computed <= value) : (computed < value))) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return high;\n }\n return baseSortedIndexBy(array, value, identity, retHighest);\n }\n\n /**\n * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`\n * which invokes `iteratee` for `value` and each element of `array` to compute\n * their sort ranking. The iteratee is invoked with one argument; (value).\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} iteratee The iteratee invoked per element.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndexBy(array, value, iteratee, retHighest) {\n value = iteratee(value);\n\n var low = 0,\n high = array == null ? 0 : array.length,\n valIsNaN = value !== value,\n valIsNull = value === null,\n valIsSymbol = isSymbol(value),\n valIsUndefined = value === undefined;\n\n while (low < high) {\n var mid = nativeFloor((low + high) / 2),\n computed = iteratee(array[mid]),\n othIsDefined = computed !== undefined,\n othIsNull = computed === null,\n othIsReflexive = computed === computed,\n othIsSymbol = isSymbol(computed);\n\n if (valIsNaN) {\n var setLow = retHighest || othIsReflexive;\n } else if (valIsUndefined) {\n setLow = othIsReflexive && (retHighest || othIsDefined);\n } else if (valIsNull) {\n setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);\n } else if (valIsSymbol) {\n setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);\n } else if (othIsNull || othIsSymbol) {\n setLow = false;\n } else {\n setLow = retHighest ? (computed <= value) : (computed < value);\n }\n if (setLow) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return nativeMin(high, MAX_ARRAY_INDEX);\n }\n\n /**\n * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseSortedUniq(array, iteratee) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n if (!index || !eq(computed, seen)) {\n var seen = computed;\n result[resIndex++] = value === 0 ? 0 : value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toNumber` which doesn't ensure correct\n * conversions of binary, hexadecimal, or octal string values.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n */\n function baseToNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n return +value;\n }\n\n /**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\n function baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n if (isArray(value)) {\n // Recursively convert values (susceptible to call stack limits).\n return arrayMap(value, baseToString) + '';\n }\n if (isSymbol(value)) {\n return symbolToString ? symbolToString.call(value) : '';\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * The base implementation of `_.uniqBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseUniq(array, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n length = array.length,\n isCommon = true,\n result = [],\n seen = result;\n\n if (comparator) {\n isCommon = false;\n includes = arrayIncludesWith;\n }\n else if (length >= LARGE_ARRAY_SIZE) {\n var set = iteratee ? null : createSet(array);\n if (set) {\n return setToArray(set);\n }\n isCommon = false;\n includes = cacheHas;\n seen = new SetCache;\n }\n else {\n seen = iteratee ? [] : result;\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var seenIndex = seen.length;\n while (seenIndex--) {\n if (seen[seenIndex] === computed) {\n continue outer;\n }\n }\n if (iteratee) {\n seen.push(computed);\n }\n result.push(value);\n }\n else if (!includes(seen, computed, comparator)) {\n if (seen !== result) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.unset`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The property path to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n */\n function baseUnset(object, path) {\n path = castPath(path, object);\n object = parent(object, path);\n return object == null || delete object[toKey(last(path))];\n }\n\n /**\n * The base implementation of `_.update`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to update.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseUpdate(object, path, updater, customizer) {\n return baseSet(object, path, updater(baseGet(object, path)), customizer);\n }\n\n /**\n * The base implementation of methods like `_.dropWhile` and `_.takeWhile`\n * without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {Function} predicate The function invoked per iteration.\n * @param {boolean} [isDrop] Specify dropping elements instead of taking them.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseWhile(array, predicate, isDrop, fromRight) {\n var length = array.length,\n index = fromRight ? length : -1;\n\n while ((fromRight ? index-- : ++index < length) &&\n predicate(array[index], index, array)) {}\n\n return isDrop\n ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))\n : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));\n }\n\n /**\n * The base implementation of `wrapperValue` which returns the result of\n * performing a sequence of actions on the unwrapped `value`, where each\n * successive action is supplied the return value of the previous.\n *\n * @private\n * @param {*} value The unwrapped value.\n * @param {Array} actions Actions to perform to resolve the unwrapped value.\n * @returns {*} Returns the resolved value.\n */\n function baseWrapperValue(value, actions) {\n var result = value;\n if (result instanceof LazyWrapper) {\n result = result.value();\n }\n return arrayReduce(actions, function(result, action) {\n return action.func.apply(action.thisArg, arrayPush([result], action.args));\n }, result);\n }\n\n /**\n * The base implementation of methods like `_.xor`, without support for\n * iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of values.\n */\n function baseXor(arrays, iteratee, comparator) {\n var length = arrays.length;\n if (length < 2) {\n return length ? baseUniq(arrays[0]) : [];\n }\n var index = -1,\n result = Array(length);\n\n while (++index < length) {\n var array = arrays[index],\n othIndex = -1;\n\n while (++othIndex < length) {\n if (othIndex != index) {\n result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);\n }\n }\n }\n return baseUniq(baseFlatten(result, 1), iteratee, comparator);\n }\n\n /**\n * This base implementation of `_.zipObject` which assigns values using `assignFunc`.\n *\n * @private\n * @param {Array} props The property identifiers.\n * @param {Array} values The property values.\n * @param {Function} assignFunc The function to assign values.\n * @returns {Object} Returns the new object.\n */\n function baseZipObject(props, values, assignFunc) {\n var index = -1,\n length = props.length,\n valsLength = values.length,\n result = {};\n\n while (++index < length) {\n var value = index < valsLength ? values[index] : undefined;\n assignFunc(result, props[index], value);\n }\n return result;\n }\n\n /**\n * Casts `value` to an empty array if it's not an array like object.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array|Object} Returns the cast array-like object.\n */\n function castArrayLikeObject(value) {\n return isArrayLikeObject(value) ? value : [];\n }\n\n /**\n * Casts `value` to `identity` if it's not a function.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Function} Returns cast function.\n */\n function castFunction(value) {\n return typeof value == 'function' ? value : identity;\n }\n\n /**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {Object} [object] The object to query keys on.\n * @returns {Array} Returns the cast property path array.\n */\n function castPath(value, object) {\n if (isArray(value)) {\n return value;\n }\n return isKey(value, object) ? [value] : stringToPath(toString(value));\n }\n\n /**\n * A `baseRest` alias which can be replaced with `identity` by module\n * replacement plugins.\n *\n * @private\n * @type {Function}\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n var castRest = baseRest;\n\n /**\n * Casts `array` to a slice if it's needed.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {number} start The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the cast slice.\n */\n function castSlice(array, start, end) {\n var length = array.length;\n end = end === undefined ? length : end;\n return (!start && end >= length) ? array : baseSlice(array, start, end);\n }\n\n /**\n * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).\n *\n * @private\n * @param {number|Object} id The timer id or timeout object of the timer to clear.\n */\n var clearTimeout = ctxClearTimeout || function(id) {\n return root.clearTimeout(id);\n };\n\n /**\n * Creates a clone of `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\n function cloneBuffer(buffer, isDeep) {\n if (isDeep) {\n return buffer.slice();\n }\n var length = buffer.length,\n result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);\n\n buffer.copy(result);\n return result;\n }\n\n /**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\n function cloneArrayBuffer(arrayBuffer) {\n var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n return result;\n }\n\n /**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\n function cloneDataView(dataView, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n }\n\n /**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\n function cloneRegExp(regexp) {\n var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n result.lastIndex = regexp.lastIndex;\n return result;\n }\n\n /**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\n function cloneSymbol(symbol) {\n return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n }\n\n /**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\n function cloneTypedArray(typedArray, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n }\n\n /**\n * Compares values to sort them in ascending order.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {number} Returns the sort order indicator for `value`.\n */\n function compareAscending(value, other) {\n if (value !== other) {\n var valIsDefined = value !== undefined,\n valIsNull = value === null,\n valIsReflexive = value === value,\n valIsSymbol = isSymbol(value);\n\n var othIsDefined = other !== undefined,\n othIsNull = other === null,\n othIsReflexive = other === other,\n othIsSymbol = isSymbol(other);\n\n if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||\n (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||\n (valIsNull && othIsDefined && othIsReflexive) ||\n (!valIsDefined && othIsReflexive) ||\n !valIsReflexive) {\n return 1;\n }\n if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||\n (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||\n (othIsNull && valIsDefined && valIsReflexive) ||\n (!othIsDefined && valIsReflexive) ||\n !othIsReflexive) {\n return -1;\n }\n }\n return 0;\n }\n\n /**\n * Used by `_.orderBy` to compare multiple properties of a value to another\n * and stable sort them.\n *\n * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,\n * specify an order of \"desc\" for descending or \"asc\" for ascending sort order\n * of corresponding values.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {boolean[]|string[]} orders The order to sort by for each property.\n * @returns {number} Returns the sort order indicator for `object`.\n */\n function compareMultiple(object, other, orders) {\n var index = -1,\n objCriteria = object.criteria,\n othCriteria = other.criteria,\n length = objCriteria.length,\n ordersLength = orders.length;\n\n while (++index < length) {\n var result = compareAscending(objCriteria[index], othCriteria[index]);\n if (result) {\n if (index >= ordersLength) {\n return result;\n }\n var order = orders[index];\n return result * (order == 'desc' ? -1 : 1);\n }\n }\n // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications\n // that causes it, under certain circumstances, to provide the same value for\n // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247\n // for more details.\n //\n // This also ensures a stable sort in V8 and other engines.\n // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.\n return object.index - other.index;\n }\n\n /**\n * Creates an array that is the composition of partially applied arguments,\n * placeholders, and provided arguments into a single array of arguments.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to prepend to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgs(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersLength = holders.length,\n leftIndex = -1,\n leftLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(leftLength + rangeLength),\n isUncurried = !isCurried;\n\n while (++leftIndex < leftLength) {\n result[leftIndex] = partials[leftIndex];\n }\n while (++argsIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[holders[argsIndex]] = args[argsIndex];\n }\n }\n while (rangeLength--) {\n result[leftIndex++] = args[argsIndex++];\n }\n return result;\n }\n\n /**\n * This function is like `composeArgs` except that the arguments composition\n * is tailored for `_.partialRight`.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to append to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgsRight(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersIndex = -1,\n holdersLength = holders.length,\n rightIndex = -1,\n rightLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(rangeLength + rightLength),\n isUncurried = !isCurried;\n\n while (++argsIndex < rangeLength) {\n result[argsIndex] = args[argsIndex];\n }\n var offset = argsIndex;\n while (++rightIndex < rightLength) {\n result[offset + rightIndex] = partials[rightIndex];\n }\n while (++holdersIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[offset + holders[holdersIndex]] = args[argsIndex++];\n }\n }\n return result;\n }\n\n /**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\n function copyArray(source, array) {\n var index = -1,\n length = source.length;\n\n array || (array = Array(length));\n while (++index < length) {\n array[index] = source[index];\n }\n return array;\n }\n\n /**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\n function copyObject(source, props, object, customizer) {\n var isNew = !object;\n object || (object = {});\n\n var index = -1,\n length = props.length;\n\n while (++index < length) {\n var key = props[index];\n\n var newValue = customizer\n ? customizer(object[key], source[key], key, object, source)\n : undefined;\n\n if (newValue === undefined) {\n newValue = source[key];\n }\n if (isNew) {\n baseAssignValue(object, key, newValue);\n } else {\n assignValue(object, key, newValue);\n }\n }\n return object;\n }\n\n /**\n * Copies own symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbols(source, object) {\n return copyObject(source, getSymbols(source), object);\n }\n\n /**\n * Copies own and inherited symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbolsIn(source, object) {\n return copyObject(source, getSymbolsIn(source), object);\n }\n\n /**\n * Creates a function like `_.groupBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} [initializer] The accumulator object initializer.\n * @returns {Function} Returns the new aggregator function.\n */\n function createAggregator(setter, initializer) {\n return function(collection, iteratee) {\n var func = isArray(collection) ? arrayAggregator : baseAggregator,\n accumulator = initializer ? initializer() : {};\n\n return func(collection, setter, getIteratee(iteratee, 2), accumulator);\n };\n }\n\n /**\n * Creates a function like `_.assign`.\n *\n * @private\n * @param {Function} assigner The function to assign values.\n * @returns {Function} Returns the new assigner function.\n */\n function createAssigner(assigner) {\n return baseRest(function(object, sources) {\n var index = -1,\n length = sources.length,\n customizer = length > 1 ? sources[length - 1] : undefined,\n guard = length > 2 ? sources[2] : undefined;\n\n customizer = (assigner.length > 3 && typeof customizer == 'function')\n ? (length--, customizer)\n : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n customizer = length < 3 ? undefined : customizer;\n length = 1;\n }\n object = Object(object);\n while (++index < length) {\n var source = sources[index];\n if (source) {\n assigner(object, source, index, customizer);\n }\n }\n return object;\n });\n }\n\n /**\n * Creates a `baseEach` or `baseEachRight` function.\n *\n * @private\n * @param {Function} eachFunc The function to iterate over a collection.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseEach(eachFunc, fromRight) {\n return function(collection, iteratee) {\n if (collection == null) {\n return collection;\n }\n if (!isArrayLike(collection)) {\n return eachFunc(collection, iteratee);\n }\n var length = collection.length,\n index = fromRight ? length : -1,\n iterable = Object(collection);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (iteratee(iterable[index], index, iterable) === false) {\n break;\n }\n }\n return collection;\n };\n }\n\n /**\n * Creates a base function for methods like `_.forIn` and `_.forOwn`.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseFor(fromRight) {\n return function(object, iteratee, keysFunc) {\n var index = -1,\n iterable = Object(object),\n props = keysFunc(object),\n length = props.length;\n\n while (length--) {\n var key = props[fromRight ? length : ++index];\n if (iteratee(iterable[key], key, iterable) === false) {\n break;\n }\n }\n return object;\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the optional `this`\n * binding of `thisArg`.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createBind(func, bitmask, thisArg) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return fn.apply(isBind ? thisArg : this, arguments);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.lowerFirst`.\n *\n * @private\n * @param {string} methodName The name of the `String` case method to use.\n * @returns {Function} Returns the new case function.\n */\n function createCaseFirst(methodName) {\n return function(string) {\n string = toString(string);\n\n var strSymbols = hasUnicode(string)\n ? stringToArray(string)\n : undefined;\n\n var chr = strSymbols\n ? strSymbols[0]\n : string.charAt(0);\n\n var trailing = strSymbols\n ? castSlice(strSymbols, 1).join('')\n : string.slice(1);\n\n return chr[methodName]() + trailing;\n };\n }\n\n /**\n * Creates a function like `_.camelCase`.\n *\n * @private\n * @param {Function} callback The function to combine each word.\n * @returns {Function} Returns the new compounder function.\n */\n function createCompounder(callback) {\n return function(string) {\n return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');\n };\n }\n\n /**\n * Creates a function that produces an instance of `Ctor` regardless of\n * whether it was invoked as part of a `new` expression or by `call` or `apply`.\n *\n * @private\n * @param {Function} Ctor The constructor to wrap.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCtor(Ctor) {\n return function() {\n // Use a `switch` statement to work with class constructors. See\n // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist\n // for more details.\n var args = arguments;\n switch (args.length) {\n case 0: return new Ctor;\n case 1: return new Ctor(args[0]);\n case 2: return new Ctor(args[0], args[1]);\n case 3: return new Ctor(args[0], args[1], args[2]);\n case 4: return new Ctor(args[0], args[1], args[2], args[3]);\n case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);\n case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);\n case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);\n }\n var thisBinding = baseCreate(Ctor.prototype),\n result = Ctor.apply(thisBinding, args);\n\n // Mimic the constructor's `return` behavior.\n // See https://es5.github.io/#x13.2.2 for more details.\n return isObject(result) ? result : thisBinding;\n };\n }\n\n /**\n * Creates a function that wraps `func` to enable currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {number} arity The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCurry(func, bitmask, arity) {\n var Ctor = createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length,\n placeholder = getHolder(wrapper);\n\n while (index--) {\n args[index] = arguments[index];\n }\n var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)\n ? []\n : replaceHolders(args, placeholder);\n\n length -= holders.length;\n if (length < arity) {\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, undefined,\n args, holders, undefined, undefined, arity - length);\n }\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return apply(fn, this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.find` or `_.findLast` function.\n *\n * @private\n * @param {Function} findIndexFunc The function to find the collection index.\n * @returns {Function} Returns the new find function.\n */\n function createFind(findIndexFunc) {\n return function(collection, predicate, fromIndex) {\n var iterable = Object(collection);\n if (!isArrayLike(collection)) {\n var iteratee = getIteratee(predicate, 3);\n collection = keys(collection);\n predicate = function(key) { return iteratee(iterable[key], key, iterable); };\n }\n var index = findIndexFunc(collection, predicate, fromIndex);\n return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;\n };\n }\n\n /**\n * Creates a `_.flow` or `_.flowRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new flow function.\n */\n function createFlow(fromRight) {\n return flatRest(function(funcs) {\n var length = funcs.length,\n index = length,\n prereq = LodashWrapper.prototype.thru;\n\n if (fromRight) {\n funcs.reverse();\n }\n while (index--) {\n var func = funcs[index];\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (prereq && !wrapper && getFuncName(func) == 'wrapper') {\n var wrapper = new LodashWrapper([], true);\n }\n }\n index = wrapper ? index : length;\n while (++index < length) {\n func = funcs[index];\n\n var funcName = getFuncName(func),\n data = funcName == 'wrapper' ? getData(func) : undefined;\n\n if (data && isLaziable(data[0]) &&\n data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&\n !data[4].length && data[9] == 1\n ) {\n wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);\n } else {\n wrapper = (func.length == 1 && isLaziable(func))\n ? wrapper[funcName]()\n : wrapper.thru(func);\n }\n }\n return function() {\n var args = arguments,\n value = args[0];\n\n if (wrapper && args.length == 1 && isArray(value)) {\n return wrapper.plant(value).value();\n }\n var index = 0,\n result = length ? funcs[index].apply(this, args) : value;\n\n while (++index < length) {\n result = funcs[index].call(this, result);\n }\n return result;\n };\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with optional `this`\n * binding of `thisArg`, partial application, and currying.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [partialsRight] The arguments to append to those provided\n * to the new function.\n * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {\n var isAry = bitmask & WRAP_ARY_FLAG,\n isBind = bitmask & WRAP_BIND_FLAG,\n isBindKey = bitmask & WRAP_BIND_KEY_FLAG,\n isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),\n isFlip = bitmask & WRAP_FLIP_FLAG,\n Ctor = isBindKey ? undefined : createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length;\n\n while (index--) {\n args[index] = arguments[index];\n }\n if (isCurried) {\n var placeholder = getHolder(wrapper),\n holdersCount = countHolders(args, placeholder);\n }\n if (partials) {\n args = composeArgs(args, partials, holders, isCurried);\n }\n if (partialsRight) {\n args = composeArgsRight(args, partialsRight, holdersRight, isCurried);\n }\n length -= holdersCount;\n if (isCurried && length < arity) {\n var newHolders = replaceHolders(args, placeholder);\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, thisArg,\n args, newHolders, argPos, ary, arity - length\n );\n }\n var thisBinding = isBind ? thisArg : this,\n fn = isBindKey ? thisBinding[func] : func;\n\n length = args.length;\n if (argPos) {\n args = reorder(args, argPos);\n } else if (isFlip && length > 1) {\n args.reverse();\n }\n if (isAry && ary < length) {\n args.length = ary;\n }\n if (this && this !== root && this instanceof wrapper) {\n fn = Ctor || createCtor(fn);\n }\n return fn.apply(thisBinding, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.invertBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} toIteratee The function to resolve iteratees.\n * @returns {Function} Returns the new inverter function.\n */\n function createInverter(setter, toIteratee) {\n return function(object, iteratee) {\n return baseInverter(object, setter, toIteratee(iteratee), {});\n };\n }\n\n /**\n * Creates a function that performs a mathematical operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @param {number} [defaultValue] The value used for `undefined` arguments.\n * @returns {Function} Returns the new mathematical operation function.\n */\n function createMathOperation(operator, defaultValue) {\n return function(value, other) {\n var result;\n if (value === undefined && other === undefined) {\n return defaultValue;\n }\n if (value !== undefined) {\n result = value;\n }\n if (other !== undefined) {\n if (result === undefined) {\n return other;\n }\n if (typeof value == 'string' || typeof other == 'string') {\n value = baseToString(value);\n other = baseToString(other);\n } else {\n value = baseToNumber(value);\n other = baseToNumber(other);\n }\n result = operator(value, other);\n }\n return result;\n };\n }\n\n /**\n * Creates a function like `_.over`.\n *\n * @private\n * @param {Function} arrayFunc The function to iterate over iteratees.\n * @returns {Function} Returns the new over function.\n */\n function createOver(arrayFunc) {\n return flatRest(function(iteratees) {\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n return baseRest(function(args) {\n var thisArg = this;\n return arrayFunc(iteratees, function(iteratee) {\n return apply(iteratee, thisArg, args);\n });\n });\n });\n }\n\n /**\n * Creates the padding for `string` based on `length`. The `chars` string\n * is truncated if the number of characters exceeds `length`.\n *\n * @private\n * @param {number} length The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padding for `string`.\n */\n function createPadding(length, chars) {\n chars = chars === undefined ? ' ' : baseToString(chars);\n\n var charsLength = chars.length;\n if (charsLength < 2) {\n return charsLength ? baseRepeat(chars, length) : chars;\n }\n var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));\n return hasUnicode(chars)\n ? castSlice(stringToArray(result), 0, length).join('')\n : result.slice(0, length);\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the `this` binding\n * of `thisArg` and `partials` prepended to the arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} partials The arguments to prepend to those provided to\n * the new function.\n * @returns {Function} Returns the new wrapped function.\n */\n function createPartial(func, bitmask, thisArg, partials) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var argsIndex = -1,\n argsLength = arguments.length,\n leftIndex = -1,\n leftLength = partials.length,\n args = Array(leftLength + argsLength),\n fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n\n while (++leftIndex < leftLength) {\n args[leftIndex] = partials[leftIndex];\n }\n while (argsLength--) {\n args[leftIndex++] = arguments[++argsIndex];\n }\n return apply(fn, isBind ? thisArg : this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.range` or `_.rangeRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new range function.\n */\n function createRange(fromRight) {\n return function(start, end, step) {\n if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {\n end = step = undefined;\n }\n // Ensure the sign of `-0` is preserved.\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);\n return baseRange(start, end, step, fromRight);\n };\n }\n\n /**\n * Creates a function that performs a relational operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @returns {Function} Returns the new relational operation function.\n */\n function createRelationalOperation(operator) {\n return function(value, other) {\n if (!(typeof value == 'string' && typeof other == 'string')) {\n value = toNumber(value);\n other = toNumber(other);\n }\n return operator(value, other);\n };\n }\n\n /**\n * Creates a function that wraps `func` to continue currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {Function} wrapFunc The function to create the `func` wrapper.\n * @param {*} placeholder The placeholder value.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {\n var isCurry = bitmask & WRAP_CURRY_FLAG,\n newHolders = isCurry ? holders : undefined,\n newHoldersRight = isCurry ? undefined : holders,\n newPartials = isCurry ? partials : undefined,\n newPartialsRight = isCurry ? undefined : partials;\n\n bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);\n bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);\n\n if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {\n bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);\n }\n var newData = [\n func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,\n newHoldersRight, argPos, ary, arity\n ];\n\n var result = wrapFunc.apply(undefined, newData);\n if (isLaziable(func)) {\n setData(result, newData);\n }\n result.placeholder = placeholder;\n return setWrapToString(result, func, bitmask);\n }\n\n /**\n * Creates a function like `_.round`.\n *\n * @private\n * @param {string} methodName The name of the `Math` method to use when rounding.\n * @returns {Function} Returns the new round function.\n */\n function createRound(methodName) {\n var func = Math[methodName];\n return function(number, precision) {\n number = toNumber(number);\n precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);\n if (precision && nativeIsFinite(number)) {\n // Shift with exponential notation to avoid floating-point issues.\n // See [MDN](https://mdn.io/round#Examples) for more details.\n var pair = (toString(number) + 'e').split('e'),\n value = func(pair[0] + 'e' + (+pair[1] + precision));\n\n pair = (toString(value) + 'e').split('e');\n return +(pair[0] + 'e' + (+pair[1] - precision));\n }\n return func(number);\n };\n }\n\n /**\n * Creates a set object of `values`.\n *\n * @private\n * @param {Array} values The values to add to the set.\n * @returns {Object} Returns the new set.\n */\n var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {\n return new Set(values);\n };\n\n /**\n * Creates a `_.toPairs` or `_.toPairsIn` function.\n *\n * @private\n * @param {Function} keysFunc The function to get the keys of a given object.\n * @returns {Function} Returns the new pairs function.\n */\n function createToPairs(keysFunc) {\n return function(object) {\n var tag = getTag(object);\n if (tag == mapTag) {\n return mapToArray(object);\n }\n if (tag == setTag) {\n return setToPairs(object);\n }\n return baseToPairs(object, keysFunc(object));\n };\n }\n\n /**\n * Creates a function that either curries or invokes `func` with optional\n * `this` binding and partially applied arguments.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags.\n * 1 - `_.bind`\n * 2 - `_.bindKey`\n * 4 - `_.curry` or `_.curryRight` of a bound function\n * 8 - `_.curry`\n * 16 - `_.curryRight`\n * 32 - `_.partial`\n * 64 - `_.partialRight`\n * 128 - `_.rearg`\n * 256 - `_.ary`\n * 512 - `_.flip`\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to be partially applied.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {\n var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;\n if (!isBindKey && typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var length = partials ? partials.length : 0;\n if (!length) {\n bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);\n partials = holders = undefined;\n }\n ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);\n arity = arity === undefined ? arity : toInteger(arity);\n length -= holders ? holders.length : 0;\n\n if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {\n var partialsRight = partials,\n holdersRight = holders;\n\n partials = holders = undefined;\n }\n var data = isBindKey ? undefined : getData(func);\n\n var newData = [\n func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,\n argPos, ary, arity\n ];\n\n if (data) {\n mergeData(newData, data);\n }\n func = newData[0];\n bitmask = newData[1];\n thisArg = newData[2];\n partials = newData[3];\n holders = newData[4];\n arity = newData[9] = newData[9] === undefined\n ? (isBindKey ? 0 : func.length)\n : nativeMax(newData[9] - length, 0);\n\n if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {\n bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);\n }\n if (!bitmask || bitmask == WRAP_BIND_FLAG) {\n var result = createBind(func, bitmask, thisArg);\n } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {\n result = createCurry(func, bitmask, arity);\n } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {\n result = createPartial(func, bitmask, thisArg, partials);\n } else {\n result = createHybrid.apply(undefined, newData);\n }\n var setter = data ? baseSetData : setData;\n return setWrapToString(setter(result, newData), func, bitmask);\n }\n\n /**\n * Used by `_.defaults` to customize its `_.assignIn` use to assign properties\n * of source objects to the destination object for all destination properties\n * that resolve to `undefined`.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to assign.\n * @param {Object} object The parent object of `objValue`.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsAssignIn(objValue, srcValue, key, object) {\n if (objValue === undefined ||\n (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n return srcValue;\n }\n return objValue;\n }\n\n /**\n * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source\n * objects into destination objects that are passed thru.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to merge.\n * @param {Object} object The parent object of `objValue`.\n * @param {Object} source The parent object of `srcValue`.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {\n if (isObject(objValue) && isObject(srcValue)) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, objValue);\n baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);\n stack['delete'](srcValue);\n }\n return objValue;\n }\n\n /**\n * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain\n * objects.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {string} key The key of the property to inspect.\n * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.\n */\n function customOmitClone(value) {\n return isPlainObject(value) ? undefined : value;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\n function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(array);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseRest` which flattens the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n function flatRest(func) {\n return setToString(overRest(func, undefined, flatten), func + '');\n }\n\n /**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n }\n\n /**\n * Creates an array of own and inherited enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeysIn(object) {\n return baseGetAllKeys(object, keysIn, getSymbolsIn);\n }\n\n /**\n * Gets metadata for `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {*} Returns the metadata for `func`.\n */\n var getData = !metaMap ? noop : function(func) {\n return metaMap.get(func);\n };\n\n /**\n * Gets the name of `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {string} Returns the function name.\n */\n function getFuncName(func) {\n var result = (func.name + ''),\n array = realNames[result],\n length = hasOwnProperty.call(realNames, result) ? array.length : 0;\n\n while (length--) {\n var data = array[length],\n otherFunc = data.func;\n if (otherFunc == null || otherFunc == func) {\n return data.name;\n }\n }\n return result;\n }\n\n /**\n * Gets the argument placeholder value for `func`.\n *\n * @private\n * @param {Function} func The function to inspect.\n * @returns {*} Returns the placeholder value.\n */\n function getHolder(func) {\n var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;\n return object.placeholder;\n }\n\n /**\n * Gets the appropriate \"iteratee\" function. If `_.iteratee` is customized,\n * this function returns the custom method, otherwise it returns `baseIteratee`.\n * If arguments are provided, the chosen function is invoked with them and\n * its result is returned.\n *\n * @private\n * @param {*} [value] The value to convert to an iteratee.\n * @param {number} [arity] The arity of the created iteratee.\n * @returns {Function} Returns the chosen function or its result.\n */\n function getIteratee() {\n var result = lodash.iteratee || iteratee;\n result = result === iteratee ? baseIteratee : result;\n return arguments.length ? result(arguments[0], arguments[1]) : result;\n }\n\n /**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\n function getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n }\n\n /**\n * Gets the property names, values, and compare flags of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the match data of `object`.\n */\n function getMatchData(object) {\n var result = keys(object),\n length = result.length;\n\n while (length--) {\n var key = result[length],\n value = object[key];\n\n result[length] = [key, value, isStrictComparable(value)];\n }\n return result;\n }\n\n /**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\n function getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n }\n\n /**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\n function getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n }\n\n /**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n };\n\n /**\n * Creates an array of the own and inherited enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {\n var result = [];\n while (object) {\n arrayPush(result, getSymbols(object));\n object = getPrototype(object);\n }\n return result;\n };\n\n /**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n var getTag = baseGetTag;\n\n // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\n if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n }\n\n /**\n * Gets the view, applying any `transforms` to the `start` and `end` positions.\n *\n * @private\n * @param {number} start The start of the view.\n * @param {number} end The end of the view.\n * @param {Array} transforms The transformations to apply to the view.\n * @returns {Object} Returns an object containing the `start` and `end`\n * positions of the view.\n */\n function getView(start, end, transforms) {\n var index = -1,\n length = transforms.length;\n\n while (++index < length) {\n var data = transforms[index],\n size = data.size;\n\n switch (data.type) {\n case 'drop': start += size; break;\n case 'dropRight': end -= size; break;\n case 'take': end = nativeMin(end, start + size); break;\n case 'takeRight': start = nativeMax(start, end - size); break;\n }\n }\n return { 'start': start, 'end': end };\n }\n\n /**\n * Extracts wrapper details from the `source` body comment.\n *\n * @private\n * @param {string} source The source to inspect.\n * @returns {Array} Returns the wrapper details.\n */\n function getWrapDetails(source) {\n var match = source.match(reWrapDetails);\n return match ? match[1].split(reSplitDetails) : [];\n }\n\n /**\n * Checks if `path` exists on `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @param {Function} hasFunc The function to check properties.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n */\n function hasPath(object, path, hasFunc) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n result = false;\n\n while (++index < length) {\n var key = toKey(path[index]);\n if (!(result = object != null && hasFunc(object, key))) {\n break;\n }\n object = object[key];\n }\n if (result || ++index != length) {\n return result;\n }\n length = object == null ? 0 : object.length;\n return !!length && isLength(length) && isIndex(key, length) &&\n (isArray(object) || isArguments(object));\n }\n\n /**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\n function initCloneArray(array) {\n var length = array.length,\n result = new array.constructor(length);\n\n // Add properties assigned by `RegExp#exec`.\n if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n result.index = array.index;\n result.input = array.input;\n }\n return result;\n }\n\n /**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneObject(object) {\n return (typeof object.constructor == 'function' && !isPrototype(object))\n ? baseCreate(getPrototype(object))\n : {};\n }\n\n /**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneByTag(object, tag, isDeep) {\n var Ctor = object.constructor;\n switch (tag) {\n case arrayBufferTag:\n return cloneArrayBuffer(object);\n\n case boolTag:\n case dateTag:\n return new Ctor(+object);\n\n case dataViewTag:\n return cloneDataView(object, isDeep);\n\n case float32Tag: case float64Tag:\n case int8Tag: case int16Tag: case int32Tag:\n case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n return cloneTypedArray(object, isDeep);\n\n case mapTag:\n return new Ctor;\n\n case numberTag:\n case stringTag:\n return new Ctor(object);\n\n case regexpTag:\n return cloneRegExp(object);\n\n case setTag:\n return new Ctor;\n\n case symbolTag:\n return cloneSymbol(object);\n }\n }\n\n /**\n * Inserts wrapper `details` in a comment at the top of the `source` body.\n *\n * @private\n * @param {string} source The source to modify.\n * @returns {Array} details The details to insert.\n * @returns {string} Returns the modified source.\n */\n function insertWrapDetails(source, details) {\n var length = details.length;\n if (!length) {\n return source;\n }\n var lastIndex = length - 1;\n details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];\n details = details.join(length > 2 ? ', ' : ' ');\n return source.replace(reWrapComment, '{\\n/* [wrapped with ' + details + '] */\\n');\n }\n\n /**\n * Checks if `value` is a flattenable `arguments` object or array.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.\n */\n function isFlattenable(value) {\n return isArray(value) || isArguments(value) ||\n !!(spreadableSymbol && value && value[spreadableSymbol]);\n }\n\n /**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\n function isIndex(value, length) {\n var type = typeof value;\n length = length == null ? MAX_SAFE_INTEGER : length;\n\n return !!length &&\n (type == 'number' ||\n (type != 'symbol' && reIsUint.test(value))) &&\n (value > -1 && value % 1 == 0 && value < length);\n }\n\n /**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\n function isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n }\n\n /**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\n function isKey(value, object) {\n if (isArray(value)) {\n return false;\n }\n var type = typeof value;\n if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n value == null || isSymbol(value)) {\n return true;\n }\n return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n (object != null && value in Object(object));\n }\n\n /**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\n function isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n }\n\n /**\n * Checks if `func` has a lazy counterpart.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` has a lazy counterpart,\n * else `false`.\n */\n function isLaziable(func) {\n var funcName = getFuncName(func),\n other = lodash[funcName];\n\n if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {\n return false;\n }\n if (func === other) {\n return true;\n }\n var data = getData(other);\n return !!data && func === data[0];\n }\n\n /**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\n function isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n }\n\n /**\n * Checks if `func` is capable of being masked.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `func` is maskable, else `false`.\n */\n var isMaskable = coreJsData ? isFunction : stubFalse;\n\n /**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\n function isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n }\n\n /**\n * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` if suitable for strict\n * equality comparisons, else `false`.\n */\n function isStrictComparable(value) {\n return value === value && !isObject(value);\n }\n\n /**\n * A specialized version of `matchesProperty` for source values suitable\n * for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function matchesStrictComparable(key, srcValue) {\n return function(object) {\n if (object == null) {\n return false;\n }\n return object[key] === srcValue &&\n (srcValue !== undefined || (key in Object(object)));\n };\n }\n\n /**\n * A specialized version of `_.memoize` which clears the memoized function's\n * cache when it exceeds `MAX_MEMOIZE_SIZE`.\n *\n * @private\n * @param {Function} func The function to have its output memoized.\n * @returns {Function} Returns the new memoized function.\n */\n function memoizeCapped(func) {\n var result = memoize(func, function(key) {\n if (cache.size === MAX_MEMOIZE_SIZE) {\n cache.clear();\n }\n return key;\n });\n\n var cache = result.cache;\n return result;\n }\n\n /**\n * Merges the function metadata of `source` into `data`.\n *\n * Merging metadata reduces the number of wrappers used to invoke a function.\n * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`\n * may be applied regardless of execution order. Methods like `_.ary` and\n * `_.rearg` modify function arguments, making the order in which they are\n * executed important, preventing the merging of metadata. However, we make\n * an exception for a safe combined case where curried functions have `_.ary`\n * and or `_.rearg` applied.\n *\n * @private\n * @param {Array} data The destination metadata.\n * @param {Array} source The source metadata.\n * @returns {Array} Returns `data`.\n */\n function mergeData(data, source) {\n var bitmask = data[1],\n srcBitmask = source[1],\n newBitmask = bitmask | srcBitmask,\n isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);\n\n var isCombo =\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||\n ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));\n\n // Exit early if metadata can't be merged.\n if (!(isCommon || isCombo)) {\n return data;\n }\n // Use source `thisArg` if available.\n if (srcBitmask & WRAP_BIND_FLAG) {\n data[2] = source[2];\n // Set when currying a bound function.\n newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;\n }\n // Compose partial arguments.\n var value = source[3];\n if (value) {\n var partials = data[3];\n data[3] = partials ? composeArgs(partials, value, source[4]) : value;\n data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];\n }\n // Compose partial right arguments.\n value = source[5];\n if (value) {\n partials = data[5];\n data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;\n data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];\n }\n // Use source `argPos` if available.\n value = source[7];\n if (value) {\n data[7] = value;\n }\n // Use source `ary` if it's smaller.\n if (srcBitmask & WRAP_ARY_FLAG) {\n data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);\n }\n // Use source `arity` if one is not provided.\n if (data[9] == null) {\n data[9] = source[9];\n }\n // Use source `func` and merge bitmasks.\n data[0] = source[0];\n data[1] = newBitmask;\n\n return data;\n }\n\n /**\n * This function is like\n * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * except that it includes inherited enumerable properties.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function nativeKeysIn(object) {\n var result = [];\n if (object != null) {\n for (var key in Object(object)) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\n function objectToString(value) {\n return nativeObjectToString.call(value);\n }\n\n /**\n * A specialized version of `baseRest` which transforms the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @param {Function} transform The rest array transform.\n * @returns {Function} Returns the new function.\n */\n function overRest(func, start, transform) {\n start = nativeMax(start === undefined ? (func.length - 1) : start, 0);\n return function() {\n var args = arguments,\n index = -1,\n length = nativeMax(args.length - start, 0),\n array = Array(length);\n\n while (++index < length) {\n array[index] = args[start + index];\n }\n index = -1;\n var otherArgs = Array(start + 1);\n while (++index < start) {\n otherArgs[index] = args[index];\n }\n otherArgs[start] = transform(array);\n return apply(func, this, otherArgs);\n };\n }\n\n /**\n * Gets the parent value at `path` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} path The path to get the parent value of.\n * @returns {*} Returns the parent value.\n */\n function parent(object, path) {\n return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));\n }\n\n /**\n * Reorder `array` according to the specified indexes where the element at\n * the first index is assigned as the first element, the element at\n * the second index is assigned as the second element, and so on.\n *\n * @private\n * @param {Array} array The array to reorder.\n * @param {Array} indexes The arranged array indexes.\n * @returns {Array} Returns `array`.\n */\n function reorder(array, indexes) {\n var arrLength = array.length,\n length = nativeMin(indexes.length, arrLength),\n oldArray = copyArray(array);\n\n while (length--) {\n var index = indexes[length];\n array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;\n }\n return array;\n }\n\n /**\n * Gets the value at `key`, unless `key` is \"__proto__\" or \"constructor\".\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function safeGet(object, key) {\n if (key === 'constructor' && typeof object[key] === 'function') {\n return;\n }\n\n if (key == '__proto__') {\n return;\n }\n\n return object[key];\n }\n\n /**\n * Sets metadata for `func`.\n *\n * **Note:** If this function becomes hot, i.e. is invoked a lot in a short\n * period of time, it will trip its breaker and transition to an identity\n * function to avoid garbage collection pauses in V8. See\n * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)\n * for more details.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var setData = shortOut(baseSetData);\n\n /**\n * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n var setTimeout = ctxSetTimeout || function(func, wait) {\n return root.setTimeout(func, wait);\n };\n\n /**\n * Sets the `toString` method of `func` to return `string`.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var setToString = shortOut(baseSetToString);\n\n /**\n * Sets the `toString` method of `wrapper` to mimic the source of `reference`\n * with wrapper details in a comment at the top of the source body.\n *\n * @private\n * @param {Function} wrapper The function to modify.\n * @param {Function} reference The reference function.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Function} Returns `wrapper`.\n */\n function setWrapToString(wrapper, reference, bitmask) {\n var source = (reference + '');\n return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));\n }\n\n /**\n * Creates a function that'll short out and invoke `identity` instead\n * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`\n * milliseconds.\n *\n * @private\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new shortable function.\n */\n function shortOut(func) {\n var count = 0,\n lastCalled = 0;\n\n return function() {\n var stamp = nativeNow(),\n remaining = HOT_SPAN - (stamp - lastCalled);\n\n lastCalled = stamp;\n if (remaining > 0) {\n if (++count >= HOT_COUNT) {\n return arguments[0];\n }\n } else {\n count = 0;\n }\n return func.apply(undefined, arguments);\n };\n }\n\n /**\n * A specialized version of `_.shuffle` which mutates and sets the size of `array`.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @param {number} [size=array.length] The size of `array`.\n * @returns {Array} Returns `array`.\n */\n function shuffleSelf(array, size) {\n var index = -1,\n length = array.length,\n lastIndex = length - 1;\n\n size = size === undefined ? length : size;\n while (++index < size) {\n var rand = baseRandom(index, lastIndex),\n value = array[rand];\n\n array[rand] = array[index];\n array[index] = value;\n }\n array.length = size;\n return array;\n }\n\n /**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\n var stringToPath = memoizeCapped(function(string) {\n var result = [];\n if (string.charCodeAt(0) === 46 /* . */) {\n result.push('');\n }\n string.replace(rePropName, function(match, number, quote, subString) {\n result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));\n });\n return result;\n });\n\n /**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\n function toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\n function toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n }\n\n /**\n * Updates wrapper `details` based on `bitmask` flags.\n *\n * @private\n * @returns {Array} details The details to modify.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Array} Returns `details`.\n */\n function updateWrapDetails(details, bitmask) {\n arrayEach(wrapFlags, function(pair) {\n var value = '_.' + pair[0];\n if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {\n details.push(value);\n }\n });\n return details.sort();\n }\n\n /**\n * Creates a clone of `wrapper`.\n *\n * @private\n * @param {Object} wrapper The wrapper to clone.\n * @returns {Object} Returns the cloned wrapper.\n */\n function wrapperClone(wrapper) {\n if (wrapper instanceof LazyWrapper) {\n return wrapper.clone();\n }\n var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);\n result.__actions__ = copyArray(wrapper.__actions__);\n result.__index__ = wrapper.__index__;\n result.__values__ = wrapper.__values__;\n return result;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of elements split into groups the length of `size`.\n * If `array` can't be split evenly, the final chunk will be the remaining\n * elements.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to process.\n * @param {number} [size=1] The length of each chunk\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the new array of chunks.\n * @example\n *\n * _.chunk(['a', 'b', 'c', 'd'], 2);\n * // => [['a', 'b'], ['c', 'd']]\n *\n * _.chunk(['a', 'b', 'c', 'd'], 3);\n * // => [['a', 'b', 'c'], ['d']]\n */\n function chunk(array, size, guard) {\n if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {\n size = 1;\n } else {\n size = nativeMax(toInteger(size), 0);\n }\n var length = array == null ? 0 : array.length;\n if (!length || size < 1) {\n return [];\n }\n var index = 0,\n resIndex = 0,\n result = Array(nativeCeil(length / size));\n\n while (index < length) {\n result[resIndex++] = baseSlice(array, index, (index += size));\n }\n return result;\n }\n\n /**\n * Creates an array with all falsey values removed. The values `false`, `null`,\n * `0`, `\"\"`, `undefined`, and `NaN` are falsey.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to compact.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.compact([0, 1, false, 2, '', 3]);\n * // => [1, 2, 3]\n */\n function compact(array) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * Creates a new array concatenating `array` with any additional arrays\n * and/or values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to concatenate.\n * @param {...*} [values] The values to concatenate.\n * @returns {Array} Returns the new concatenated array.\n * @example\n *\n * var array = [1];\n * var other = _.concat(array, 2, [3], [[4]]);\n *\n * console.log(other);\n * // => [1, 2, 3, [4]]\n *\n * console.log(array);\n * // => [1]\n */\n function concat() {\n var length = arguments.length;\n if (!length) {\n return [];\n }\n var args = Array(length - 1),\n array = arguments[0],\n index = length;\n\n while (index--) {\n args[index - 1] = arguments[index];\n }\n return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));\n }\n\n /**\n * Creates an array of `array` values not included in the other given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * **Note:** Unlike `_.pullAll`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.without, _.xor\n * @example\n *\n * _.difference([2, 1], [2, 3]);\n * // => [1]\n */\n var difference = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `iteratee` which\n * is invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * **Note:** Unlike `_.pullAllBy`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var differenceBy = baseRest(function(array, values) {\n var iteratee = last(values);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `comparator`\n * which is invoked to compare elements of `array` to `values`. The order and\n * references of result values are determined by the first array. The comparator\n * is invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.pullAllWith`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n *\n * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }]\n */\n var differenceWith = baseRest(function(array, values) {\n var comparator = last(values);\n if (isArrayLikeObject(comparator)) {\n comparator = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)\n : [];\n });\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.drop([1, 2, 3]);\n * // => [2, 3]\n *\n * _.drop([1, 2, 3], 2);\n * // => [3]\n *\n * _.drop([1, 2, 3], 5);\n * // => []\n *\n * _.drop([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function drop(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.dropRight([1, 2, 3]);\n * // => [1, 2]\n *\n * _.dropRight([1, 2, 3], 2);\n * // => [1]\n *\n * _.dropRight([1, 2, 3], 5);\n * // => []\n *\n * _.dropRight([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function dropRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the end.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.dropRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropRightWhile(users, ['active', false]);\n * // => objects for ['barney']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropRightWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the beginning.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.dropWhile(users, function(o) { return !o.active; });\n * // => objects for ['pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropWhile(users, ['active', false]);\n * // => objects for ['pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true)\n : [];\n }\n\n /**\n * Fills elements of `array` with `value` from `start` up to, but not\n * including, `end`.\n *\n * **Note:** This method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Array\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.fill(array, 'a');\n * console.log(array);\n * // => ['a', 'a', 'a']\n *\n * _.fill(Array(3), 2);\n * // => [2, 2, 2]\n *\n * _.fill([4, 6, 8, 10], '*', 1, 3);\n * // => [4, '*', '*', 10]\n */\n function fill(array, value, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {\n start = 0;\n end = length;\n }\n return baseFill(array, value, start, end);\n }\n\n /**\n * This method is like `_.find` except that it returns the index of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.findIndex(users, function(o) { return o.user == 'barney'; });\n * // => 0\n *\n * // The `_.matches` iteratee shorthand.\n * _.findIndex(users, { 'user': 'fred', 'active': false });\n * // => 1\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findIndex(users, ['active', false]);\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.findIndex(users, 'active');\n * // => 2\n */\n function findIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index);\n }\n\n /**\n * This method is like `_.findIndex` except that it iterates over elements\n * of `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });\n * // => 2\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastIndex(users, { 'user': 'barney', 'active': true });\n * // => 0\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastIndex(users, ['active', false]);\n * // => 2\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastIndex(users, 'active');\n * // => 0\n */\n function findLastIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length - 1;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = fromIndex < 0\n ? nativeMax(length + index, 0)\n : nativeMin(index, length - 1);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index, true);\n }\n\n /**\n * Flattens `array` a single level deep.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flatten([1, [2, [3, [4]], 5]]);\n * // => [1, 2, [3, [4]], 5]\n */\n function flatten(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, 1) : [];\n }\n\n /**\n * Recursively flattens `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flattenDeep([1, [2, [3, [4]], 5]]);\n * // => [1, 2, 3, 4, 5]\n */\n function flattenDeep(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, INFINITY) : [];\n }\n\n /**\n * Recursively flatten `array` up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * var array = [1, [2, [3, [4]], 5]];\n *\n * _.flattenDepth(array, 1);\n * // => [1, 2, [3, [4]], 5]\n *\n * _.flattenDepth(array, 2);\n * // => [1, 2, 3, [4], 5]\n */\n function flattenDepth(array, depth) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(array, depth);\n }\n\n /**\n * The inverse of `_.toPairs`; this method returns an object composed\n * from key-value `pairs`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} pairs The key-value pairs.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.fromPairs([['a', 1], ['b', 2]]);\n * // => { 'a': 1, 'b': 2 }\n */\n function fromPairs(pairs) {\n var index = -1,\n length = pairs == null ? 0 : pairs.length,\n result = {};\n\n while (++index < length) {\n var pair = pairs[index];\n result[pair[0]] = pair[1];\n }\n return result;\n }\n\n /**\n * Gets the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias first\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the first element of `array`.\n * @example\n *\n * _.head([1, 2, 3]);\n * // => 1\n *\n * _.head([]);\n * // => undefined\n */\n function head(array) {\n return (array && array.length) ? array[0] : undefined;\n }\n\n /**\n * Gets the index at which the first occurrence of `value` is found in `array`\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. If `fromIndex` is negative, it's used as the\n * offset from the end of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.indexOf([1, 2, 1, 2], 2);\n * // => 1\n *\n * // Search from the `fromIndex`.\n * _.indexOf([1, 2, 1, 2], 2, 2);\n * // => 3\n */\n function indexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseIndexOf(array, value, index);\n }\n\n /**\n * Gets all but the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.initial([1, 2, 3]);\n * // => [1, 2]\n */\n function initial(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 0, -1) : [];\n }\n\n /**\n * Creates an array of unique values that are included in all given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersection([2, 1], [2, 3]);\n * // => [2]\n */\n var intersection = baseRest(function(arrays) {\n var mapped = arrayMap(arrays, castArrayLikeObject);\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped)\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `iteratee`\n * which is invoked for each element of each `arrays` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [2.1]\n *\n * // The `_.property` iteratee shorthand.\n * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }]\n */\n var intersectionBy = baseRest(function(arrays) {\n var iteratee = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n if (iteratee === last(mapped)) {\n iteratee = undefined;\n } else {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `comparator`\n * which is invoked to compare elements of `arrays`. The order and references\n * of result values are determined by the first array. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.intersectionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }]\n */\n var intersectionWith = baseRest(function(arrays) {\n var comparator = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n comparator = typeof comparator == 'function' ? comparator : undefined;\n if (comparator) {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, undefined, comparator)\n : [];\n });\n\n /**\n * Converts all elements in `array` into a string separated by `separator`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to convert.\n * @param {string} [separator=','] The element separator.\n * @returns {string} Returns the joined string.\n * @example\n *\n * _.join(['a', 'b', 'c'], '~');\n * // => 'a~b~c'\n */\n function join(array, separator) {\n return array == null ? '' : nativeJoin.call(array, separator);\n }\n\n /**\n * Gets the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the last element of `array`.\n * @example\n *\n * _.last([1, 2, 3]);\n * // => 3\n */\n function last(array) {\n var length = array == null ? 0 : array.length;\n return length ? array[length - 1] : undefined;\n }\n\n /**\n * This method is like `_.indexOf` except that it iterates over elements of\n * `array` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.lastIndexOf([1, 2, 1, 2], 2);\n * // => 3\n *\n * // Search from the `fromIndex`.\n * _.lastIndexOf([1, 2, 1, 2], 2, 2);\n * // => 1\n */\n function lastIndexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);\n }\n return value === value\n ? strictLastIndexOf(array, value, index)\n : baseFindIndex(array, baseIsNaN, index, true);\n }\n\n /**\n * Gets the element at index `n` of `array`. If `n` is negative, the nth\n * element from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.11.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=0] The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n *\n * _.nth(array, 1);\n * // => 'b'\n *\n * _.nth(array, -2);\n * // => 'c';\n */\n function nth(array, n) {\n return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;\n }\n\n /**\n * Removes all given values from `array` using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`\n * to remove elements from an array by predicate.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...*} [values] The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pull(array, 'a', 'c');\n * console.log(array);\n * // => ['b', 'b']\n */\n var pull = baseRest(pullAll);\n\n /**\n * This method is like `_.pull` except that it accepts an array of values to remove.\n *\n * **Note:** Unlike `_.difference`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pullAll(array, ['a', 'c']);\n * console.log(array);\n * // => ['b', 'b']\n */\n function pullAll(array, values) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values)\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `iteratee` which is\n * invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The iteratee is invoked with one argument: (value).\n *\n * **Note:** Unlike `_.differenceBy`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];\n *\n * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');\n * console.log(array);\n * // => [{ 'x': 2 }]\n */\n function pullAllBy(array, values, iteratee) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, getIteratee(iteratee, 2))\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `comparator` which\n * is invoked to compare elements of `array` to `values`. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.differenceWith`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];\n *\n * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);\n * console.log(array);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]\n */\n function pullAllWith(array, values, comparator) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, undefined, comparator)\n : array;\n }\n\n /**\n * Removes elements from `array` corresponding to `indexes` and returns an\n * array of removed elements.\n *\n * **Note:** Unlike `_.at`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...(number|number[])} [indexes] The indexes of elements to remove.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n * var pulled = _.pullAt(array, [1, 3]);\n *\n * console.log(array);\n * // => ['a', 'c']\n *\n * console.log(pulled);\n * // => ['b', 'd']\n */\n var pullAt = flatRest(function(array, indexes) {\n var length = array == null ? 0 : array.length,\n result = baseAt(array, indexes);\n\n basePullAt(array, arrayMap(indexes, function(index) {\n return isIndex(index, length) ? +index : index;\n }).sort(compareAscending));\n\n return result;\n });\n\n /**\n * Removes all elements from `array` that `predicate` returns truthy for\n * and returns an array of the removed elements. The predicate is invoked\n * with three arguments: (value, index, array).\n *\n * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`\n * to pull elements from an array by value.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = [1, 2, 3, 4];\n * var evens = _.remove(array, function(n) {\n * return n % 2 == 0;\n * });\n *\n * console.log(array);\n * // => [1, 3]\n *\n * console.log(evens);\n * // => [2, 4]\n */\n function remove(array, predicate) {\n var result = [];\n if (!(array && array.length)) {\n return result;\n }\n var index = -1,\n indexes = [],\n length = array.length;\n\n predicate = getIteratee(predicate, 3);\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result.push(value);\n indexes.push(index);\n }\n }\n basePullAt(array, indexes);\n return result;\n }\n\n /**\n * Reverses `array` so that the first element becomes the last, the second\n * element becomes the second to last, and so on.\n *\n * **Note:** This method mutates `array` and is based on\n * [`Array#reverse`](https://mdn.io/Array/reverse).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.reverse(array);\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function reverse(array) {\n return array == null ? array : nativeReverse.call(array);\n }\n\n /**\n * Creates a slice of `array` from `start` up to, but not including, `end`.\n *\n * **Note:** This method is used instead of\n * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are\n * returned.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function slice(array, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {\n start = 0;\n end = length;\n }\n else {\n start = start == null ? 0 : toInteger(start);\n end = end === undefined ? length : toInteger(end);\n }\n return baseSlice(array, start, end);\n }\n\n /**\n * Uses a binary search to determine the lowest index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedIndex([30, 50], 40);\n * // => 1\n */\n function sortedIndex(array, value) {\n return baseSortedIndex(array, value);\n }\n\n /**\n * This method is like `_.sortedIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedIndexBy(objects, { 'x': 4 }, 'x');\n * // => 0\n */\n function sortedIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));\n }\n\n /**\n * This method is like `_.indexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedIndexOf([4, 5, 5, 5, 6], 5);\n * // => 1\n */\n function sortedIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value);\n if (index < length && eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.sortedIndex` except that it returns the highest\n * index at which `value` should be inserted into `array` in order to\n * maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedLastIndex([4, 5, 5, 5, 6], 5);\n * // => 4\n */\n function sortedLastIndex(array, value) {\n return baseSortedIndex(array, value, true);\n }\n\n /**\n * This method is like `_.sortedLastIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 1\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');\n * // => 1\n */\n function sortedLastIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);\n }\n\n /**\n * This method is like `_.lastIndexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);\n * // => 3\n */\n function sortedLastIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value, true) - 1;\n if (eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.uniq` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniq([1, 1, 2]);\n * // => [1, 2]\n */\n function sortedUniq(array) {\n return (array && array.length)\n ? baseSortedUniq(array)\n : [];\n }\n\n /**\n * This method is like `_.uniqBy` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);\n * // => [1.1, 2.3]\n */\n function sortedUniqBy(array, iteratee) {\n return (array && array.length)\n ? baseSortedUniq(array, getIteratee(iteratee, 2))\n : [];\n }\n\n /**\n * Gets all but the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.tail([1, 2, 3]);\n * // => [2, 3]\n */\n function tail(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 1, length) : [];\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.take([1, 2, 3]);\n * // => [1]\n *\n * _.take([1, 2, 3], 2);\n * // => [1, 2]\n *\n * _.take([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.take([1, 2, 3], 0);\n * // => []\n */\n function take(array, n, guard) {\n if (!(array && array.length)) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.takeRight([1, 2, 3]);\n * // => [3]\n *\n * _.takeRight([1, 2, 3], 2);\n * // => [2, 3]\n *\n * _.takeRight([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.takeRight([1, 2, 3], 0);\n * // => []\n */\n function takeRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with elements taken from the end. Elements are\n * taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.takeRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeRightWhile(users, ['active', false]);\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeRightWhile(users, 'active');\n * // => []\n */\n function takeRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), false, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` with elements taken from the beginning. Elements\n * are taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.takeWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeWhile(users, ['active', false]);\n * // => objects for ['barney', 'fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeWhile(users, 'active');\n * // => []\n */\n function takeWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3))\n : [];\n }\n\n /**\n * Creates an array of unique values, in order, from all given arrays using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.union([2], [1, 2]);\n * // => [2, 1]\n */\n var union = baseRest(function(arrays) {\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));\n });\n\n /**\n * This method is like `_.union` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which uniqueness is computed. Result values are chosen from the first\n * array in which the value occurs. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.unionBy([2.1], [1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n var unionBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.union` except that it accepts `comparator` which\n * is invoked to compare elements of `arrays`. Result values are chosen from\n * the first array in which the value occurs. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.unionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var unionWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);\n });\n\n /**\n * Creates a duplicate-free version of an array, using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons, in which only the first occurrence of each element\n * is kept. The order of result values is determined by the order they occur\n * in the array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniq([2, 1, 2]);\n * // => [2, 1]\n */\n function uniq(array) {\n return (array && array.length) ? baseUniq(array) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n function uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `comparator` which\n * is invoked to compare elements of `array`. The order of result values is\n * determined by the order they occur in the array.The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.uniqWith(objects, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]\n */\n function uniqWith(array, comparator) {\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return (array && array.length) ? baseUniq(array, undefined, comparator) : [];\n }\n\n /**\n * This method is like `_.zip` except that it accepts an array of grouped\n * elements and creates an array regrouping the elements to their pre-zip\n * configuration.\n *\n * @static\n * @memberOf _\n * @since 1.2.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n *\n * _.unzip(zipped);\n * // => [['a', 'b'], [1, 2], [true, false]]\n */\n function unzip(array) {\n if (!(array && array.length)) {\n return [];\n }\n var length = 0;\n array = arrayFilter(array, function(group) {\n if (isArrayLikeObject(group)) {\n length = nativeMax(group.length, length);\n return true;\n }\n });\n return baseTimes(length, function(index) {\n return arrayMap(array, baseProperty(index));\n });\n }\n\n /**\n * This method is like `_.unzip` except that it accepts `iteratee` to specify\n * how regrouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * regrouped values.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip([1, 2], [10, 20], [100, 200]);\n * // => [[1, 10, 100], [2, 20, 200]]\n *\n * _.unzipWith(zipped, _.add);\n * // => [3, 30, 300]\n */\n function unzipWith(array, iteratee) {\n if (!(array && array.length)) {\n return [];\n }\n var result = unzip(array);\n if (iteratee == null) {\n return result;\n }\n return arrayMap(result, function(group) {\n return apply(iteratee, undefined, group);\n });\n }\n\n /**\n * Creates an array excluding all given values using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.pull`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...*} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.xor\n * @example\n *\n * _.without([2, 1, 2, 3], 1, 2);\n * // => [3]\n */\n var without = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, values)\n : [];\n });\n\n /**\n * Creates an array of unique values that is the\n * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)\n * of the given arrays. The order of result values is determined by the order\n * they occur in the arrays.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.without\n * @example\n *\n * _.xor([2, 1], [2, 3]);\n * // => [1, 3]\n */\n var xor = baseRest(function(arrays) {\n return baseXor(arrayFilter(arrays, isArrayLikeObject));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which by which they're compared. The order of result values is determined\n * by the order they occur in the arrays. The iteratee is invoked with one\n * argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2, 3.4]\n *\n * // The `_.property` iteratee shorthand.\n * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var xorBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `comparator` which is\n * invoked to compare elements of `arrays`. The order of result values is\n * determined by the order they occur in the arrays. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.xorWith(objects, others, _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var xorWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);\n });\n\n /**\n * Creates an array of grouped elements, the first of which contains the\n * first elements of the given arrays, the second of which contains the\n * second elements of the given arrays, and so on.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n */\n var zip = baseRest(unzip);\n\n /**\n * This method is like `_.fromPairs` except that it accepts two arrays,\n * one of property identifiers and one of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 0.4.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObject(['a', 'b'], [1, 2]);\n * // => { 'a': 1, 'b': 2 }\n */\n function zipObject(props, values) {\n return baseZipObject(props || [], values || [], assignValue);\n }\n\n /**\n * This method is like `_.zipObject` except that it supports property paths.\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);\n * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }\n */\n function zipObjectDeep(props, values) {\n return baseZipObject(props || [], values || [], baseSet);\n }\n\n /**\n * This method is like `_.zip` except that it accepts `iteratee` to specify\n * how grouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * grouped values.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {\n * return a + b + c;\n * });\n * // => [111, 222]\n */\n var zipWith = baseRest(function(arrays) {\n var length = arrays.length,\n iteratee = length > 1 ? arrays[length - 1] : undefined;\n\n iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;\n return unzipWith(arrays, iteratee);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` wrapper instance that wraps `value` with explicit method\n * chain sequences enabled. The result of such sequences must be unwrapped\n * with `_#value`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Seq\n * @param {*} value The value to wrap.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'pebbles', 'age': 1 }\n * ];\n *\n * var youngest = _\n * .chain(users)\n * .sortBy('age')\n * .map(function(o) {\n * return o.user + ' is ' + o.age;\n * })\n * .head()\n * .value();\n * // => 'pebbles is 1'\n */\n function chain(value) {\n var result = lodash(value);\n result.__chain__ = true;\n return result;\n }\n\n /**\n * This method invokes `interceptor` and returns `value`. The interceptor\n * is invoked with one argument; (value). The purpose of this method is to\n * \"tap into\" a method chain sequence in order to modify intermediate results.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns `value`.\n * @example\n *\n * _([1, 2, 3])\n * .tap(function(array) {\n * // Mutate input array.\n * array.pop();\n * })\n * .reverse()\n * .value();\n * // => [2, 1]\n */\n function tap(value, interceptor) {\n interceptor(value);\n return value;\n }\n\n /**\n * This method is like `_.tap` except that it returns the result of `interceptor`.\n * The purpose of this method is to \"pass thru\" values replacing intermediate\n * results in a method chain sequence.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns the result of `interceptor`.\n * @example\n *\n * _(' abc ')\n * .chain()\n * .trim()\n * .thru(function(value) {\n * return [value];\n * })\n * .value();\n * // => ['abc']\n */\n function thru(value, interceptor) {\n return interceptor(value);\n }\n\n /**\n * This method is the wrapper version of `_.at`.\n *\n * @name at\n * @memberOf _\n * @since 1.0.0\n * @category Seq\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _(object).at(['a[0].b.c', 'a[1]']).value();\n * // => [3, 4]\n */\n var wrapperAt = flatRest(function(paths) {\n var length = paths.length,\n start = length ? paths[0] : 0,\n value = this.__wrapped__,\n interceptor = function(object) { return baseAt(object, paths); };\n\n if (length > 1 || this.__actions__.length ||\n !(value instanceof LazyWrapper) || !isIndex(start)) {\n return this.thru(interceptor);\n }\n value = value.slice(start, +start + (length ? 1 : 0));\n value.__actions__.push({\n 'func': thru,\n 'args': [interceptor],\n 'thisArg': undefined\n });\n return new LodashWrapper(value, this.__chain__).thru(function(array) {\n if (length && !array.length) {\n array.push(undefined);\n }\n return array;\n });\n });\n\n /**\n * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.\n *\n * @name chain\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 }\n * ];\n *\n * // A sequence without explicit chaining.\n * _(users).head();\n * // => { 'user': 'barney', 'age': 36 }\n *\n * // A sequence with explicit chaining.\n * _(users)\n * .chain()\n * .head()\n * .pick('user')\n * .value();\n * // => { 'user': 'barney' }\n */\n function wrapperChain() {\n return chain(this);\n }\n\n /**\n * Executes the chain sequence and returns the wrapped result.\n *\n * @name commit\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2];\n * var wrapped = _(array).push(3);\n *\n * console.log(array);\n * // => [1, 2]\n *\n * wrapped = wrapped.commit();\n * console.log(array);\n * // => [1, 2, 3]\n *\n * wrapped.last();\n * // => 3\n *\n * console.log(array);\n * // => [1, 2, 3]\n */\n function wrapperCommit() {\n return new LodashWrapper(this.value(), this.__chain__);\n }\n\n /**\n * Gets the next value on a wrapped object following the\n * [iterator protocol](https://mdn.io/iteration_protocols#iterator).\n *\n * @name next\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the next iterator value.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 1 }\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 2 }\n *\n * wrapped.next();\n * // => { 'done': true, 'value': undefined }\n */\n function wrapperNext() {\n if (this.__values__ === undefined) {\n this.__values__ = toArray(this.value());\n }\n var done = this.__index__ >= this.__values__.length,\n value = done ? undefined : this.__values__[this.__index__++];\n\n return { 'done': done, 'value': value };\n }\n\n /**\n * Enables the wrapper to be iterable.\n *\n * @name Symbol.iterator\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the wrapper object.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped[Symbol.iterator]() === wrapped;\n * // => true\n *\n * Array.from(wrapped);\n * // => [1, 2]\n */\n function wrapperToIterator() {\n return this;\n }\n\n /**\n * Creates a clone of the chain sequence planting `value` as the wrapped value.\n *\n * @name plant\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @param {*} value The value to plant.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2]).map(square);\n * var other = wrapped.plant([3, 4]);\n *\n * other.value();\n * // => [9, 16]\n *\n * wrapped.value();\n * // => [1, 4]\n */\n function wrapperPlant(value) {\n var result,\n parent = this;\n\n while (parent instanceof baseLodash) {\n var clone = wrapperClone(parent);\n clone.__index__ = 0;\n clone.__values__ = undefined;\n if (result) {\n previous.__wrapped__ = clone;\n } else {\n result = clone;\n }\n var previous = clone;\n parent = parent.__wrapped__;\n }\n previous.__wrapped__ = value;\n return result;\n }\n\n /**\n * This method is the wrapper version of `_.reverse`.\n *\n * **Note:** This method mutates the wrapped array.\n *\n * @name reverse\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _(array).reverse().value()\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function wrapperReverse() {\n var value = this.__wrapped__;\n if (value instanceof LazyWrapper) {\n var wrapped = value;\n if (this.__actions__.length) {\n wrapped = new LazyWrapper(this);\n }\n wrapped = wrapped.reverse();\n wrapped.__actions__.push({\n 'func': thru,\n 'args': [reverse],\n 'thisArg': undefined\n });\n return new LodashWrapper(wrapped, this.__chain__);\n }\n return this.thru(reverse);\n }\n\n /**\n * Executes the chain sequence to resolve the unwrapped value.\n *\n * @name value\n * @memberOf _\n * @since 0.1.0\n * @alias toJSON, valueOf\n * @category Seq\n * @returns {*} Returns the resolved unwrapped value.\n * @example\n *\n * _([1, 2, 3]).value();\n * // => [1, 2, 3]\n */\n function wrapperValue() {\n return baseWrapperValue(this.__wrapped__, this.__actions__);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the number of times the key was returned by `iteratee`. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.countBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': 1, '6': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.countBy(['one', 'two', 'three'], 'length');\n * // => { '3': 2, '5': 1 }\n */\n var countBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n ++result[key];\n } else {\n baseAssignValue(result, key, 1);\n }\n });\n\n /**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\n function every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning an array of all elements\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * **Note:** Unlike `_.remove`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.reject\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * _.filter(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, { 'age': 36, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.filter(users, 'active');\n * // => objects for ['barney']\n */\n function filter(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning the first element\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false },\n * { 'user': 'pebbles', 'age': 1, 'active': true }\n * ];\n *\n * _.find(users, function(o) { return o.age < 40; });\n * // => object for 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.find(users, { 'age': 1, 'active': true });\n * // => object for 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.find(users, ['active', false]);\n * // => object for 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.find(users, 'active');\n * // => object for 'barney'\n */\n var find = createFind(findIndex);\n\n /**\n * This method is like `_.find` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=collection.length-1] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * _.findLast([1, 2, 3, 4], function(n) {\n * return n % 2 == 1;\n * });\n * // => 3\n */\n var findLast = createFind(findLastIndex);\n\n /**\n * Creates a flattened array of values by running each element in `collection`\n * thru `iteratee` and flattening the mapped results. The iteratee is invoked\n * with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [n, n];\n * }\n *\n * _.flatMap([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMap(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), 1);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDeep([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMapDeep(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), INFINITY);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDepth([1, 2], duplicate, 2);\n * // => [[1, 1], [2, 2]]\n */\n function flatMapDepth(collection, iteratee, depth) {\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(map(collection, iteratee), depth);\n }\n\n /**\n * Iterates over elements of `collection` and invokes `iteratee` for each element.\n * The iteratee is invoked with three arguments: (value, index|key, collection).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * **Note:** As with other \"Collections\" methods, objects with a \"length\"\n * property are iterated like arrays. To avoid this behavior use `_.forIn`\n * or `_.forOwn` for object iteration.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias each\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEachRight\n * @example\n *\n * _.forEach([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `1` then `2`.\n *\n * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forEach(collection, iteratee) {\n var func = isArray(collection) ? arrayEach : baseEach;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forEach` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @alias eachRight\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEach\n * @example\n *\n * _.forEachRight([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `2` then `1`.\n */\n function forEachRight(collection, iteratee) {\n var func = isArray(collection) ? arrayEachRight : baseEachRight;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The order of grouped values\n * is determined by the order they occur in `collection`. The corresponding\n * value of each key is an array of elements responsible for generating the\n * key. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.groupBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': [4.2], '6': [6.1, 6.3] }\n *\n * // The `_.property` iteratee shorthand.\n * _.groupBy(['one', 'two', 'three'], 'length');\n * // => { '3': ['one', 'two'], '5': ['three'] }\n */\n var groupBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n result[key].push(value);\n } else {\n baseAssignValue(result, key, [value]);\n }\n });\n\n /**\n * Checks if `value` is in `collection`. If `collection` is a string, it's\n * checked for a substring of `value`, otherwise\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * is used for equality comparisons. If `fromIndex` is negative, it's used as\n * the offset from the end of `collection`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {boolean} Returns `true` if `value` is found, else `false`.\n * @example\n *\n * _.includes([1, 2, 3], 1);\n * // => true\n *\n * _.includes([1, 2, 3], 1, 2);\n * // => false\n *\n * _.includes({ 'a': 1, 'b': 2 }, 1);\n * // => true\n *\n * _.includes('abcd', 'bc');\n * // => true\n */\n function includes(collection, value, fromIndex, guard) {\n collection = isArrayLike(collection) ? collection : values(collection);\n fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;\n\n var length = collection.length;\n if (fromIndex < 0) {\n fromIndex = nativeMax(length + fromIndex, 0);\n }\n return isString(collection)\n ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)\n : (!!length && baseIndexOf(collection, value, fromIndex) > -1);\n }\n\n /**\n * Invokes the method at `path` of each element in `collection`, returning\n * an array of the results of each invoked method. Any additional arguments\n * are provided to each invoked method. If `path` is a function, it's invoked\n * for, and `this` bound to, each element in `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array|Function|string} path The path of the method to invoke or\n * the function invoked per iteration.\n * @param {...*} [args] The arguments to invoke each method with.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');\n * // => [[1, 5, 7], [1, 2, 3]]\n *\n * _.invokeMap([123, 456], String.prototype.split, '');\n * // => [['1', '2', '3'], ['4', '5', '6']]\n */\n var invokeMap = baseRest(function(collection, path, args) {\n var index = -1,\n isFunc = typeof path == 'function',\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value) {\n result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);\n });\n return result;\n });\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the last element responsible for generating the key. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * var array = [\n * { 'dir': 'left', 'code': 97 },\n * { 'dir': 'right', 'code': 100 }\n * ];\n *\n * _.keyBy(array, function(o) {\n * return String.fromCharCode(o.code);\n * });\n * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }\n *\n * _.keyBy(array, 'dir');\n * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }\n */\n var keyBy = createAggregator(function(result, value, key) {\n baseAssignValue(result, key, value);\n });\n\n /**\n * Creates an array of values by running each element in `collection` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.\n *\n * The guarded methods are:\n * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,\n * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,\n * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,\n * `template`, `trim`, `trimEnd`, `trimStart`, and `words`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * _.map([4, 8], square);\n * // => [16, 64]\n *\n * _.map({ 'a': 4, 'b': 8 }, square);\n * // => [16, 64] (iteration order is not guaranteed)\n *\n * var users = [\n * { 'user': 'barney' },\n * { 'user': 'fred' }\n * ];\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, 'user');\n * // => ['barney', 'fred']\n */\n function map(collection, iteratee) {\n var func = isArray(collection) ? arrayMap : baseMap;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.sortBy` except that it allows specifying the sort\n * orders of the iteratees to sort by. If `orders` is unspecified, all values\n * are sorted in ascending order. Otherwise, specify an order of \"desc\" for\n * descending or \"asc\" for ascending sort order of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @param {string[]} [orders] The sort orders of `iteratees`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 34 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 36 }\n * ];\n *\n * // Sort by `user` in ascending order and by `age` in descending order.\n * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n */\n function orderBy(collection, iteratees, orders, guard) {\n if (collection == null) {\n return [];\n }\n if (!isArray(iteratees)) {\n iteratees = iteratees == null ? [] : [iteratees];\n }\n orders = guard ? undefined : orders;\n if (!isArray(orders)) {\n orders = orders == null ? [] : [orders];\n }\n return baseOrderBy(collection, iteratees, orders);\n }\n\n /**\n * Creates an array of elements split into two groups, the first of which\n * contains elements `predicate` returns truthy for, the second of which\n * contains elements `predicate` returns falsey for. The predicate is\n * invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of grouped elements.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true },\n * { 'user': 'pebbles', 'age': 1, 'active': false }\n * ];\n *\n * _.partition(users, function(o) { return o.active; });\n * // => objects for [['fred'], ['barney', 'pebbles']]\n *\n * // The `_.matches` iteratee shorthand.\n * _.partition(users, { 'age': 1, 'active': false });\n * // => objects for [['pebbles'], ['barney', 'fred']]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.partition(users, ['active', false]);\n * // => objects for [['barney', 'pebbles'], ['fred']]\n *\n * // The `_.property` iteratee shorthand.\n * _.partition(users, 'active');\n * // => objects for [['fred'], ['barney', 'pebbles']]\n */\n var partition = createAggregator(function(result, value, key) {\n result[key ? 0 : 1].push(value);\n }, function() { return [[], []]; });\n\n /**\n * Reduces `collection` to a value which is the accumulated result of running\n * each element in `collection` thru `iteratee`, where each successive\n * invocation is supplied the return value of the previous. If `accumulator`\n * is not given, the first element of `collection` is used as the initial\n * value. The iteratee is invoked with four arguments:\n * (accumulator, value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.reduce`, `_.reduceRight`, and `_.transform`.\n *\n * The guarded methods are:\n * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,\n * and `sortBy`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduceRight\n * @example\n *\n * _.reduce([1, 2], function(sum, n) {\n * return sum + n;\n * }, 0);\n * // => 3\n *\n * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * return result;\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)\n */\n function reduce(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduce : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);\n }\n\n /**\n * This method is like `_.reduce` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduce\n * @example\n *\n * var array = [[0, 1], [2, 3], [4, 5]];\n *\n * _.reduceRight(array, function(flattened, other) {\n * return flattened.concat(other);\n * }, []);\n * // => [4, 5, 2, 3, 0, 1]\n */\n function reduceRight(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduceRight : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);\n }\n\n /**\n * The opposite of `_.filter`; this method returns the elements of `collection`\n * that `predicate` does **not** return truthy for.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.filter\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true }\n * ];\n *\n * _.reject(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.reject(users, { 'age': 40, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.reject(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.reject(users, 'active');\n * // => objects for ['barney']\n */\n function reject(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, negate(getIteratee(predicate, 3)));\n }\n\n /**\n * Gets a random element from `collection`.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n * @example\n *\n * _.sample([1, 2, 3, 4]);\n * // => 2\n */\n function sample(collection) {\n var func = isArray(collection) ? arraySample : baseSample;\n return func(collection);\n }\n\n /**\n * Gets `n` random elements at unique keys from `collection` up to the\n * size of `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @param {number} [n=1] The number of elements to sample.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the random elements.\n * @example\n *\n * _.sampleSize([1, 2, 3], 2);\n * // => [3, 1]\n *\n * _.sampleSize([1, 2, 3], 4);\n * // => [2, 3, 1]\n */\n function sampleSize(collection, n, guard) {\n if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n var func = isArray(collection) ? arraySampleSize : baseSampleSize;\n return func(collection, n);\n }\n\n /**\n * Creates an array of shuffled values, using a version of the\n * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n * @example\n *\n * _.shuffle([1, 2, 3, 4]);\n * // => [4, 1, 3, 2]\n */\n function shuffle(collection) {\n var func = isArray(collection) ? arrayShuffle : baseShuffle;\n return func(collection);\n }\n\n /**\n * Gets the size of `collection` by returning its length for array-like\n * values or the number of own enumerable string keyed properties for objects.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @returns {number} Returns the collection size.\n * @example\n *\n * _.size([1, 2, 3]);\n * // => 3\n *\n * _.size({ 'a': 1, 'b': 2 });\n * // => 2\n *\n * _.size('pebbles');\n * // => 7\n */\n function size(collection) {\n if (collection == null) {\n return 0;\n }\n if (isArrayLike(collection)) {\n return isString(collection) ? stringSize(collection) : collection.length;\n }\n var tag = getTag(collection);\n if (tag == mapTag || tag == setTag) {\n return collection.size;\n }\n return baseKeys(collection).length;\n }\n\n /**\n * Checks if `predicate` returns truthy for **any** element of `collection`.\n * Iteration is stopped once `predicate` returns truthy. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n * @example\n *\n * _.some([null, 0, 'yes', false], Boolean);\n * // => true\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.some(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.some(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.some(users, 'active');\n * // => true\n */\n function some(collection, predicate, guard) {\n var func = isArray(collection) ? arraySome : baseSome;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]\n */\n var sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\n var now = ctxNow || function() {\n return root.Date.now();\n };\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The opposite of `_.before`; this method creates a function that invokes\n * `func` once it's called `n` or more times.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {number} n The number of calls before `func` is invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var saves = ['profile', 'settings'];\n *\n * var done = _.after(saves.length, function() {\n * console.log('done saving!');\n * });\n *\n * _.forEach(saves, function(type) {\n * asyncSave({ 'type': type, 'complete': done });\n * });\n * // => Logs 'done saving!' after the two async saves have completed.\n */\n function after(n, func) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n < 1) {\n return func.apply(this, arguments);\n }\n };\n }\n\n /**\n * Creates a function that invokes `func`, with up to `n` arguments,\n * ignoring any additional arguments.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @param {number} [n=func.length] The arity cap.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.ary(parseInt, 1));\n * // => [6, 8, 10]\n */\n function ary(func, n, guard) {\n n = guard ? undefined : n;\n n = (func && n == null) ? func.length : n;\n return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);\n }\n\n /**\n * Creates a function that invokes `func`, with the `this` binding and arguments\n * of the created function, while it's called less than `n` times. Subsequent\n * calls to the created function return the result of the last `func` invocation.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {number} n The number of calls at which `func` is no longer invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * jQuery(element).on('click', _.before(5, addContactToList));\n * // => Allows adding up to 4 contacts to the list.\n */\n function before(n, func) {\n var result;\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n > 0) {\n result = func.apply(this, arguments);\n }\n if (n <= 1) {\n func = undefined;\n }\n return result;\n };\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of `thisArg`\n * and `partials` prepended to the arguments it receives.\n *\n * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for partially applied arguments.\n *\n * **Note:** Unlike native `Function#bind`, this method doesn't set the \"length\"\n * property of bound functions.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to bind.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * function greet(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n *\n * var object = { 'user': 'fred' };\n *\n * var bound = _.bind(greet, object, 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bind(greet, object, _, '!');\n * bound('hi');\n * // => 'hi fred!'\n */\n var bind = baseRest(function(func, thisArg, partials) {\n var bitmask = WRAP_BIND_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bind));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(func, bitmask, thisArg, partials, holders);\n });\n\n /**\n * Creates a function that invokes the method at `object[key]` with `partials`\n * prepended to the arguments it receives.\n *\n * This method differs from `_.bind` by allowing bound functions to reference\n * methods that may be redefined or don't yet exist. See\n * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)\n * for more details.\n *\n * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Function\n * @param {Object} object The object to invoke the method on.\n * @param {string} key The key of the method.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * var object = {\n * 'user': 'fred',\n * 'greet': function(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n * };\n *\n * var bound = _.bindKey(object, 'greet', 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * object.greet = function(greeting, punctuation) {\n * return greeting + 'ya ' + this.user + punctuation;\n * };\n *\n * bound('!');\n * // => 'hiya fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bindKey(object, 'greet', _, '!');\n * bound('hi');\n * // => 'hiya fred!'\n */\n var bindKey = baseRest(function(object, key, partials) {\n var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bindKey));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(key, bitmask, object, partials, holders);\n });\n\n /**\n * Creates a function that accepts arguments of `func` and either invokes\n * `func` returning its result, if at least `arity` number of arguments have\n * been provided, or returns a function that accepts the remaining `func`\n * arguments, and so on. The arity of `func` may be specified if `func.length`\n * is not sufficient.\n *\n * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curry(abc);\n *\n * curried(1)(2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(1)(_, 3)(2);\n * // => [1, 2, 3]\n */\n function curry(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curry.placeholder;\n return result;\n }\n\n /**\n * This method is like `_.curry` except that arguments are applied to `func`\n * in the manner of `_.partialRight` instead of `_.partial`.\n *\n * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curryRight(abc);\n *\n * curried(3)(2)(1);\n * // => [1, 2, 3]\n *\n * curried(2, 3)(1);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(3)(1, _)(2);\n * // => [1, 2, 3]\n */\n function curryRight(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curryRight.placeholder;\n return result;\n }\n\n /**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\n function debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n timeWaiting = wait - timeSinceLastCall;\n\n return maxing\n ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)\n : timeWaiting;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n clearTimeout(timerId);\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n }\n\n /**\n * Defers invoking the `func` until the current call stack has cleared. Any\n * additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to defer.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.defer(function(text) {\n * console.log(text);\n * }, 'deferred');\n * // => Logs 'deferred' after one millisecond.\n */\n var defer = baseRest(function(func, args) {\n return baseDelay(func, 1, args);\n });\n\n /**\n * Invokes `func` after `wait` milliseconds. Any additional arguments are\n * provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.delay(function(text) {\n * console.log(text);\n * }, 1000, 'later');\n * // => Logs 'later' after one second.\n */\n var delay = baseRest(function(func, wait, args) {\n return baseDelay(func, toNumber(wait) || 0, args);\n });\n\n /**\n * Creates a function that invokes `func` with arguments reversed.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to flip arguments for.\n * @returns {Function} Returns the new flipped function.\n * @example\n *\n * var flipped = _.flip(function() {\n * return _.toArray(arguments);\n * });\n *\n * flipped('a', 'b', 'c', 'd');\n * // => ['d', 'c', 'b', 'a']\n */\n function flip(func) {\n return createWrap(func, WRAP_FLIP_FLAG);\n }\n\n /**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `clear`, `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\n function memoize(func, resolver) {\n if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var memoized = function() {\n var args = arguments,\n key = resolver ? resolver.apply(this, args) : args[0],\n cache = memoized.cache;\n\n if (cache.has(key)) {\n return cache.get(key);\n }\n var result = func.apply(this, args);\n memoized.cache = cache.set(key, result) || cache;\n return result;\n };\n memoized.cache = new (memoize.Cache || MapCache);\n return memoized;\n }\n\n // Expose `MapCache`.\n memoize.Cache = MapCache;\n\n /**\n * Creates a function that negates the result of the predicate `func`. The\n * `func` predicate is invoked with the `this` binding and arguments of the\n * created function.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} predicate The predicate to negate.\n * @returns {Function} Returns the new negated function.\n * @example\n *\n * function isEven(n) {\n * return n % 2 == 0;\n * }\n *\n * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));\n * // => [1, 3, 5]\n */\n function negate(predicate) {\n if (typeof predicate != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return function() {\n var args = arguments;\n switch (args.length) {\n case 0: return !predicate.call(this);\n case 1: return !predicate.call(this, args[0]);\n case 2: return !predicate.call(this, args[0], args[1]);\n case 3: return !predicate.call(this, args[0], args[1], args[2]);\n }\n return !predicate.apply(this, args);\n };\n }\n\n /**\n * Creates a function that is restricted to invoking `func` once. Repeat calls\n * to the function return the value of the first invocation. The `func` is\n * invoked with the `this` binding and arguments of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var initialize = _.once(createApplication);\n * initialize();\n * initialize();\n * // => `createApplication` is invoked once\n */\n function once(func) {\n return before(2, func);\n }\n\n /**\n * Creates a function that invokes `func` with its arguments transformed.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Function\n * @param {Function} func The function to wrap.\n * @param {...(Function|Function[])} [transforms=[_.identity]]\n * The argument transforms.\n * @returns {Function} Returns the new function.\n * @example\n *\n * function doubled(n) {\n * return n * 2;\n * }\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var func = _.overArgs(function(x, y) {\n * return [x, y];\n * }, [square, doubled]);\n *\n * func(9, 3);\n * // => [81, 6]\n *\n * func(10, 5);\n * // => [100, 10]\n */\n var overArgs = castRest(function(func, transforms) {\n transforms = (transforms.length == 1 && isArray(transforms[0]))\n ? arrayMap(transforms[0], baseUnary(getIteratee()))\n : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));\n\n var funcsLength = transforms.length;\n return baseRest(function(args) {\n var index = -1,\n length = nativeMin(args.length, funcsLength);\n\n while (++index < length) {\n args[index] = transforms[index].call(this, args[index]);\n }\n return apply(func, this, args);\n });\n });\n\n /**\n * Creates a function that invokes `func` with `partials` prepended to the\n * arguments it receives. This method is like `_.bind` except it does **not**\n * alter the `this` binding.\n *\n * The `_.partial.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 0.2.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var sayHelloTo = _.partial(greet, 'hello');\n * sayHelloTo('fred');\n * // => 'hello fred'\n *\n * // Partially applied with placeholders.\n * var greetFred = _.partial(greet, _, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n */\n var partial = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partial));\n return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);\n });\n\n /**\n * This method is like `_.partial` except that partially applied arguments\n * are appended to the arguments it receives.\n *\n * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var greetFred = _.partialRight(greet, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n *\n * // Partially applied with placeholders.\n * var sayHelloTo = _.partialRight(greet, 'hello', _);\n * sayHelloTo('fred');\n * // => 'hello fred'\n */\n var partialRight = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partialRight));\n return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);\n });\n\n /**\n * Creates a function that invokes `func` with arguments arranged according\n * to the specified `indexes` where the argument value at the first index is\n * provided as the first argument, the argument value at the second index is\n * provided as the second argument, and so on.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to rearrange arguments for.\n * @param {...(number|number[])} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var rearged = _.rearg(function(a, b, c) {\n * return [a, b, c];\n * }, [2, 0, 1]);\n *\n * rearged('b', 'c', 'a')\n * // => ['a', 'b', 'c']\n */\n var rearg = flatRest(function(func, indexes) {\n return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);\n });\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * created function and arguments from `start` and beyond provided as\n * an array.\n *\n * **Note:** This method is based on the\n * [rest parameter](https://mdn.io/rest_parameters).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.rest(function(what, names) {\n * return what + ' ' + _.initial(names).join(', ') +\n * (_.size(names) > 1 ? ', & ' : '') + _.last(names);\n * });\n *\n * say('hello', 'fred', 'barney', 'pebbles');\n * // => 'hello fred, barney, & pebbles'\n */\n function rest(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start === undefined ? start : toInteger(start);\n return baseRest(func, start);\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * create function and an array of arguments much like\n * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).\n *\n * **Note:** This method is based on the\n * [spread operator](https://mdn.io/spread_operator).\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Function\n * @param {Function} func The function to spread arguments over.\n * @param {number} [start=0] The start position of the spread.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.spread(function(who, what) {\n * return who + ' says ' + what;\n * });\n *\n * say(['fred', 'hello']);\n * // => 'fred says hello'\n *\n * var numbers = Promise.all([\n * Promise.resolve(40),\n * Promise.resolve(36)\n * ]);\n *\n * numbers.then(_.spread(function(x, y) {\n * return x + y;\n * }));\n * // => a Promise of 76\n */\n function spread(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start == null ? 0 : nativeMax(toInteger(start), 0);\n return baseRest(function(args) {\n var array = args[start],\n otherArgs = castSlice(args, 0, start);\n\n if (array) {\n arrayPush(otherArgs, array);\n }\n return apply(func, this, otherArgs);\n });\n }\n\n /**\n * Creates a throttled function that only invokes `func` at most once per\n * every `wait` milliseconds. The throttled function comes with a `cancel`\n * method to cancel delayed `func` invocations and a `flush` method to\n * immediately invoke them. Provide `options` to indicate whether `func`\n * should be invoked on the leading and/or trailing edge of the `wait`\n * timeout. The `func` is invoked with the last arguments provided to the\n * throttled function. Subsequent calls to the throttled function return the\n * result of the last `func` invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the throttled function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.throttle` and `_.debounce`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to throttle.\n * @param {number} [wait=0] The number of milliseconds to throttle invocations to.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=true]\n * Specify invoking on the leading edge of the timeout.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new throttled function.\n * @example\n *\n * // Avoid excessively updating the position while scrolling.\n * jQuery(window).on('scroll', _.throttle(updatePosition, 100));\n *\n * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.\n * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });\n * jQuery(element).on('click', throttled);\n *\n * // Cancel the trailing throttled invocation.\n * jQuery(window).on('popstate', throttled.cancel);\n */\n function throttle(func, wait, options) {\n var leading = true,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (isObject(options)) {\n leading = 'leading' in options ? !!options.leading : leading;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n return debounce(func, wait, {\n 'leading': leading,\n 'maxWait': wait,\n 'trailing': trailing\n });\n }\n\n /**\n * Creates a function that accepts up to one argument, ignoring any\n * additional arguments.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.unary(parseInt));\n * // => [6, 8, 10]\n */\n function unary(func) {\n return ary(func, 1);\n }\n\n /**\n * Creates a function that provides `value` to `wrapper` as its first\n * argument. Any additional arguments provided to the function are appended\n * to those provided to the `wrapper`. The wrapper is invoked with the `this`\n * binding of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {*} value The value to wrap.\n * @param {Function} [wrapper=identity] The wrapper function.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var p = _.wrap(_.escape, function(func, text) {\n * return '' + func(text) + '
';\n * });\n *\n * p('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles
'\n */\n function wrap(value, wrapper) {\n return partial(castFunction(wrapper), value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Casts `value` as an array if it's not one.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Lang\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast array.\n * @example\n *\n * _.castArray(1);\n * // => [1]\n *\n * _.castArray({ 'a': 1 });\n * // => [{ 'a': 1 }]\n *\n * _.castArray('abc');\n * // => ['abc']\n *\n * _.castArray(null);\n * // => [null]\n *\n * _.castArray(undefined);\n * // => [undefined]\n *\n * _.castArray();\n * // => []\n *\n * var array = [1, 2, 3];\n * console.log(_.castArray(array) === array);\n * // => true\n */\n function castArray() {\n if (!arguments.length) {\n return [];\n }\n var value = arguments[0];\n return isArray(value) ? value : [value];\n }\n\n /**\n * Creates a shallow clone of `value`.\n *\n * **Note:** This method is loosely based on the\n * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)\n * and supports cloning arrays, array buffers, booleans, date objects, maps,\n * numbers, `Object` objects, regexes, sets, strings, symbols, and typed\n * arrays. The own enumerable properties of `arguments` objects are cloned\n * as plain objects. An empty object is returned for uncloneable values such\n * as error objects, functions, DOM nodes, and WeakMaps.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to clone.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeep\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var shallow = _.clone(objects);\n * console.log(shallow[0] === objects[0]);\n * // => true\n */\n function clone(value) {\n return baseClone(value, CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.clone` except that it accepts `customizer` which\n * is invoked to produce the cloned value. If `customizer` returns `undefined`,\n * cloning is handled by the method instead. The `customizer` is invoked with\n * up to four arguments; (value [, index|key, object, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeepWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(false);\n * }\n * }\n *\n * var el = _.cloneWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 0\n */\n function cloneWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\n function cloneDeep(value) {\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.cloneWith` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the deep cloned value.\n * @see _.cloneWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(true);\n * }\n * }\n *\n * var el = _.cloneDeepWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 20\n */\n function cloneDeepWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * Checks if `object` conforms to `source` by invoking the predicate\n * properties of `source` with the corresponding property values of `object`.\n *\n * **Note:** This method is equivalent to `_.conforms` when `source` is\n * partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 1; } });\n * // => true\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 2; } });\n * // => false\n */\n function conformsTo(object, source) {\n return source == null || baseConformsTo(object, source, keys(source));\n }\n\n /**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\n function eq(value, other) {\n return value === other || (value !== value && other !== other);\n }\n\n /**\n * Checks if `value` is greater than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n * @see _.lt\n * @example\n *\n * _.gt(3, 1);\n * // => true\n *\n * _.gt(3, 3);\n * // => false\n *\n * _.gt(1, 3);\n * // => false\n */\n var gt = createRelationalOperation(baseGt);\n\n /**\n * Checks if `value` is greater than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than or equal to\n * `other`, else `false`.\n * @see _.lte\n * @example\n *\n * _.gte(3, 1);\n * // => true\n *\n * _.gte(3, 3);\n * // => true\n *\n * _.gte(1, 3);\n * // => false\n */\n var gte = createRelationalOperation(function(value, other) {\n return value >= other;\n });\n\n /**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\n var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n };\n\n /**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\n var isArray = Array.isArray;\n\n /**\n * Checks if `value` is classified as an `ArrayBuffer` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n * @example\n *\n * _.isArrayBuffer(new ArrayBuffer(2));\n * // => true\n *\n * _.isArrayBuffer(new Array(2));\n * // => false\n */\n var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;\n\n /**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\n function isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n }\n\n /**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n * else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\n function isArrayLikeObject(value) {\n return isObjectLike(value) && isArrayLike(value);\n }\n\n /**\n * Checks if `value` is classified as a boolean primitive or object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.\n * @example\n *\n * _.isBoolean(false);\n * // => true\n *\n * _.isBoolean(null);\n * // => false\n */\n function isBoolean(value) {\n return value === true || value === false ||\n (isObjectLike(value) && baseGetTag(value) == boolTag);\n }\n\n /**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\n var isBuffer = nativeIsBuffer || stubFalse;\n\n /**\n * Checks if `value` is classified as a `Date` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n * @example\n *\n * _.isDate(new Date);\n * // => true\n *\n * _.isDate('Mon April 23 2012');\n * // => false\n */\n var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;\n\n /**\n * Checks if `value` is likely a DOM element.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.\n * @example\n *\n * _.isElement(document.body);\n * // => true\n *\n * _.isElement('');\n * // => false\n */\n function isElement(value) {\n return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);\n }\n\n /**\n * Checks if `value` is an empty object, collection, map, or set.\n *\n * Objects are considered empty if they have no own enumerable string keyed\n * properties.\n *\n * Array-like values such as `arguments` objects, arrays, buffers, strings, or\n * jQuery-like collections are considered empty if they have a `length` of `0`.\n * Similarly, maps and sets are considered empty if they have a `size` of `0`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is empty, else `false`.\n * @example\n *\n * _.isEmpty(null);\n * // => true\n *\n * _.isEmpty(true);\n * // => true\n *\n * _.isEmpty(1);\n * // => true\n *\n * _.isEmpty([1, 2, 3]);\n * // => false\n *\n * _.isEmpty({ 'a': 1 });\n * // => false\n */\n function isEmpty(value) {\n if (value == null) {\n return true;\n }\n if (isArrayLike(value) &&\n (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||\n isBuffer(value) || isTypedArray(value) || isArguments(value))) {\n return !value.length;\n }\n var tag = getTag(value);\n if (tag == mapTag || tag == setTag) {\n return !value.size;\n }\n if (isPrototype(value)) {\n return !baseKeys(value).length;\n }\n for (var key in value) {\n if (hasOwnProperty.call(value, key)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\n function isEqual(value, other) {\n return baseIsEqual(value, other);\n }\n\n /**\n * This method is like `_.isEqual` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with up to\n * six arguments: (objValue, othValue [, index|key, object, other, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, othValue) {\n * if (isGreeting(objValue) && isGreeting(othValue)) {\n * return true;\n * }\n * }\n *\n * var array = ['hello', 'goodbye'];\n * var other = ['hi', 'goodbye'];\n *\n * _.isEqualWith(array, other, customizer);\n * // => true\n */\n function isEqualWith(value, other, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n var result = customizer ? customizer(value, other) : undefined;\n return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;\n }\n\n /**\n * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,\n * `SyntaxError`, `TypeError`, or `URIError` object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an error object, else `false`.\n * @example\n *\n * _.isError(new Error);\n * // => true\n *\n * _.isError(Error);\n * // => false\n */\n function isError(value) {\n if (!isObjectLike(value)) {\n return false;\n }\n var tag = baseGetTag(value);\n return tag == errorTag || tag == domExcTag ||\n (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));\n }\n\n /**\n * Checks if `value` is a finite primitive number.\n *\n * **Note:** This method is based on\n * [`Number.isFinite`](https://mdn.io/Number/isFinite).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.\n * @example\n *\n * _.isFinite(3);\n * // => true\n *\n * _.isFinite(Number.MIN_VALUE);\n * // => true\n *\n * _.isFinite(Infinity);\n * // => false\n *\n * _.isFinite('3');\n * // => false\n */\n function isFinite(value) {\n return typeof value == 'number' && nativeIsFinite(value);\n }\n\n /**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\n function isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n }\n\n /**\n * Checks if `value` is an integer.\n *\n * **Note:** This method is based on\n * [`Number.isInteger`](https://mdn.io/Number/isInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an integer, else `false`.\n * @example\n *\n * _.isInteger(3);\n * // => true\n *\n * _.isInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isInteger(Infinity);\n * // => false\n *\n * _.isInteger('3');\n * // => false\n */\n function isInteger(value) {\n return typeof value == 'number' && value == toInteger(value);\n }\n\n /**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\n function isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\n function isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n }\n\n /**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\n function isObjectLike(value) {\n return value != null && typeof value == 'object';\n }\n\n /**\n * Checks if `value` is classified as a `Map` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n * @example\n *\n * _.isMap(new Map);\n * // => true\n *\n * _.isMap(new WeakMap);\n * // => false\n */\n var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;\n\n /**\n * Performs a partial deep comparison between `object` and `source` to\n * determine if `object` contains equivalent property values.\n *\n * **Note:** This method is equivalent to `_.matches` when `source` is\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.isMatch(object, { 'b': 2 });\n * // => true\n *\n * _.isMatch(object, { 'b': 1 });\n * // => false\n */\n function isMatch(object, source) {\n return object === source || baseIsMatch(object, source, getMatchData(source));\n }\n\n /**\n * This method is like `_.isMatch` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with five\n * arguments: (objValue, srcValue, index|key, object, source).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, srcValue) {\n * if (isGreeting(objValue) && isGreeting(srcValue)) {\n * return true;\n * }\n * }\n *\n * var object = { 'greeting': 'hello' };\n * var source = { 'greeting': 'hi' };\n *\n * _.isMatchWith(object, source, customizer);\n * // => true\n */\n function isMatchWith(object, source, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseIsMatch(object, source, getMatchData(source), customizer);\n }\n\n /**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\n function isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n }\n\n /**\n * Checks if `value` is a pristine native function.\n *\n * **Note:** This method can't reliably detect native functions in the presence\n * of the core-js package because core-js circumvents this kind of detection.\n * Despite multiple requests, the core-js maintainer has made it clear: any\n * attempt to fix the detection will be obstructed. As a result, we're left\n * with little choice but to throw an error. Unfortunately, this also affects\n * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),\n * which rely on core-js.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n * @example\n *\n * _.isNative(Array.prototype.push);\n * // => true\n *\n * _.isNative(_);\n * // => false\n */\n function isNative(value) {\n if (isMaskable(value)) {\n throw new Error(CORE_ERROR_TEXT);\n }\n return baseIsNative(value);\n }\n\n /**\n * Checks if `value` is `null`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `null`, else `false`.\n * @example\n *\n * _.isNull(null);\n * // => true\n *\n * _.isNull(void 0);\n * // => false\n */\n function isNull(value) {\n return value === null;\n }\n\n /**\n * Checks if `value` is `null` or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is nullish, else `false`.\n * @example\n *\n * _.isNil(null);\n * // => true\n *\n * _.isNil(void 0);\n * // => true\n *\n * _.isNil(NaN);\n * // => false\n */\n function isNil(value) {\n return value == null;\n }\n\n /**\n * Checks if `value` is classified as a `Number` primitive or object.\n *\n * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are\n * classified as numbers, use the `_.isFinite` method.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a number, else `false`.\n * @example\n *\n * _.isNumber(3);\n * // => true\n *\n * _.isNumber(Number.MIN_VALUE);\n * // => true\n *\n * _.isNumber(Infinity);\n * // => true\n *\n * _.isNumber('3');\n * // => false\n */\n function isNumber(value) {\n return typeof value == 'number' ||\n (isObjectLike(value) && baseGetTag(value) == numberTag);\n }\n\n /**\n * Checks if `value` is a plain object, that is, an object created by the\n * `Object` constructor or one with a `[[Prototype]]` of `null`.\n *\n * @static\n * @memberOf _\n * @since 0.8.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * _.isPlainObject(new Foo);\n * // => false\n *\n * _.isPlainObject([1, 2, 3]);\n * // => false\n *\n * _.isPlainObject({ 'x': 0, 'y': 0 });\n * // => true\n *\n * _.isPlainObject(Object.create(null));\n * // => true\n */\n function isPlainObject(value) {\n if (!isObjectLike(value) || baseGetTag(value) != objectTag) {\n return false;\n }\n var proto = getPrototype(value);\n if (proto === null) {\n return true;\n }\n var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;\n return typeof Ctor == 'function' && Ctor instanceof Ctor &&\n funcToString.call(Ctor) == objectCtorString;\n }\n\n /**\n * Checks if `value` is classified as a `RegExp` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n * @example\n *\n * _.isRegExp(/abc/);\n * // => true\n *\n * _.isRegExp('/abc/');\n * // => false\n */\n var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;\n\n /**\n * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754\n * double precision number which isn't the result of a rounded unsafe integer.\n *\n * **Note:** This method is based on\n * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.\n * @example\n *\n * _.isSafeInteger(3);\n * // => true\n *\n * _.isSafeInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isSafeInteger(Infinity);\n * // => false\n *\n * _.isSafeInteger('3');\n * // => false\n */\n function isSafeInteger(value) {\n return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is classified as a `Set` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n * @example\n *\n * _.isSet(new Set);\n * // => true\n *\n * _.isSet(new WeakSet);\n * // => false\n */\n var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;\n\n /**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\n function isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n }\n\n /**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\n function isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n }\n\n /**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\n var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n /**\n * Checks if `value` is `undefined`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.\n * @example\n *\n * _.isUndefined(void 0);\n * // => true\n *\n * _.isUndefined(null);\n * // => false\n */\n function isUndefined(value) {\n return value === undefined;\n }\n\n /**\n * Checks if `value` is classified as a `WeakMap` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.\n * @example\n *\n * _.isWeakMap(new WeakMap);\n * // => true\n *\n * _.isWeakMap(new Map);\n * // => false\n */\n function isWeakMap(value) {\n return isObjectLike(value) && getTag(value) == weakMapTag;\n }\n\n /**\n * Checks if `value` is classified as a `WeakSet` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.\n * @example\n *\n * _.isWeakSet(new WeakSet);\n * // => true\n *\n * _.isWeakSet(new Set);\n * // => false\n */\n function isWeakSet(value) {\n return isObjectLike(value) && baseGetTag(value) == weakSetTag;\n }\n\n /**\n * Checks if `value` is less than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n * @see _.gt\n * @example\n *\n * _.lt(1, 3);\n * // => true\n *\n * _.lt(3, 3);\n * // => false\n *\n * _.lt(3, 1);\n * // => false\n */\n var lt = createRelationalOperation(baseLt);\n\n /**\n * Checks if `value` is less than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than or equal to\n * `other`, else `false`.\n * @see _.gte\n * @example\n *\n * _.lte(1, 3);\n * // => true\n *\n * _.lte(3, 3);\n * // => true\n *\n * _.lte(3, 1);\n * // => false\n */\n var lte = createRelationalOperation(function(value, other) {\n return value <= other;\n });\n\n /**\n * Converts `value` to an array.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Array} Returns the converted array.\n * @example\n *\n * _.toArray({ 'a': 1, 'b': 2 });\n * // => [1, 2]\n *\n * _.toArray('abc');\n * // => ['a', 'b', 'c']\n *\n * _.toArray(1);\n * // => []\n *\n * _.toArray(null);\n * // => []\n */\n function toArray(value) {\n if (!value) {\n return [];\n }\n if (isArrayLike(value)) {\n return isString(value) ? stringToArray(value) : copyArray(value);\n }\n if (symIterator && value[symIterator]) {\n return iteratorToArray(value[symIterator]());\n }\n var tag = getTag(value),\n func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);\n\n return func(value);\n }\n\n /**\n * Converts `value` to a finite number.\n *\n * @static\n * @memberOf _\n * @since 4.12.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted number.\n * @example\n *\n * _.toFinite(3.2);\n * // => 3.2\n *\n * _.toFinite(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toFinite(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toFinite('3.2');\n * // => 3.2\n */\n function toFinite(value) {\n if (!value) {\n return value === 0 ? value : 0;\n }\n value = toNumber(value);\n if (value === INFINITY || value === -INFINITY) {\n var sign = (value < 0 ? -1 : 1);\n return sign * MAX_INTEGER;\n }\n return value === value ? value : 0;\n }\n\n /**\n * Converts `value` to an integer.\n *\n * **Note:** This method is loosely based on\n * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toInteger(3.2);\n * // => 3\n *\n * _.toInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toInteger(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toInteger('3.2');\n * // => 3\n */\n function toInteger(value) {\n var result = toFinite(value),\n remainder = result % 1;\n\n return result === result ? (remainder ? result - remainder : result) : 0;\n }\n\n /**\n * Converts `value` to an integer suitable for use as the length of an\n * array-like object.\n *\n * **Note:** This method is based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toLength(3.2);\n * // => 3\n *\n * _.toLength(Number.MIN_VALUE);\n * // => 0\n *\n * _.toLength(Infinity);\n * // => 4294967295\n *\n * _.toLength('3.2');\n * // => 3\n */\n function toLength(value) {\n return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;\n }\n\n /**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\n function toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = value.replace(reTrim, '');\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n }\n\n /**\n * Converts `value` to a plain object flattening inherited enumerable string\n * keyed properties of `value` to own properties of the plain object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Object} Returns the converted plain object.\n * @example\n *\n * function Foo() {\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.assign({ 'a': 1 }, new Foo);\n * // => { 'a': 1, 'b': 2 }\n *\n * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));\n * // => { 'a': 1, 'b': 2, 'c': 3 }\n */\n function toPlainObject(value) {\n return copyObject(value, keysIn(value));\n }\n\n /**\n * Converts `value` to a safe integer. A safe integer can be compared and\n * represented correctly.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toSafeInteger(3.2);\n * // => 3\n *\n * _.toSafeInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toSafeInteger(Infinity);\n * // => 9007199254740991\n *\n * _.toSafeInteger('3.2');\n * // => 3\n */\n function toSafeInteger(value) {\n return value\n ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)\n : (value === 0 ? value : 0);\n }\n\n /**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\n function toString(value) {\n return value == null ? '' : baseToString(value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Assigns own enumerable string keyed properties of source objects to the\n * destination object. Source objects are applied from left to right.\n * Subsequent sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object` and is loosely based on\n * [`Object.assign`](https://mdn.io/Object/assign).\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assignIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assign({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'c': 3 }\n */\n var assign = createAssigner(function(object, source) {\n if (isPrototype(source) || isArrayLike(source)) {\n copyObject(source, keys(source), object);\n return;\n }\n for (var key in source) {\n if (hasOwnProperty.call(source, key)) {\n assignValue(object, key, source[key]);\n }\n }\n });\n\n /**\n * This method is like `_.assign` except that it iterates over own and\n * inherited source properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extend\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assign\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assignIn({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }\n */\n var assignIn = createAssigner(function(object, source) {\n copyObject(source, keysIn(source), object);\n });\n\n /**\n * This method is like `_.assignIn` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extendWith\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignInWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keysIn(source), object, customizer);\n });\n\n /**\n * This method is like `_.assign` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignInWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keys(source), object, customizer);\n });\n\n /**\n * Creates an array of values corresponding to `paths` of `object`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Array} Returns the picked values.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _.at(object, ['a[0].b.c', 'a[1]']);\n * // => [3, 4]\n */\n var at = flatRest(baseAt);\n\n /**\n * Creates an object that inherits from the `prototype` object. If a\n * `properties` object is given, its own enumerable string keyed properties\n * are assigned to the created object.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Object\n * @param {Object} prototype The object to inherit from.\n * @param {Object} [properties] The properties to assign to the object.\n * @returns {Object} Returns the new object.\n * @example\n *\n * function Shape() {\n * this.x = 0;\n * this.y = 0;\n * }\n *\n * function Circle() {\n * Shape.call(this);\n * }\n *\n * Circle.prototype = _.create(Shape.prototype, {\n * 'constructor': Circle\n * });\n *\n * var circle = new Circle;\n * circle instanceof Circle;\n * // => true\n *\n * circle instanceof Shape;\n * // => true\n */\n function create(prototype, properties) {\n var result = baseCreate(prototype);\n return properties == null ? result : baseAssign(result, properties);\n }\n\n /**\n * Assigns own and inherited enumerable string keyed properties of source\n * objects to the destination object for all destination properties that\n * resolve to `undefined`. Source objects are applied from left to right.\n * Once a property is set, additional values of the same property are ignored.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaultsDeep\n * @example\n *\n * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var defaults = baseRest(function(object, sources) {\n object = Object(object);\n\n var index = -1;\n var length = sources.length;\n var guard = length > 2 ? sources[2] : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n length = 1;\n }\n\n while (++index < length) {\n var source = sources[index];\n var props = keysIn(source);\n var propsIndex = -1;\n var propsLength = props.length;\n\n while (++propsIndex < propsLength) {\n var key = props[propsIndex];\n var value = object[key];\n\n if (value === undefined ||\n (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n object[key] = source[key];\n }\n }\n }\n\n return object;\n });\n\n /**\n * This method is like `_.defaults` except that it recursively assigns\n * default properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaults\n * @example\n *\n * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });\n * // => { 'a': { 'b': 2, 'c': 3 } }\n */\n var defaultsDeep = baseRest(function(args) {\n args.push(undefined, customDefaultsMerge);\n return apply(mergeWith, undefined, args);\n });\n\n /**\n * This method is like `_.find` except that it returns the key of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findKey(users, function(o) { return o.age < 40; });\n * // => 'barney' (iteration order is not guaranteed)\n *\n * // The `_.matches` iteratee shorthand.\n * _.findKey(users, { 'age': 1, 'active': true });\n * // => 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findKey(users, 'active');\n * // => 'barney'\n */\n function findKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);\n }\n\n /**\n * This method is like `_.findKey` except that it iterates over elements of\n * a collection in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findLastKey(users, function(o) { return o.age < 40; });\n * // => returns 'pebbles' assuming `_.findKey` returns 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastKey(users, { 'age': 36, 'active': true });\n * // => 'barney'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastKey(users, 'active');\n * // => 'pebbles'\n */\n function findLastKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);\n }\n\n /**\n * Iterates over own and inherited enumerable string keyed properties of an\n * object and invokes `iteratee` for each property. The iteratee is invoked\n * with three arguments: (value, key, object). Iteratee functions may exit\n * iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forInRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forIn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).\n */\n function forIn(object, iteratee) {\n return object == null\n ? object\n : baseFor(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * This method is like `_.forIn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forInRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.\n */\n function forInRight(object, iteratee) {\n return object == null\n ? object\n : baseForRight(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * Iterates over own enumerable string keyed properties of an object and\n * invokes `iteratee` for each property. The iteratee is invoked with three\n * arguments: (value, key, object). Iteratee functions may exit iteration\n * early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwnRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forOwn(object, iteratee) {\n return object && baseForOwn(object, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forOwn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwnRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.\n */\n function forOwnRight(object, iteratee) {\n return object && baseForOwnRight(object, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an array of function property names from own enumerable properties\n * of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functionsIn\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functions(new Foo);\n * // => ['a', 'b']\n */\n function functions(object) {\n return object == null ? [] : baseFunctions(object, keys(object));\n }\n\n /**\n * Creates an array of function property names from own and inherited\n * enumerable properties of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functions\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functionsIn(new Foo);\n * // => ['a', 'b', 'c']\n */\n function functionsIn(object) {\n return object == null ? [] : baseFunctions(object, keysIn(object));\n }\n\n /**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\n function get(object, path, defaultValue) {\n var result = object == null ? undefined : baseGet(object, path);\n return result === undefined ? defaultValue : result;\n }\n\n /**\n * Checks if `path` is a direct property of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = { 'a': { 'b': 2 } };\n * var other = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.has(object, 'a');\n * // => true\n *\n * _.has(object, 'a.b');\n * // => true\n *\n * _.has(object, ['a', 'b']);\n * // => true\n *\n * _.has(other, 'a');\n * // => false\n */\n function has(object, path) {\n return object != null && hasPath(object, path, baseHas);\n }\n\n /**\n * Checks if `path` is a direct or inherited property of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.hasIn(object, 'a');\n * // => true\n *\n * _.hasIn(object, 'a.b');\n * // => true\n *\n * _.hasIn(object, ['a', 'b']);\n * // => true\n *\n * _.hasIn(object, 'b');\n * // => false\n */\n function hasIn(object, path) {\n return object != null && hasPath(object, path, baseHasIn);\n }\n\n /**\n * Creates an object composed of the inverted keys and values of `object`.\n * If `object` contains duplicate values, subsequent values overwrite\n * property assignments of previous values.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Object\n * @param {Object} object The object to invert.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invert(object);\n * // => { '1': 'c', '2': 'b' }\n */\n var invert = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n result[value] = key;\n }, constant(identity));\n\n /**\n * This method is like `_.invert` except that the inverted object is generated\n * from the results of running each element of `object` thru `iteratee`. The\n * corresponding inverted value of each inverted key is an array of keys\n * responsible for generating the inverted value. The iteratee is invoked\n * with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Object\n * @param {Object} object The object to invert.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invertBy(object);\n * // => { '1': ['a', 'c'], '2': ['b'] }\n *\n * _.invertBy(object, function(value) {\n * return 'group' + value;\n * });\n * // => { 'group1': ['a', 'c'], 'group2': ['b'] }\n */\n var invertBy = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }, getIteratee);\n\n /**\n * Invokes the method at `path` of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };\n *\n * _.invoke(object, 'a[0].b.c.slice', 1, 3);\n * // => [2, 3]\n */\n var invoke = baseRest(baseInvoke);\n\n /**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\n function keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n }\n\n /**\n * Creates an array of the own and inherited enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keysIn(new Foo);\n * // => ['a', 'b', 'c'] (iteration order is not guaranteed)\n */\n function keysIn(object) {\n return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);\n }\n\n /**\n * The opposite of `_.mapValues`; this method creates an object with the\n * same values as `object` and keys generated by running each own enumerable\n * string keyed property of `object` thru `iteratee`. The iteratee is invoked\n * with three arguments: (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapValues\n * @example\n *\n * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {\n * return key + value;\n * });\n * // => { 'a1': 1, 'b2': 2 }\n */\n function mapKeys(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, iteratee(value, key, object), value);\n });\n return result;\n }\n\n /**\n * Creates an object with the same keys as `object` and values generated\n * by running each own enumerable string keyed property of `object` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapKeys\n * @example\n *\n * var users = {\n * 'fred': { 'user': 'fred', 'age': 40 },\n * 'pebbles': { 'user': 'pebbles', 'age': 1 }\n * };\n *\n * _.mapValues(users, function(o) { return o.age; });\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n *\n * // The `_.property` iteratee shorthand.\n * _.mapValues(users, 'age');\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n */\n function mapValues(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, key, iteratee(value, key, object));\n });\n return result;\n }\n\n /**\n * This method is like `_.assign` except that it recursively merges own and\n * inherited enumerable string keyed properties of source objects into the\n * destination object. Source properties that resolve to `undefined` are\n * skipped if a destination value exists. Array and plain object properties\n * are merged recursively. Other objects and value types are overridden by\n * assignment. Source objects are applied from left to right. Subsequent\n * sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {\n * 'a': [{ 'b': 2 }, { 'd': 4 }]\n * };\n *\n * var other = {\n * 'a': [{ 'c': 3 }, { 'e': 5 }]\n * };\n *\n * _.merge(object, other);\n * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }\n */\n var merge = createAssigner(function(object, source, srcIndex) {\n baseMerge(object, source, srcIndex);\n });\n\n /**\n * This method is like `_.merge` except that it accepts `customizer` which\n * is invoked to produce the merged values of the destination and source\n * properties. If `customizer` returns `undefined`, merging is handled by the\n * method instead. The `customizer` is invoked with six arguments:\n * (objValue, srcValue, key, object, source, stack).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} customizer The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * function customizer(objValue, srcValue) {\n * if (_.isArray(objValue)) {\n * return objValue.concat(srcValue);\n * }\n * }\n *\n * var object = { 'a': [1], 'b': [2] };\n * var other = { 'a': [3], 'b': [4] };\n *\n * _.mergeWith(object, other, customizer);\n * // => { 'a': [1, 3], 'b': [2, 4] }\n */\n var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {\n baseMerge(object, source, srcIndex, customizer);\n });\n\n /**\n * The opposite of `_.pick`; this method creates an object composed of the\n * own and inherited enumerable property paths of `object` that are not omitted.\n *\n * **Note:** This method is considerably slower than `_.pick`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to omit.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omit(object, ['a', 'c']);\n * // => { 'b': '2' }\n */\n var omit = flatRest(function(object, paths) {\n var result = {};\n if (object == null) {\n return result;\n }\n var isDeep = false;\n paths = arrayMap(paths, function(path) {\n path = castPath(path, object);\n isDeep || (isDeep = path.length > 1);\n return path;\n });\n copyObject(object, getAllKeysIn(object), result);\n if (isDeep) {\n result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);\n }\n var length = paths.length;\n while (length--) {\n baseUnset(result, paths[length]);\n }\n return result;\n });\n\n /**\n * The opposite of `_.pickBy`; this method creates an object composed of\n * the own and inherited enumerable string keyed properties of `object` that\n * `predicate` doesn't return truthy for. The predicate is invoked with two\n * arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omitBy(object, _.isNumber);\n * // => { 'b': '2' }\n */\n function omitBy(object, predicate) {\n return pickBy(object, negate(getIteratee(predicate)));\n }\n\n /**\n * Creates an object composed of the picked `object` properties.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pick(object, ['a', 'c']);\n * // => { 'a': 1, 'c': 3 }\n */\n var pick = flatRest(function(object, paths) {\n return object == null ? {} : basePick(object, paths);\n });\n\n /**\n * Creates an object composed of the `object` properties `predicate` returns\n * truthy for. The predicate is invoked with two arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pickBy(object, _.isNumber);\n * // => { 'a': 1, 'c': 3 }\n */\n function pickBy(object, predicate) {\n if (object == null) {\n return {};\n }\n var props = arrayMap(getAllKeysIn(object), function(prop) {\n return [prop];\n });\n predicate = getIteratee(predicate);\n return basePickBy(object, props, function(value, path) {\n return predicate(value, path[0]);\n });\n }\n\n /**\n * This method is like `_.get` except that if the resolved value is a\n * function it's invoked with the `this` binding of its parent object and\n * its result is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to resolve.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };\n *\n * _.result(object, 'a[0].b.c1');\n * // => 3\n *\n * _.result(object, 'a[0].b.c2');\n * // => 4\n *\n * _.result(object, 'a[0].b.c3', 'default');\n * // => 'default'\n *\n * _.result(object, 'a[0].b.c3', _.constant('default'));\n * // => 'default'\n */\n function result(object, path, defaultValue) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length;\n\n // Ensure the loop is entered when path is empty.\n if (!length) {\n length = 1;\n object = undefined;\n }\n while (++index < length) {\n var value = object == null ? undefined : object[toKey(path[index])];\n if (value === undefined) {\n index = length;\n value = defaultValue;\n }\n object = isFunction(value) ? value.call(object) : value;\n }\n return object;\n }\n\n /**\n * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,\n * it's created. Arrays are created for missing index properties while objects\n * are created for all other missing properties. Use `_.setWith` to customize\n * `path` creation.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.set(object, 'a[0].b.c', 4);\n * console.log(object.a[0].b.c);\n * // => 4\n *\n * _.set(object, ['x', '0', 'y', 'z'], 5);\n * console.log(object.x[0].y.z);\n * // => 5\n */\n function set(object, path, value) {\n return object == null ? object : baseSet(object, path, value);\n }\n\n /**\n * This method is like `_.set` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.setWith(object, '[0][1]', 'a', Object);\n * // => { '0': { '1': 'a' } }\n */\n function setWith(object, path, value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseSet(object, path, value, customizer);\n }\n\n /**\n * Creates an array of own enumerable string keyed-value pairs for `object`\n * which can be consumed by `_.fromPairs`. If `object` is a map or set, its\n * entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entries\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairs(new Foo);\n * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)\n */\n var toPairs = createToPairs(keys);\n\n /**\n * Creates an array of own and inherited enumerable string keyed-value pairs\n * for `object` which can be consumed by `_.fromPairs`. If `object` is a map\n * or set, its entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entriesIn\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairsIn(new Foo);\n * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)\n */\n var toPairsIn = createToPairs(keysIn);\n\n /**\n * An alternative to `_.reduce`; this method transforms `object` to a new\n * `accumulator` object which is the result of running each of its own\n * enumerable string keyed properties thru `iteratee`, with each invocation\n * potentially mutating the `accumulator` object. If `accumulator` is not\n * provided, a new object with the same `[[Prototype]]` will be used. The\n * iteratee is invoked with four arguments: (accumulator, value, key, object).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The custom accumulator value.\n * @returns {*} Returns the accumulated value.\n * @example\n *\n * _.transform([2, 3, 4], function(result, n) {\n * result.push(n *= n);\n * return n % 2 == 0;\n * }, []);\n * // => [4, 9]\n *\n * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] }\n */\n function transform(object, iteratee, accumulator) {\n var isArr = isArray(object),\n isArrLike = isArr || isBuffer(object) || isTypedArray(object);\n\n iteratee = getIteratee(iteratee, 4);\n if (accumulator == null) {\n var Ctor = object && object.constructor;\n if (isArrLike) {\n accumulator = isArr ? new Ctor : [];\n }\n else if (isObject(object)) {\n accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};\n }\n else {\n accumulator = {};\n }\n }\n (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {\n return iteratee(accumulator, value, index, object);\n });\n return accumulator;\n }\n\n /**\n * Removes the property at `path` of `object`.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 7 } }] };\n * _.unset(object, 'a[0].b.c');\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n *\n * _.unset(object, ['a', '0', 'b', 'c']);\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n */\n function unset(object, path) {\n return object == null ? true : baseUnset(object, path);\n }\n\n /**\n * This method is like `_.set` except that accepts `updater` to produce the\n * value to set. Use `_.updateWith` to customize `path` creation. The `updater`\n * is invoked with one argument: (value).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.update(object, 'a[0].b.c', function(n) { return n * n; });\n * console.log(object.a[0].b.c);\n * // => 9\n *\n * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });\n * console.log(object.x[0].y.z);\n * // => 0\n */\n function update(object, path, updater) {\n return object == null ? object : baseUpdate(object, path, castFunction(updater));\n }\n\n /**\n * This method is like `_.update` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.updateWith(object, '[0][1]', _.constant('a'), Object);\n * // => { '0': { '1': 'a' } }\n */\n function updateWith(object, path, updater, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);\n }\n\n /**\n * Creates an array of the own enumerable string keyed property values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.values(new Foo);\n * // => [1, 2] (iteration order is not guaranteed)\n *\n * _.values('hi');\n * // => ['h', 'i']\n */\n function values(object) {\n return object == null ? [] : baseValues(object, keys(object));\n }\n\n /**\n * Creates an array of the own and inherited enumerable string keyed property\n * values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.valuesIn(new Foo);\n * // => [1, 2, 3] (iteration order is not guaranteed)\n */\n function valuesIn(object) {\n return object == null ? [] : baseValues(object, keysIn(object));\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Clamps `number` within the inclusive `lower` and `upper` bounds.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Number\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n * @example\n *\n * _.clamp(-10, -5, 5);\n * // => -5\n *\n * _.clamp(10, -5, 5);\n * // => 5\n */\n function clamp(number, lower, upper) {\n if (upper === undefined) {\n upper = lower;\n lower = undefined;\n }\n if (upper !== undefined) {\n upper = toNumber(upper);\n upper = upper === upper ? upper : 0;\n }\n if (lower !== undefined) {\n lower = toNumber(lower);\n lower = lower === lower ? lower : 0;\n }\n return baseClamp(toNumber(number), lower, upper);\n }\n\n /**\n * Checks if `n` is between `start` and up to, but not including, `end`. If\n * `end` is not specified, it's set to `start` with `start` then set to `0`.\n * If `start` is greater than `end` the params are swapped to support\n * negative ranges.\n *\n * @static\n * @memberOf _\n * @since 3.3.0\n * @category Number\n * @param {number} number The number to check.\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n * @see _.range, _.rangeRight\n * @example\n *\n * _.inRange(3, 2, 4);\n * // => true\n *\n * _.inRange(4, 8);\n * // => true\n *\n * _.inRange(4, 2);\n * // => false\n *\n * _.inRange(2, 2);\n * // => false\n *\n * _.inRange(1.2, 2);\n * // => true\n *\n * _.inRange(5.2, 4);\n * // => false\n *\n * _.inRange(-3, -2, -6);\n * // => true\n */\n function inRange(number, start, end) {\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n number = toNumber(number);\n return baseInRange(number, start, end);\n }\n\n /**\n * Produces a random number between the inclusive `lower` and `upper` bounds.\n * If only one argument is provided a number between `0` and the given number\n * is returned. If `floating` is `true`, or either `lower` or `upper` are\n * floats, a floating-point number is returned instead of an integer.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Number\n * @param {number} [lower=0] The lower bound.\n * @param {number} [upper=1] The upper bound.\n * @param {boolean} [floating] Specify returning a floating-point number.\n * @returns {number} Returns the random number.\n * @example\n *\n * _.random(0, 5);\n * // => an integer between 0 and 5\n *\n * _.random(5);\n * // => also an integer between 0 and 5\n *\n * _.random(5, true);\n * // => a floating-point number between 0 and 5\n *\n * _.random(1.2, 5.2);\n * // => a floating-point number between 1.2 and 5.2\n */\n function random(lower, upper, floating) {\n if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {\n upper = floating = undefined;\n }\n if (floating === undefined) {\n if (typeof upper == 'boolean') {\n floating = upper;\n upper = undefined;\n }\n else if (typeof lower == 'boolean') {\n floating = lower;\n lower = undefined;\n }\n }\n if (lower === undefined && upper === undefined) {\n lower = 0;\n upper = 1;\n }\n else {\n lower = toFinite(lower);\n if (upper === undefined) {\n upper = lower;\n lower = 0;\n } else {\n upper = toFinite(upper);\n }\n }\n if (lower > upper) {\n var temp = lower;\n lower = upper;\n upper = temp;\n }\n if (floating || lower % 1 || upper % 1) {\n var rand = nativeRandom();\n return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);\n }\n return baseRandom(lower, upper);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the camel cased string.\n * @example\n *\n * _.camelCase('Foo Bar');\n * // => 'fooBar'\n *\n * _.camelCase('--foo-bar--');\n * // => 'fooBar'\n *\n * _.camelCase('__FOO_BAR__');\n * // => 'fooBar'\n */\n var camelCase = createCompounder(function(result, word, index) {\n word = word.toLowerCase();\n return result + (index ? capitalize(word) : word);\n });\n\n /**\n * Converts the first character of `string` to upper case and the remaining\n * to lower case.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to capitalize.\n * @returns {string} Returns the capitalized string.\n * @example\n *\n * _.capitalize('FRED');\n * // => 'Fred'\n */\n function capitalize(string) {\n return upperFirst(toString(string).toLowerCase());\n }\n\n /**\n * Deburrs `string` by converting\n * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)\n * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)\n * letters to basic Latin letters and removing\n * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to deburr.\n * @returns {string} Returns the deburred string.\n * @example\n *\n * _.deburr('déjà vu');\n * // => 'deja vu'\n */\n function deburr(string) {\n string = toString(string);\n return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');\n }\n\n /**\n * Checks if `string` ends with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=string.length] The position to search up to.\n * @returns {boolean} Returns `true` if `string` ends with `target`,\n * else `false`.\n * @example\n *\n * _.endsWith('abc', 'c');\n * // => true\n *\n * _.endsWith('abc', 'b');\n * // => false\n *\n * _.endsWith('abc', 'b', 2);\n * // => true\n */\n function endsWith(string, target, position) {\n string = toString(string);\n target = baseToString(target);\n\n var length = string.length;\n position = position === undefined\n ? length\n : baseClamp(toInteger(position), 0, length);\n\n var end = position;\n position -= target.length;\n return position >= 0 && string.slice(position, end) == target;\n }\n\n /**\n * Converts the characters \"&\", \"<\", \">\", '\"', and \"'\" in `string` to their\n * corresponding HTML entities.\n *\n * **Note:** No other characters are escaped. To escape additional\n * characters use a third-party library like [_he_](https://mths.be/he).\n *\n * Though the \">\" character is escaped for symmetry, characters like\n * \">\" and \"/\" don't need escaping in HTML and have no special meaning\n * unless they're part of a tag or unquoted attribute value. See\n * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)\n * (under \"semi-related fun fact\") for more details.\n *\n * When working with HTML you should always\n * [quote attribute values](http://wonko.com/post/html-escaping) to reduce\n * XSS vectors.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escape('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles'\n */\n function escape(string) {\n string = toString(string);\n return (string && reHasUnescapedHtml.test(string))\n ? string.replace(reUnescapedHtml, escapeHtmlChar)\n : string;\n }\n\n /**\n * Escapes the `RegExp` special characters \"^\", \"$\", \"\\\", \".\", \"*\", \"+\",\n * \"?\", \"(\", \")\", \"[\", \"]\", \"{\", \"}\", and \"|\" in `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escapeRegExp('[lodash](https://lodash.com/)');\n * // => '\\[lodash\\]\\(https://lodash\\.com/\\)'\n */\n function escapeRegExp(string) {\n string = toString(string);\n return (string && reHasRegExpChar.test(string))\n ? string.replace(reRegExpChar, '\\\\$&')\n : string;\n }\n\n /**\n * Converts `string` to\n * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the kebab cased string.\n * @example\n *\n * _.kebabCase('Foo Bar');\n * // => 'foo-bar'\n *\n * _.kebabCase('fooBar');\n * // => 'foo-bar'\n *\n * _.kebabCase('__FOO_BAR__');\n * // => 'foo-bar'\n */\n var kebabCase = createCompounder(function(result, word, index) {\n return result + (index ? '-' : '') + word.toLowerCase();\n });\n\n /**\n * Converts `string`, as space separated words, to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.lowerCase('--Foo-Bar--');\n * // => 'foo bar'\n *\n * _.lowerCase('fooBar');\n * // => 'foo bar'\n *\n * _.lowerCase('__FOO_BAR__');\n * // => 'foo bar'\n */\n var lowerCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toLowerCase();\n });\n\n /**\n * Converts the first character of `string` to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.lowerFirst('Fred');\n * // => 'fred'\n *\n * _.lowerFirst('FRED');\n * // => 'fRED'\n */\n var lowerFirst = createCaseFirst('toLowerCase');\n\n /**\n * Pads `string` on the left and right sides if it's shorter than `length`.\n * Padding characters are truncated if they can't be evenly divided by `length`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.pad('abc', 8);\n * // => ' abc '\n *\n * _.pad('abc', 8, '_-');\n * // => '_-abc_-_'\n *\n * _.pad('abc', 3);\n * // => 'abc'\n */\n function pad(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n if (!length || strLength >= length) {\n return string;\n }\n var mid = (length - strLength) / 2;\n return (\n createPadding(nativeFloor(mid), chars) +\n string +\n createPadding(nativeCeil(mid), chars)\n );\n }\n\n /**\n * Pads `string` on the right side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padEnd('abc', 6);\n * // => 'abc '\n *\n * _.padEnd('abc', 6, '_-');\n * // => 'abc_-_'\n *\n * _.padEnd('abc', 3);\n * // => 'abc'\n */\n function padEnd(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (string + createPadding(length - strLength, chars))\n : string;\n }\n\n /**\n * Pads `string` on the left side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padStart('abc', 6);\n * // => ' abc'\n *\n * _.padStart('abc', 6, '_-');\n * // => '_-_abc'\n *\n * _.padStart('abc', 3);\n * // => 'abc'\n */\n function padStart(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (createPadding(length - strLength, chars) + string)\n : string;\n }\n\n /**\n * Converts `string` to an integer of the specified radix. If `radix` is\n * `undefined` or `0`, a `radix` of `10` is used unless `value` is a\n * hexadecimal, in which case a `radix` of `16` is used.\n *\n * **Note:** This method aligns with the\n * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category String\n * @param {string} string The string to convert.\n * @param {number} [radix=10] The radix to interpret `value` by.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.parseInt('08');\n * // => 8\n *\n * _.map(['6', '08', '10'], _.parseInt);\n * // => [6, 8, 10]\n */\n function parseInt(string, radix, guard) {\n if (guard || radix == null) {\n radix = 0;\n } else if (radix) {\n radix = +radix;\n }\n return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);\n }\n\n /**\n * Repeats the given string `n` times.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to repeat.\n * @param {number} [n=1] The number of times to repeat the string.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the repeated string.\n * @example\n *\n * _.repeat('*', 3);\n * // => '***'\n *\n * _.repeat('abc', 2);\n * // => 'abcabc'\n *\n * _.repeat('abc', 0);\n * // => ''\n */\n function repeat(string, n, guard) {\n if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n return baseRepeat(toString(string), n);\n }\n\n /**\n * Replaces matches for `pattern` in `string` with `replacement`.\n *\n * **Note:** This method is based on\n * [`String#replace`](https://mdn.io/String/replace).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to modify.\n * @param {RegExp|string} pattern The pattern to replace.\n * @param {Function|string} replacement The match replacement.\n * @returns {string} Returns the modified string.\n * @example\n *\n * _.replace('Hi Fred', 'Fred', 'Barney');\n * // => 'Hi Barney'\n */\n function replace() {\n var args = arguments,\n string = toString(args[0]);\n\n return args.length < 3 ? string : string.replace(args[1], args[2]);\n }\n\n /**\n * Converts `string` to\n * [snake case](https://en.wikipedia.org/wiki/Snake_case).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the snake cased string.\n * @example\n *\n * _.snakeCase('Foo Bar');\n * // => 'foo_bar'\n *\n * _.snakeCase('fooBar');\n * // => 'foo_bar'\n *\n * _.snakeCase('--FOO-BAR--');\n * // => 'foo_bar'\n */\n var snakeCase = createCompounder(function(result, word, index) {\n return result + (index ? '_' : '') + word.toLowerCase();\n });\n\n /**\n * Splits `string` by `separator`.\n *\n * **Note:** This method is based on\n * [`String#split`](https://mdn.io/String/split).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to split.\n * @param {RegExp|string} separator The separator pattern to split by.\n * @param {number} [limit] The length to truncate results to.\n * @returns {Array} Returns the string segments.\n * @example\n *\n * _.split('a-b-c', '-', 2);\n * // => ['a', 'b']\n */\n function split(string, separator, limit) {\n if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {\n separator = limit = undefined;\n }\n limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;\n if (!limit) {\n return [];\n }\n string = toString(string);\n if (string && (\n typeof separator == 'string' ||\n (separator != null && !isRegExp(separator))\n )) {\n separator = baseToString(separator);\n if (!separator && hasUnicode(string)) {\n return castSlice(stringToArray(string), 0, limit);\n }\n }\n return string.split(separator, limit);\n }\n\n /**\n * Converts `string` to\n * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).\n *\n * @static\n * @memberOf _\n * @since 3.1.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the start cased string.\n * @example\n *\n * _.startCase('--foo-bar--');\n * // => 'Foo Bar'\n *\n * _.startCase('fooBar');\n * // => 'Foo Bar'\n *\n * _.startCase('__FOO_BAR__');\n * // => 'FOO BAR'\n */\n var startCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + upperFirst(word);\n });\n\n /**\n * Checks if `string` starts with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=0] The position to search from.\n * @returns {boolean} Returns `true` if `string` starts with `target`,\n * else `false`.\n * @example\n *\n * _.startsWith('abc', 'a');\n * // => true\n *\n * _.startsWith('abc', 'b');\n * // => false\n *\n * _.startsWith('abc', 'b', 1);\n * // => true\n */\n function startsWith(string, target, position) {\n string = toString(string);\n position = position == null\n ? 0\n : baseClamp(toInteger(position), 0, string.length);\n\n target = baseToString(target);\n return string.slice(position, position + target.length) == target;\n }\n\n /**\n * Creates a compiled template function that can interpolate data properties\n * in \"interpolate\" delimiters, HTML-escape interpolated data properties in\n * \"escape\" delimiters, and execute JavaScript in \"evaluate\" delimiters. Data\n * properties may be accessed as free variables in the template. If a setting\n * object is given, it takes precedence over `_.templateSettings` values.\n *\n * **Note:** In the development build `_.template` utilizes\n * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)\n * for easier debugging.\n *\n * For more information on precompiling templates see\n * [lodash's custom builds documentation](https://lodash.com/custom-builds).\n *\n * For more information on Chrome extension sandboxes see\n * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The template string.\n * @param {Object} [options={}] The options object.\n * @param {RegExp} [options.escape=_.templateSettings.escape]\n * The HTML \"escape\" delimiter.\n * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]\n * The \"evaluate\" delimiter.\n * @param {Object} [options.imports=_.templateSettings.imports]\n * An object to import into the template as free variables.\n * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]\n * The \"interpolate\" delimiter.\n * @param {string} [options.sourceURL='lodash.templateSources[n]']\n * The sourceURL of the compiled template.\n * @param {string} [options.variable='obj']\n * The data object variable name.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the compiled template function.\n * @example\n *\n * // Use the \"interpolate\" delimiter to create a compiled template.\n * var compiled = _.template('hello <%= user %>!');\n * compiled({ 'user': 'fred' });\n * // => 'hello fred!'\n *\n * // Use the HTML \"escape\" delimiter to escape data property values.\n * var compiled = _.template('<%- value %>');\n * compiled({ 'value': '\n if (val === '') return true;\n if (val === 'false') return false;\n if (val === 'true') return true;\n return val;\n}\n\nif (DOCUMENT && typeof DOCUMENT.querySelector === 'function') {\n var attrs = [['data-family-prefix', 'familyPrefix'], ['data-replacement-class', 'replacementClass'], ['data-auto-replace-svg', 'autoReplaceSvg'], ['data-auto-add-css', 'autoAddCss'], ['data-auto-a11y', 'autoA11y'], ['data-search-pseudo-elements', 'searchPseudoElements'], ['data-observe-mutations', 'observeMutations'], ['data-mutate-approach', 'mutateApproach'], ['data-keep-original-source', 'keepOriginalSource'], ['data-measure-performance', 'measurePerformance'], ['data-show-missing-icons', 'showMissingIcons']];\n attrs.forEach(function (_ref) {\n var _ref2 = _slicedToArray(_ref, 2),\n attr = _ref2[0],\n key = _ref2[1];\n\n var val = coerce(getAttrConfig(attr));\n\n if (val !== undefined && val !== null) {\n initial[key] = val;\n }\n });\n}\n\nvar _default = {\n familyPrefix: DEFAULT_FAMILY_PREFIX,\n replacementClass: DEFAULT_REPLACEMENT_CLASS,\n autoReplaceSvg: true,\n autoAddCss: true,\n autoA11y: true,\n searchPseudoElements: false,\n observeMutations: true,\n mutateApproach: 'async',\n keepOriginalSource: true,\n measurePerformance: false,\n showMissingIcons: true\n};\n\nvar _config = _objectSpread({}, _default, initial);\n\nif (!_config.autoReplaceSvg) _config.observeMutations = false;\n\nvar config = _objectSpread({}, _config);\n\nWINDOW.FontAwesomeConfig = config;\n\nvar w = WINDOW || {};\nif (!w[NAMESPACE_IDENTIFIER]) w[NAMESPACE_IDENTIFIER] = {};\nif (!w[NAMESPACE_IDENTIFIER].styles) w[NAMESPACE_IDENTIFIER].styles = {};\nif (!w[NAMESPACE_IDENTIFIER].hooks) w[NAMESPACE_IDENTIFIER].hooks = {};\nif (!w[NAMESPACE_IDENTIFIER].shims) w[NAMESPACE_IDENTIFIER].shims = [];\nvar namespace = w[NAMESPACE_IDENTIFIER];\n\nvar functions = [];\n\nvar listener = function listener() {\n DOCUMENT.removeEventListener('DOMContentLoaded', listener);\n loaded = 1;\n functions.map(function (fn) {\n return fn();\n });\n};\n\nvar loaded = false;\n\nif (IS_DOM) {\n loaded = (DOCUMENT.documentElement.doScroll ? /^loaded|^c/ : /^loaded|^i|^c/).test(DOCUMENT.readyState);\n if (!loaded) DOCUMENT.addEventListener('DOMContentLoaded', listener);\n}\n\nfunction domready (fn) {\n if (!IS_DOM) return;\n loaded ? setTimeout(fn, 0) : functions.push(fn);\n}\n\nvar PENDING = 'pending';\nvar SETTLED = 'settled';\nvar FULFILLED = 'fulfilled';\nvar REJECTED = 'rejected';\n\nvar NOOP = function NOOP() {};\n\nvar isNode = typeof global !== 'undefined' && typeof global.process !== 'undefined' && typeof global.process.emit === 'function';\nvar asyncSetTimer = typeof setImmediate === 'undefined' ? setTimeout : setImmediate;\nvar asyncQueue = [];\nvar asyncTimer;\n\nfunction asyncFlush() {\n // run promise callbacks\n for (var i = 0; i < asyncQueue.length; i++) {\n asyncQueue[i][0](asyncQueue[i][1]);\n } // reset async asyncQueue\n\n\n asyncQueue = [];\n asyncTimer = false;\n}\n\nfunction asyncCall(callback, arg) {\n asyncQueue.push([callback, arg]);\n\n if (!asyncTimer) {\n asyncTimer = true;\n asyncSetTimer(asyncFlush, 0);\n }\n}\n\nfunction invokeResolver(resolver, promise) {\n function resolvePromise(value) {\n resolve(promise, value);\n }\n\n function rejectPromise(reason) {\n reject(promise, reason);\n }\n\n try {\n resolver(resolvePromise, rejectPromise);\n } catch (e) {\n rejectPromise(e);\n }\n}\n\nfunction invokeCallback(subscriber) {\n var owner = subscriber.owner;\n var settled = owner._state;\n var value = owner._data;\n var callback = subscriber[settled];\n var promise = subscriber.then;\n\n if (typeof callback === 'function') {\n settled = FULFILLED;\n\n try {\n value = callback(value);\n } catch (e) {\n reject(promise, e);\n }\n }\n\n if (!handleThenable(promise, value)) {\n if (settled === FULFILLED) {\n resolve(promise, value);\n }\n\n if (settled === REJECTED) {\n reject(promise, value);\n }\n }\n}\n\nfunction handleThenable(promise, value) {\n var resolved;\n\n try {\n if (promise === value) {\n throw new TypeError('A promises callback cannot return that same promise.');\n }\n\n if (value && (typeof value === 'function' || _typeof(value) === 'object')) {\n // then should be retrieved only once\n var then = value.then;\n\n if (typeof then === 'function') {\n then.call(value, function (val) {\n if (!resolved) {\n resolved = true;\n\n if (value === val) {\n fulfill(promise, val);\n } else {\n resolve(promise, val);\n }\n }\n }, function (reason) {\n if (!resolved) {\n resolved = true;\n reject(promise, reason);\n }\n });\n return true;\n }\n }\n } catch (e) {\n if (!resolved) {\n reject(promise, e);\n }\n\n return true;\n }\n\n return false;\n}\n\nfunction resolve(promise, value) {\n if (promise === value || !handleThenable(promise, value)) {\n fulfill(promise, value);\n }\n}\n\nfunction fulfill(promise, value) {\n if (promise._state === PENDING) {\n promise._state = SETTLED;\n promise._data = value;\n asyncCall(publishFulfillment, promise);\n }\n}\n\nfunction reject(promise, reason) {\n if (promise._state === PENDING) {\n promise._state = SETTLED;\n promise._data = reason;\n asyncCall(publishRejection, promise);\n }\n}\n\nfunction publish(promise) {\n promise._then = promise._then.forEach(invokeCallback);\n}\n\nfunction publishFulfillment(promise) {\n promise._state = FULFILLED;\n publish(promise);\n}\n\nfunction publishRejection(promise) {\n promise._state = REJECTED;\n publish(promise);\n\n if (!promise._handled && isNode) {\n global.process.emit('unhandledRejection', promise._data, promise);\n }\n}\n\nfunction notifyRejectionHandled(promise) {\n global.process.emit('rejectionHandled', promise);\n}\n/**\n * @class\n */\n\n\nfunction P(resolver) {\n if (typeof resolver !== 'function') {\n throw new TypeError('Promise resolver ' + resolver + ' is not a function');\n }\n\n if (this instanceof P === false) {\n throw new TypeError('Failed to construct \\'Promise\\': Please use the \\'new\\' operator, this object constructor cannot be called as a function.');\n }\n\n this._then = [];\n invokeResolver(resolver, this);\n}\n\nP.prototype = {\n constructor: P,\n _state: PENDING,\n _then: null,\n _data: undefined,\n _handled: false,\n then: function then(onFulfillment, onRejection) {\n var subscriber = {\n owner: this,\n then: new this.constructor(NOOP),\n fulfilled: onFulfillment,\n rejected: onRejection\n };\n\n if ((onRejection || onFulfillment) && !this._handled) {\n this._handled = true;\n\n if (this._state === REJECTED && isNode) {\n asyncCall(notifyRejectionHandled, this);\n }\n }\n\n if (this._state === FULFILLED || this._state === REJECTED) {\n // already resolved, call callback async\n asyncCall(invokeCallback, subscriber);\n } else {\n // subscribe\n this._then.push(subscriber);\n }\n\n return subscriber.then;\n },\n catch: function _catch(onRejection) {\n return this.then(null, onRejection);\n }\n};\n\nP.all = function (promises) {\n if (!Array.isArray(promises)) {\n throw new TypeError('You must pass an array to Promise.all().');\n }\n\n return new P(function (resolve, reject) {\n var results = [];\n var remaining = 0;\n\n function resolver(index) {\n remaining++;\n return function (value) {\n results[index] = value;\n\n if (! --remaining) {\n resolve(results);\n }\n };\n }\n\n for (var i = 0, promise; i < promises.length; i++) {\n promise = promises[i];\n\n if (promise && typeof promise.then === 'function') {\n promise.then(resolver(i), reject);\n } else {\n results[i] = promise;\n }\n }\n\n if (!remaining) {\n resolve(results);\n }\n });\n};\n\nP.race = function (promises) {\n if (!Array.isArray(promises)) {\n throw new TypeError('You must pass an array to Promise.race().');\n }\n\n return new P(function (resolve, reject) {\n for (var i = 0, promise; i < promises.length; i++) {\n promise = promises[i];\n\n if (promise && typeof promise.then === 'function') {\n promise.then(resolve, reject);\n } else {\n resolve(promise);\n }\n }\n });\n};\n\nP.resolve = function (value) {\n if (value && _typeof(value) === 'object' && value.constructor === P) {\n return value;\n }\n\n return new P(function (resolve) {\n resolve(value);\n });\n};\n\nP.reject = function (reason) {\n return new P(function (resolve, reject) {\n reject(reason);\n });\n};\n\nvar picked = typeof Promise === 'function' ? Promise : P;\n\nvar d = UNITS_IN_GRID;\nvar meaninglessTransform = {\n size: 16,\n x: 0,\n y: 0,\n rotate: 0,\n flipX: false,\n flipY: false\n};\n\nfunction isReserved(name) {\n return ~RESERVED_CLASSES.indexOf(name);\n}\nfunction insertCss(css) {\n if (!css || !IS_DOM) {\n return;\n }\n\n var style = DOCUMENT.createElement('style');\n style.setAttribute('type', 'text/css');\n style.innerHTML = css;\n var headChildren = DOCUMENT.head.childNodes;\n var beforeChild = null;\n\n for (var i = headChildren.length - 1; i > -1; i--) {\n var child = headChildren[i];\n var tagName = (child.tagName || '').toUpperCase();\n\n if (['STYLE', 'LINK'].indexOf(tagName) > -1) {\n beforeChild = child;\n }\n }\n\n DOCUMENT.head.insertBefore(style, beforeChild);\n return css;\n}\nvar idPool = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ';\nfunction nextUniqueId() {\n var size = 12;\n var id = '';\n\n while (size-- > 0) {\n id += idPool[Math.random() * 62 | 0];\n }\n\n return id;\n}\nfunction toArray(obj) {\n var array = [];\n\n for (var i = (obj || []).length >>> 0; i--;) {\n array[i] = obj[i];\n }\n\n return array;\n}\nfunction classArray(node) {\n if (node.classList) {\n return toArray(node.classList);\n } else {\n return (node.getAttribute('class') || '').split(' ').filter(function (i) {\n return i;\n });\n }\n}\nfunction getIconName(familyPrefix, cls) {\n var parts = cls.split('-');\n var prefix = parts[0];\n var iconName = parts.slice(1).join('-');\n\n if (prefix === familyPrefix && iconName !== '' && !isReserved(iconName)) {\n return iconName;\n } else {\n return null;\n }\n}\nfunction htmlEscape(str) {\n return \"\".concat(str).replace(/&/g, '&').replace(/\"/g, '"').replace(/'/g, ''').replace(//g, '>');\n}\nfunction joinAttributes(attributes) {\n return Object.keys(attributes || {}).reduce(function (acc, attributeName) {\n return acc + \"\".concat(attributeName, \"=\\\"\").concat(htmlEscape(attributes[attributeName]), \"\\\" \");\n }, '').trim();\n}\nfunction joinStyles(styles) {\n return Object.keys(styles || {}).reduce(function (acc, styleName) {\n return acc + \"\".concat(styleName, \": \").concat(styles[styleName], \";\");\n }, '');\n}\nfunction transformIsMeaningful(transform) {\n return transform.size !== meaninglessTransform.size || transform.x !== meaninglessTransform.x || transform.y !== meaninglessTransform.y || transform.rotate !== meaninglessTransform.rotate || transform.flipX || transform.flipY;\n}\nfunction transformForSvg(_ref) {\n var transform = _ref.transform,\n containerWidth = _ref.containerWidth,\n iconWidth = _ref.iconWidth;\n var outer = {\n transform: \"translate(\".concat(containerWidth / 2, \" 256)\")\n };\n var innerTranslate = \"translate(\".concat(transform.x * 32, \", \").concat(transform.y * 32, \") \");\n var innerScale = \"scale(\".concat(transform.size / 16 * (transform.flipX ? -1 : 1), \", \").concat(transform.size / 16 * (transform.flipY ? -1 : 1), \") \");\n var innerRotate = \"rotate(\".concat(transform.rotate, \" 0 0)\");\n var inner = {\n transform: \"\".concat(innerTranslate, \" \").concat(innerScale, \" \").concat(innerRotate)\n };\n var path = {\n transform: \"translate(\".concat(iconWidth / 2 * -1, \" -256)\")\n };\n return {\n outer: outer,\n inner: inner,\n path: path\n };\n}\nfunction transformForCss(_ref2) {\n var transform = _ref2.transform,\n _ref2$width = _ref2.width,\n width = _ref2$width === void 0 ? UNITS_IN_GRID : _ref2$width,\n _ref2$height = _ref2.height,\n height = _ref2$height === void 0 ? UNITS_IN_GRID : _ref2$height,\n _ref2$startCentered = _ref2.startCentered,\n startCentered = _ref2$startCentered === void 0 ? false : _ref2$startCentered;\n var val = '';\n\n if (startCentered && IS_IE) {\n val += \"translate(\".concat(transform.x / d - width / 2, \"em, \").concat(transform.y / d - height / 2, \"em) \");\n } else if (startCentered) {\n val += \"translate(calc(-50% + \".concat(transform.x / d, \"em), calc(-50% + \").concat(transform.y / d, \"em)) \");\n } else {\n val += \"translate(\".concat(transform.x / d, \"em, \").concat(transform.y / d, \"em) \");\n }\n\n val += \"scale(\".concat(transform.size / d * (transform.flipX ? -1 : 1), \", \").concat(transform.size / d * (transform.flipY ? -1 : 1), \") \");\n val += \"rotate(\".concat(transform.rotate, \"deg) \");\n return val;\n}\n\nvar ALL_SPACE = {\n x: 0,\n y: 0,\n width: '100%',\n height: '100%'\n};\n\nfunction fillBlack(abstract) {\n var force = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;\n\n if (abstract.attributes && (abstract.attributes.fill || force)) {\n abstract.attributes.fill = 'black';\n }\n\n return abstract;\n}\n\nfunction deGroup(abstract) {\n if (abstract.tag === 'g') {\n return abstract.children;\n } else {\n return [abstract];\n }\n}\n\nfunction makeIconMasking (_ref) {\n var children = _ref.children,\n attributes = _ref.attributes,\n main = _ref.main,\n mask = _ref.mask,\n transform = _ref.transform;\n var mainWidth = main.width,\n mainPath = main.icon;\n var maskWidth = mask.width,\n maskPath = mask.icon;\n var trans = transformForSvg({\n transform: transform,\n containerWidth: maskWidth,\n iconWidth: mainWidth\n });\n var maskRect = {\n tag: 'rect',\n attributes: _objectSpread({}, ALL_SPACE, {\n fill: 'white'\n })\n };\n var maskInnerGroupChildrenMixin = mainPath.children ? {\n children: mainPath.children.map(fillBlack)\n } : {};\n var maskInnerGroup = {\n tag: 'g',\n attributes: _objectSpread({}, trans.inner),\n children: [fillBlack(_objectSpread({\n tag: mainPath.tag,\n attributes: _objectSpread({}, mainPath.attributes, trans.path)\n }, maskInnerGroupChildrenMixin))]\n };\n var maskOuterGroup = {\n tag: 'g',\n attributes: _objectSpread({}, trans.outer),\n children: [maskInnerGroup]\n };\n var maskId = \"mask-\".concat(nextUniqueId());\n var clipId = \"clip-\".concat(nextUniqueId());\n var maskTag = {\n tag: 'mask',\n attributes: _objectSpread({}, ALL_SPACE, {\n id: maskId,\n maskUnits: 'userSpaceOnUse',\n maskContentUnits: 'userSpaceOnUse'\n }),\n children: [maskRect, maskOuterGroup]\n };\n var defs = {\n tag: 'defs',\n children: [{\n tag: 'clipPath',\n attributes: {\n id: clipId\n },\n children: deGroup(maskPath)\n }, maskTag]\n };\n children.push(defs, {\n tag: 'rect',\n attributes: _objectSpread({\n fill: 'currentColor',\n 'clip-path': \"url(#\".concat(clipId, \")\"),\n mask: \"url(#\".concat(maskId, \")\")\n }, ALL_SPACE)\n });\n return {\n children: children,\n attributes: attributes\n };\n}\n\nfunction makeIconStandard (_ref) {\n var children = _ref.children,\n attributes = _ref.attributes,\n main = _ref.main,\n transform = _ref.transform,\n styles = _ref.styles;\n var styleString = joinStyles(styles);\n\n if (styleString.length > 0) {\n attributes['style'] = styleString;\n }\n\n if (transformIsMeaningful(transform)) {\n var trans = transformForSvg({\n transform: transform,\n containerWidth: main.width,\n iconWidth: main.width\n });\n children.push({\n tag: 'g',\n attributes: _objectSpread({}, trans.outer),\n children: [{\n tag: 'g',\n attributes: _objectSpread({}, trans.inner),\n children: [{\n tag: main.icon.tag,\n children: main.icon.children,\n attributes: _objectSpread({}, main.icon.attributes, trans.path)\n }]\n }]\n });\n } else {\n children.push(main.icon);\n }\n\n return {\n children: children,\n attributes: attributes\n };\n}\n\nfunction asIcon (_ref) {\n var children = _ref.children,\n main = _ref.main,\n mask = _ref.mask,\n attributes = _ref.attributes,\n styles = _ref.styles,\n transform = _ref.transform;\n\n if (transformIsMeaningful(transform) && main.found && !mask.found) {\n var width = main.width,\n height = main.height;\n var offset = {\n x: width / height / 2,\n y: 0.5\n };\n attributes['style'] = joinStyles(_objectSpread({}, styles, {\n 'transform-origin': \"\".concat(offset.x + transform.x / 16, \"em \").concat(offset.y + transform.y / 16, \"em\")\n }));\n }\n\n return [{\n tag: 'svg',\n attributes: attributes,\n children: children\n }];\n}\n\nfunction asSymbol (_ref) {\n var prefix = _ref.prefix,\n iconName = _ref.iconName,\n children = _ref.children,\n attributes = _ref.attributes,\n symbol = _ref.symbol;\n var id = symbol === true ? \"\".concat(prefix, \"-\").concat(config.familyPrefix, \"-\").concat(iconName) : symbol;\n return [{\n tag: 'svg',\n attributes: {\n style: 'display: none;'\n },\n children: [{\n tag: 'symbol',\n attributes: _objectSpread({}, attributes, {\n id: id\n }),\n children: children\n }]\n }];\n}\n\nfunction makeInlineSvgAbstract(params) {\n var _params$icons = params.icons,\n main = _params$icons.main,\n mask = _params$icons.mask,\n prefix = params.prefix,\n iconName = params.iconName,\n transform = params.transform,\n symbol = params.symbol,\n title = params.title,\n extra = params.extra,\n _params$watchable = params.watchable,\n watchable = _params$watchable === void 0 ? false : _params$watchable;\n\n var _ref = mask.found ? mask : main,\n width = _ref.width,\n height = _ref.height;\n\n var widthClass = \"fa-w-\".concat(Math.ceil(width / height * 16));\n var attrClass = [config.replacementClass, iconName ? \"\".concat(config.familyPrefix, \"-\").concat(iconName) : '', widthClass].filter(function (c) {\n return extra.classes.indexOf(c) === -1;\n }).concat(extra.classes).join(' ');\n var content = {\n children: [],\n attributes: _objectSpread({}, extra.attributes, {\n 'data-prefix': prefix,\n 'data-icon': iconName,\n 'class': attrClass,\n 'role': extra.attributes.role || 'img',\n 'xmlns': 'http://www.w3.org/2000/svg',\n 'viewBox': \"0 0 \".concat(width, \" \").concat(height)\n })\n };\n\n if (watchable) {\n content.attributes[DATA_FA_I2SVG] = '';\n }\n\n if (title) content.children.push({\n tag: 'title',\n attributes: {\n id: content.attributes['aria-labelledby'] || \"title-\".concat(nextUniqueId())\n },\n children: [title]\n });\n\n var args = _objectSpread({}, content, {\n prefix: prefix,\n iconName: iconName,\n main: main,\n mask: mask,\n transform: transform,\n symbol: symbol,\n styles: extra.styles\n });\n\n var _ref2 = mask.found && main.found ? makeIconMasking(args) : makeIconStandard(args),\n children = _ref2.children,\n attributes = _ref2.attributes;\n\n args.children = children;\n args.attributes = attributes;\n\n if (symbol) {\n return asSymbol(args);\n } else {\n return asIcon(args);\n }\n}\nfunction makeLayersTextAbstract(params) {\n var content = params.content,\n width = params.width,\n height = params.height,\n transform = params.transform,\n title = params.title,\n extra = params.extra,\n _params$watchable2 = params.watchable,\n watchable = _params$watchable2 === void 0 ? false : _params$watchable2;\n\n var attributes = _objectSpread({}, extra.attributes, title ? {\n 'title': title\n } : {}, {\n 'class': extra.classes.join(' ')\n });\n\n if (watchable) {\n attributes[DATA_FA_I2SVG] = '';\n }\n\n var styles = _objectSpread({}, extra.styles);\n\n if (transformIsMeaningful(transform)) {\n styles['transform'] = transformForCss({\n transform: transform,\n startCentered: true,\n width: width,\n height: height\n });\n styles['-webkit-transform'] = styles['transform'];\n }\n\n var styleString = joinStyles(styles);\n\n if (styleString.length > 0) {\n attributes['style'] = styleString;\n }\n\n var val = [];\n val.push({\n tag: 'span',\n attributes: attributes,\n children: [content]\n });\n\n if (title) {\n val.push({\n tag: 'span',\n attributes: {\n class: 'sr-only'\n },\n children: [title]\n });\n }\n\n return val;\n}\nfunction makeLayersCounterAbstract(params) {\n var content = params.content,\n title = params.title,\n extra = params.extra;\n\n var attributes = _objectSpread({}, extra.attributes, title ? {\n 'title': title\n } : {}, {\n 'class': extra.classes.join(' ')\n });\n\n var styleString = joinStyles(extra.styles);\n\n if (styleString.length > 0) {\n attributes['style'] = styleString;\n }\n\n var val = [];\n val.push({\n tag: 'span',\n attributes: attributes,\n children: [content]\n });\n\n if (title) {\n val.push({\n tag: 'span',\n attributes: {\n class: 'sr-only'\n },\n children: [title]\n });\n }\n\n return val;\n}\n\nvar noop$1 = function noop() {};\n\nvar p = config.measurePerformance && PERFORMANCE && PERFORMANCE.mark && PERFORMANCE.measure ? PERFORMANCE : {\n mark: noop$1,\n measure: noop$1\n};\nvar preamble = \"FA \\\"5.10.2\\\"\";\n\nvar begin = function begin(name) {\n p.mark(\"\".concat(preamble, \" \").concat(name, \" begins\"));\n return function () {\n return end(name);\n };\n};\n\nvar end = function end(name) {\n p.mark(\"\".concat(preamble, \" \").concat(name, \" ends\"));\n p.measure(\"\".concat(preamble, \" \").concat(name), \"\".concat(preamble, \" \").concat(name, \" begins\"), \"\".concat(preamble, \" \").concat(name, \" ends\"));\n};\n\nvar perf = {\n begin: begin,\n end: end\n};\n\n/**\n * Internal helper to bind a function known to have 4 arguments\n * to a given context.\n */\n\nvar bindInternal4 = function bindInternal4(func, thisContext) {\n return function (a, b, c, d) {\n return func.call(thisContext, a, b, c, d);\n };\n};\n\n/**\n * # Reduce\n *\n * A fast object `.reduce()` implementation.\n *\n * @param {Object} subject The object to reduce over.\n * @param {Function} fn The reducer function.\n * @param {mixed} initialValue The initial value for the reducer, defaults to subject[0].\n * @param {Object} thisContext The context for the reducer.\n * @return {mixed} The final result.\n */\n\n\nvar reduce = function fastReduceObject(subject, fn, initialValue, thisContext) {\n var keys = Object.keys(subject),\n length = keys.length,\n iterator = thisContext !== undefined ? bindInternal4(fn, thisContext) : fn,\n i,\n key,\n result;\n\n if (initialValue === undefined) {\n i = 1;\n result = subject[keys[0]];\n } else {\n i = 0;\n result = initialValue;\n }\n\n for (; i < length; i++) {\n key = keys[i];\n result = iterator(result, subject[key], key, subject);\n }\n\n return result;\n};\n\nfunction toHex(unicode) {\n var result = '';\n\n for (var i = 0; i < unicode.length; i++) {\n var hex = unicode.charCodeAt(i).toString(16);\n result += ('000' + hex).slice(-4);\n }\n\n return result;\n}\n\nfunction defineIcons(prefix, icons) {\n var params = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};\n var _params$skipHooks = params.skipHooks,\n skipHooks = _params$skipHooks === void 0 ? false : _params$skipHooks;\n var normalized = Object.keys(icons).reduce(function (acc, iconName) {\n var icon = icons[iconName];\n var expanded = !!icon.icon;\n\n if (expanded) {\n acc[icon.iconName] = icon.icon;\n } else {\n acc[iconName] = icon;\n }\n\n return acc;\n }, {});\n\n if (typeof namespace.hooks.addPack === 'function' && !skipHooks) {\n namespace.hooks.addPack(prefix, normalized);\n } else {\n namespace.styles[prefix] = _objectSpread({}, namespace.styles[prefix] || {}, normalized);\n }\n /**\n * Font Awesome 4 used the prefix of `fa` for all icons. With the introduction\n * of new styles we needed to differentiate between them. Prefix `fa` is now an alias\n * for `fas` so we'll easy the upgrade process for our users by automatically defining\n * this as well.\n */\n\n\n if (prefix === 'fas') {\n defineIcons('fa', icons);\n }\n}\n\nvar styles = namespace.styles,\n shims = namespace.shims;\nvar _byUnicode = {};\nvar _byLigature = {};\nvar _byOldName = {};\nvar build = function build() {\n var lookup = function lookup(reducer) {\n return reduce(styles, function (o, style, prefix) {\n o[prefix] = reduce(style, reducer, {});\n return o;\n }, {});\n };\n\n _byUnicode = lookup(function (acc, icon, iconName) {\n if (icon[3]) {\n acc[icon[3]] = iconName;\n }\n\n return acc;\n });\n _byLigature = lookup(function (acc, icon, iconName) {\n var ligatures = icon[2];\n acc[iconName] = iconName;\n ligatures.forEach(function (ligature) {\n acc[ligature] = iconName;\n });\n return acc;\n });\n var hasRegular = 'far' in styles;\n _byOldName = reduce(shims, function (acc, shim) {\n var oldName = shim[0];\n var prefix = shim[1];\n var iconName = shim[2];\n\n if (prefix === 'far' && !hasRegular) {\n prefix = 'fas';\n }\n\n acc[oldName] = {\n prefix: prefix,\n iconName: iconName\n };\n return acc;\n }, {});\n};\nbuild();\nfunction byUnicode(prefix, unicode) {\n return (_byUnicode[prefix] || {})[unicode];\n}\nfunction byLigature(prefix, ligature) {\n return (_byLigature[prefix] || {})[ligature];\n}\nfunction byOldName(name) {\n return _byOldName[name] || {\n prefix: null,\n iconName: null\n };\n}\n\nvar styles$1 = namespace.styles;\nvar emptyCanonicalIcon = function emptyCanonicalIcon() {\n return {\n prefix: null,\n iconName: null,\n rest: []\n };\n};\nfunction getCanonicalIcon(values) {\n return values.reduce(function (acc, cls) {\n var iconName = getIconName(config.familyPrefix, cls);\n\n if (styles$1[cls]) {\n acc.prefix = cls;\n } else if (config.autoFetchSvg && ['fas', 'far', 'fal', 'fad', 'fab', 'fa'].indexOf(cls) > -1) {\n acc.prefix = cls;\n } else if (iconName) {\n var shim = acc.prefix === 'fa' ? byOldName(iconName) : {};\n acc.iconName = shim.iconName || iconName;\n acc.prefix = shim.prefix || acc.prefix;\n } else if (cls !== config.replacementClass && cls.indexOf('fa-w-') !== 0) {\n acc.rest.push(cls);\n }\n\n return acc;\n }, emptyCanonicalIcon());\n}\nfunction iconFromMapping(mapping, prefix, iconName) {\n if (mapping && mapping[prefix] && mapping[prefix][iconName]) {\n return {\n prefix: prefix,\n iconName: iconName,\n icon: mapping[prefix][iconName]\n };\n }\n}\n\nfunction toHtml(abstractNodes) {\n var tag = abstractNodes.tag,\n _abstractNodes$attrib = abstractNodes.attributes,\n attributes = _abstractNodes$attrib === void 0 ? {} : _abstractNodes$attrib,\n _abstractNodes$childr = abstractNodes.children,\n children = _abstractNodes$childr === void 0 ? [] : _abstractNodes$childr;\n\n if (typeof abstractNodes === 'string') {\n return htmlEscape(abstractNodes);\n } else {\n return \"<\".concat(tag, \" \").concat(joinAttributes(attributes), \">\").concat(children.map(toHtml).join(''), \"\").concat(tag, \">\");\n }\n}\n\nvar noop$2 = function noop() {};\n\nfunction isWatched(node) {\n var i2svg = node.getAttribute ? node.getAttribute(DATA_FA_I2SVG) : null;\n return typeof i2svg === 'string';\n}\n\nfunction getMutator() {\n if (config.autoReplaceSvg === true) {\n return mutators.replace;\n }\n\n var mutator = mutators[config.autoReplaceSvg];\n return mutator || mutators.replace;\n}\n\nvar mutators = {\n replace: function replace(mutation) {\n var node = mutation[0];\n var abstract = mutation[1];\n var newOuterHTML = abstract.map(function (a) {\n return toHtml(a);\n }).join('\\n');\n\n if (node.parentNode && node.outerHTML) {\n node.outerHTML = newOuterHTML + (config.keepOriginalSource && node.tagName.toLowerCase() !== 'svg' ? \"\") : '');\n } else if (node.parentNode) {\n var newNode = document.createElement('span');\n node.parentNode.replaceChild(newNode, node);\n newNode.outerHTML = newOuterHTML;\n }\n },\n nest: function nest(mutation) {\n var node = mutation[0];\n var abstract = mutation[1]; // If we already have a replaced node we do not want to continue nesting within it.\n // Short-circuit to the standard replacement\n\n if (~classArray(node).indexOf(config.replacementClass)) {\n return mutators.replace(mutation);\n }\n\n var forSvg = new RegExp(\"\".concat(config.familyPrefix, \"-.*\"));\n delete abstract[0].attributes.style;\n var splitClasses = abstract[0].attributes.class.split(' ').reduce(function (acc, cls) {\n if (cls === config.replacementClass || cls.match(forSvg)) {\n acc.toSvg.push(cls);\n } else {\n acc.toNode.push(cls);\n }\n\n return acc;\n }, {\n toNode: [],\n toSvg: []\n });\n abstract[0].attributes.class = splitClasses.toSvg.join(' ');\n var newInnerHTML = abstract.map(function (a) {\n return toHtml(a);\n }).join('\\n');\n node.setAttribute('class', splitClasses.toNode.join(' '));\n node.setAttribute(DATA_FA_I2SVG, '');\n node.innerHTML = newInnerHTML;\n }\n};\n\nfunction performOperationSync(op) {\n op();\n}\n\nfunction perform(mutations, callback) {\n var callbackFunction = typeof callback === 'function' ? callback : noop$2;\n\n if (mutations.length === 0) {\n callbackFunction();\n } else {\n var frame = performOperationSync;\n\n if (config.mutateApproach === MUTATION_APPROACH_ASYNC) {\n frame = WINDOW.requestAnimationFrame || performOperationSync;\n }\n\n frame(function () {\n var mutator = getMutator();\n var mark = perf.begin('mutate');\n mutations.map(mutator);\n mark();\n callbackFunction();\n });\n }\n}\nvar disabled = false;\nfunction disableObservation() {\n disabled = true;\n}\nfunction enableObservation() {\n disabled = false;\n}\nvar mo = null;\nfunction observe(options) {\n if (!MUTATION_OBSERVER) {\n return;\n }\n\n if (!config.observeMutations) {\n return;\n }\n\n var treeCallback = options.treeCallback,\n nodeCallback = options.nodeCallback,\n pseudoElementsCallback = options.pseudoElementsCallback,\n _options$observeMutat = options.observeMutationsRoot,\n observeMutationsRoot = _options$observeMutat === void 0 ? DOCUMENT : _options$observeMutat;\n mo = new MUTATION_OBSERVER(function (objects) {\n if (disabled) return;\n toArray(objects).forEach(function (mutationRecord) {\n if (mutationRecord.type === 'childList' && mutationRecord.addedNodes.length > 0 && !isWatched(mutationRecord.addedNodes[0])) {\n if (config.searchPseudoElements) {\n pseudoElementsCallback(mutationRecord.target);\n }\n\n treeCallback(mutationRecord.target);\n }\n\n if (mutationRecord.type === 'attributes' && mutationRecord.target.parentNode && config.searchPseudoElements) {\n pseudoElementsCallback(mutationRecord.target.parentNode);\n }\n\n if (mutationRecord.type === 'attributes' && isWatched(mutationRecord.target) && ~ATTRIBUTES_WATCHED_FOR_MUTATION.indexOf(mutationRecord.attributeName)) {\n if (mutationRecord.attributeName === 'class') {\n var _getCanonicalIcon = getCanonicalIcon(classArray(mutationRecord.target)),\n prefix = _getCanonicalIcon.prefix,\n iconName = _getCanonicalIcon.iconName;\n\n if (prefix) mutationRecord.target.setAttribute('data-prefix', prefix);\n if (iconName) mutationRecord.target.setAttribute('data-icon', iconName);\n } else {\n nodeCallback(mutationRecord.target);\n }\n }\n });\n });\n if (!IS_DOM) return;\n mo.observe(observeMutationsRoot, {\n childList: true,\n attributes: true,\n characterData: true,\n subtree: true\n });\n}\nfunction disconnect() {\n if (!mo) return;\n mo.disconnect();\n}\n\nfunction styleParser (node) {\n var style = node.getAttribute('style');\n var val = [];\n\n if (style) {\n val = style.split(';').reduce(function (acc, style) {\n var styles = style.split(':');\n var prop = styles[0];\n var value = styles.slice(1);\n\n if (prop && value.length > 0) {\n acc[prop] = value.join(':').trim();\n }\n\n return acc;\n }, {});\n }\n\n return val;\n}\n\nfunction classParser (node) {\n var existingPrefix = node.getAttribute('data-prefix');\n var existingIconName = node.getAttribute('data-icon');\n var innerText = node.innerText !== undefined ? node.innerText.trim() : '';\n var val = getCanonicalIcon(classArray(node));\n\n if (existingPrefix && existingIconName) {\n val.prefix = existingPrefix;\n val.iconName = existingIconName;\n }\n\n if (val.prefix && innerText.length > 1) {\n val.iconName = byLigature(val.prefix, node.innerText);\n } else if (val.prefix && innerText.length === 1) {\n val.iconName = byUnicode(val.prefix, toHex(node.innerText));\n }\n\n return val;\n}\n\nvar parseTransformString = function parseTransformString(transformString) {\n var transform = {\n size: 16,\n x: 0,\n y: 0,\n flipX: false,\n flipY: false,\n rotate: 0\n };\n\n if (!transformString) {\n return transform;\n } else {\n return transformString.toLowerCase().split(' ').reduce(function (acc, n) {\n var parts = n.toLowerCase().split('-');\n var first = parts[0];\n var rest = parts.slice(1).join('-');\n\n if (first && rest === 'h') {\n acc.flipX = true;\n return acc;\n }\n\n if (first && rest === 'v') {\n acc.flipY = true;\n return acc;\n }\n\n rest = parseFloat(rest);\n\n if (isNaN(rest)) {\n return acc;\n }\n\n switch (first) {\n case 'grow':\n acc.size = acc.size + rest;\n break;\n\n case 'shrink':\n acc.size = acc.size - rest;\n break;\n\n case 'left':\n acc.x = acc.x - rest;\n break;\n\n case 'right':\n acc.x = acc.x + rest;\n break;\n\n case 'up':\n acc.y = acc.y - rest;\n break;\n\n case 'down':\n acc.y = acc.y + rest;\n break;\n\n case 'rotate':\n acc.rotate = acc.rotate + rest;\n break;\n }\n\n return acc;\n }, transform);\n }\n};\nfunction transformParser (node) {\n return parseTransformString(node.getAttribute('data-fa-transform'));\n}\n\nfunction symbolParser (node) {\n var symbol = node.getAttribute('data-fa-symbol');\n return symbol === null ? false : symbol === '' ? true : symbol;\n}\n\nfunction attributesParser (node) {\n var extraAttributes = toArray(node.attributes).reduce(function (acc, attr) {\n if (acc.name !== 'class' && acc.name !== 'style') {\n acc[attr.name] = attr.value;\n }\n\n return acc;\n }, {});\n var title = node.getAttribute('title');\n\n if (config.autoA11y) {\n if (title) {\n extraAttributes['aria-labelledby'] = \"\".concat(config.replacementClass, \"-title-\").concat(nextUniqueId());\n } else {\n extraAttributes['aria-hidden'] = 'true';\n extraAttributes['focusable'] = 'false';\n }\n }\n\n return extraAttributes;\n}\n\nfunction maskParser (node) {\n var mask = node.getAttribute('data-fa-mask');\n\n if (!mask) {\n return emptyCanonicalIcon();\n } else {\n return getCanonicalIcon(mask.split(' ').map(function (i) {\n return i.trim();\n }));\n }\n}\n\nfunction blankMeta() {\n return {\n iconName: null,\n title: null,\n prefix: null,\n transform: meaninglessTransform,\n symbol: false,\n mask: null,\n extra: {\n classes: [],\n styles: {},\n attributes: {}\n }\n };\n}\nfunction parseMeta(node) {\n var _classParser = classParser(node),\n iconName = _classParser.iconName,\n prefix = _classParser.prefix,\n extraClasses = _classParser.rest;\n\n var extraStyles = styleParser(node);\n var transform = transformParser(node);\n var symbol = symbolParser(node);\n var extraAttributes = attributesParser(node);\n var mask = maskParser(node);\n return {\n iconName: iconName,\n title: node.getAttribute('title'),\n prefix: prefix,\n transform: transform,\n symbol: symbol,\n mask: mask,\n extra: {\n classes: extraClasses,\n styles: extraStyles,\n attributes: extraAttributes\n }\n };\n}\n\nfunction MissingIcon(error) {\n this.name = 'MissingIcon';\n this.message = error || 'Icon unavailable';\n this.stack = new Error().stack;\n}\nMissingIcon.prototype = Object.create(Error.prototype);\nMissingIcon.prototype.constructor = MissingIcon;\n\nvar FILL = {\n fill: 'currentColor'\n};\nvar ANIMATION_BASE = {\n attributeType: 'XML',\n repeatCount: 'indefinite',\n dur: '2s'\n};\nvar RING = {\n tag: 'path',\n attributes: _objectSpread({}, FILL, {\n d: 'M156.5,447.7l-12.6,29.5c-18.7-9.5-35.9-21.2-51.5-34.9l22.7-22.7C127.6,430.5,141.5,440,156.5,447.7z M40.6,272H8.5 c1.4,21.2,5.4,41.7,11.7,61.1L50,321.2C45.1,305.5,41.8,289,40.6,272z M40.6,240c1.4-18.8,5.2-37,11.1-54.1l-29.5-12.6 C14.7,194.3,10,216.7,8.5,240H40.6z M64.3,156.5c7.8-14.9,17.2-28.8,28.1-41.5L69.7,92.3c-13.7,15.6-25.5,32.8-34.9,51.5 L64.3,156.5z M397,419.6c-13.9,12-29.4,22.3-46.1,30.4l11.9,29.8c20.7-9.9,39.8-22.6,56.9-37.6L397,419.6z M115,92.4 c13.9-12,29.4-22.3,46.1-30.4l-11.9-29.8c-20.7,9.9-39.8,22.6-56.8,37.6L115,92.4z M447.7,355.5c-7.8,14.9-17.2,28.8-28.1,41.5 l22.7,22.7c13.7-15.6,25.5-32.9,34.9-51.5L447.7,355.5z M471.4,272c-1.4,18.8-5.2,37-11.1,54.1l29.5,12.6 c7.5-21.1,12.2-43.5,13.6-66.8H471.4z M321.2,462c-15.7,5-32.2,8.2-49.2,9.4v32.1c21.2-1.4,41.7-5.4,61.1-11.7L321.2,462z M240,471.4c-18.8-1.4-37-5.2-54.1-11.1l-12.6,29.5c21.1,7.5,43.5,12.2,66.8,13.6V471.4z M462,190.8c5,15.7,8.2,32.2,9.4,49.2h32.1 c-1.4-21.2-5.4-41.7-11.7-61.1L462,190.8z M92.4,397c-12-13.9-22.3-29.4-30.4-46.1l-29.8,11.9c9.9,20.7,22.6,39.8,37.6,56.9 L92.4,397z M272,40.6c18.8,1.4,36.9,5.2,54.1,11.1l12.6-29.5C317.7,14.7,295.3,10,272,8.5V40.6z M190.8,50 c15.7-5,32.2-8.2,49.2-9.4V8.5c-21.2,1.4-41.7,5.4-61.1,11.7L190.8,50z M442.3,92.3L419.6,115c12,13.9,22.3,29.4,30.5,46.1 l29.8-11.9C470,128.5,457.3,109.4,442.3,92.3z M397,92.4l22.7-22.7c-15.6-13.7-32.8-25.5-51.5-34.9l-12.6,29.5 C370.4,72.1,384.4,81.5,397,92.4z'\n })\n};\n\nvar OPACITY_ANIMATE = _objectSpread({}, ANIMATION_BASE, {\n attributeName: 'opacity'\n});\n\nvar DOT = {\n tag: 'circle',\n attributes: _objectSpread({}, FILL, {\n cx: '256',\n cy: '364',\n r: '28'\n }),\n children: [{\n tag: 'animate',\n attributes: _objectSpread({}, ANIMATION_BASE, {\n attributeName: 'r',\n values: '28;14;28;28;14;28;'\n })\n }, {\n tag: 'animate',\n attributes: _objectSpread({}, OPACITY_ANIMATE, {\n values: '1;0;1;1;0;1;'\n })\n }]\n};\nvar QUESTION = {\n tag: 'path',\n attributes: _objectSpread({}, FILL, {\n opacity: '1',\n d: 'M263.7,312h-16c-6.6,0-12-5.4-12-12c0-71,77.4-63.9,77.4-107.8c0-20-17.8-40.2-57.4-40.2c-29.1,0-44.3,9.6-59.2,28.7 c-3.9,5-11.1,6-16.2,2.4l-13.1-9.2c-5.6-3.9-6.9-11.8-2.6-17.2c21.2-27.2,46.4-44.7,91.2-44.7c52.3,0,97.4,29.8,97.4,80.2 c0,67.6-77.4,63.5-77.4,107.8C275.7,306.6,270.3,312,263.7,312z'\n }),\n children: [{\n tag: 'animate',\n attributes: _objectSpread({}, OPACITY_ANIMATE, {\n values: '1;0;0;0;0;1;'\n })\n }]\n};\nvar EXCLAMATION = {\n tag: 'path',\n attributes: _objectSpread({}, FILL, {\n opacity: '0',\n d: 'M232.5,134.5l7,168c0.3,6.4,5.6,11.5,12,11.5h9c6.4,0,11.7-5.1,12-11.5l7-168c0.3-6.8-5.2-12.5-12-12.5h-23 C237.7,122,232.2,127.7,232.5,134.5z'\n }),\n children: [{\n tag: 'animate',\n attributes: _objectSpread({}, OPACITY_ANIMATE, {\n values: '0;0;1;1;0;0;'\n })\n }]\n};\nvar missing = {\n tag: 'g',\n children: [RING, DOT, QUESTION, EXCLAMATION]\n};\n\nvar styles$2 = namespace.styles;\nfunction asFoundIcon(icon) {\n var width = icon[0];\n var height = icon[1];\n\n var _icon$slice = icon.slice(4),\n _icon$slice2 = _slicedToArray(_icon$slice, 1),\n vectorData = _icon$slice2[0];\n\n var element = null;\n\n if (Array.isArray(vectorData)) {\n element = {\n tag: 'g',\n attributes: {\n class: \"\".concat(config.familyPrefix, \"-\").concat(DUOTONE_CLASSES.GROUP)\n },\n children: [{\n tag: 'path',\n attributes: {\n class: \"\".concat(config.familyPrefix, \"-\").concat(DUOTONE_CLASSES.SECONDARY),\n fill: 'currentColor',\n d: vectorData[0]\n }\n }, {\n tag: 'path',\n attributes: {\n class: \"\".concat(config.familyPrefix, \"-\").concat(DUOTONE_CLASSES.PRIMARY),\n fill: 'currentColor',\n d: vectorData[1]\n }\n }]\n };\n } else {\n element = {\n tag: 'path',\n attributes: {\n fill: 'currentColor',\n d: vectorData\n }\n };\n }\n\n return {\n found: true,\n width: width,\n height: height,\n icon: element\n };\n}\nfunction findIcon(iconName, prefix) {\n return new picked(function (resolve, reject) {\n var val = {\n found: false,\n width: 512,\n height: 512,\n icon: missing\n };\n\n if (iconName && prefix && styles$2[prefix] && styles$2[prefix][iconName]) {\n var icon = styles$2[prefix][iconName];\n return resolve(asFoundIcon(icon));\n }\n\n if (iconName && prefix && !config.showMissingIcons) {\n reject(new MissingIcon(\"Icon is missing for prefix \".concat(prefix, \" with icon name \").concat(iconName)));\n } else {\n resolve(val);\n }\n });\n}\n\nvar styles$3 = namespace.styles;\n\nfunction generateSvgReplacementMutation(node, nodeMeta) {\n var iconName = nodeMeta.iconName,\n title = nodeMeta.title,\n prefix = nodeMeta.prefix,\n transform = nodeMeta.transform,\n symbol = nodeMeta.symbol,\n mask = nodeMeta.mask,\n extra = nodeMeta.extra;\n return new picked(function (resolve, reject) {\n picked.all([findIcon(iconName, prefix), findIcon(mask.iconName, mask.prefix)]).then(function (_ref) {\n var _ref2 = _slicedToArray(_ref, 2),\n main = _ref2[0],\n mask = _ref2[1];\n\n resolve([node, makeInlineSvgAbstract({\n icons: {\n main: main,\n mask: mask\n },\n prefix: prefix,\n iconName: iconName,\n transform: transform,\n symbol: symbol,\n mask: mask,\n title: title,\n extra: extra,\n watchable: true\n })]);\n });\n });\n}\n\nfunction generateLayersText(node, nodeMeta) {\n var title = nodeMeta.title,\n transform = nodeMeta.transform,\n extra = nodeMeta.extra;\n var width = null;\n var height = null;\n\n if (IS_IE) {\n var computedFontSize = parseInt(getComputedStyle(node).fontSize, 10);\n var boundingClientRect = node.getBoundingClientRect();\n width = boundingClientRect.width / computedFontSize;\n height = boundingClientRect.height / computedFontSize;\n }\n\n if (config.autoA11y && !title) {\n extra.attributes['aria-hidden'] = 'true';\n }\n\n return picked.resolve([node, makeLayersTextAbstract({\n content: node.innerHTML,\n width: width,\n height: height,\n transform: transform,\n title: title,\n extra: extra,\n watchable: true\n })]);\n}\n\nfunction generateMutation(node) {\n var nodeMeta = parseMeta(node);\n\n if (~nodeMeta.extra.classes.indexOf(LAYERS_TEXT_CLASSNAME)) {\n return generateLayersText(node, nodeMeta);\n } else {\n return generateSvgReplacementMutation(node, nodeMeta);\n }\n}\n\nfunction onTree(root) {\n var callback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;\n if (!IS_DOM) return;\n var htmlClassList = DOCUMENT.documentElement.classList;\n\n var hclAdd = function hclAdd(suffix) {\n return htmlClassList.add(\"\".concat(HTML_CLASS_I2SVG_BASE_CLASS, \"-\").concat(suffix));\n };\n\n var hclRemove = function hclRemove(suffix) {\n return htmlClassList.remove(\"\".concat(HTML_CLASS_I2SVG_BASE_CLASS, \"-\").concat(suffix));\n };\n\n var prefixes = config.autoFetchSvg ? Object.keys(PREFIX_TO_STYLE) : Object.keys(styles$3);\n var prefixesDomQuery = [\".\".concat(LAYERS_TEXT_CLASSNAME, \":not([\").concat(DATA_FA_I2SVG, \"])\")].concat(prefixes.map(function (p) {\n return \".\".concat(p, \":not([\").concat(DATA_FA_I2SVG, \"])\");\n })).join(', ');\n\n if (prefixesDomQuery.length === 0) {\n return;\n }\n\n var candidates = [];\n\n try {\n candidates = toArray(root.querySelectorAll(prefixesDomQuery));\n } catch (e) {// noop\n }\n\n if (candidates.length > 0) {\n hclAdd('pending');\n hclRemove('complete');\n } else {\n return;\n }\n\n var mark = perf.begin('onTree');\n var mutations = candidates.reduce(function (acc, node) {\n try {\n var mutation = generateMutation(node);\n\n if (mutation) {\n acc.push(mutation);\n }\n } catch (e) {\n if (!PRODUCTION) {\n if (e instanceof MissingIcon) {\n console.error(e);\n }\n }\n }\n\n return acc;\n }, []);\n return new picked(function (resolve, reject) {\n picked.all(mutations).then(function (resolvedMutations) {\n perform(resolvedMutations, function () {\n hclAdd('active');\n hclAdd('complete');\n hclRemove('pending');\n if (typeof callback === 'function') callback();\n mark();\n resolve();\n });\n }).catch(function () {\n mark();\n reject();\n });\n });\n}\nfunction onNode(node) {\n var callback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;\n generateMutation(node).then(function (mutation) {\n if (mutation) {\n perform([mutation], callback);\n }\n });\n}\n\nfunction replaceForPosition(node, position) {\n var pendingAttribute = \"\".concat(DATA_FA_PSEUDO_ELEMENT_PENDING).concat(position.replace(':', '-'));\n return new picked(function (resolve, reject) {\n if (node.getAttribute(pendingAttribute) !== null) {\n // This node is already being processed\n return resolve();\n }\n\n var children = toArray(node.children);\n var alreadyProcessedPseudoElement = children.filter(function (c) {\n return c.getAttribute(DATA_FA_PSEUDO_ELEMENT) === position;\n })[0];\n var styles = WINDOW.getComputedStyle(node, position);\n var fontFamily = styles.getPropertyValue('font-family').match(FONT_FAMILY_PATTERN);\n var fontWeight = styles.getPropertyValue('font-weight');\n\n if (alreadyProcessedPseudoElement && !fontFamily) {\n // If we've already processed it but the current computed style does not result in a font-family,\n // that probably means that a class name that was previously present to make the icon has been\n // removed. So we now should delete the icon.\n node.removeChild(alreadyProcessedPseudoElement);\n return resolve();\n } else if (fontFamily) {\n var content = styles.getPropertyValue('content');\n var prefix = ~['Solid', 'Regular', 'Light', 'Duotone', 'Brands'].indexOf(fontFamily[1]) ? STYLE_TO_PREFIX[fontFamily[1].toLowerCase()] : FONT_WEIGHT_TO_PREFIX[fontWeight];\n var hexValue = toHex(content.length === 3 ? content.substr(1, 1) : content);\n var iconName = byUnicode(prefix, hexValue);\n var iconIdentifier = iconName; // Only convert the pseudo element in this :before/:after position into an icon if we haven't\n // already done so with the same prefix and iconName\n\n if (iconName && (!alreadyProcessedPseudoElement || alreadyProcessedPseudoElement.getAttribute(DATA_PREFIX) !== prefix || alreadyProcessedPseudoElement.getAttribute(DATA_ICON) !== iconIdentifier)) {\n node.setAttribute(pendingAttribute, iconIdentifier);\n\n if (alreadyProcessedPseudoElement) {\n // Delete the old one, since we're replacing it with a new one\n node.removeChild(alreadyProcessedPseudoElement);\n }\n\n var meta = blankMeta();\n var extra = meta.extra;\n extra.attributes[DATA_FA_PSEUDO_ELEMENT] = position;\n findIcon(iconName, prefix).then(function (main) {\n var abstract = makeInlineSvgAbstract(_objectSpread({}, meta, {\n icons: {\n main: main,\n mask: emptyCanonicalIcon()\n },\n prefix: prefix,\n iconName: iconIdentifier,\n extra: extra,\n watchable: true\n }));\n var element = DOCUMENT.createElement('svg');\n\n if (position === ':before') {\n node.insertBefore(element, node.firstChild);\n } else {\n node.appendChild(element);\n }\n\n element.outerHTML = abstract.map(function (a) {\n return toHtml(a);\n }).join('\\n');\n node.removeAttribute(pendingAttribute);\n resolve();\n }).catch(reject);\n } else {\n resolve();\n }\n } else {\n resolve();\n }\n });\n}\n\nfunction replace(node) {\n return picked.all([replaceForPosition(node, ':before'), replaceForPosition(node, ':after')]);\n}\n\nfunction processable(node) {\n return node.parentNode !== document.head && !~TAGNAMES_TO_SKIP_FOR_PSEUDOELEMENTS.indexOf(node.tagName.toUpperCase()) && !node.getAttribute(DATA_FA_PSEUDO_ELEMENT) && (!node.parentNode || node.parentNode.tagName !== 'svg');\n}\n\nfunction searchPseudoElements (root) {\n if (!IS_DOM) return;\n return new picked(function (resolve, reject) {\n var operations = toArray(root.querySelectorAll('*')).filter(processable).map(replace);\n var end = perf.begin('searchPseudoElements');\n disableObservation();\n picked.all(operations).then(function () {\n end();\n enableObservation();\n resolve();\n }).catch(function () {\n end();\n enableObservation();\n reject();\n });\n });\n}\n\nvar baseStyles = \"svg:not(:root).svg-inline--fa {\\n overflow: visible;\\n}\\n\\n.svg-inline--fa {\\n display: inline-block;\\n font-size: inherit;\\n height: 1em;\\n overflow: visible;\\n vertical-align: -0.125em;\\n}\\n.svg-inline--fa.fa-lg {\\n vertical-align: -0.225em;\\n}\\n.svg-inline--fa.fa-w-1 {\\n width: 0.0625em;\\n}\\n.svg-inline--fa.fa-w-2 {\\n width: 0.125em;\\n}\\n.svg-inline--fa.fa-w-3 {\\n width: 0.1875em;\\n}\\n.svg-inline--fa.fa-w-4 {\\n width: 0.25em;\\n}\\n.svg-inline--fa.fa-w-5 {\\n width: 0.3125em;\\n}\\n.svg-inline--fa.fa-w-6 {\\n width: 0.375em;\\n}\\n.svg-inline--fa.fa-w-7 {\\n width: 0.4375em;\\n}\\n.svg-inline--fa.fa-w-8 {\\n width: 0.5em;\\n}\\n.svg-inline--fa.fa-w-9 {\\n width: 0.5625em;\\n}\\n.svg-inline--fa.fa-w-10 {\\n width: 0.625em;\\n}\\n.svg-inline--fa.fa-w-11 {\\n width: 0.6875em;\\n}\\n.svg-inline--fa.fa-w-12 {\\n width: 0.75em;\\n}\\n.svg-inline--fa.fa-w-13 {\\n width: 0.8125em;\\n}\\n.svg-inline--fa.fa-w-14 {\\n width: 0.875em;\\n}\\n.svg-inline--fa.fa-w-15 {\\n width: 0.9375em;\\n}\\n.svg-inline--fa.fa-w-16 {\\n width: 1em;\\n}\\n.svg-inline--fa.fa-w-17 {\\n width: 1.0625em;\\n}\\n.svg-inline--fa.fa-w-18 {\\n width: 1.125em;\\n}\\n.svg-inline--fa.fa-w-19 {\\n width: 1.1875em;\\n}\\n.svg-inline--fa.fa-w-20 {\\n width: 1.25em;\\n}\\n.svg-inline--fa.fa-pull-left {\\n margin-right: 0.3em;\\n width: auto;\\n}\\n.svg-inline--fa.fa-pull-right {\\n margin-left: 0.3em;\\n width: auto;\\n}\\n.svg-inline--fa.fa-border {\\n height: 1.5em;\\n}\\n.svg-inline--fa.fa-li {\\n width: 2em;\\n}\\n.svg-inline--fa.fa-fw {\\n width: 1.25em;\\n}\\n\\n.fa-layers svg.svg-inline--fa {\\n bottom: 0;\\n left: 0;\\n margin: auto;\\n position: absolute;\\n right: 0;\\n top: 0;\\n}\\n\\n.fa-layers {\\n display: inline-block;\\n height: 1em;\\n position: relative;\\n text-align: center;\\n vertical-align: -0.125em;\\n width: 1em;\\n}\\n.fa-layers svg.svg-inline--fa {\\n -webkit-transform-origin: center center;\\n transform-origin: center center;\\n}\\n\\n.fa-layers-counter, .fa-layers-text {\\n display: inline-block;\\n position: absolute;\\n text-align: center;\\n}\\n\\n.fa-layers-text {\\n left: 50%;\\n top: 50%;\\n -webkit-transform: translate(-50%, -50%);\\n transform: translate(-50%, -50%);\\n -webkit-transform-origin: center center;\\n transform-origin: center center;\\n}\\n\\n.fa-layers-counter {\\n background-color: #ff253a;\\n border-radius: 1em;\\n -webkit-box-sizing: border-box;\\n box-sizing: border-box;\\n color: #fff;\\n height: 1.5em;\\n line-height: 1;\\n max-width: 5em;\\n min-width: 1.5em;\\n overflow: hidden;\\n padding: 0.25em;\\n right: 0;\\n text-overflow: ellipsis;\\n top: 0;\\n -webkit-transform: scale(0.25);\\n transform: scale(0.25);\\n -webkit-transform-origin: top right;\\n transform-origin: top right;\\n}\\n\\n.fa-layers-bottom-right {\\n bottom: 0;\\n right: 0;\\n top: auto;\\n -webkit-transform: scale(0.25);\\n transform: scale(0.25);\\n -webkit-transform-origin: bottom right;\\n transform-origin: bottom right;\\n}\\n\\n.fa-layers-bottom-left {\\n bottom: 0;\\n left: 0;\\n right: auto;\\n top: auto;\\n -webkit-transform: scale(0.25);\\n transform: scale(0.25);\\n -webkit-transform-origin: bottom left;\\n transform-origin: bottom left;\\n}\\n\\n.fa-layers-top-right {\\n right: 0;\\n top: 0;\\n -webkit-transform: scale(0.25);\\n transform: scale(0.25);\\n -webkit-transform-origin: top right;\\n transform-origin: top right;\\n}\\n\\n.fa-layers-top-left {\\n left: 0;\\n right: auto;\\n top: 0;\\n -webkit-transform: scale(0.25);\\n transform: scale(0.25);\\n -webkit-transform-origin: top left;\\n transform-origin: top left;\\n}\\n\\n.fa-lg {\\n font-size: 1.3333333333em;\\n line-height: 0.75em;\\n vertical-align: -0.0667em;\\n}\\n\\n.fa-xs {\\n font-size: 0.75em;\\n}\\n\\n.fa-sm {\\n font-size: 0.875em;\\n}\\n\\n.fa-1x {\\n font-size: 1em;\\n}\\n\\n.fa-2x {\\n font-size: 2em;\\n}\\n\\n.fa-3x {\\n font-size: 3em;\\n}\\n\\n.fa-4x {\\n font-size: 4em;\\n}\\n\\n.fa-5x {\\n font-size: 5em;\\n}\\n\\n.fa-6x {\\n font-size: 6em;\\n}\\n\\n.fa-7x {\\n font-size: 7em;\\n}\\n\\n.fa-8x {\\n font-size: 8em;\\n}\\n\\n.fa-9x {\\n font-size: 9em;\\n}\\n\\n.fa-10x {\\n font-size: 10em;\\n}\\n\\n.fa-fw {\\n text-align: center;\\n width: 1.25em;\\n}\\n\\n.fa-ul {\\n list-style-type: none;\\n margin-left: 2.5em;\\n padding-left: 0;\\n}\\n.fa-ul > li {\\n position: relative;\\n}\\n\\n.fa-li {\\n left: -2em;\\n position: absolute;\\n text-align: center;\\n width: 2em;\\n line-height: inherit;\\n}\\n\\n.fa-border {\\n border: solid 0.08em #eee;\\n border-radius: 0.1em;\\n padding: 0.2em 0.25em 0.15em;\\n}\\n\\n.fa-pull-left {\\n float: left;\\n}\\n\\n.fa-pull-right {\\n float: right;\\n}\\n\\n.fa.fa-pull-left,\\n.fas.fa-pull-left,\\n.far.fa-pull-left,\\n.fal.fa-pull-left,\\n.fab.fa-pull-left {\\n margin-right: 0.3em;\\n}\\n.fa.fa-pull-right,\\n.fas.fa-pull-right,\\n.far.fa-pull-right,\\n.fal.fa-pull-right,\\n.fab.fa-pull-right {\\n margin-left: 0.3em;\\n}\\n\\n.fa-spin {\\n -webkit-animation: fa-spin 2s infinite linear;\\n animation: fa-spin 2s infinite linear;\\n}\\n\\n.fa-pulse {\\n -webkit-animation: fa-spin 1s infinite steps(8);\\n animation: fa-spin 1s infinite steps(8);\\n}\\n\\n@-webkit-keyframes fa-spin {\\n 0% {\\n -webkit-transform: rotate(0deg);\\n transform: rotate(0deg);\\n }\\n 100% {\\n -webkit-transform: rotate(360deg);\\n transform: rotate(360deg);\\n }\\n}\\n\\n@keyframes fa-spin {\\n 0% {\\n -webkit-transform: rotate(0deg);\\n transform: rotate(0deg);\\n }\\n 100% {\\n -webkit-transform: rotate(360deg);\\n transform: rotate(360deg);\\n }\\n}\\n.fa-rotate-90 {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\\\";\\n -webkit-transform: rotate(90deg);\\n transform: rotate(90deg);\\n}\\n\\n.fa-rotate-180 {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\\\";\\n -webkit-transform: rotate(180deg);\\n transform: rotate(180deg);\\n}\\n\\n.fa-rotate-270 {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\\\";\\n -webkit-transform: rotate(270deg);\\n transform: rotate(270deg);\\n}\\n\\n.fa-flip-horizontal {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\\\";\\n -webkit-transform: scale(-1, 1);\\n transform: scale(-1, 1);\\n}\\n\\n.fa-flip-vertical {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";\\n -webkit-transform: scale(1, -1);\\n transform: scale(1, -1);\\n}\\n\\n.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {\\n -ms-filter: \\\"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\\\";\\n -webkit-transform: scale(-1, -1);\\n transform: scale(-1, -1);\\n}\\n\\n:root .fa-rotate-90,\\n:root .fa-rotate-180,\\n:root .fa-rotate-270,\\n:root .fa-flip-horizontal,\\n:root .fa-flip-vertical,\\n:root .fa-flip-both {\\n -webkit-filter: none;\\n filter: none;\\n}\\n\\n.fa-stack {\\n display: inline-block;\\n height: 2em;\\n position: relative;\\n width: 2.5em;\\n}\\n\\n.fa-stack-1x,\\n.fa-stack-2x {\\n bottom: 0;\\n left: 0;\\n margin: auto;\\n position: absolute;\\n right: 0;\\n top: 0;\\n}\\n\\n.svg-inline--fa.fa-stack-1x {\\n height: 1em;\\n width: 1.25em;\\n}\\n.svg-inline--fa.fa-stack-2x {\\n height: 2em;\\n width: 2.5em;\\n}\\n\\n.fa-inverse {\\n color: #fff;\\n}\\n\\n.sr-only {\\n border: 0;\\n clip: rect(0, 0, 0, 0);\\n height: 1px;\\n margin: -1px;\\n overflow: hidden;\\n padding: 0;\\n position: absolute;\\n width: 1px;\\n}\\n\\n.sr-only-focusable:active, .sr-only-focusable:focus {\\n clip: auto;\\n height: auto;\\n margin: 0;\\n overflow: visible;\\n position: static;\\n width: auto;\\n}\\n\\n.svg-inline--fa .fa-primary {\\n fill: var(--fa-primary-color, currentColor);\\n opacity: 1;\\n opacity: var(--fa-primary-opacity, 1);\\n}\\n\\n.svg-inline--fa .fa-secondary {\\n fill: var(--fa-secondary-color, currentColor);\\n opacity: 0.4;\\n opacity: var(--fa-secondary-opacity, 0.4);\\n}\\n\\n.svg-inline--fa.fa-swap-opacity .fa-primary {\\n opacity: 0.4;\\n opacity: var(--fa-secondary-opacity, 0.4);\\n}\\n\\n.svg-inline--fa.fa-swap-opacity .fa-secondary {\\n opacity: 1;\\n opacity: var(--fa-primary-opacity, 1);\\n}\\n\\n.svg-inline--fa mask .fa-primary,\\n.svg-inline--fa mask .fa-secondary {\\n fill: black;\\n}\\n\\n.fad.fa-inverse {\\n color: #fff;\\n}\";\n\nfunction css () {\n var dfp = DEFAULT_FAMILY_PREFIX;\n var drc = DEFAULT_REPLACEMENT_CLASS;\n var fp = config.familyPrefix;\n var rc = config.replacementClass;\n var s = baseStyles;\n\n if (fp !== dfp || rc !== drc) {\n var dPatt = new RegExp(\"\\\\.\".concat(dfp, \"\\\\-\"), 'g');\n var customPropPatt = new RegExp(\"\\\\--\".concat(dfp, \"\\\\-\"), 'g');\n var rPatt = new RegExp(\"\\\\.\".concat(drc), 'g');\n s = s.replace(dPatt, \".\".concat(fp, \"-\")).replace(customPropPatt, \"--\".concat(fp, \"-\")).replace(rPatt, \".\".concat(rc));\n }\n\n return s;\n}\n\nvar Library =\n/*#__PURE__*/\nfunction () {\n function Library() {\n _classCallCheck(this, Library);\n\n this.definitions = {};\n }\n\n _createClass(Library, [{\n key: \"add\",\n value: function add() {\n var _this = this;\n\n for (var _len = arguments.length, definitions = new Array(_len), _key = 0; _key < _len; _key++) {\n definitions[_key] = arguments[_key];\n }\n\n var additions = definitions.reduce(this._pullDefinitions, {});\n Object.keys(additions).forEach(function (key) {\n _this.definitions[key] = _objectSpread({}, _this.definitions[key] || {}, additions[key]);\n defineIcons(key, additions[key]);\n build();\n });\n }\n }, {\n key: \"reset\",\n value: function reset() {\n this.definitions = {};\n }\n }, {\n key: \"_pullDefinitions\",\n value: function _pullDefinitions(additions, definition) {\n var normalized = definition.prefix && definition.iconName && definition.icon ? {\n 0: definition\n } : definition;\n Object.keys(normalized).map(function (key) {\n var _normalized$key = normalized[key],\n prefix = _normalized$key.prefix,\n iconName = _normalized$key.iconName,\n icon = _normalized$key.icon;\n if (!additions[prefix]) additions[prefix] = {};\n additions[prefix][iconName] = icon;\n });\n return additions;\n }\n }]);\n\n return Library;\n}();\n\nfunction ensureCss() {\n if (config.autoAddCss && !_cssInserted) {\n insertCss(css());\n\n _cssInserted = true;\n }\n}\n\nfunction apiObject(val, abstractCreator) {\n Object.defineProperty(val, 'abstract', {\n get: abstractCreator\n });\n Object.defineProperty(val, 'html', {\n get: function get() {\n return val.abstract.map(function (a) {\n return toHtml(a);\n });\n }\n });\n Object.defineProperty(val, 'node', {\n get: function get() {\n if (!IS_DOM) return;\n var container = DOCUMENT.createElement('div');\n container.innerHTML = val.html;\n return container.children;\n }\n });\n return val;\n}\n\nfunction findIconDefinition(iconLookup) {\n var _iconLookup$prefix = iconLookup.prefix,\n prefix = _iconLookup$prefix === void 0 ? 'fa' : _iconLookup$prefix,\n iconName = iconLookup.iconName;\n if (!iconName) return;\n return iconFromMapping(library.definitions, prefix, iconName) || iconFromMapping(namespace.styles, prefix, iconName);\n}\n\nfunction resolveIcons(next) {\n return function (maybeIconDefinition) {\n var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var iconDefinition = (maybeIconDefinition || {}).icon ? maybeIconDefinition : findIconDefinition(maybeIconDefinition || {});\n var mask = params.mask;\n\n if (mask) {\n mask = (mask || {}).icon ? mask : findIconDefinition(mask || {});\n }\n\n return next(iconDefinition, _objectSpread({}, params, {\n mask: mask\n }));\n };\n}\n\nvar library = new Library();\nvar noAuto = function noAuto() {\n config.autoReplaceSvg = false;\n config.observeMutations = false;\n disconnect();\n};\nvar _cssInserted = false;\nvar dom = {\n i2svg: function i2svg() {\n var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n\n if (IS_DOM) {\n ensureCss();\n var _params$node = params.node,\n node = _params$node === void 0 ? DOCUMENT : _params$node,\n _params$callback = params.callback,\n callback = _params$callback === void 0 ? function () {} : _params$callback;\n\n if (config.searchPseudoElements) {\n searchPseudoElements(node);\n }\n\n return onTree(node, callback);\n } else {\n return picked.reject('Operation requires a DOM of some kind.');\n }\n },\n css: css,\n insertCss: function insertCss$$1() {\n if (!_cssInserted) {\n insertCss(css());\n\n _cssInserted = true;\n }\n },\n watch: function watch() {\n var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n var autoReplaceSvgRoot = params.autoReplaceSvgRoot,\n observeMutationsRoot = params.observeMutationsRoot;\n\n if (config.autoReplaceSvg === false) {\n config.autoReplaceSvg = true;\n }\n\n config.observeMutations = true;\n domready(function () {\n autoReplace({\n autoReplaceSvgRoot: autoReplaceSvgRoot\n });\n observe({\n treeCallback: onTree,\n nodeCallback: onNode,\n pseudoElementsCallback: searchPseudoElements,\n observeMutationsRoot: observeMutationsRoot\n });\n });\n }\n};\nvar parse = {\n transform: function transform(transformString) {\n return parseTransformString(transformString);\n }\n};\nvar icon = resolveIcons(function (iconDefinition) {\n var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var _params$transform = params.transform,\n transform = _params$transform === void 0 ? meaninglessTransform : _params$transform,\n _params$symbol = params.symbol,\n symbol = _params$symbol === void 0 ? false : _params$symbol,\n _params$mask = params.mask,\n mask = _params$mask === void 0 ? null : _params$mask,\n _params$title = params.title,\n title = _params$title === void 0 ? null : _params$title,\n _params$classes = params.classes,\n classes = _params$classes === void 0 ? [] : _params$classes,\n _params$attributes = params.attributes,\n attributes = _params$attributes === void 0 ? {} : _params$attributes,\n _params$styles = params.styles,\n styles = _params$styles === void 0 ? {} : _params$styles;\n if (!iconDefinition) return;\n var prefix = iconDefinition.prefix,\n iconName = iconDefinition.iconName,\n icon = iconDefinition.icon;\n return apiObject(_objectSpread({\n type: 'icon'\n }, iconDefinition), function () {\n ensureCss();\n\n if (config.autoA11y) {\n if (title) {\n attributes['aria-labelledby'] = \"\".concat(config.replacementClass, \"-title-\").concat(nextUniqueId());\n } else {\n attributes['aria-hidden'] = 'true';\n attributes['focusable'] = 'false';\n }\n }\n\n return makeInlineSvgAbstract({\n icons: {\n main: asFoundIcon(icon),\n mask: mask ? asFoundIcon(mask.icon) : {\n found: false,\n width: null,\n height: null,\n icon: {}\n }\n },\n prefix: prefix,\n iconName: iconName,\n transform: _objectSpread({}, meaninglessTransform, transform),\n symbol: symbol,\n title: title,\n extra: {\n attributes: attributes,\n styles: styles,\n classes: classes\n }\n });\n });\n});\nvar text = function text(content) {\n var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var _params$transform2 = params.transform,\n transform = _params$transform2 === void 0 ? meaninglessTransform : _params$transform2,\n _params$title2 = params.title,\n title = _params$title2 === void 0 ? null : _params$title2,\n _params$classes2 = params.classes,\n classes = _params$classes2 === void 0 ? [] : _params$classes2,\n _params$attributes2 = params.attributes,\n attributes = _params$attributes2 === void 0 ? {} : _params$attributes2,\n _params$styles2 = params.styles,\n styles = _params$styles2 === void 0 ? {} : _params$styles2;\n return apiObject({\n type: 'text',\n content: content\n }, function () {\n ensureCss();\n return makeLayersTextAbstract({\n content: content,\n transform: _objectSpread({}, meaninglessTransform, transform),\n title: title,\n extra: {\n attributes: attributes,\n styles: styles,\n classes: [\"\".concat(config.familyPrefix, \"-layers-text\")].concat(_toConsumableArray(classes))\n }\n });\n });\n};\nvar counter = function counter(content) {\n var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var _params$title3 = params.title,\n title = _params$title3 === void 0 ? null : _params$title3,\n _params$classes3 = params.classes,\n classes = _params$classes3 === void 0 ? [] : _params$classes3,\n _params$attributes3 = params.attributes,\n attributes = _params$attributes3 === void 0 ? {} : _params$attributes3,\n _params$styles3 = params.styles,\n styles = _params$styles3 === void 0 ? {} : _params$styles3;\n return apiObject({\n type: 'counter',\n content: content\n }, function () {\n ensureCss();\n return makeLayersCounterAbstract({\n content: content.toString(),\n title: title,\n extra: {\n attributes: attributes,\n styles: styles,\n classes: [\"\".concat(config.familyPrefix, \"-layers-counter\")].concat(_toConsumableArray(classes))\n }\n });\n });\n};\nvar layer = function layer(assembler) {\n var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n var _params$classes4 = params.classes,\n classes = _params$classes4 === void 0 ? [] : _params$classes4;\n return apiObject({\n type: 'layer'\n }, function () {\n ensureCss();\n var children = [];\n assembler(function (args) {\n Array.isArray(args) ? args.map(function (a) {\n children = children.concat(a.abstract);\n }) : children = children.concat(args.abstract);\n });\n return [{\n tag: 'span',\n attributes: {\n class: [\"\".concat(config.familyPrefix, \"-layers\")].concat(_toConsumableArray(classes)).join(' ')\n },\n children: children\n }];\n });\n};\nvar api = {\n noAuto: noAuto,\n config: config,\n dom: dom,\n library: library,\n parse: parse,\n findIconDefinition: findIconDefinition,\n icon: icon,\n text: text,\n counter: counter,\n layer: layer,\n toHtml: toHtml\n};\n\nvar autoReplace = function autoReplace() {\n var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n var _params$autoReplaceSv = params.autoReplaceSvgRoot,\n autoReplaceSvgRoot = _params$autoReplaceSv === void 0 ? DOCUMENT : _params$autoReplaceSv;\n if ((Object.keys(namespace.styles).length > 0 || config.autoFetchSvg) && IS_DOM && config.autoReplaceSvg) api.dom.i2svg({\n node: autoReplaceSvgRoot\n });\n};\n\nexport { icon, noAuto, config, toHtml, layer, text, counter, library, dom, parse, findIconDefinition };\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/@fortawesome/fontawesome-svg-core/index.es.js\n// module id = C/JF\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var nn = moment.defineLocale('nn', {\n months : 'januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember'.split('_'),\n monthsShort : 'jan_feb_mar_apr_mai_jun_jul_aug_sep_okt_nov_des'.split('_'),\n weekdays : 'sundag_måndag_tysdag_onsdag_torsdag_fredag_laurdag'.split('_'),\n weekdaysShort : 'sun_mån_tys_ons_tor_fre_lau'.split('_'),\n weekdaysMin : 'su_må_ty_on_to_fr_lø'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY [kl.] H:mm',\n LLLL : 'dddd D. MMMM YYYY [kl.] HH:mm'\n },\n calendar : {\n sameDay: '[I dag klokka] LT',\n nextDay: '[I morgon klokka] LT',\n nextWeek: 'dddd [klokka] LT',\n lastDay: '[I går klokka] LT',\n lastWeek: '[Føregåande] dddd [klokka] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'om %s',\n past : '%s sidan',\n s : 'nokre sekund',\n ss : '%d sekund',\n m : 'eit minutt',\n mm : '%d minutt',\n h : 'ein time',\n hh : '%d timar',\n d : 'ein dag',\n dd : '%d dagar',\n M : 'ein månad',\n MM : '%d månader',\n y : 'eit år',\n yy : '%d år'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return nn;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/nn.js\n// module id = C7av\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { BInputGroupAddon, commonProps } from './input-group-addon'; // @vue/component\n\nexport var BInputGroupPrepend =\n/*#__PURE__*/\nVue.extend({\n name: 'BInputGroupPrepend',\n functional: true,\n props: commonProps,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n // pass all our props/attrs down to child, and set`append` to false\n return h(BInputGroupAddon, mergeData(data, {\n props: _objectSpread({}, props, {\n append: false\n })\n }), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/input-group/input-group-prepend.js\n// module id = C8bk\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n function isFunction(input) {\n return input instanceof Function || Object.prototype.toString.call(input) === '[object Function]';\n }\n\n\n var el = moment.defineLocale('el', {\n monthsNominativeEl : 'Ιανουάριος_Φεβρουάριος_Μάρτιος_Απρίλιος_Μάιος_Ιούνιος_Ιούλιος_Αύγουστος_Σεπτέμβριος_Οκτώβριος_Νοέμβριος_Δεκέμβριος'.split('_'),\n monthsGenitiveEl : 'Ιανουαρίου_Φεβρουαρίου_Μαρτίου_Απριλίου_Μαΐου_Ιουνίου_Ιουλίου_Αυγούστου_Σεπτεμβρίου_Οκτωβρίου_Νοεμβρίου_Δεκεμβρίου'.split('_'),\n months : function (momentToFormat, format) {\n if (!momentToFormat) {\n return this._monthsNominativeEl;\n } else if (typeof format === 'string' && /D/.test(format.substring(0, format.indexOf('MMMM')))) { // if there is a day number before 'MMMM'\n return this._monthsGenitiveEl[momentToFormat.month()];\n } else {\n return this._monthsNominativeEl[momentToFormat.month()];\n }\n },\n monthsShort : 'Ιαν_Φεβ_Μαρ_Απρ_Μαϊ_Ιουν_Ιουλ_Αυγ_Σεπ_Οκτ_Νοε_Δεκ'.split('_'),\n weekdays : 'Κυριακή_Δευτέρα_Τρίτη_Τετάρτη_Πέμπτη_Παρασκευή_Σάββατο'.split('_'),\n weekdaysShort : 'Κυρ_Δευ_Τρι_Τετ_Πεμ_Παρ_Σαβ'.split('_'),\n weekdaysMin : 'Κυ_Δε_Τρ_Τε_Πε_Πα_Σα'.split('_'),\n meridiem : function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'μμ' : 'ΜΜ';\n } else {\n return isLower ? 'πμ' : 'ΠΜ';\n }\n },\n isPM : function (input) {\n return ((input + '').toLowerCase()[0] === 'μ');\n },\n meridiemParse : /[ΠΜ]\\.?Μ?\\.?/i,\n longDateFormat : {\n LT : 'h:mm A',\n LTS : 'h:mm:ss A',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY h:mm A',\n LLLL : 'dddd, D MMMM YYYY h:mm A'\n },\n calendarEl : {\n sameDay : '[Σήμερα {}] LT',\n nextDay : '[Αύριο {}] LT',\n nextWeek : 'dddd [{}] LT',\n lastDay : '[Χθες {}] LT',\n lastWeek : function () {\n switch (this.day()) {\n case 6:\n return '[το προηγούμενο] dddd [{}] LT';\n default:\n return '[την προηγούμενη] dddd [{}] LT';\n }\n },\n sameElse : 'L'\n },\n calendar : function (key, mom) {\n var output = this._calendarEl[key],\n hours = mom && mom.hours();\n if (isFunction(output)) {\n output = output.apply(mom);\n }\n return output.replace('{}', (hours % 12 === 1 ? 'στη' : 'στις'));\n },\n relativeTime : {\n future : 'σε %s',\n past : '%s πριν',\n s : 'λίγα δευτερόλεπτα',\n ss : '%d δευτερόλεπτα',\n m : 'ένα λεπτό',\n mm : '%d λεπτά',\n h : 'μία ώρα',\n hh : '%d ώρες',\n d : 'μία μέρα',\n dd : '%d μέρες',\n M : 'ένας μήνας',\n MM : '%d μήνες',\n y : 'ένας χρόνος',\n yy : '%d χρόνια'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}η/,\n ordinal: '%dη',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4st is the first week of the year.\n }\n });\n\n return el;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/el.js\n// module id = CFqe\n// module chunks = 0","import { BInputGroup } from './input-group';\nimport { BInputGroupAddon } from './input-group-addon';\nimport { BInputGroupPrepend } from './input-group-prepend';\nimport { BInputGroupAppend } from './input-group-append';\nimport { BInputGroupText } from './input-group-text';\nimport { pluginFactory } from '../../utils/plugins';\nvar InputGroupPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BInputGroup: BInputGroup,\n BInputGroupAddon: BInputGroupAddon,\n BInputGroupPrepend: BInputGroupPrepend,\n BInputGroupAppend: BInputGroupAppend,\n BInputGroupText: BInputGroupText\n }\n});\nexport { InputGroupPlugin, BInputGroup, BInputGroupAddon, BInputGroupPrepend, BInputGroupAppend, BInputGroupText };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/input-group/index.js\n// module id = CLQ2\n// module chunks = 0","var metric\n , imperial;\n\nmetric = {\n 'm/s': {\n name: {\n singular: 'Metre per second'\n , plural: 'Metres per second'\n }\n , to_anchor: 3.6\n }\n, 'km/h': {\n name: {\n singular: 'Kilometre per hour'\n , plural: 'Kilometres per hour'\n }\n , to_anchor: 1\n }\n}\n\n imperial = {\n 'm/h': {\n name: {\n singular: 'Mile per hour'\n , plural: 'Miles per hour'\n }\n , to_anchor: 1\n }\n , knot: {\n name: {\n singular: 'Knot'\n , plural: 'Knots'\n }\n , to_anchor: 1.150779\n }\n , 'ft/s': {\n name: {\n singular: 'Foot per second'\n , plural: 'Feet per second'\n }\n , to_anchor: 0.681818\n }\n};\n\nmodule.exports = {\n metric: metric\n, imperial: imperial\n, _anchors: {\n metric: {\n unit: 'km/h'\n , ratio: 1/1.609344\n }\n , imperial: {\n unit: 'm/h'\n , ratio: 1.609344\n }\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/convert-units/lib/definitions/speed.js\n// module id = CRqz\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport idMixin from '../../mixins/id';\nimport formMixin from '../../mixins/form';\nimport formSizeMixin from '../../mixins/form-size';\nimport formStateMixin from '../../mixins/form-state';\nimport formTextMixin from '../../mixins/form-text';\nimport formSelectionMixin from '../../mixins/form-selection';\nimport formValidityMixin from '../../mixins/form-validity';\nimport { arrayIncludes } from '../../utils/array';\nimport { eventOn, eventOff } from '../../utils/dom'; // Valid supported input types\n\nvar TYPES = ['text', 'password', 'email', 'number', 'url', 'tel', 'search', 'range', 'color', 'date', 'time', 'datetime', 'datetime-local', 'month', 'week']; // @vue/component\n\nexport var BFormInput =\n/*#__PURE__*/\nVue.extend({\n name: 'BFormInput',\n mixins: [idMixin, formMixin, formSizeMixin, formStateMixin, formTextMixin, formSelectionMixin, formValidityMixin],\n props: {\n // value prop defined in form-text mixin\n // value: { },\n type: {\n type: String,\n default: 'text',\n validator: function validator(type) {\n return arrayIncludes(TYPES, type);\n }\n },\n noWheel: {\n // Disable mousewheel to prevent wheel from changing values (i.e. number/date).\n type: Boolean,\n default: false\n },\n min: {\n type: [String, Number],\n default: null\n },\n max: {\n type: [String, Number],\n default: null\n },\n step: {\n type: [String, Number],\n default: null\n },\n list: {\n type: String,\n default: null\n }\n },\n computed: {\n localType: function localType() {\n // We only allow certain types\n return arrayIncludes(TYPES, this.type) ? this.type : 'text';\n }\n },\n watch: {\n noWheel: function noWheel(newVal) {\n this.setWheelStopper(newVal);\n }\n },\n mounted: function mounted() {\n this.setWheelStopper(this.noWheel);\n },\n deactivated: function deactivated() {\n // Turn off listeners when keep-alive component deactivated\n\n /* istanbul ignore next */\n this.setWheelStopper(false);\n },\n activated: function activated() {\n // Turn on listeners (if no-wheel) when keep-alive component activated\n\n /* istanbul ignore next */\n this.setWheelStopper(this.noWheel);\n },\n beforeDestroy: function beforeDestroy() {\n /* istanbul ignore next */\n this.setWheelStopper(false);\n },\n methods: {\n setWheelStopper: function setWheelStopper(on) {\n var input = this.$el; // We use native events, so that we don't interfere with propgation\n\n if (on) {\n eventOn(input, 'focus', this.onWheelFocus);\n eventOn(input, 'blur', this.onWheelBlur);\n } else {\n eventOff(input, 'focus', this.onWheelFocus);\n eventOff(input, 'blur', this.onWheelBlur);\n eventOff(document, 'wheel', this.stopWheel);\n }\n },\n onWheelFocus: function onWheelFocus(evt) {\n eventOn(document, 'wheel', this.stopWheel);\n },\n onWheelBlur: function onWheelBlur(evt) {\n eventOff(document, 'wheel', this.stopWheel);\n },\n stopWheel: function stopWheel(evt) {\n evt.preventDefault();\n this.$el.blur();\n }\n },\n render: function render(h) {\n var self = this;\n return h('input', {\n ref: 'input',\n class: self.computedClass,\n directives: [{\n name: 'model',\n rawName: 'v-model',\n value: self.localValue,\n expression: 'localValue'\n }],\n attrs: {\n id: self.safeId(),\n name: self.name,\n form: self.form || null,\n type: self.localType,\n disabled: self.disabled,\n placeholder: self.placeholder,\n required: self.required,\n autocomplete: self.autocomplete || null,\n readonly: self.readonly || self.plaintext,\n min: self.min,\n max: self.max,\n step: self.step,\n list: self.localType !== 'password' ? self.list : null,\n 'aria-required': self.required ? 'true' : null,\n 'aria-invalid': self.computedAriaInvalid\n },\n domProps: {\n value: self.localValue\n },\n on: _objectSpread({}, self.$listeners, {\n input: self.onInput,\n change: self.onChange,\n blur: self.onBlur\n })\n });\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-input/form-input.js\n// module id = CWYK\n// module chunks = 0","'use strict';\nvar LIBRARY = require('./_library');\nvar global = require('./_global');\nvar ctx = require('./_ctx');\nvar classof = require('./_classof');\nvar $export = require('./_export');\nvar isObject = require('./_is-object');\nvar aFunction = require('./_a-function');\nvar anInstance = require('./_an-instance');\nvar forOf = require('./_for-of');\nvar speciesConstructor = require('./_species-constructor');\nvar task = require('./_task').set;\nvar microtask = require('./_microtask')();\nvar newPromiseCapabilityModule = require('./_new-promise-capability');\nvar perform = require('./_perform');\nvar userAgent = require('./_user-agent');\nvar promiseResolve = require('./_promise-resolve');\nvar PROMISE = 'Promise';\nvar TypeError = global.TypeError;\nvar process = global.process;\nvar versions = process && process.versions;\nvar v8 = versions && versions.v8 || '';\nvar $Promise = global[PROMISE];\nvar isNode = classof(process) == 'process';\nvar empty = function () { /* empty */ };\nvar Internal, newGenericPromiseCapability, OwnPromiseCapability, Wrapper;\nvar newPromiseCapability = newGenericPromiseCapability = newPromiseCapabilityModule.f;\n\nvar USE_NATIVE = !!function () {\n try {\n // correct subclassing with @@species support\n var promise = $Promise.resolve(1);\n var FakePromise = (promise.constructor = {})[require('./_wks')('species')] = function (exec) {\n exec(empty, empty);\n };\n // unhandled rejections tracking support, NodeJS Promise without it fails @@species test\n return (isNode || typeof PromiseRejectionEvent == 'function')\n && promise.then(empty) instanceof FakePromise\n // v8 6.6 (Node 10 and Chrome 66) have a bug with resolving custom thenables\n // https://bugs.chromium.org/p/chromium/issues/detail?id=830565\n // we can't detect it synchronously, so just check versions\n && v8.indexOf('6.6') !== 0\n && userAgent.indexOf('Chrome/66') === -1;\n } catch (e) { /* empty */ }\n}();\n\n// helpers\nvar isThenable = function (it) {\n var then;\n return isObject(it) && typeof (then = it.then) == 'function' ? then : false;\n};\nvar notify = function (promise, isReject) {\n if (promise._n) return;\n promise._n = true;\n var chain = promise._c;\n microtask(function () {\n var value = promise._v;\n var ok = promise._s == 1;\n var i = 0;\n var run = function (reaction) {\n var handler = ok ? reaction.ok : reaction.fail;\n var resolve = reaction.resolve;\n var reject = reaction.reject;\n var domain = reaction.domain;\n var result, then, exited;\n try {\n if (handler) {\n if (!ok) {\n if (promise._h == 2) onHandleUnhandled(promise);\n promise._h = 1;\n }\n if (handler === true) result = value;\n else {\n if (domain) domain.enter();\n result = handler(value); // may throw\n if (domain) {\n domain.exit();\n exited = true;\n }\n }\n if (result === reaction.promise) {\n reject(TypeError('Promise-chain cycle'));\n } else if (then = isThenable(result)) {\n then.call(result, resolve, reject);\n } else resolve(result);\n } else reject(value);\n } catch (e) {\n if (domain && !exited) domain.exit();\n reject(e);\n }\n };\n while (chain.length > i) run(chain[i++]); // variable length - can't use forEach\n promise._c = [];\n promise._n = false;\n if (isReject && !promise._h) onUnhandled(promise);\n });\n};\nvar onUnhandled = function (promise) {\n task.call(global, function () {\n var value = promise._v;\n var unhandled = isUnhandled(promise);\n var result, handler, console;\n if (unhandled) {\n result = perform(function () {\n if (isNode) {\n process.emit('unhandledRejection', value, promise);\n } else if (handler = global.onunhandledrejection) {\n handler({ promise: promise, reason: value });\n } else if ((console = global.console) && console.error) {\n console.error('Unhandled promise rejection', value);\n }\n });\n // Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should\n promise._h = isNode || isUnhandled(promise) ? 2 : 1;\n } promise._a = undefined;\n if (unhandled && result.e) throw result.v;\n });\n};\nvar isUnhandled = function (promise) {\n return promise._h !== 1 && (promise._a || promise._c).length === 0;\n};\nvar onHandleUnhandled = function (promise) {\n task.call(global, function () {\n var handler;\n if (isNode) {\n process.emit('rejectionHandled', promise);\n } else if (handler = global.onrejectionhandled) {\n handler({ promise: promise, reason: promise._v });\n }\n });\n};\nvar $reject = function (value) {\n var promise = this;\n if (promise._d) return;\n promise._d = true;\n promise = promise._w || promise; // unwrap\n promise._v = value;\n promise._s = 2;\n if (!promise._a) promise._a = promise._c.slice();\n notify(promise, true);\n};\nvar $resolve = function (value) {\n var promise = this;\n var then;\n if (promise._d) return;\n promise._d = true;\n promise = promise._w || promise; // unwrap\n try {\n if (promise === value) throw TypeError(\"Promise can't be resolved itself\");\n if (then = isThenable(value)) {\n microtask(function () {\n var wrapper = { _w: promise, _d: false }; // wrap\n try {\n then.call(value, ctx($resolve, wrapper, 1), ctx($reject, wrapper, 1));\n } catch (e) {\n $reject.call(wrapper, e);\n }\n });\n } else {\n promise._v = value;\n promise._s = 1;\n notify(promise, false);\n }\n } catch (e) {\n $reject.call({ _w: promise, _d: false }, e); // wrap\n }\n};\n\n// constructor polyfill\nif (!USE_NATIVE) {\n // 25.4.3.1 Promise(executor)\n $Promise = function Promise(executor) {\n anInstance(this, $Promise, PROMISE, '_h');\n aFunction(executor);\n Internal.call(this);\n try {\n executor(ctx($resolve, this, 1), ctx($reject, this, 1));\n } catch (err) {\n $reject.call(this, err);\n }\n };\n // eslint-disable-next-line no-unused-vars\n Internal = function Promise(executor) {\n this._c = []; // <- awaiting reactions\n this._a = undefined; // <- checked in isUnhandled reactions\n this._s = 0; // <- state\n this._d = false; // <- done\n this._v = undefined; // <- value\n this._h = 0; // <- rejection state, 0 - default, 1 - handled, 2 - unhandled\n this._n = false; // <- notify\n };\n Internal.prototype = require('./_redefine-all')($Promise.prototype, {\n // 25.4.5.3 Promise.prototype.then(onFulfilled, onRejected)\n then: function then(onFulfilled, onRejected) {\n var reaction = newPromiseCapability(speciesConstructor(this, $Promise));\n reaction.ok = typeof onFulfilled == 'function' ? onFulfilled : true;\n reaction.fail = typeof onRejected == 'function' && onRejected;\n reaction.domain = isNode ? process.domain : undefined;\n this._c.push(reaction);\n if (this._a) this._a.push(reaction);\n if (this._s) notify(this, false);\n return reaction.promise;\n },\n // 25.4.5.1 Promise.prototype.catch(onRejected)\n 'catch': function (onRejected) {\n return this.then(undefined, onRejected);\n }\n });\n OwnPromiseCapability = function () {\n var promise = new Internal();\n this.promise = promise;\n this.resolve = ctx($resolve, promise, 1);\n this.reject = ctx($reject, promise, 1);\n };\n newPromiseCapabilityModule.f = newPromiseCapability = function (C) {\n return C === $Promise || C === Wrapper\n ? new OwnPromiseCapability(C)\n : newGenericPromiseCapability(C);\n };\n}\n\n$export($export.G + $export.W + $export.F * !USE_NATIVE, { Promise: $Promise });\nrequire('./_set-to-string-tag')($Promise, PROMISE);\nrequire('./_set-species')(PROMISE);\nWrapper = require('./_core')[PROMISE];\n\n// statics\n$export($export.S + $export.F * !USE_NATIVE, PROMISE, {\n // 25.4.4.5 Promise.reject(r)\n reject: function reject(r) {\n var capability = newPromiseCapability(this);\n var $$reject = capability.reject;\n $$reject(r);\n return capability.promise;\n }\n});\n$export($export.S + $export.F * (LIBRARY || !USE_NATIVE), PROMISE, {\n // 25.4.4.6 Promise.resolve(x)\n resolve: function resolve(x) {\n return promiseResolve(LIBRARY && this === Wrapper ? $Promise : this, x);\n }\n});\n$export($export.S + $export.F * !(USE_NATIVE && require('./_iter-detect')(function (iter) {\n $Promise.all(iter)['catch'](empty);\n})), PROMISE, {\n // 25.4.4.1 Promise.all(iterable)\n all: function all(iterable) {\n var C = this;\n var capability = newPromiseCapability(C);\n var resolve = capability.resolve;\n var reject = capability.reject;\n var result = perform(function () {\n var values = [];\n var index = 0;\n var remaining = 1;\n forOf(iterable, false, function (promise) {\n var $index = index++;\n var alreadyCalled = false;\n values.push(undefined);\n remaining++;\n C.resolve(promise).then(function (value) {\n if (alreadyCalled) return;\n alreadyCalled = true;\n values[$index] = value;\n --remaining || resolve(values);\n }, reject);\n });\n --remaining || resolve(values);\n });\n if (result.e) reject(result.v);\n return capability.promise;\n },\n // 25.4.4.4 Promise.race(iterable)\n race: function race(iterable) {\n var C = this;\n var capability = newPromiseCapability(C);\n var reject = capability.reject;\n var result = perform(function () {\n forOf(iterable, false, function (promise) {\n C.resolve(promise).then(capability.resolve, reject);\n });\n });\n if (result.e) reject(result.v);\n return capability.promise;\n }\n});\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/es6.promise.js\n// module id = CXw9\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n function translate(number, withoutSuffix, key, isFuture) {\n switch (key) {\n case 's':\n return withoutSuffix ? 'хэдхэн секунд' : 'хэдхэн секундын';\n case 'ss':\n return number + (withoutSuffix ? ' секунд' : ' секундын');\n case 'm':\n case 'mm':\n return number + (withoutSuffix ? ' минут' : ' минутын');\n case 'h':\n case 'hh':\n return number + (withoutSuffix ? ' цаг' : ' цагийн');\n case 'd':\n case 'dd':\n return number + (withoutSuffix ? ' өдөр' : ' өдрийн');\n case 'M':\n case 'MM':\n return number + (withoutSuffix ? ' сар' : ' сарын');\n case 'y':\n case 'yy':\n return number + (withoutSuffix ? ' жил' : ' жилийн');\n default:\n return number;\n }\n }\n\n var mn = moment.defineLocale('mn', {\n months : 'Нэгдүгээр сар_Хоёрдугаар сар_Гуравдугаар сар_Дөрөвдүгээр сар_Тавдугаар сар_Зургадугаар сар_Долдугаар сар_Наймдугаар сар_Есдүгээр сар_Аравдугаар сар_Арван нэгдүгээр сар_Арван хоёрдугаар сар'.split('_'),\n monthsShort : '1 сар_2 сар_3 сар_4 сар_5 сар_6 сар_7 сар_8 сар_9 сар_10 сар_11 сар_12 сар'.split('_'),\n monthsParseExact : true,\n weekdays : 'Ням_Даваа_Мягмар_Лхагва_Пүрэв_Баасан_Бямба'.split('_'),\n weekdaysShort : 'Ням_Дав_Мяг_Лха_Пүр_Баа_Бям'.split('_'),\n weekdaysMin : 'Ня_Да_Мя_Лх_Пү_Ба_Бя'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'YYYY-MM-DD',\n LL : 'YYYY оны MMMMын D',\n LLL : 'YYYY оны MMMMын D HH:mm',\n LLLL : 'dddd, YYYY оны MMMMын D HH:mm'\n },\n meridiemParse: /ҮӨ|ҮХ/i,\n isPM : function (input) {\n return input === 'ҮХ';\n },\n meridiem : function (hour, minute, isLower) {\n if (hour < 12) {\n return 'ҮӨ';\n } else {\n return 'ҮХ';\n }\n },\n calendar : {\n sameDay : '[Өнөөдөр] LT',\n nextDay : '[Маргааш] LT',\n nextWeek : '[Ирэх] dddd LT',\n lastDay : '[Өчигдөр] LT',\n lastWeek : '[Өнгөрсөн] dddd LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%s дараа',\n past : '%s өмнө',\n s : translate,\n ss : translate,\n m : translate,\n mm : translate,\n h : translate,\n hh : translate,\n d : translate,\n dd : translate,\n M : translate,\n MM : translate,\n y : translate,\n yy : translate\n },\n dayOfMonthOrdinalParse: /\\d{1,2} өдөр/,\n ordinal : function (number, period) {\n switch (period) {\n case 'd':\n case 'D':\n case 'DDD':\n return number + ' өдөр';\n default:\n return number;\n }\n }\n });\n\n return mn;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/mn.js\n// module id = CqHt\n// module chunks = 0","/*\n * Consistent and stable sort function across JavaScript platforms\n *\n * Inconsistent sorts can cause SSR problems between client and server\n * such as in if sortBy is applied to the data on server side render.\n * Chrome and V8 native sorts are inconsistent/unstable\n *\n * This function uses native sort with fallback to index compare when the a and b\n * compare returns 0\n *\n * Algorithm based on:\n * https://stackoverflow.com/questions/1427608/fast-stable-sorting-algorithm-implementation-in-javascript/45422645#45422645\n *\n * @param {array} array to sort\n * @param {function} sort compare function\n * @return {array}\n */\nvar stableSort = function stableSort(array, compareFn) {\n // Using `.bind(compareFn)` on the wrapped anonymous function improves\n // performance by avoiding the function call setup. We don't use an arrow\n // function here as it binds `this` to the `stableSort` context rather than\n // the `compareFn` context, which wouldn't give us the performance increase.\n return array.map(function (a, index) {\n return [index, a];\n }).sort(function (a, b) {\n return this(a[1], b[1]) || a[0] - b[0];\n }.bind(compareFn)).map(function (e) {\n return e[1];\n });\n};\n\nexport default stableSort;\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/utils/stable-sort.js\n// module id = Cu+j\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\n// Tooltip \"Class\" (Built as a renderless Vue instance)\n//\n// Handles trigger events, etc.\n// Instantiates template on demand\nimport Vue from '../../../utils/vue';\nimport getScopId from '../../../utils/get-scope-id';\nimport looseEqual from '../../../utils/loose-equal';\nimport { arrayIncludes, concat, from as arrayFrom } from '../../../utils/array';\nimport { isElement, isDisabled, isVisible, closest, select, getById, hasClass, getAttr, hasAttr, setAttr, removeAttr, eventOn, eventOff } from '../../../utils/dom';\nimport { isFunction, isNumber, isPlainObject, isString, isUndefined } from '../../../utils/inspect';\nimport { keys } from '../../../utils/object';\nimport { warn } from '../../../utils/warn';\nimport { BvEvent } from '../../../utils/bv-event.class';\nimport { BVTooltipTemplate } from './bv-tooltip-template';\nvar NAME = 'BVTooltip'; // Modal container selector for appending tooltip/popover\n\nvar MODAL_SELECTOR = '.modal-content'; // Modal `$root` hidden event\n\nvar MODAL_CLOSE_EVENT = 'bv::modal::hidden'; // For dropdown sniffing\n\nvar DROPDOWN_CLASS = 'dropdown';\nvar DROPDOWN_OPEN_SELECTOR = '.dropdown-menu.show'; // Options for Native Event Listeners (since we never call preventDefault)\n\nvar EvtOpts = {\n passive: true,\n capture: false // Data specific to popper and template\n // We don't use props, as we need reactivity (we can't pass reactive props)\n\n};\nvar templateData = {\n // Text string or Scoped slot function\n title: '',\n // Text string or Scoped slot function\n content: '',\n // String\n variant: null,\n // String, Array, Object\n customClass: null,\n // String or array of Strings (overwritten by BVPopper)\n triggers: '',\n // String (overwritten by BVPopper)\n placement: 'auto',\n // String or array of strings\n fallbackPlacement: 'flip',\n // Element or Component reference (or function that returns element) of\n // the element that will have the trigger events bound, and is also\n // default element for positioning\n target: null,\n // HTML ID, Element or Component reference\n container: null,\n // 'body'\n // Boolean\n noFade: false,\n // 'scrollParent', 'viewport', 'window', Element, or Component reference\n boundary: 'scrollParent',\n // Tooltip/popover will try and stay away from\n // boundary edge by this many pixels (Number)\n boundaryPadding: 5,\n // Arrow offset (Number)\n offset: 0,\n // Hover/focus delay (Number or Object)\n delay: 0,\n // Arrow of Tooltip/popover will try and stay away from\n // the edge of tooltip/popover edge by this many pixels\n arrowPadding: 6,\n // Disabled state (Boolean)\n disabled: false,\n // ID to use for tooltip/popover\n id: null,\n // Flag used by directives only, for HTML content\n html: false // @vue/component\n\n};\nexport var BVTooltip =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n props: {// None\n },\n data: function data() {\n return _objectSpread({}, templateData, {\n // State management data\n activeTrigger: {\n // manual: false,\n hover: false,\n click: false,\n focus: false\n },\n localShow: false\n });\n },\n computed: {\n templateType: function templateType() {\n // Overwritten by BVPopover\n return 'tooltip';\n },\n computedId: function computedId() {\n return this.id || \"__bv_\".concat(this.templateType, \"_\").concat(this._uid, \"__\");\n },\n computedDelay: function computedDelay() {\n // Normalizes delay into object form\n var delay = {\n show: 0,\n hide: 0\n };\n\n if (isPlainObject(this.delay)) {\n delay.show = Math.max(parseInt(this.delay.show, 10) || 0, 0);\n delay.hide = Math.max(parseInt(this.delay.hide, 10) || 0, 0);\n } else if (isNumber(this.delay) || isString(this.delay)) {\n delay.show = delay.hide = Math.max(parseInt(this.delay, 10) || 0, 0);\n }\n\n return delay;\n },\n computedTriggers: function computedTriggers() {\n // Returns the triggers in sorted array form\n // TODO: Switch this to object form for easier lookup\n return concat(this.triggers).filter(Boolean).join(' ').trim().toLowerCase().split(/\\s+/).sort();\n },\n isWithActiveTrigger: function isWithActiveTrigger() {\n for (var trigger in this.activeTrigger) {\n if (this.activeTrigger[trigger]) {\n return true;\n }\n }\n\n return false;\n },\n computedTemplateData: function computedTemplateData() {\n return {\n title: this.title,\n content: this.content,\n variant: this.variant,\n customClass: this.customClass,\n noFade: this.noFade\n };\n }\n },\n watch: {\n computedTriggers: function computedTriggers(newTriggers, oldTriggers) {\n var _this = this;\n\n // Triggers have changed, so re-register them\n\n /* istanbul ignore next */\n if (!looseEqual(newTriggers, oldTriggers)) {\n this.$nextTick(function () {\n // Disable trigger listeners\n _this.unListen(); // Clear any active triggers that are no longer in the list of triggers\n\n\n oldTriggers.forEach(function (trigger) {\n if (!arrayIncludes(newTriggers, trigger)) {\n if (_this.activeTrigger[trigger]) {\n _this.activeTrigger[trigger] = false;\n }\n }\n }); // Re-enable the trigger listeners\n\n _this.listen();\n });\n }\n },\n computedTemplateData: function computedTemplateData() {\n // If any of the while open reactive \"props\" change,\n // ensure that the template updates accordingly\n this.handleTemplateUpdate();\n },\n disabled: function disabled(newVal) {\n newVal ? this.disable() : this.enable();\n }\n },\n created: function created() {\n var _this2 = this;\n\n // Create non-reactive properties\n this.$_tip = null;\n this.$_hoverTimeout = null;\n this.$_hoverState = '';\n this.$_visibleInterval = null;\n this.$_enabled = !this.disabled;\n\n this.$_noop = function () {}; // Destroy ourselves when the parent is destroyed\n\n\n if (this.$parent) {\n this.$parent.$once('hook:beforeDestroy', this.$destroy);\n }\n\n this.$nextTick(function () {\n var target = _this2.getTarget();\n\n if (target && document.contains(target)) {\n // Copy the parent's scoped style attribute\n _this2.scopeId = getScopId(_this2.$parent); // Set up all trigger handlers and listeners\n\n _this2.listen();\n } else {\n /* istanbul ignore next */\n warn(\"\".concat(_this2.templateType, \" unable to find target element in document\"));\n }\n });\n },\n updated: function updated()\n /* istanbul ignore next */\n {\n // Usually called when the slots/data changes\n this.$nextTick(this.handleTemplateUpdate);\n },\n deactivated: function deactivated()\n /* istanbul ignore next */\n {\n // In a keepalive that has been deactivated, so hide\n // the tooltip/popover if it is showing\n this.forceHide();\n },\n beforeDestroy: function beforeDestroy()\n /* istanbul ignore next */\n {\n // Remove all handler/listeners\n this.unListen();\n this.setWhileOpenListeners(false); // Clear any timeouts/Timers\n\n clearTimeout(this.$_hoverTimeout);\n this.$_hoverTimeout = null;\n this.destroyTemplate();\n this.restoreTitle();\n },\n methods: {\n //\n // Methods for creating and destroying the template\n //\n getTemplate: function getTemplate() {\n // Overridden by BVPopover\n return BVTooltipTemplate;\n },\n updateData: function updateData() {\n var _this3 = this;\n\n var data = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n // Method for updating popper/template data\n // We only update data if it exists, and has not changed\n var titleUpdated = false;\n keys(templateData).forEach(function (prop) {\n if (!isUndefined(data[prop]) && _this3[prop] !== data[prop]) {\n _this3[prop] = data[prop];\n\n if (prop === 'title') {\n titleUpdated = true;\n }\n }\n });\n\n if (titleUpdated && this.localShow) {\n // If the title has updated, we may need to handle the title\n // attribute on the trigger target. We only do this while the\n // template is open\n this.fixTitle();\n }\n },\n createTemplateAndShow: function createTemplateAndShow() {\n // Creates the template instance and show it\n // this.destroyTemplate()\n var container = this.getContainer();\n var Template = this.getTemplate();\n var $tip = this.$_tip = new Template({\n parent: this,\n // The following is not reactive to changes in the props data\n propsData: {\n // These values cannot be changed while template is showing\n id: this.computedId,\n html: this.html,\n placement: this.placement,\n fallbackPlacement: this.fallbackPlacement,\n offset: this.offset,\n arrowPadding: this.arrowPadding,\n boundaryPadding: this.boundaryPadding,\n boundary: this.getBoundary(),\n target: this.getPlacementTarget()\n }\n }); // We set the initial reactive data (values that can be changed while open)\n\n this.handleTemplateUpdate(); // Template transition phase events (handled once only)\n // When the template has mounted, but not visibly shown yet\n\n $tip.$once('show', this.onTemplateShow); // When the template has completed showing\n\n $tip.$once('shown', this.onTemplateShown); // When the template has started to hide\n\n $tip.$once('hide', this.onTemplateHide); // When the template has completed hiding\n\n $tip.$once('hidden', this.onTemplateHidden); // When the template gets destroyed for any reason\n\n $tip.$once('hook:destroyed', this.destroyTemplate); // Convenience events from template\n // To save us from manually adding/removing DOM\n // listeners to tip element when it is open\n\n $tip.$on('focusin', this.handleEvent);\n $tip.$on('focusout', this.handleEvent);\n $tip.$on('mouseenter', this.handleEvent);\n $tip.$on('mouseleave', this.handleEvent); // Mount (which triggers the `show`)\n\n $tip.$mount(container.appendChild(document.createElement('div'))); // Template will automatically remove its markup from DOM when hidden\n },\n hideTemplate: function hideTemplate() {\n // Trigger the template to start hiding\n // The template will emit the `hide` event after this and\n // then emit the `hidden` event once it is fully hidden\n // The `hook:destroyed` will also be called (safety measure)\n this.$_tip && this.$_tip.hide();\n },\n destroyTemplate: function destroyTemplate() {\n // Destroy the template instance and reset state\n this.setWhileOpenListeners(false);\n clearTimeout(this.$_hoverTimeout);\n this.$_hoverTimout = null;\n this.$_hoverState = '';\n this.clearActiveTriggers();\n this.localPlacementTarget = null;\n\n try {\n this.$_tip && this.$_tip.$destroy();\n } catch (_unused) {}\n\n this.$_tip = null;\n this.localShow = false;\n },\n getTemplateElement: function getTemplateElement() {\n return this.$_tip ? this.$_tip.$el : null;\n },\n handleTemplateUpdate: function handleTemplateUpdate() {\n var _this4 = this;\n\n // Update our template title/content \"props\"\n // So that the template updates accordingly\n var $tip = this.$_tip;\n\n if ($tip) {\n var props = ['title', 'content', 'variant', 'customClass', 'noFade']; // Only update the values if they have changed\n\n props.forEach(function (prop) {\n if ($tip[prop] !== _this4[prop]) {\n $tip[prop] = _this4[prop];\n }\n });\n }\n },\n //\n // Show and Hide handlers\n //\n show: function show() {\n // Show the tooltip\n var target = this.getTarget();\n\n if (!target || !document.body.contains(target) || !isVisible(target) || this.dropdownOpen()) {\n // If trigger element isn't in the DOM or is not visible, or is on an open dropdown toggle\n return;\n }\n\n if (this.$_tip || this.localShow) {\n // If tip already exists, exit early\n\n /* istanbul ignore next */\n return;\n } // In the process of showing\n\n\n this.localShow = true; // Create a cancelable BvEvent\n\n var showEvt = this.buildEvent('show', {\n cancelable: true\n });\n this.emitEvent(showEvt);\n /* istanbul ignore next: ignore for now */\n\n if (showEvt.defaultPrevented) {\n // Don't show if event cancelled\n // Destroy the template (if for some reason it was created)\n\n /* istanbul ignore next */\n this.destroyTemplate(); // Clear the localShow flag\n\n /* istanbul ignore next */\n\n this.localShow = false;\n /* istanbul ignore next */\n\n return;\n } // Fix the title attribute on target\n\n\n this.fixTitle(); // Set aria-describedby on target\n\n this.addAriaDescribedby(); // Create and show the tooltip\n\n this.createTemplateAndShow();\n },\n hide: function hide() {\n var force = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n // Hide the tooltip\n var tip = this.getTemplateElement();\n\n if (!tip || !this.localShow) {\n /* istanbul ignore next */\n return;\n } // Emit cancelable BvEvent 'hide'\n // We disable cancelling if `force` is true\n\n\n var hideEvt = this.buildEvent('hide', {\n cancelable: !force\n });\n this.emitEvent(hideEvt);\n /* istanbul ignore next: ignore for now */\n\n if (hideEvt.defaultPrevented) {\n // Don't hide if event cancelled\n return;\n } // Tell the template to hide\n\n\n this.hideTemplate(); // TODO: The following could be added to `hideTemplate()`\n // Clear out any stragging active triggers\n\n this.clearActiveTriggers(); // Reset the hover state\n\n this.$_hoverState = '';\n },\n forceHide: function forceHide() {\n // Forcefully hides/destroys the template, regardless of any active triggers\n var tip = this.getTemplateElement();\n\n if (!tip || !this.localShow) {\n /* istanbul ignore next */\n return;\n } // Disable while open listeners/watchers\n // This is also done in the template `hide` evt handler\n\n\n this.setWhileOpenListeners(false); // Clear any hover enter/leave event\n\n clearTimeout(this.hoverTimeout);\n this.$_hoverTimeout = null;\n this.$_hoverState = '';\n this.clearActiveTriggers(); // Disable the fade animation on the template\n\n if (this.$_tip) {\n this.$_tip.noFade = true;\n } // Hide the tip (with force = true)\n\n\n this.hide(true);\n },\n enable: function enable() {\n this.$_enabled = true; // Create a non-cancelable BvEvent\n\n this.emitEvent(this.buildEvent('enabled', {}));\n },\n disable: function disable() {\n this.$_enabled = false; // Create a non-cancelable BvEvent\n\n this.emitEvent(this.buildEvent('disabled', {}));\n },\n //\n // Handlers for template events\n //\n onTemplateShow: function onTemplateShow() {\n // When template is inserted into DOM, but not yet shown\n // Enable while open listeners/watchers\n this.setWhileOpenListeners(true);\n },\n onTemplateShown: function onTemplateShown() {\n // When template show transition completes\n var prevHoverState = this.$_hoverState;\n this.$_hoverState = '';\n\n if (prevHoverState === 'out') {\n this.leave(null);\n } // Emit a non-cancelable BvEvent 'shown'\n\n\n this.emitEvent(this.buildEvent('shown', {}));\n },\n onTemplateHide: function onTemplateHide() {\n // When template is starting to hide\n // Disable while open listeners/watchers\n this.setWhileOpenListeners(false);\n },\n onTemplateHidden: function onTemplateHidden() {\n // When template has completed closing (just before it self destructs)\n // TODO:\n // The next two lines could be moved into `destroyTemplate()`\n this.removeAriaDescribedby();\n this.restoreTitle();\n this.destroyTemplate(); // Emit a non-cancelable BvEvent 'shown'\n\n this.emitEvent(this.buildEvent('hidden', {}));\n },\n //\n // Utility methods\n //\n getTarget: function getTarget() {\n // Handle case where target may be a component ref\n var target = this.target ? this.target.$el || this.target : null; // If an ID\n\n target = isString(target) ? getById(target.replace(/^#/, '')) : target; // If a function\n\n target = isFunction(target) ? target() : target; // If an element ref\n\n return isElement(target) ? target : null;\n },\n getPlacementTarget: function getPlacementTarget() {\n // This is the target that the tooltip will be placed on, which may not\n // necessarily be the same element that has the trigger event listeners\n // For now, this is the same as target\n // TODO:\n // Add in child selector support\n // Add in visibility checks for this element\n // Fallback to target if not found\n return this.getTarget();\n },\n getTargetId: function getTargetId() {\n // Returns the ID of the trigger element\n var target = this.getTarget();\n return target && target.id ? target.id : null;\n },\n getContainer: function getContainer() {\n // Handle case where container may be a component ref\n var container = this.container ? this.container.$el || this.container : false;\n var body = document.body;\n var target = this.getTarget(); // If we are in a modal, we append to the modal instead\n // of body, unless a container is specified\n // TODO:\n // Template should periodically check to see if it is in dom\n // And if not, self destruct (if container got v-if'ed out of DOM)\n // Or this could possibly be part of the visibility check\n\n return container === false ? closest(MODAL_SELECTOR, target) || body : isString(container) ? getById(container.replace(/^#/, '')) || body : body;\n },\n getBoundary: function getBoundary() {\n return this.boundary ? this.boundary.$el || this.boundary : 'scrollParent';\n },\n isInModal: function isInModal() {\n var target = this.getTarget();\n return target && closest(MODAL_SELECTOR, target);\n },\n isDropdown: function isDropdown() {\n // Returns true if trigger is a dropdown\n var target = this.getTarget();\n return target && hasClass(target, DROPDOWN_CLASS);\n },\n dropdownOpen: function dropdownOpen() {\n // Returns true if trigger is a dropdown and the dropdown menu is open\n var target = this.getTarget();\n return this.isDropdown() && target && select(DROPDOWN_OPEN_SELECTOR, target);\n },\n clearActiveTriggers: function clearActiveTriggers() {\n for (var trigger in this.activeTrigger) {\n this.activeTrigger[trigger] = false;\n }\n },\n addAriaDescribedby: function addAriaDescribedby() {\n // Add aria-describedby on trigger element, without removing any other IDs\n var target = this.getTarget();\n var desc = getAttr(target, 'aria-describedby') || '';\n desc = desc.split(/\\s+/).concat(this.computedId).join(' ').trim(); // Update/add aria-described by\n\n setAttr(target, 'aria-describedby', desc);\n },\n removeAriaDescribedby: function removeAriaDescribedby() {\n var _this5 = this;\n\n // Remove aria-describedby on trigger element, without removing any other IDs\n var target = this.getTarget();\n var desc = getAttr(target, 'aria-describedby') || '';\n desc = desc.split(/\\s+/).filter(function (d) {\n return d !== _this5.computedId;\n }).join(' ').trim(); // Update or remove aria-describedby\n\n if (desc) {\n /* istanbul ignore next */\n setAttr(target, 'aria-describedby', desc);\n } else {\n removeAttr(target, 'aria-describedby');\n }\n },\n fixTitle: function fixTitle() {\n // If the target has a title attribute, null it out and\n // store on data-title\n var target = this.getTarget();\n\n if (target && getAttr(target, 'title')) {\n // We only update title attribute if it has a value\n setAttr(target, 'data-original-title', getAttr(target, 'title') || '');\n setAttr(target, 'title', '');\n }\n },\n restoreTitle: function restoreTitle() {\n // If target had a title, restore the title attribute\n // and remove the data-title attribute\n var target = this.getTarget();\n\n if (target && hasAttr(target, 'data-original-title')) {\n setAttr(target, 'title', getAttr(target, 'data-original-title') || '');\n setAttr(target, 'data-original-title', '');\n }\n },\n //\n // BvEvent helpers\n //\n buildEvent: function buildEvent(type) {\n var opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n // Defaults to a non-cancellable event\n return new BvEvent(type, _objectSpread({\n cancelable: false,\n target: this.getTarget(),\n relatedTarget: this.getTemplateElement() || null,\n componentId: this.computedId,\n vueTarget: this\n }, opts));\n },\n emitEvent: function emitEvent(bvEvt) {\n // Emits a BvEvent on $root and this instance\n var evtName = bvEvt.type;\n var $root = this.$root;\n\n if ($root && $root.$emit) {\n // Emit an event on $root\n $root.$emit(\"bv::\".concat(this.templateType, \"::\").concat(evtName), bvEvt);\n }\n\n this.$emit(evtName, bvEvt);\n },\n //\n // Event handler setup methods\n //\n listen: function listen() {\n var _this6 = this;\n\n // Enable trigger event handlers\n var el = this.getTarget();\n\n if (!el) {\n /* istanbul ignore next */\n return;\n } // Listen for global show/hide events\n\n\n this.setRootListener(true); // Set up our listeners on the target trigger element\n\n this.computedTriggers.forEach(function (trigger) {\n if (trigger === 'click') {\n eventOn(el, 'click', _this6.handleEvent, EvtOpts);\n } else if (trigger === 'focus') {\n eventOn(el, 'focusin', _this6.handleEvent, EvtOpts);\n eventOn(el, 'focusout', _this6.handleEvent, EvtOpts);\n } else if (trigger === 'blur') {\n // Used to close $tip when element looses focus\n\n /* istanbul ignore next */\n eventOn(el, 'focusout', _this6.handleEvent, EvtOpts);\n } else if (trigger === 'hover') {\n eventOn(el, 'mouseenter', _this6.handleEvent, EvtOpts);\n eventOn(el, 'mouseleave', _this6.handleEvent, EvtOpts);\n }\n }, this);\n },\n unListen: function unListen()\n /* istanbul ignore next */\n {\n var _this7 = this;\n\n // Remove trigger event handlers\n var events = ['click', 'focusin', 'focusout', 'mouseenter', 'mouseleave'];\n var target = this.getTarget(); // Stop listening for global show/hide/enable/disable events\n\n this.setRootListener(false); // Clear out any active target listeners\n\n events.forEach(function (evt) {\n target && eventOff(target, evt, _this7.handleEvent, EvtOpts);\n }, this);\n },\n setRootListener: function setRootListener(on) {\n // Listen for global `bv::{hide|show}::{tooltip|popover}` hide request event\n var $root = this.$root;\n\n if ($root) {\n var method = on ? '$on' : '$off';\n var type = this.templateType;\n $root[method](\"bv::hide::\".concat(type), this.doHide);\n $root[method](\"bv::show::\".concat(type), this.doShow);\n $root[method](\"bv::disable::\".concat(type), this.doDisable);\n $root[method](\"bv::enable::\".concat(type), this.doEnable);\n }\n },\n setWhileOpenListeners: function setWhileOpenListeners(on) {\n // Events that are only registered when the template is showing\n // Modal close events\n this.setModalListener(on); // Dropdown open events (if we are attached to a dropdown)\n\n this.setDropdownListener(on); // Periodic $element visibility check\n // For handling when tip target is in , tabs, carousel, etc\n\n this.visibleCheck(on); // On-touch start listeners\n\n this.setOnTouchStartListener(on);\n },\n visibleCheck: function visibleCheck(on) {\n var _this8 = this;\n\n // Handler for periodic visibility check\n clearInterval(this.$_visibleInterval);\n this.$_visibleInterval = null;\n var target = this.getTarget();\n var tip = this.getTemplateElement();\n\n if (on) {\n this.visibleInterval = setInterval(function () {\n if (tip && _this8.localShow && (!target.parentNode || !isVisible(target))) {\n // Target element is no longer visible or not in DOM, so force-hide the tooltip\n _this8.forceHide();\n }\n }, 100);\n }\n },\n setModalListener: function setModalListener(on) {\n // Handle case where tooltip/target is in a modal\n if (this.isInModal()) {\n // We can listen for modal hidden events on `$root`\n this.$root[on ? '$on' : '$off'](MODAL_CLOSE_EVENT, this.forceHide);\n }\n },\n setOnTouchStartListener: function setOnTouchStartListener(on)\n /* istanbul ignore next: JSDOM doesn't support `ontouchstart` */\n {\n var _this9 = this;\n\n // If this is a touch-enabled device we add extra empty\n // `mouseover` listeners to the body's immediate children\n // Only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n var method = on ? eventOn : eventOff;\n arrayFrom(document.body.children).forEach(function (el) {\n method(el, 'mouseover', _this9.$_noop);\n });\n }\n },\n setDropdownListener: function setDropdownListener(on) {\n var target = this.getTarget();\n\n if (!target || !this.$root || !this.isDropdown) {\n return;\n } // We can listen for dropdown shown events on it's instance\n // TODO:\n // We could grab the ID from the dropdown, and listen for\n // $root events for that particular dropdown id\n // Dropdown shown and hidden events will need to emit\n // Note: Dropdown auto-ID happens in a `$nextTick()` after mount\n // So the ID lookup would need to be done in a `$nextTick()`\n\n\n if (target.__vue__) {\n target.__vue__[on ? '$on' : '$off']('shown', this.forceHide);\n }\n },\n //\n // Event handlers\n //\n handleEvent: function handleEvent(evt) {\n // General trigger event handler\n // target is the trigger element\n var target = this.getTarget();\n\n if (!target || isDisabled(target) || !this.$_enabled || this.dropdownOpen()) {\n // If disabled or not enabled, or if a dropdown that is open, don't do anything\n // If tip is shown before element gets disabled, then tip will not\n // close until no longer disabled or forcefully closed\n return;\n }\n\n var type = evt.type;\n var triggers = this.computedTriggers;\n\n if (type === 'click' && arrayIncludes(triggers, 'click')) {\n this.click(evt);\n } else if (type === 'mouseenter' && arrayIncludes(triggers, 'hover')) {\n // `mouseenter` is a non-bubbling event\n this.enter(evt);\n } else if (type === 'focusin' && arrayIncludes(triggers, 'focus')) {\n // `focusin` is a bubbling event\n // `evt` includes `relatedTarget` (element loosing focus)\n this.enter(evt);\n } else if (type === 'focusout' && (arrayIncludes(triggers, 'focus') || arrayIncludes(triggers, 'blur')) || type === 'mouseleave' && arrayIncludes(triggers, 'hover')) {\n // `focusout` is a bubbling event\n // `mouseleave` is a non-bubbling event\n // `tip` is the template (will be null if not open)\n var tip = this.getTemplateElement(); // `evtTarget` is the element which is loosing focus/hover and\n\n var evtTarget = evt.target; // `relatedTarget` is the element gaining focus/hover\n\n var relatedTarget = evt.relatedTarget;\n /* istanbul ignore next */\n\n if ( // From tip to target\n tip && tip.contains(evtTarget) && target.contains(relatedTarget) || // From target to tip\n tip && target.contains(evtTarget) && tip.contains(relatedTarget) || // Within tip\n tip && tip.contains(evtTarget) && tip.contains(relatedTarget) || // Within target\n target.contains(evtTarget) && target.contains(relatedTarget)) {\n // If focus/hover moves within `tip` and `target`, don't trigger a leave\n return;\n } // Otherwise trigger a leave\n\n\n this.leave(evt);\n }\n },\n doHide: function doHide(id) {\n // Programmatically hide tooltip or popover\n if (!id || this.getTargetId() === id || this.computedId === id) {\n // Close all tooltips or popovers, or this specific tip (with ID)\n this.forceHide();\n }\n },\n doShow: function doShow(id) {\n // Programmatically show tooltip or popover\n if (!id || this.getTargetId() === id || this.computedId === id) {\n // Open all tooltips or popovers, or this specific tip (with ID)\n this.show();\n }\n },\n doDisable: function doDisable(id)\n /*istanbul ignore next: ignore for now */\n {\n // Programmatically disable tooltip or popover\n if (!id || this.getTargetId() === id || this.computedId === id) {\n // Disable all tooltips or popovers (no ID), or this specific tip (with ID)\n this.disable();\n }\n },\n doEnable: function doEnable(id)\n /*istanbul ignore next: ignore for now */\n {\n // Programmatically enable tooltip or popover\n if (!id || this.getTargetId() === id || this.computedId === id) {\n // Enable all tooltips or popovers (no ID), or this specific tip (with ID)\n this.enable();\n }\n },\n click: function click(evt) {\n if (!this.$_enabled || this.dropdownOpen()) {\n /* istanbul ignore next */\n return;\n }\n\n this.activeTrigger.click = !this.activeTrigger.click;\n\n if (this.isWithActiveTrigger) {\n this.enter(null);\n } else {\n /* istanbul ignore next */\n this.leave(null);\n }\n },\n toggle: function toggle()\n /* istanbul ignore next */\n {\n // Manual toggle handler\n if (!this.$_enabled || this.dropdownOpen()) {\n /* istanbul ignore next */\n return;\n } // Should we register as an active trigger?\n // this.activeTrigger.manual = !this.activeTrigger.manual\n\n\n if (this.localShow) {\n this.leave(null);\n } else {\n this.enter(null);\n }\n },\n enter: function enter() {\n var _this10 = this;\n\n var evt = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;\n\n // Opening trigger handler\n // Note: Click events are sent with evt === null\n if (evt) {\n this.activeTrigger[evt.type === 'focusin' ? 'focus' : 'hover'] = true;\n }\n /* istanbul ignore next */\n\n\n if (this.localShow || this.$_hoverState === 'in') {\n this.$_hoverState = 'in';\n return;\n }\n\n clearTimeout(this.hoverTimeout);\n this.$_hoverState = 'in';\n\n if (!this.computedDelay.show) {\n this.show();\n } else {\n this.hoverTimeout = setTimeout(function () {\n if (_this10.$_hoverState === 'in') {\n _this10.show();\n }\n }, this.computedDelay.show);\n }\n },\n leave: function leave() {\n var _this11 = this;\n\n var evt = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;\n\n // Closing trigger handler\n // Note: Click events are sent with evt === null\n if (evt) {\n this.activeTrigger[evt.type === 'focusout' ? 'focus' : 'hover'] = false;\n /* istanbul ignore next */\n\n if (evt.type === 'focusout' && arrayIncludes(this.computedTriggers, 'blur')) {\n // Special case for `blur`: we clear out the other triggers\n this.activeTrigger.click = false;\n this.activeTrigger.hover = false;\n }\n }\n /* istanbul ignore next: ignore for now */\n\n\n if (this.isWithActiveTrigger) {\n return;\n }\n\n clearTimeout(this.hoverTimeout);\n this.$_hoverState = 'out';\n\n if (!this.computedDelay.hide) {\n this.hide();\n } else {\n this.$hoverTimeout = setTimeout(function () {\n if (_this11.$_hoverState === 'out') {\n _this11.hide();\n }\n }, this.computedDelay.hide);\n }\n }\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/tooltip/helpers/bv-tooltip.js\n// module id = D/ty\n// module chunks = 0","var hasOwnProperty = {}.hasOwnProperty;\nmodule.exports = function (it, key) {\n return hasOwnProperty.call(it, key);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_has.js\n// module id = D2L2\n// module chunks = 0","// @vue/component\nexport default {\n computed: {\n selectionStart: {\n // Expose selectionStart for formatters, etc\n cache: false,\n get: function get()\n /* istanbul ignore next */\n {\n return this.$refs.input.selectionStart;\n },\n set: function set(val)\n /* istanbul ignore next */\n {\n this.$refs.input.selectionStart = val;\n }\n },\n selectionEnd: {\n // Expose selectionEnd for formatters, etc\n cache: false,\n get: function get()\n /* istanbul ignore next */\n {\n return this.$refs.input.selectionEnd;\n },\n set: function set(val)\n /* istanbul ignore next */\n {\n this.$refs.input.selectionEnd = val;\n }\n },\n selectionDirection: {\n // Expose selectionDirection for formatters, etc\n cache: false,\n get: function get()\n /* istanbul ignore next */\n {\n return this.$refs.input.selectionDirection;\n },\n set: function set(val)\n /* istanbul ignore next */\n {\n this.$refs.input.selectionDirection = val;\n }\n }\n },\n methods: {\n select: function select()\n /* istanbul ignore next */\n {\n var _this$$refs$input;\n\n // For external handler that may want a select() method\n (_this$$refs$input = this.$refs.input).select.apply(_this$$refs$input, arguments);\n },\n setSelectionRange: function setSelectionRange()\n /* istanbul ignore next */\n {\n var _this$$refs$input2;\n\n // For external handler that may want a setSelectionRange(a,b,c) method\n (_this$$refs$input2 = this.$refs.input).setSelectionRange.apply(_this$$refs$input2, arguments);\n },\n setRangeText: function setRangeText()\n /* istanbul ignore next */\n {\n var _this$$refs$input3;\n\n // For external handler that may want a setRangeText(a,b,c) method\n (_this$$refs$input3 = this.$refs.input).setRangeText.apply(_this$$refs$input3, arguments);\n }\n }\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/mixins/form-selection.js\n// module id = DBNW\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { VBVisible } from '../../directives/visible';\nimport idMixin from '../../mixins/id';\nimport formMixin from '../../mixins/form';\nimport formSizeMixin from '../../mixins/form-size';\nimport formStateMixin from '../../mixins/form-state';\nimport formTextMixin from '../../mixins/form-text';\nimport formSelectionMixin from '../../mixins/form-selection';\nimport formValidityMixin from '../../mixins/form-validity';\nimport listenOnRootMixin from '../../mixins/listen-on-root';\nimport { getCS, isVisible, requestAF } from '../../utils/dom';\nimport { isNull } from '../../utils/inspect'; // @vue/component\n\nexport var BFormTextarea =\n/*#__PURE__*/\nVue.extend({\n name: 'BFormTextarea',\n directives: {\n 'b-visible': VBVisible\n },\n mixins: [idMixin, listenOnRootMixin, formMixin, formSizeMixin, formStateMixin, formTextMixin, formSelectionMixin, formValidityMixin],\n props: {\n rows: {\n type: [Number, String],\n default: 2\n },\n maxRows: {\n type: [Number, String],\n default: null\n },\n wrap: {\n // 'soft', 'hard' or 'off'. Browser default is 'soft'\n type: String,\n default: 'soft'\n },\n noResize: {\n // Disable the resize handle of textarea\n type: Boolean,\n default: false\n },\n noAutoShrink: {\n // When in auto resize mode, disable shrinking to content height\n type: Boolean,\n default: false\n }\n },\n data: function data() {\n return {\n heightInPx: null\n };\n },\n computed: {\n computedStyle: function computedStyle() {\n var styles = {\n // Setting `noResize` to true will disable the ability for the user to\n // manually resize the textarea. We also disable when in auto height mode\n resize: !this.computedRows || this.noResize ? 'none' : null\n };\n\n if (!this.computedRows) {\n // Conditionally set the computed CSS height when auto rows/height is enabled\n // We avoid setting the style to `null`, which can override user manual resize handle\n styles.height = this.heightInPx; // We always add a vertical scrollbar to the textarea when auto-height is\n // enabled so that the computed height calculation returns a stable value\n\n styles.overflowY = 'scroll';\n }\n\n return styles;\n },\n computedMinRows: function computedMinRows() {\n // Ensure rows is at least 2 and positive (2 is the native textarea value)\n // A value of 1 can cause issues in some browsers, and most browsers\n // only support 2 as the smallest value\n return Math.max(parseInt(this.rows, 10) || 2, 2);\n },\n computedMaxRows: function computedMaxRows() {\n return Math.max(this.computedMinRows, parseInt(this.maxRows, 10) || 0);\n },\n computedRows: function computedRows() {\n // This is used to set the attribute 'rows' on the textarea\n // If auto-height is enabled, then we return `null` as we use CSS to control height\n return this.computedMinRows === this.computedMaxRows ? this.computedMinRows : null;\n }\n },\n watch: {\n localValue: function localValue(newVal, oldVal) {\n this.setHeight();\n }\n },\n mounted: function mounted() {\n this.setHeight();\n },\n methods: {\n // Called by intersection observer directive\n visibleCallback: function visibleCallback(visible)\n /* istanbul ignore next */\n {\n if (visible) {\n // We use a `$nextTick()` here just to make sure any\n // transitions or portalling have completed\n this.$nextTick(this.setHeight);\n }\n },\n setHeight: function setHeight() {\n var _this = this;\n\n this.$nextTick(function () {\n requestAF(function () {\n _this.heightInPx = _this.computeHeight();\n });\n });\n },\n computeHeight: function computeHeight()\n /* istanbul ignore next: can't test getComputedStyle in JSDOM */\n {\n if (this.$isServer || !isNull(this.computedRows)) {\n return null;\n }\n\n var el = this.$el; // Element must be visible (not hidden) and in document\n // Must be checked after above checks\n\n if (!isVisible(el)) {\n return null;\n } // Get current computed styles\n\n\n var computedStyle = getCS(el); // Height of one line of text in px\n\n var lineHeight = parseFloat(computedStyle.lineHeight); // Calculate height of border and padding\n\n var border = (parseFloat(computedStyle.borderTopWidth) || 0) + (parseFloat(computedStyle.borderBottomWidth) || 0);\n var padding = (parseFloat(computedStyle.paddingTop) || 0) + (parseFloat(computedStyle.paddingBottom) || 0); // Calculate offset\n\n var offset = border + padding; // Minimum height for min rows (which must be 2 rows or greater for cross-browser support)\n\n var minHeight = lineHeight * this.computedMinRows + offset; // Get the current style height (with `px` units)\n\n var oldHeight = el.style.height || computedStyle.height; // Probe scrollHeight by temporarily changing the height to `auto`\n\n el.style.height = 'auto';\n var scrollHeight = el.scrollHeight; // Place the original old height back on the element, just in case `computedProp`\n // returns the same value as before\n\n el.style.height = oldHeight; // Calculate content height in 'rows' (scrollHeight includes padding but not border)\n\n var contentRows = Math.max((scrollHeight - padding) / lineHeight, 2); // Calculate number of rows to display (limited within min/max rows)\n\n var rows = Math.min(Math.max(contentRows, this.computedMinRows), this.computedMaxRows); // Calculate the required height of the textarea including border and padding (in pixels)\n\n var height = Math.max(Math.ceil(rows * lineHeight + offset), minHeight); // Computed height remains the larger of `oldHeight` and new `height`,\n // when height is in `sticky` mode (prop `no-auto-shrink` is true)\n\n if (this.noAutoShrink && (parseFloat(oldHeight) || 0) > height) {\n return oldHeight;\n } // Return the new computed CSS height in px units\n\n\n return \"\".concat(height, \"px\");\n }\n },\n render: function render(h) {\n // Using self instead of this helps reduce code size during minification\n var self = this;\n return h('textarea', {\n ref: 'input',\n class: self.computedClass,\n style: self.computedStyle,\n directives: [{\n name: 'model',\n value: self.localValue\n }, {\n name: 'b-visible',\n value: this.visibleCallback,\n // If textarea is within 640px of viewport, consider it visible\n modifiers: {\n '640': true\n }\n }],\n attrs: {\n id: self.safeId(),\n name: self.name,\n form: self.form || null,\n disabled: self.disabled,\n placeholder: self.placeholder,\n required: self.required,\n autocomplete: self.autocomplete || null,\n readonly: self.readonly || self.plaintext,\n rows: self.computedRows,\n wrap: self.wrap || null,\n 'aria-required': self.required ? 'true' : null,\n 'aria-invalid': self.computedAriaInvalid\n },\n domProps: {\n value: self.localValue\n },\n on: _objectSpread({}, self.$listeners, {\n input: self.onInput,\n change: self.onChange,\n blur: self.onBlur\n })\n });\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-textarea/form-textarea.js\n// module id = DF+s\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n 'm': ['eine Minute', 'einer Minute'],\n 'h': ['eine Stunde', 'einer Stunde'],\n 'd': ['ein Tag', 'einem Tag'],\n 'dd': [number + ' Tage', number + ' Tagen'],\n 'M': ['ein Monat', 'einem Monat'],\n 'MM': [number + ' Monate', number + ' Monaten'],\n 'y': ['ein Jahr', 'einem Jahr'],\n 'yy': [number + ' Jahre', number + ' Jahren']\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var de = moment.defineLocale('de', {\n months : 'Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split('_'),\n monthsShort : 'Jan._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split('_'),\n monthsParseExact : true,\n weekdays : 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split('_'),\n weekdaysShort : 'So._Mo._Di._Mi._Do._Fr._Sa.'.split('_'),\n weekdaysMin : 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY HH:mm',\n LLLL : 'dddd, D. MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]'\n },\n relativeTime : {\n future : 'in %s',\n past : 'vor %s',\n s : 'ein paar Sekunden',\n ss : '%d Sekunden',\n m : processRelativeTime,\n mm : '%d Minuten',\n h : processRelativeTime,\n hh : '%d Stunden',\n d : processRelativeTime,\n dd : processRelativeTime,\n M : processRelativeTime,\n MM : processRelativeTime,\n y : processRelativeTime,\n yy : processRelativeTime\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return de;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/de.js\n// module id = DOkx\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/axios/lib/helpers/buildURL.js\n// module id = DQCr\n// module chunks = 0","import { BFormRadio } from './form-radio';\nimport { BFormRadioGroup } from './form-radio-group';\nimport { pluginFactory } from '../../utils/plugins';\nvar FormRadioPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BFormRadio: BFormRadio,\n BRadio: BFormRadio,\n BFormRadioGroup: BFormRadioGroup,\n BRadioGroup: BFormRadioGroup\n }\n});\nexport { FormRadioPlugin, BFormRadio, BFormRadioGroup };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-radio/index.js\n// module id = DQqX\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var sw = moment.defineLocale('sw', {\n months : 'Januari_Februari_Machi_Aprili_Mei_Juni_Julai_Agosti_Septemba_Oktoba_Novemba_Desemba'.split('_'),\n monthsShort : 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ago_Sep_Okt_Nov_Des'.split('_'),\n weekdays : 'Jumapili_Jumatatu_Jumanne_Jumatano_Alhamisi_Ijumaa_Jumamosi'.split('_'),\n weekdaysShort : 'Jpl_Jtat_Jnne_Jtan_Alh_Ijm_Jmos'.split('_'),\n weekdaysMin : 'J2_J3_J4_J5_Al_Ij_J1'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY HH:mm',\n LLLL : 'dddd, D MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay : '[leo saa] LT',\n nextDay : '[kesho saa] LT',\n nextWeek : '[wiki ijayo] dddd [saat] LT',\n lastDay : '[jana] LT',\n lastWeek : '[wiki iliyopita] dddd [saat] LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%s baadaye',\n past : 'tokea %s',\n s : 'hivi punde',\n ss : 'sekunde %d',\n m : 'dakika moja',\n mm : 'dakika %d',\n h : 'saa limoja',\n hh : 'masaa %d',\n d : 'siku moja',\n dd : 'masiku %d',\n M : 'mwezi mmoja',\n MM : 'miezi %d',\n y : 'mwaka mmoja',\n yy : 'miaka %d'\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return sw;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/sw.js\n// module id = DSXN\n// module chunks = 0","var metric\n , imperial;\n\nmetric = {\n 'mm3/s': {\n name: {\n singular: 'Cubic Millimeter per second'\n , plural: 'Cubic Millimeters per second'\n }\n , to_anchor: 1/1000000\n }\n, 'cm3/s': {\n name: {\n singular: 'Cubic Centimeter per second'\n , plural: 'Cubic Centimeters per second'\n }\n , to_anchor: 1/1000\n }\n, 'ml/s': {\n name: {\n singular: 'Millilitre per second'\n , plural: 'Millilitres per second'\n }\n , to_anchor: 1/1000\n }\n, 'cl/s': {\n name: {\n singular: 'Centilitre per second'\n , plural: 'Centilitres per second'\n }\n , to_anchor: 1/100\n }\n, 'dl/s': {\n name: {\n singular: 'Decilitre per second'\n , plural: 'Decilitres per second'\n }\n , to_anchor: 1/10\n }\n, 'l/s': {\n name: {\n singular: 'Litre per second'\n , plural: 'Litres per second'\n }\n , to_anchor: 1\n }\n, 'l/min': {\n name: {\n singular: 'Litre per minute'\n , plural: 'Litres per minute'\n }\n , to_anchor: 1/60\n }\n, 'l/h': {\n name: {\n singular: 'Litre per hour'\n , plural: 'Litres per hour'\n }\n , to_anchor: 1/3600\n }\n, 'kl/s': {\n name: {\n singular: 'Kilolitre per second'\n , plural: 'Kilolitres per second'\n }\n , to_anchor: 1000\n }\n, 'kl/min': {\n name: {\n singular: 'Kilolitre per minute'\n , plural: 'Kilolitres per minute'\n }\n , to_anchor: 50/3\n }\n, 'kl/h': {\n name: {\n singular: 'Kilolitre per hour'\n , plural: 'Kilolitres per hour'\n }\n , to_anchor: 5/18\n }\n, 'm3/s': {\n name: {\n singular: 'Cubic meter per second'\n , plural: 'Cubic meters per second'\n }\n , to_anchor: 1000\n }\n, 'm3/min': {\n name: {\n singular: 'Cubic meter per minute'\n , plural: 'Cubic meters per minute'\n }\n , to_anchor: 50/3\n }\n, 'm3/h': {\n name: {\n singular: 'Cubic meter per hour'\n , plural: 'Cubic meters per hour'\n }\n , to_anchor: 5/18\n }\n, 'km3/s': {\n name: {\n singular: 'Cubic kilometer per second'\n , plural: 'Cubic kilometers per second'\n }\n , to_anchor: 1000000000000\n }\n};\n\nimperial = {\n 'tsp/s': {\n name: {\n singular: 'Teaspoon per second'\n , plural: 'Teaspoons per second'\n }\n , to_anchor: 1/6\n }\n, 'Tbs/s': {\n name: {\n singular: 'Tablespoon per second'\n , plural: 'Tablespoons per second'\n }\n , to_anchor: 1/2\n }\n, 'in3/s': {\n name: {\n singular: 'Cubic inch per second'\n , plural: 'Cubic inches per second'\n }\n , to_anchor: 0.55411\n }\n, 'in3/min': {\n name: {\n singular: 'Cubic inch per minute'\n , plural: 'Cubic inches per minute'\n }\n , to_anchor: 0.55411/60\n }\n, 'in3/h': {\n name: {\n singular: 'Cubic inch per hour'\n , plural: 'Cubic inches per hour'\n }\n , to_anchor: 0.55411/3600\n }\n, 'fl-oz/s': {\n name: {\n singular: 'Fluid Ounce per second'\n , plural: 'Fluid Ounces per second'\n }\n , to_anchor: 1\n }\n, 'fl-oz/min': {\n name: {\n singular: 'Fluid Ounce per minute'\n , plural: 'Fluid Ounces per minute'\n }\n , to_anchor: 1/60\n }\n, 'fl-oz/h': {\n name: {\n singular: 'Fluid Ounce per hour'\n , plural: 'Fluid Ounces per hour'\n }\n , to_anchor: 1/3600\n }\n, 'cup/s': {\n name: {\n singular: 'Cup per second'\n , plural: 'Cups per second'\n }\n , to_anchor: 8\n }\n, 'pnt/s': {\n name: {\n singular: 'Pint per second'\n , plural: 'Pints per second'\n }\n , to_anchor: 16\n }\n, 'pnt/min': {\n name: {\n singular: 'Pint per minute'\n , plural: 'Pints per minute'\n }\n , to_anchor: 4/15\n }\n, 'pnt/h': {\n name: {\n singular: 'Pint per hour'\n , plural: 'Pints per hour'\n }\n , to_anchor: 1/225\n }\n, 'qt/s': {\n name: {\n singular: 'Quart per second'\n , plural: 'Quarts per second'\n }\n , to_anchor: 32\n }\n, 'gal/s': {\n name: {\n singular: 'Gallon per second'\n , plural: 'Gallons per second'\n }\n , to_anchor: 128\n }\n, 'gal/min': {\n name: {\n singular: 'Gallon per minute'\n , plural: 'Gallons per minute'\n }\n , to_anchor: 32/15\n }\n, 'gal/h': {\n name: {\n singular: 'Gallon per hour'\n , plural: 'Gallons per hour'\n }\n , to_anchor: 8/225\n }\n, 'ft3/s': {\n name: {\n singular: 'Cubic foot per second'\n , plural: 'Cubic feet per second'\n }\n , to_anchor: 957.506\n }\n, 'ft3/min': {\n name: {\n singular: 'Cubic foot per minute'\n , plural: 'Cubic feet per minute'\n }\n , to_anchor: 957.506/60\n }\n, 'ft3/h': {\n name: {\n singular: 'Cubic foot per hour'\n , plural: 'Cubic feet per hour'\n }\n , to_anchor: 957.506/3600\n }\n, 'yd3/s': {\n name: {\n singular: 'Cubic yard per second'\n , plural: 'Cubic yards per second'\n }\n , to_anchor: 25852.7\n }\n, 'yd3/min': {\n name: {\n singular: 'Cubic yard per minute'\n , plural: 'Cubic yards per minute'\n }\n , to_anchor: 25852.7/60\n }\n, 'yd3/h': {\n name: {\n singular: 'Cubic yard per hour'\n , plural: 'Cubic yards per hour'\n }\n , to_anchor: 25852.7/3600\n }\n};\n\nmodule.exports = {\n metric: metric\n, imperial: imperial\n, _anchors: {\n metric: {\n unit: 'l/s'\n , ratio: 33.8140227\n }\n , imperial: {\n unit: 'fl-oz/s'\n , ratio: 1/33.8140227\n }\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/convert-units/lib/definitions/volumeFlowRate.js\n// module id = DWek\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport BVTransition from '../../utils/bv-transition';\nimport KeyCodes from '../../utils/key-codes';\nimport observeDom from '../../utils/observe-dom';\nimport { arrayIncludes } from '../../utils/array';\nimport { getComponentConfig } from '../../utils/config';\nimport { contains, eventOff, eventOn, isVisible, requestAF, select, selectAll } from '../../utils/dom';\nimport { isBrowser } from '../../utils/env';\nimport { stripTags } from '../../utils/html';\nimport { isString, isUndefinedOrNull } from '../../utils/inspect';\nimport { BTransporterSingle } from '../../utils/transporter';\nimport idMixin from '../../mixins/id';\nimport listenOnRootMixin from '../../mixins/listen-on-root';\nimport normalizeSlotMixin from '../../mixins/normalize-slot';\nimport scopedStyleAttrsMixin from '../../mixins/scoped-style-attrs';\nimport { BButton } from '../button/button';\nimport { BButtonClose } from '../button/button-close';\nimport { modalManager } from './helpers/modal-manager';\nimport { BvModalEvent } from './helpers/bv-modal-event.class'; // --- Constants ---\n\nvar NAME = 'BModal'; // ObserveDom config to detect changes in modal content\n// so that we can adjust the modal padding if needed\n\nvar OBSERVER_CONFIG = {\n subtree: true,\n childList: true,\n characterData: true,\n attributes: true,\n attributeFilter: ['style', 'class'] // Options for DOM event listeners\n\n};\nvar EVT_OPTIONS = {\n passive: true,\n capture: false // Query selector to find all tabbable elements\n // (includes tabindex=\"-1\", which we filter out after)\n\n};\nvar TABABLE_SELECTOR = ['button', '[href]:not(.disabled)', 'input', 'select', 'textarea', '[tabindex]', '[contenteditable]'].map(function (s) {\n return \"\".concat(s, \":not(:disabled):not([disabled])\");\n}).join(', '); // --- Utility methods ---\n// Attempt to focus an element, and return true if successful\n\nvar attemptFocus = function attemptFocus(el) {\n if (el && isVisible(el) && el.focus) {\n try {\n el.focus();\n } catch (_unused) {}\n } // If the element has focus, then return true\n\n\n return document.activeElement === el;\n}; // --- Props ---\n\n\nexport var props = {\n size: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'size');\n }\n },\n centered: {\n type: Boolean,\n default: false\n },\n scrollable: {\n type: Boolean,\n default: false\n },\n buttonSize: {\n type: String,\n default: ''\n },\n noStacking: {\n type: Boolean,\n default: false\n },\n noFade: {\n type: Boolean,\n default: false\n },\n noCloseOnBackdrop: {\n type: Boolean,\n default: false\n },\n noCloseOnEsc: {\n type: Boolean,\n default: false\n },\n noEnforceFocus: {\n type: Boolean,\n default: false\n },\n title: {\n type: String,\n default: ''\n },\n titleHtml: {\n type: String\n },\n titleTag: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'titleTag');\n }\n },\n titleClass: {\n type: [String, Array, Object],\n default: null\n },\n titleSrOnly: {\n type: Boolean,\n default: false\n },\n ariaLabel: {\n type: String,\n default: null\n },\n headerBgVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'headerBgVariant');\n }\n },\n headerBorderVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'headerBorderVariant');\n }\n },\n headerTextVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'headerTextVariant');\n }\n },\n headerCloseVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'headerCloseVariant');\n }\n },\n headerClass: {\n type: [String, Array, Object],\n default: null\n },\n bodyBgVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'bodyBgVariant');\n }\n },\n bodyTextVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'bodyTextVariant');\n }\n },\n modalClass: {\n type: [String, Array, Object],\n default: null\n },\n dialogClass: {\n type: [String, Array, Object],\n default: null\n },\n contentClass: {\n type: [String, Array, Object],\n default: null\n },\n bodyClass: {\n type: [String, Array, Object],\n default: null\n },\n footerBgVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'footerBgVariant');\n }\n },\n footerBorderVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'footerBorderVariant');\n }\n },\n footerTextVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'footerTextVariant');\n }\n },\n footerClass: {\n type: [String, Array, Object],\n default: null\n },\n hideHeader: {\n type: Boolean,\n default: false\n },\n hideFooter: {\n type: Boolean,\n default: false\n },\n hideHeaderClose: {\n type: Boolean,\n default: false\n },\n hideBackdrop: {\n type: Boolean,\n default: false\n },\n okOnly: {\n type: Boolean,\n default: false\n },\n okDisabled: {\n type: Boolean,\n default: false\n },\n cancelDisabled: {\n type: Boolean,\n default: false\n },\n visible: {\n type: Boolean,\n default: false\n },\n returnFocus: {\n // type: Object,\n default: null\n },\n headerCloseLabel: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'headerCloseLabel');\n }\n },\n cancelTitle: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'cancelTitle');\n }\n },\n cancelTitleHtml: {\n type: String\n },\n okTitle: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'okTitle');\n }\n },\n okTitleHtml: {\n type: String\n },\n cancelVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'cancelVariant');\n }\n },\n okVariant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'okVariant');\n }\n },\n lazy: {\n type: Boolean,\n default: false\n },\n busy: {\n type: Boolean,\n default: false\n },\n static: {\n type: Boolean,\n default: false\n },\n autoFocusButton: {\n type: String,\n default: null,\n validator: function validator(val) {\n /* istanbul ignore next */\n return isUndefinedOrNull(val) || arrayIncludes(['ok', 'cancel', 'close'], val);\n }\n } // @vue/component\n\n};\nexport var BModal =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n mixins: [idMixin, listenOnRootMixin, normalizeSlotMixin, scopedStyleAttrsMixin],\n inheritAttrs: false,\n model: {\n prop: 'visible',\n event: 'change'\n },\n props: props,\n data: function data() {\n return {\n isHidden: true,\n // If modal should not be in document\n isVisible: false,\n // Controls modal visible state\n isTransitioning: false,\n // Used for style control\n isShow: false,\n // Used for style control\n isBlock: false,\n // Used for style control\n isOpening: false,\n // To signal that the modal is in the process of opening\n isClosing: false,\n // To signal that the modal is in the process of closing\n ignoreBackdropClick: false,\n // Used to signify if click out listener should ignore the click\n isModalOverflowing: false,\n return_focus: this.returnFocus || null,\n // The following items are controlled by the modalManager instance\n scrollbarWidth: 0,\n zIndex: modalManager.getBaseZIndex(),\n isTop: true,\n isBodyOverflowing: false\n };\n },\n computed: {\n modalClasses: function modalClasses() {\n return [{\n fade: !this.noFade,\n show: this.isShow\n }, this.modalClass];\n },\n modalStyles: function modalStyles() {\n var sbWidth = \"\".concat(this.scrollbarWidth, \"px\");\n return {\n paddingLeft: !this.isBodyOverflowing && this.isModalOverflowing ? sbWidth : '',\n paddingRight: this.isBodyOverflowing && !this.isModalOverflowing ? sbWidth : '',\n // Needed to fix issue https://github.com/bootstrap-vue/bootstrap-vue/issues/3457\n // Even though we are using v-show, we must ensure 'none' is restored in the styles\n display: this.isBlock ? 'block' : 'none'\n };\n },\n dialogClasses: function dialogClasses() {\n var _ref;\n\n return [(_ref = {}, _defineProperty(_ref, \"modal-\".concat(this.size), Boolean(this.size)), _defineProperty(_ref, 'modal-dialog-centered', this.centered), _defineProperty(_ref, 'modal-dialog-scrollable', this.scrollable), _ref), this.dialogClass];\n },\n headerClasses: function headerClasses() {\n var _ref2;\n\n return [(_ref2 = {}, _defineProperty(_ref2, \"bg-\".concat(this.headerBgVariant), Boolean(this.headerBgVariant)), _defineProperty(_ref2, \"text-\".concat(this.headerTextVariant), Boolean(this.headerTextVariant)), _defineProperty(_ref2, \"border-\".concat(this.headerBorderVariant), Boolean(this.headerBorderVariant)), _ref2), this.headerClass];\n },\n titleClasses: function titleClasses() {\n return [{\n 'sr-only': this.titleSrOnly\n }, this.titleClass];\n },\n bodyClasses: function bodyClasses() {\n var _ref3;\n\n return [(_ref3 = {}, _defineProperty(_ref3, \"bg-\".concat(this.bodyBgVariant), Boolean(this.bodyBgVariant)), _defineProperty(_ref3, \"text-\".concat(this.bodyTextVariant), Boolean(this.bodyTextVariant)), _ref3), this.bodyClass];\n },\n footerClasses: function footerClasses() {\n var _ref4;\n\n return [(_ref4 = {}, _defineProperty(_ref4, \"bg-\".concat(this.footerBgVariant), Boolean(this.footerBgVariant)), _defineProperty(_ref4, \"text-\".concat(this.footerTextVariant), Boolean(this.footerTextVariant)), _defineProperty(_ref4, \"border-\".concat(this.footerBorderVariant), Boolean(this.footerBorderVariant)), _ref4), this.footerClass];\n },\n modalOuterStyle: function modalOuterStyle() {\n // Styles needed for proper stacking of modals\n return {\n position: 'absolute',\n zIndex: this.zIndex\n };\n },\n slotScope: function slotScope() {\n return {\n ok: this.onOk,\n cancel: this.onCancel,\n close: this.onClose,\n hide: this.hide,\n visible: this.isVisible\n };\n }\n },\n watch: {\n visible: function visible(newVal, oldVal) {\n if (newVal !== oldVal) {\n this[newVal ? 'show' : 'hide']();\n }\n }\n },\n created: function created() {\n // Define non-reactive properties\n this._observer = null;\n },\n mounted: function mounted() {\n // Set initial z-index as queried from the DOM\n this.zIndex = modalManager.getBaseZIndex(); // Listen for events from others to either open or close ourselves\n // and listen to all modals to enable/disable enforce focus\n\n this.listenOnRoot('bv::show::modal', this.showHandler);\n this.listenOnRoot('bv::hide::modal', this.hideHandler);\n this.listenOnRoot('bv::toggle::modal', this.toggleHandler); // Listen for `bv:modal::show events`, and close ourselves if the\n // opening modal not us\n\n this.listenOnRoot('bv::modal::show', this.modalListener); // Initially show modal?\n\n if (this.visible === true) {\n this.$nextTick(this.show);\n }\n },\n beforeDestroy: function beforeDestroy() {\n // Ensure everything is back to normal\n if (this._observer) {\n this._observer.disconnect();\n\n this._observer = null;\n }\n\n this.setEnforceFocus(false);\n this.setResizeEvent(false);\n\n if (this.isVisible) {\n this.isVisible = false;\n this.isShow = false;\n this.isTransitioning = false;\n }\n },\n methods: {\n // Private method to update the v-model\n updateModel: function updateModel(val) {\n if (val !== this.visible) {\n this.$emit('change', val);\n }\n },\n // Private method to create a BvModalEvent object\n buildEvent: function buildEvent(type) {\n var opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n return new BvModalEvent(type, _objectSpread({\n // Default options\n cancelable: false,\n target: this.$refs.modal || this.$el || null,\n relatedTarget: null,\n trigger: null\n }, opts, {\n // Options that can't be overridden\n vueTarget: this,\n componentId: this.safeId()\n }));\n },\n // Public method to show modal\n show: function show() {\n if (this.isVisible || this.isOpening) {\n // If already open, or in the process of opening, do nothing\n\n /* istanbul ignore next */\n return;\n }\n\n if (this.isClosing) {\n // If we are in the process of closing, wait until hidden before re-opening\n\n /* istanbul ignore next */\n this.$once('hidden', this.show);\n /* istanbul ignore next */\n\n return;\n }\n\n this.isOpening = true; // Set the element to return focus to when closed\n\n this.return_focus = this.return_focus || this.getActiveElement();\n var showEvt = this.buildEvent('show', {\n cancelable: true\n });\n this.emitEvent(showEvt); // Don't show if canceled\n\n if (showEvt.defaultPrevented || this.isVisible) {\n this.isOpening = false; // Ensure the v-model reflects the current state\n\n this.updateModel(false);\n return;\n } // Show the modal\n\n\n this.doShow();\n },\n // Public method to hide modal\n hide: function hide() {\n var trigger = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';\n\n if (!this.isVisible || this.isClosing) {\n /* istanbul ignore next */\n return;\n }\n\n this.isClosing = true;\n var hideEvt = this.buildEvent('hide', {\n cancelable: trigger !== 'FORCE',\n trigger: trigger || null\n }); // We emit specific event for one of the three built-in buttons\n\n if (trigger === 'ok') {\n this.$emit('ok', hideEvt);\n } else if (trigger === 'cancel') {\n this.$emit('cancel', hideEvt);\n } else if (trigger === 'headerclose') {\n this.$emit('close', hideEvt);\n }\n\n this.emitEvent(hideEvt); // Hide if not canceled\n\n if (hideEvt.defaultPrevented || !this.isVisible) {\n this.isClosing = false; // Ensure v-model reflects current state\n\n this.updateModel(true);\n return;\n } // Stop observing for content changes\n\n\n if (this._observer) {\n this._observer.disconnect();\n\n this._observer = null;\n } // Trigger the hide transition\n\n\n this.isVisible = false; // Update the v-model\n\n this.updateModel(false);\n },\n // Public method to toggle modal visibility\n toggle: function toggle(triggerEl) {\n if (triggerEl) {\n this.return_focus = triggerEl;\n }\n\n if (this.isVisible) {\n this.hide('toggle');\n } else {\n this.show();\n }\n },\n // Private method to get the current document active element\n getActiveElement: function getActiveElement() {\n if (isBrowser) {\n var activeElement = document.activeElement; // Note: On IE11, `document.activeElement` may be null.\n // So we test it for truthiness first.\n // https://github.com/bootstrap-vue/bootstrap-vue/issues/3206\n // Returning focus to document.body may cause unwanted scrolls, so we\n // exclude setting focus on body\n\n if (activeElement && activeElement !== document.body && activeElement.focus) {\n // Preset the fallback return focus value if it is not set\n // `document.activeElement` should be the trigger element that was clicked or\n // in the case of using the v-model, which ever element has current focus\n // Will be overridden by some commands such as toggle, etc.\n return activeElement;\n }\n }\n\n return null;\n },\n // Private method to get a list of all tabable elements within modal content\n getTabables: function getTabables() {\n // Find all tabable elements in the modal content\n // Assumes users have not used tabindex > 0 on elements!\n return selectAll(TABABLE_SELECTOR, this.$refs.content).filter(isVisible).filter(function (i) {\n return i.tabIndex > -1 && !i.disabled;\n });\n },\n // Private method to finish showing modal\n doShow: function doShow() {\n var _this = this;\n\n /* istanbul ignore next: commenting out for now until we can test stacking */\n if (modalManager.modalsAreOpen && this.noStacking) {\n // If another modal(s) is already open, wait for it(them) to close\n this.listenOnRootOnce('bv::modal::hidden', this.doShow);\n return;\n }\n\n modalManager.registerModal(this); // Place modal in DOM\n\n this.isHidden = false;\n this.$nextTick(function () {\n // We do this in `$nextTick()` to ensure the modal is in DOM first\n // before we show it\n _this.isVisible = true;\n _this.isOpening = false; // Update the v-model\n\n _this.updateModel(true);\n\n _this.$nextTick(function () {\n // In a nextTick in case modal content is lazy\n // Observe changes in modal content and adjust if necessary\n _this._observer = observeDom(_this.$refs.content, _this.checkModalOverflow.bind(_this), OBSERVER_CONFIG);\n });\n });\n },\n // Transition handlers\n onBeforeEnter: function onBeforeEnter() {\n this.isTransitioning = true;\n this.setResizeEvent(true);\n },\n onEnter: function onEnter() {\n this.isBlock = true;\n },\n onAfterEnter: function onAfterEnter() {\n var _this2 = this;\n\n this.checkModalOverflow();\n this.isShow = true;\n this.isTransitioning = false; // We use `requestAF()` to allow transition hooks to complete\n // before passing control over to the other handlers\n // This will allow users to not have to use `$nextTick()` or `requestAF()`\n // when trying to pre-focus an element\n\n requestAF(function () {\n _this2.emitEvent(_this2.buildEvent('shown'));\n\n _this2.setEnforceFocus(true);\n\n _this2.$nextTick(function () {\n // Delayed in a `$nextTick()` to allow users time to pre-focus\n // an element if the wish\n _this2.focusFirst();\n });\n });\n },\n onBeforeLeave: function onBeforeLeave() {\n this.isTransitioning = true;\n this.setResizeEvent(false);\n this.setEnforceFocus(false);\n },\n onLeave: function onLeave() {\n // Remove the 'show' class\n this.isShow = false;\n },\n onAfterLeave: function onAfterLeave() {\n var _this3 = this;\n\n this.isBlock = false;\n this.isTransitioning = false;\n this.isModalOverflowing = false;\n this.isHidden = true;\n this.$nextTick(function () {\n _this3.isClosing = false;\n modalManager.unregisterModal(_this3);\n\n _this3.returnFocusTo(); // TODO: Need to find a way to pass the `trigger` property\n // to the `hidden` event, not just only the `hide` event\n\n\n _this3.emitEvent(_this3.buildEvent('hidden'));\n });\n },\n // Event emitter\n emitEvent: function emitEvent(bvModalEvt) {\n var type = bvModalEvt.type; // We emit on root first incase a global listener wants to cancel\n // the event first before the instance emits it's event\n\n this.emitOnRoot(\"bv::modal::\".concat(type), bvModalEvt, bvModalEvt.componentId);\n this.$emit(type, bvModalEvt);\n },\n // UI event handlers\n onDialogMousedown: function onDialogMousedown() {\n var _this4 = this;\n\n // Watch to see if the matching mouseup event occurs outside the dialog\n // And if it does, cancel the clickOut handler\n var modal = this.$refs.modal;\n\n var onceModalMouseup = function onceModalMouseup(evt) {\n eventOff(modal, 'mouseup', onceModalMouseup, EVT_OPTIONS);\n\n if (evt.target === modal) {\n _this4.ignoreBackdropClick = true;\n }\n };\n\n eventOn(modal, 'mouseup', onceModalMouseup, EVT_OPTIONS);\n },\n onClickOut: function onClickOut(evt) {\n if (this.ignoreBackdropClick) {\n // Click was initiated inside the modal content, but finished outside.\n // Set by the above onDialogMousedown handler\n this.ignoreBackdropClick = false;\n return;\n } // Do nothing if not visible, backdrop click disabled, or element\n // that generated click event is no longer in document body\n\n\n if (!this.isVisible || this.noCloseOnBackdrop || !contains(document.body, evt.target)) {\n return;\n } // If backdrop clicked, hide modal\n\n\n if (!contains(this.$refs.content, evt.target)) {\n this.hide('backdrop');\n }\n },\n onOk: function onOk() {\n this.hide('ok');\n },\n onCancel: function onCancel() {\n this.hide('cancel');\n },\n onClose: function onClose() {\n this.hide('headerclose');\n },\n onEsc: function onEsc(evt) {\n // If ESC pressed, hide modal\n if (evt.keyCode === KeyCodes.ESC && this.isVisible && !this.noCloseOnEsc) {\n this.hide('esc');\n }\n },\n // Document focusin listener\n focusHandler: function focusHandler(evt) {\n // If focus leaves modal content, bring it back\n var content = this.$refs.content;\n var target = evt.target;\n\n if (!this.noEnforceFocus && this.isTop && this.isVisible && content && document !== target && !contains(content, target)) {\n var tabables = this.getTabables();\n\n if (this.$refs.bottomTrap && target === this.$refs.bottomTrap) {\n // If user pressed TAB out of modal into our bottom trab trap element\n // Find the first tabable element in the modal content and focus it\n if (attemptFocus(tabables[0])) {\n // Focus was successful\n return;\n }\n } else if (this.$refs.topTrap && target === this.$refs.topTrap) {\n // If user pressed CTRL-TAB out of modal and into our top tab trap element\n // Find the last tabable element in the modal content and focus it\n if (attemptFocus(tabables[tabables.length - 1])) {\n // Focus was successful\n return;\n }\n } // Otherwise focus the modal content container\n\n\n content.focus({\n preventScroll: true\n });\n }\n },\n // Turn on/off focusin listener\n setEnforceFocus: function setEnforceFocus(on) {\n var method = on ? eventOn : eventOff;\n method(document, 'focusin', this.focusHandler, EVT_OPTIONS);\n },\n // Resize listener\n setResizeEvent: function setResizeEvent(on) {\n var method = on ? eventOn : eventOff; // These events should probably also check if\n // body is overflowing\n\n method(window, 'resize', this.checkModalOverflow, EVT_OPTIONS);\n method(window, 'orientationchange', this.checkModalOverflow, EVT_OPTIONS);\n },\n // Root listener handlers\n showHandler: function showHandler(id, triggerEl) {\n if (id === this.safeId()) {\n this.return_focus = triggerEl || this.getActiveElement();\n this.show();\n }\n },\n hideHandler: function hideHandler(id) {\n if (id === this.safeId()) {\n this.hide('event');\n }\n },\n toggleHandler: function toggleHandler(id, triggerEl) {\n if (id === this.safeId()) {\n this.toggle(triggerEl);\n }\n },\n modalListener: function modalListener(bvEvt) {\n // If another modal opens, close this one if stacking not permitted\n if (this.noStacking && bvEvt.vueTarget !== this) {\n this.hide();\n }\n },\n // Focus control handlers\n focusFirst: function focusFirst() {\n var _this5 = this;\n\n // Don't try and focus if we are SSR\n if (isBrowser) {\n requestAF(function () {\n var modal = _this5.$refs.modal;\n var content = _this5.$refs.content;\n\n var activeElement = _this5.getActiveElement(); // If the modal contains the activeElement, we don't do anything\n\n\n if (modal && content && !(activeElement && contains(content, activeElement))) {\n var ok = _this5.$refs['ok-button'];\n var cancel = _this5.$refs['cancel-button'];\n var close = _this5.$refs['close-button']; // Focus the appropriate button or modal content wrapper\n\n var autoFocus = _this5.autoFocusButton;\n var el = autoFocus === 'ok' && ok ? ok.$el || ok : autoFocus === 'cancel' && cancel ? cancel.$el || cancel : autoFocus === 'close' && close ? close.$el || close : content; // Focus the element\n\n attemptFocus(el);\n\n if (el === content) {\n // Make sure top of modal is showing (if longer than the viewport)\n _this5.$nextTick(function () {\n modal.scrollTop = 0;\n });\n }\n }\n });\n }\n },\n returnFocusTo: function returnFocusTo() {\n // Prefer `returnFocus` prop over event specified\n // `return_focus` value\n var el = this.returnFocus || this.return_focus || null;\n this.return_focus = null;\n this.$nextTick(function () {\n // Is el a string CSS selector?\n el = isString(el) ? select(el) : el;\n\n if (el) {\n // Possibly could be a component reference\n el = el.$el || el;\n attemptFocus(el);\n }\n });\n },\n checkModalOverflow: function checkModalOverflow() {\n if (this.isVisible) {\n var modal = this.$refs.modal;\n this.isModalOverflowing = modal.scrollHeight > document.documentElement.clientHeight;\n }\n },\n makeModal: function makeModal(h) {\n // Modal header\n var header = h();\n\n if (!this.hideHeader) {\n var modalHeader = this.normalizeSlot('modal-header', this.slotScope);\n\n if (!modalHeader) {\n var closeButton = h();\n\n if (!this.hideHeaderClose) {\n closeButton = h(BButtonClose, {\n ref: 'close-button',\n props: {\n disabled: this.isTransitioning,\n ariaLabel: this.headerCloseLabel,\n textVariant: this.headerCloseVariant || this.headerTextVariant\n },\n on: {\n click: this.onClose\n }\n }, [this.normalizeSlot('modal-header-close')]);\n }\n\n var domProps = !this.hasNormalizedSlot('modal-title') && this.titleHtml ? {\n innerHTML: this.titleHtml\n } : {};\n modalHeader = [h(this.titleTag, {\n staticClass: 'modal-title',\n class: this.titleClasses,\n attrs: {\n id: this.safeId('__BV_modal_title_')\n },\n domProps: domProps\n }, [this.normalizeSlot('modal-title', this.slotScope) || stripTags(this.title)]), closeButton];\n }\n\n header = h('header', {\n ref: 'header',\n staticClass: 'modal-header',\n class: this.headerClasses,\n attrs: {\n id: this.safeId('__BV_modal_header_')\n }\n }, [modalHeader]);\n } // Modal body\n\n\n var body = h('div', {\n ref: 'body',\n staticClass: 'modal-body',\n class: this.bodyClasses,\n attrs: {\n id: this.safeId('__BV_modal_body_')\n }\n }, this.normalizeSlot('default', this.slotScope)); // Modal footer\n\n var footer = h();\n\n if (!this.hideFooter) {\n var modalFooter = this.normalizeSlot('modal-footer', this.slotScope);\n\n if (!modalFooter) {\n var cancelButton = h();\n\n if (!this.okOnly) {\n var cancelHtml = this.cancelTitleHtml ? {\n innerHTML: this.cancelTitleHtml\n } : null;\n cancelButton = h(BButton, {\n ref: 'cancel-button',\n props: {\n variant: this.cancelVariant,\n size: this.buttonSize,\n disabled: this.cancelDisabled || this.busy || this.isTransitioning\n },\n on: {\n click: this.onCancel\n }\n }, [this.normalizeSlot('modal-cancel') || (cancelHtml ? h('span', {\n domProps: cancelHtml\n }) : stripTags(this.cancelTitle))]);\n }\n\n var okHtml = this.okTitleHtml ? {\n innerHTML: this.okTitleHtml\n } : null;\n var okButton = h(BButton, {\n ref: 'ok-button',\n props: {\n variant: this.okVariant,\n size: this.buttonSize,\n disabled: this.okDisabled || this.busy || this.isTransitioning\n },\n on: {\n click: this.onOk\n }\n }, [this.normalizeSlot('modal-ok') || (okHtml ? h('span', {\n domProps: okHtml\n }) : stripTags(this.okTitle))]);\n modalFooter = [cancelButton, okButton];\n }\n\n footer = h('footer', {\n ref: 'footer',\n staticClass: 'modal-footer',\n class: this.footerClasses,\n attrs: {\n id: this.safeId('__BV_modal_footer_')\n }\n }, [modalFooter]);\n } // Assemble modal content\n\n\n var modalContent = h('div', {\n ref: 'content',\n staticClass: 'modal-content',\n class: this.contentClass,\n attrs: {\n role: 'document',\n id: this.safeId('__BV_modal_content_'),\n tabindex: '-1'\n }\n }, [header, body, footer]); // Tab trap to prevent page from scrolling to next element in\n // tab index during enforce focus tab cycle\n\n var tabTrapTop = h();\n var tabTrapBottom = h();\n\n if (this.isVisible && !this.noEnforceFocus) {\n tabTrapTop = h('span', {\n ref: 'topTrap',\n attrs: {\n tabindex: '0'\n }\n });\n tabTrapBottom = h('span', {\n ref: 'bottomTrap',\n attrs: {\n tabindex: '0'\n }\n });\n } // Modal dialog wrapper\n\n\n var modalDialog = h('div', {\n ref: 'dialog',\n staticClass: 'modal-dialog',\n class: this.dialogClasses,\n on: {\n mousedown: this.onDialogMousedown\n }\n }, [tabTrapTop, modalContent, tabTrapBottom]); // Modal\n\n var modal = h('div', {\n ref: 'modal',\n staticClass: 'modal',\n class: this.modalClasses,\n style: this.modalStyles,\n directives: [{\n name: 'show',\n rawName: 'v-show',\n value: this.isVisible,\n expression: 'isVisible'\n }],\n attrs: {\n id: this.safeId(),\n role: 'dialog',\n 'aria-hidden': this.isVisible ? null : 'true',\n 'aria-modal': this.isVisible ? 'true' : null,\n 'aria-label': this.ariaLabel,\n 'aria-labelledby': this.hideHeader || this.ariaLabel || !(this.hasNormalizedSlot('modal-title') || this.titleHtml || this.title) ? null : this.safeId('__BV_modal_title_'),\n 'aria-describedby': this.safeId('__BV_modal_body_')\n },\n on: {\n keydown: this.onEsc,\n click: this.onClickOut\n }\n }, [modalDialog]); // Wrap modal in transition\n // Sadly, we can't use BVTransition here due to the differences in\n // transition durations for .modal and .modal-dialog. Not until\n // issue https://github.com/vuejs/vue/issues/9986 is resolved\n\n modal = h('transition', {\n props: {\n enterClass: '',\n enterToClass: '',\n enterActiveClass: '',\n leaveClass: '',\n leaveActiveClass: '',\n leaveToClass: ''\n },\n on: {\n beforeEnter: this.onBeforeEnter,\n enter: this.onEnter,\n afterEnter: this.onAfterEnter,\n beforeLeave: this.onBeforeLeave,\n leave: this.onLeave,\n afterLeave: this.onAfterLeave\n }\n }, [modal]); // Modal backdrop\n\n var backdrop = h();\n\n if (!this.hideBackdrop && this.isVisible) {\n backdrop = h('div', {\n staticClass: 'modal-backdrop',\n attrs: {\n id: this.safeId('__BV_modal_backdrop_')\n }\n }, [this.normalizeSlot('modal-backdrop')]);\n }\n\n backdrop = h(BVTransition, {\n props: {\n noFade: this.noFade\n }\n }, [backdrop]); // If the parent has a scoped style attribute, and the modal\n // is portalled, add the scoped attribute to the modal wrapper\n\n var scopedStyleAttrs = !this.static ? this.scopedStyleAttrs : {}; // Assemble modal and backdrop in an outer \n\n return h('div', {\n key: \"modal-outer-\".concat(this._uid),\n style: this.modalOuterStyle,\n attrs: _objectSpread({}, scopedStyleAttrs, {}, this.$attrs, {\n id: this.safeId('__BV_modal_outer_')\n })\n }, [modal, backdrop]);\n }\n },\n render: function render(h) {\n if (this.static) {\n return this.lazy && this.isHidden ? h() : this.makeModal(h);\n } else {\n return this.isHidden ? h() : h(BTransporterSingle, {}, [this.makeModal(h)]);\n }\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/modal/modal.js\n// module id = Du2k\n// module chunks = 0","var g;\r\n\r\n// This works in non-strict mode\r\ng = (function() {\r\n\treturn this;\r\n})();\r\n\r\ntry {\r\n\t// This works if eval is allowed (see CSP)\r\n\tg = g || Function(\"return this\")() || (1,eval)(\"this\");\r\n} catch(e) {\r\n\t// This works if the window reference is available\r\n\tif(typeof window === \"object\")\r\n\t\tg = window;\r\n}\r\n\r\n// g can still be undefined, but nothing to do about it...\r\n// We return undefined, instead of nothing here, so it's\r\n// easier to handle this case. if(!global) { ...}\r\n\r\nmodule.exports = g;\r\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// (webpack)/buildin/global.js\n// module id = DuR2\n// module chunks = 0","function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { arrayIncludes } from '../../utils/array';\nvar COMMON_ALIGNMENT = ['start', 'end', 'center'];\nexport var props = {\n tag: {\n type: String,\n default: 'div'\n },\n noGutters: {\n type: Boolean,\n default: false\n },\n alignV: {\n type: String,\n default: null,\n validator: function validator(str) {\n return arrayIncludes(COMMON_ALIGNMENT.concat(['baseline', 'stretch']), str);\n }\n },\n alignH: {\n type: String,\n default: null,\n validator: function validator(str) {\n return arrayIncludes(COMMON_ALIGNMENT.concat(['between', 'around']), str);\n }\n },\n alignContent: {\n type: String,\n default: null,\n validator: function validator(str) {\n return arrayIncludes(COMMON_ALIGNMENT.concat(['between', 'around', 'stretch']), str);\n }\n } // @vue/component\n\n};\nexport var BRow =\n/*#__PURE__*/\nVue.extend({\n name: 'BRow',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var _class;\n\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, mergeData(data, {\n staticClass: 'row',\n class: (_class = {\n 'no-gutters': props.noGutters\n }, _defineProperty(_class, \"align-items-\".concat(props.alignV), props.alignV), _defineProperty(_class, \"justify-content-\".concat(props.alignH), props.alignH), _defineProperty(_class, \"align-content-\".concat(props.alignContent), props.alignContent), _class)\n }), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/layout/row.js\n// module id = E4zB\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport pluckProps from '../../utils/pluck-props';\nimport { concat } from '../../utils/array';\nimport { getComponentConfig } from '../../utils/config';\nimport { addClass, removeClass } from '../../utils/dom';\nimport { isBoolean, isEvent, isFunction } from '../../utils/inspect';\nimport { keys } from '../../utils/object';\nimport { BLink, propsFactory as linkPropsFactory } from '../link/link'; // --- Constants --\n\nvar NAME = 'BButton';\nvar btnProps = {\n block: {\n type: Boolean,\n default: false\n },\n disabled: {\n type: Boolean,\n default: false\n },\n size: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'size');\n }\n },\n variant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'variant');\n }\n },\n type: {\n type: String,\n default: 'button'\n },\n tag: {\n type: String,\n default: 'button'\n },\n pill: {\n type: Boolean,\n default: false\n },\n squared: {\n type: Boolean,\n default: false\n },\n pressed: {\n // tri-state prop: true, false or null\n // => on, off, not a toggle\n type: Boolean,\n default: null\n }\n};\nvar linkProps = linkPropsFactory();\ndelete linkProps.href.default;\ndelete linkProps.to.default;\nvar linkPropKeys = keys(linkProps);\nexport var props = _objectSpread({}, linkProps, {}, btnProps); // --- Helper methods ---\n// Focus handler for toggle buttons. Needs class of 'focus' when focused.\n\nvar handleFocus = function handleFocus(evt) {\n if (evt.type === 'focusin') {\n addClass(evt.target, 'focus');\n } else if (evt.type === 'focusout') {\n removeClass(evt.target, 'focus');\n }\n}; // Is the requested button a link?\n\n\nvar isLink = function isLink(props) {\n // If tag prop is set to `a`, we use a b-link to get proper disabled handling\n return Boolean(props.href || props.to || props.tag && String(props.tag).toLowerCase() === 'a');\n}; // Is the button to be a toggle button?\n\n\nvar isToggle = function isToggle(props) {\n return isBoolean(props.pressed);\n}; // Is the button \"really\" a button?\n\n\nvar isButton = function isButton(props) {\n if (isLink(props)) {\n return false;\n } else if (props.tag && String(props.tag).toLowerCase() !== 'button') {\n return false;\n }\n\n return true;\n}; // Is the requested tag not a button or link?\n\n\nvar isNonStandardTag = function isNonStandardTag(props) {\n return !isLink(props) && !isButton(props);\n}; // Compute required classes (non static classes)\n\n\nvar computeClass = function computeClass(props) {\n var _ref;\n\n return [\"btn-\".concat(props.variant || getComponentConfig(NAME, 'variant')), (_ref = {}, _defineProperty(_ref, \"btn-\".concat(props.size), Boolean(props.size)), _defineProperty(_ref, 'btn-block', props.block), _defineProperty(_ref, 'rounded-pill', props.pill), _defineProperty(_ref, 'rounded-0', props.squared && !props.pill), _defineProperty(_ref, \"disabled\", props.disabled), _defineProperty(_ref, \"active\", props.pressed), _ref)];\n}; // Compute the link props to pass to b-link (if required)\n\n\nvar computeLinkProps = function computeLinkProps(props) {\n return isLink(props) ? pluckProps(linkPropKeys, props) : null;\n}; // Compute the attributes for a button\n\n\nvar computeAttrs = function computeAttrs(props, data) {\n var button = isButton(props);\n var link = isLink(props);\n var toggle = isToggle(props);\n var nonStdTag = isNonStandardTag(props);\n var role = data.attrs && data.attrs.role ? data.attrs.role : null;\n var tabindex = data.attrs ? data.attrs.tabindex : null;\n\n if (nonStdTag) {\n tabindex = '0';\n }\n\n return {\n // Type only used for \"real\" buttons\n type: button && !link ? props.type : null,\n // Disabled only set on \"real\" buttons\n disabled: button ? props.disabled : null,\n // We add a role of button when the tag is not a link or button for ARIA.\n // Don't bork any role provided in data.attrs when isLink or isButton\n role: nonStdTag ? 'button' : role,\n // We set the aria-disabled state for non-standard tags\n 'aria-disabled': nonStdTag ? String(props.disabled) : null,\n // For toggles, we need to set the pressed state for ARIA\n 'aria-pressed': toggle ? String(props.pressed) : null,\n // autocomplete off is needed in toggle mode to prevent some browsers from\n // remembering the previous setting when using the back button.\n autocomplete: toggle ? 'off' : null,\n // Tab index is used when the component is not a button.\n // Links are tabbable, but don't allow disabled, while non buttons or links\n // are not tabbable, so we mimic that functionality by disabling tabbing\n // when disabled, and adding a tabindex of '0' to non buttons or non links.\n tabindex: props.disabled && !button ? '-1' : tabindex\n };\n}; // @vue/component\n\n\nexport var BButton =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n functional: true,\n props: props,\n render: function render(h, _ref2) {\n var props = _ref2.props,\n data = _ref2.data,\n listeners = _ref2.listeners,\n children = _ref2.children;\n var toggle = isToggle(props);\n var link = isLink(props);\n var on = {\n click: function click(evt) {\n /* istanbul ignore if: blink/button disabled should handle this */\n if (props.disabled && isEvent(evt)) {\n evt.stopPropagation();\n evt.preventDefault();\n } else if (toggle && listeners && listeners['update:pressed']) {\n // Send .sync updates to any \"pressed\" prop (if .sync listeners)\n // Concat will normalize the value to an array\n // without double wrapping an array value in an array.\n concat(listeners['update:pressed']).forEach(function (fn) {\n if (isFunction(fn)) {\n fn(!props.pressed);\n }\n });\n }\n }\n };\n\n if (toggle) {\n on.focusin = handleFocus;\n on.focusout = handleFocus;\n }\n\n var componentData = {\n staticClass: 'btn',\n class: computeClass(props),\n props: computeLinkProps(props),\n attrs: computeAttrs(props, data),\n on: on\n };\n return h(link ? BLink : props.tag, mergeData(data, componentData), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/button/button.js\n// module id = EA8u\n// module chunks = 0","module.exports = function (done, value) {\n return { value: value, done: !!done };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_iter-step.js\n// module id = EGZi\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var symbolMap = {\n '1': '१',\n '2': '२',\n '3': '३',\n '4': '४',\n '5': '५',\n '6': '६',\n '7': '७',\n '8': '८',\n '9': '९',\n '0': '०'\n },\n numberMap = {\n '१': '1',\n '२': '2',\n '३': '3',\n '४': '4',\n '५': '5',\n '६': '6',\n '७': '7',\n '८': '8',\n '९': '9',\n '०': '0'\n };\n\n var hi = moment.defineLocale('hi', {\n months : 'जनवरी_फ़रवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितम्बर_अक्टूबर_नवम्बर_दिसम्बर'.split('_'),\n monthsShort : 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split('_'),\n monthsParseExact: true,\n weekdays : 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),\n weekdaysShort : 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split('_'),\n weekdaysMin : 'र_सो_मं_बु_गु_शु_श'.split('_'),\n longDateFormat : {\n LT : 'A h:mm बजे',\n LTS : 'A h:mm:ss बजे',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY, A h:mm बजे',\n LLLL : 'dddd, D MMMM YYYY, A h:mm बजे'\n },\n calendar : {\n sameDay : '[आज] LT',\n nextDay : '[कल] LT',\n nextWeek : 'dddd, LT',\n lastDay : '[कल] LT',\n lastWeek : '[पिछले] dddd, LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%s में',\n past : '%s पहले',\n s : 'कुछ ही क्षण',\n ss : '%d सेकंड',\n m : 'एक मिनट',\n mm : '%d मिनट',\n h : 'एक घंटा',\n hh : '%d घंटे',\n d : 'एक दिन',\n dd : '%d दिन',\n M : 'एक महीने',\n MM : '%d महीने',\n y : 'एक वर्ष',\n yy : '%d वर्ष'\n },\n preparse: function (string) {\n return string.replace(/[१२३४५६७८९०]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n // Hindi notation for meridiems are quite fuzzy in practice. While there exists\n // a rigid notion of a 'Pahar' it is not used as rigidly in modern Hindi.\n meridiemParse: /रात|सुबह|दोपहर|शाम/,\n meridiemHour : function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'रात') {\n return hour < 4 ? hour : hour + 12;\n } else if (meridiem === 'सुबह') {\n return hour;\n } else if (meridiem === 'दोपहर') {\n return hour >= 10 ? hour : hour + 12;\n } else if (meridiem === 'शाम') {\n return hour + 12;\n }\n },\n meridiem : function (hour, minute, isLower) {\n if (hour < 4) {\n return 'रात';\n } else if (hour < 10) {\n return 'सुबह';\n } else if (hour < 17) {\n return 'दोपहर';\n } else if (hour < 20) {\n return 'शाम';\n } else {\n return 'रात';\n }\n },\n week : {\n dow : 0, // Sunday is the first day of the week.\n doy : 6 // The week that contains Jan 6th is the first week of the year.\n }\n });\n\n return hi;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/hi.js\n// module id = ETHv\n// module chunks = 0","import { from as arrayFrom } from './array';\nimport { hasWindowSupport, hasDocumentSupport, hasPassiveEventSupport } from './env';\nimport { isFunction, isNull, isObject } from '../utils/inspect'; // --- Constants ---\n\nvar w = hasWindowSupport ? window : {};\nvar d = hasDocumentSupport ? document : {};\nvar elProto = typeof Element !== 'undefined' ? Element.prototype : {}; // --- Normalization utils ---\n// See: https://developer.mozilla.org/en-US/docs/Web/API/Element/matches#Polyfill\n\n/* istanbul ignore next */\n\nexport var matchesEl = elProto.matches || elProto.msMatchesSelector || elProto.webkitMatchesSelector; // See: https://developer.mozilla.org/en-US/docs/Web/API/Element/closest\n\n/* istanbul ignore next */\n\nexport var closestEl = elProto.closest || function (sel)\n/* istanbul ignore next */\n{\n var el = this;\n\n do {\n // Use our \"patched\" matches function\n if (matches(el, sel)) {\n return el;\n }\n\n el = el.parentElement || el.parentNode;\n } while (!isNull(el) && el.nodeType === Node.ELEMENT_NODE);\n\n return null;\n}; // `requestAnimationFrame()` convenience method\n\nexport var requestAF = w.requestAnimationFrame || w.webkitRequestAnimationFrame || w.mozRequestAnimationFrame || w.msRequestAnimationFrame || w.oRequestAnimationFrame || // Fallback, but not a true polyfill\n// Only needed for Opera Mini\n\n/* istanbul ignore next */\nfunction (cb) {\n return setTimeout(cb, 16);\n};\nexport var MutationObs = w.MutationObserver || w.WebKitMutationObserver || w.MozMutationObserver || null; // --- Utils ---\n// Normalize event options based on support of passive option\n// Exported only for testing purposes\n\nexport var parseEventOptions = function parseEventOptions(options) {\n /* istanbul ignore else: can't test in JSDOM, as it supports passive */\n if (hasPassiveEventSupport) {\n return isObject(options) ? options : {\n useCapture: Boolean(options || false)\n };\n } else {\n // Need to translate to actual Boolean value\n return Boolean(isObject(options) ? options.useCapture : options);\n }\n}; // Attach an event listener to an element\n\nexport var eventOn = function eventOn(el, evtName, handler, options) {\n if (el && el.addEventListener) {\n el.addEventListener(evtName, handler, parseEventOptions(options));\n }\n}; // Remove an event listener from an element\n\nexport var eventOff = function eventOff(el, evtName, handler, options) {\n if (el && el.removeEventListener) {\n el.removeEventListener(evtName, handler, parseEventOptions(options));\n }\n}; // Determine if an element is an HTML Element\n\nexport var isElement = function isElement(el) {\n return Boolean(el && el.nodeType === Node.ELEMENT_NODE);\n}; // Determine if an HTML element is visible - Faster than CSS check\n\nexport var isVisible = function isVisible(el) {\n if (!isElement(el) || !contains(d.body, el)) {\n return false;\n }\n\n if (el.style.display === 'none') {\n // We do this check to help with vue-test-utils when using v-show\n\n /* istanbul ignore next */\n return false;\n } // All browsers support getBoundingClientRect(), except JSDOM as it returns all 0's for values :(\n // So any tests that need isVisible will fail in JSDOM\n // Except when we override the getBCR prototype in some tests\n\n\n var bcr = getBCR(el);\n return Boolean(bcr && bcr.height > 0 && bcr.width > 0);\n}; // Determine if an element is disabled\n\nexport var isDisabled = function isDisabled(el) {\n return !isElement(el) || el.disabled || Boolean(getAttr(el, 'disabled')) || hasClass(el, 'disabled');\n}; // Cause/wait-for an element to reflow it's content (adjusting it's height/width)\n\nexport var reflow = function reflow(el) {\n // Requesting an elements offsetHight will trigger a reflow of the element content\n\n /* istanbul ignore next: reflow doesn't happen in JSDOM */\n return isElement(el) && el.offsetHeight;\n}; // Select all elements matching selector. Returns `[]` if none found\n\nexport var selectAll = function selectAll(selector, root) {\n return arrayFrom((isElement(root) ? root : d).querySelectorAll(selector));\n}; // Select a single element, returns `null` if not found\n\nexport var select = function select(selector, root) {\n return (isElement(root) ? root : d).querySelector(selector) || null;\n}; // Determine if an element matches a selector\n\nexport var matches = function matches(el, selector) {\n if (!isElement(el)) {\n return false;\n }\n\n return matchesEl.call(el, selector);\n}; // Finds closest element matching selector. Returns `null` if not found\n\nexport var closest = function closest(selector, root) {\n if (!isElement(root)) {\n return null;\n }\n\n var el = closestEl.call(root, selector); // Emulate jQuery closest and return `null` if match is the passed in element (root)\n\n return el === root ? null : el;\n}; // Returns true if the parent element contains the child element\n\nexport var contains = function contains(parent, child) {\n if (!parent || !isFunction(parent.contains)) {\n return false;\n }\n\n return parent.contains(child);\n}; // Get an element given an ID\n\nexport var getById = function getById(id) {\n return d.getElementById(/^#/.test(id) ? id.slice(1) : id) || null;\n}; // Add a class to an element\n\nexport var addClass = function addClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n el.classList.add(className);\n }\n}; // Remove a class from an element\n\nexport var removeClass = function removeClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n el.classList.remove(className);\n }\n}; // Test if an element has a class\n\nexport var hasClass = function hasClass(el, className) {\n // We are checking for `el.classList` existence here since IE 11\n // returns `undefined` for some elements (e.g. SVG elements)\n // See https://github.com/bootstrap-vue/bootstrap-vue/issues/2713\n if (className && isElement(el) && el.classList) {\n return el.classList.contains(className);\n }\n\n return false;\n}; // Set an attribute on an element\n\nexport var setAttr = function setAttr(el, attr, val) {\n if (attr && isElement(el)) {\n el.setAttribute(attr, val);\n }\n}; // Remove an attribute from an element\n\nexport var removeAttr = function removeAttr(el, attr) {\n if (attr && isElement(el)) {\n el.removeAttribute(attr);\n }\n}; // Get an attribute value from an element\n// Returns `null` if not found\n\nexport var getAttr = function getAttr(el, attr) {\n return attr && isElement(el) ? el.getAttribute(attr) : null;\n}; // Determine if an attribute exists on an element\n// Returns `true` or `false`, or `null` if element not found\n\nexport var hasAttr = function hasAttr(el, attr) {\n return attr && isElement(el) ? el.hasAttribute(attr) : null;\n}; // Return the Bounding Client Rect of an element\n// Returns `null` if not an element\n\n/* istanbul ignore next: getBoundingClientRect() doesn't work in JSDOM */\n\nexport var getBCR = function getBCR(el) {\n return isElement(el) ? el.getBoundingClientRect() : null;\n}; // Get computed style object for an element\n\n/* istanbul ignore next: getComputedStyle() doesn't work in JSDOM */\n\nexport var getCS = function getCS(el) {\n return hasWindowSupport && isElement(el) ? w.getComputedStyle(el) : {};\n}; // Returns a `Selection` object representing the range of text selected\n// Returns `null` if no window support is given\n\n/* istanbul ignore next: getSelection() doesn't work in JSDOM */\n\nexport var getSel = function getSel() {\n return hasWindowSupport && w.getSelection ? w.getSelection() : null;\n}; // Return an element's offset with respect to document element\n// https://j11y.io/jquery/#v=git&fn=jQuery.fn.offset\n\nexport var offset = function offset(el)\n/* istanbul ignore next: getBoundingClientRect(), getClientRects() doesn't work in JSDOM */\n{\n var _offset = {\n top: 0,\n left: 0\n };\n\n if (!isElement(el) || el.getClientRects().length === 0) {\n return _offset;\n }\n\n var bcr = getBCR(el);\n\n if (bcr) {\n var win = el.ownerDocument.defaultView;\n _offset.top = bcr.top + win.pageYOffset;\n _offset.left = bcr.left + win.pageXOffset;\n }\n\n return _offset;\n}; // Return an element's offset with respect to to it's offsetParent\n// https://j11y.io/jquery/#v=git&fn=jQuery.fn.position\n\nexport var position = function position(el)\n/* istanbul ignore next: getBoundingClientRect() doesn't work in JSDOM */\n{\n var _offset = {\n top: 0,\n left: 0\n };\n\n if (!isElement(el)) {\n return _offset;\n }\n\n var parentOffset = {\n top: 0,\n left: 0\n };\n var elStyles = getCS(el);\n\n if (elStyles.position === 'fixed') {\n _offset = getBCR(el) || _offset;\n } else {\n _offset = offset(el);\n var doc = el.ownerDocument;\n var offsetParent = el.offsetParent || doc.documentElement;\n\n while (offsetParent && (offsetParent === doc.body || offsetParent === doc.documentElement) && getCS(offsetParent).position === 'static') {\n offsetParent = offsetParent.parentNode;\n }\n\n if (offsetParent && offsetParent !== el && offsetParent.nodeType === Node.ELEMENT_NODE) {\n parentOffset = offset(offsetParent);\n var offsetParentStyles = getCS(offsetParent);\n parentOffset.top += parseFloat(offsetParentStyles.borderTopWidth);\n parentOffset.left += parseFloat(offsetParentStyles.borderLeftWidth);\n }\n }\n\n return {\n top: _offset.top - parentOffset.top - parseFloat(elStyles.marginTop),\n left: _offset.left - parentOffset.left - parseFloat(elStyles.marginLeft)\n };\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/utils/dom.js\n// module id = EWS6\n// module chunks = 0","// https://github.com/tc39/proposal-promise-finally\n'use strict';\nvar $export = require('./_export');\nvar core = require('./_core');\nvar global = require('./_global');\nvar speciesConstructor = require('./_species-constructor');\nvar promiseResolve = require('./_promise-resolve');\n\n$export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) {\n var C = speciesConstructor(this, core.Promise || global.Promise);\n var isFunction = typeof onFinally == 'function';\n return this.then(\n isFunction ? function (x) {\n return promiseResolve(C, onFinally()).then(function () { return x; });\n } : onFinally,\n isFunction ? function (e) {\n return promiseResolve(C, onFinally()).then(function () { throw e; });\n } : onFinally\n );\n} });\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/es7.promise.finally.js\n// module id = EqBC\n// module chunks = 0","module.exports = function (it) {\n return typeof it === 'object' ? it !== null : typeof it === 'function';\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_is-object.js\n// module id = EqjI\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var symbolMap = {\n '1': '၁',\n '2': '၂',\n '3': '၃',\n '4': '၄',\n '5': '၅',\n '6': '၆',\n '7': '၇',\n '8': '၈',\n '9': '၉',\n '0': '၀'\n }, numberMap = {\n '၁': '1',\n '၂': '2',\n '၃': '3',\n '၄': '4',\n '၅': '5',\n '၆': '6',\n '၇': '7',\n '၈': '8',\n '၉': '9',\n '၀': '0'\n };\n\n var my = moment.defineLocale('my', {\n months: 'ဇန်နဝါရီ_ဖေဖော်ဝါရီ_မတ်_ဧပြီ_မေ_ဇွန်_ဇူလိုင်_သြဂုတ်_စက်တင်ဘာ_အောက်တိုဘာ_နိုဝင်ဘာ_ဒီဇင်ဘာ'.split('_'),\n monthsShort: 'ဇန်_ဖေ_မတ်_ပြီ_မေ_ဇွန်_လိုင်_သြ_စက်_အောက်_နို_ဒီ'.split('_'),\n weekdays: 'တနင်္ဂနွေ_တနင်္လာ_အင်္ဂါ_ဗုဒ္ဓဟူး_ကြာသပတေး_သောကြာ_စနေ'.split('_'),\n weekdaysShort: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n weekdaysMin: 'နွေ_လာ_ဂါ_ဟူး_ကြာ_သော_နေ'.split('_'),\n\n longDateFormat: {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L: 'DD/MM/YYYY',\n LL: 'D MMMM YYYY',\n LLL: 'D MMMM YYYY HH:mm',\n LLLL: 'dddd D MMMM YYYY HH:mm'\n },\n calendar: {\n sameDay: '[ယနေ.] LT [မှာ]',\n nextDay: '[မနက်ဖြန်] LT [မှာ]',\n nextWeek: 'dddd LT [မှာ]',\n lastDay: '[မနေ.က] LT [မှာ]',\n lastWeek: '[ပြီးခဲ့သော] dddd LT [မှာ]',\n sameElse: 'L'\n },\n relativeTime: {\n future: 'လာမည့် %s မှာ',\n past: 'လွန်ခဲ့သော %s က',\n s: 'စက္ကန်.အနည်းငယ်',\n ss : '%d စက္ကန့်',\n m: 'တစ်မိနစ်',\n mm: '%d မိနစ်',\n h: 'တစ်နာရီ',\n hh: '%d နာရီ',\n d: 'တစ်ရက်',\n dd: '%d ရက်',\n M: 'တစ်လ',\n MM: '%d လ',\n y: 'တစ်နှစ်',\n yy: '%d နှစ်'\n },\n preparse: function (string) {\n return string.replace(/[၁၂၃၄၅၆၇၈၉၀]/g, function (match) {\n return numberMap[match];\n });\n },\n postformat: function (string) {\n return string.replace(/\\d/g, function (match) {\n return symbolMap[match];\n });\n },\n week: {\n dow: 1, // Monday is the first day of the week.\n doy: 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return my;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/my.js\n// module id = F+2e\n// module chunks = 0","import { stripTags } from '../utils/html';\nimport { isArray, isPlainObject, isUndefined } from '../utils/inspect';\nimport { keys } from '../utils/object'; // @vue/component\n\nexport default {\n props: {\n options: {\n type: [Array, Object],\n default: function _default() {\n return [];\n }\n },\n valueField: {\n type: String,\n default: 'value'\n },\n textField: {\n type: String,\n default: 'text'\n },\n htmlField: {\n type: String,\n default: 'html'\n },\n disabledField: {\n type: String,\n default: 'disabled'\n }\n },\n computed: {\n formOptions: function formOptions() {\n var options = this.options;\n var valueField = this.valueField;\n var textField = this.textField;\n var htmlField = this.htmlField;\n var disabledField = this.disabledField;\n\n if (isArray(options)) {\n // Normalize flat-ish arrays to Array of Objects\n return options.map(function (option) {\n if (isPlainObject(option)) {\n var value = option[valueField];\n var text = String(option[textField]);\n return {\n value: isUndefined(value) ? text : value,\n text: stripTags(text),\n html: option[htmlField],\n disabled: Boolean(option[disabledField])\n };\n }\n\n return {\n value: option,\n text: stripTags(String(option)),\n disabled: false\n };\n });\n } else {\n // options is Object\n // Normalize Objects to Array of Objects\n return keys(options).map(function (key) {\n var option = options[key] || {};\n\n if (isPlainObject(option)) {\n var value = option[valueField];\n var text = option[textField];\n return {\n value: isUndefined(value) ? key : value,\n text: isUndefined(text) ? stripTags(String(key)) : stripTags(String(text)),\n html: option[htmlField],\n disabled: Boolean(option[disabledField])\n };\n }\n\n return {\n value: key,\n text: stripTags(String(option)),\n disabled: false\n };\n });\n }\n }\n }\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/mixins/form-options.js\n// module id = FAPV\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var it = moment.defineLocale('it', {\n months : 'gennaio_febbraio_marzo_aprile_maggio_giugno_luglio_agosto_settembre_ottobre_novembre_dicembre'.split('_'),\n monthsShort : 'gen_feb_mar_apr_mag_giu_lug_ago_set_ott_nov_dic'.split('_'),\n weekdays : 'domenica_lunedì_martedì_mercoledì_giovedì_venerdì_sabato'.split('_'),\n weekdaysShort : 'dom_lun_mar_mer_gio_ven_sab'.split('_'),\n weekdaysMin : 'do_lu_ma_me_gi_ve_sa'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY HH:mm',\n LLLL : 'dddd D MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[Oggi alle] LT',\n nextDay: '[Domani alle] LT',\n nextWeek: 'dddd [alle] LT',\n lastDay: '[Ieri alle] LT',\n lastWeek: function () {\n switch (this.day()) {\n case 0:\n return '[la scorsa] dddd [alle] LT';\n default:\n return '[lo scorso] dddd [alle] LT';\n }\n },\n sameElse: 'L'\n },\n relativeTime : {\n future : function (s) {\n return ((/^[0-9].+$/).test(s) ? 'tra' : 'in') + ' ' + s;\n },\n past : '%s fa',\n s : 'alcuni secondi',\n ss : '%d secondi',\n m : 'un minuto',\n mm : '%d minuti',\n h : 'un\\'ora',\n hh : '%d ore',\n d : 'un giorno',\n dd : '%d giorni',\n M : 'un mese',\n MM : '%d mesi',\n y : 'un anno',\n yy : '%d anni'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal: '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return it;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/it.js\n// module id = FKXc\n// module chunks = 0","export default {\n props: {\n perPage: {\n type: [Number, String],\n default: 0\n },\n currentPage: {\n type: [Number, String],\n default: 1\n }\n },\n computed: {\n localPaging: function localPaging() {\n return this.hasProvider ? !!this.noProviderPaging : true;\n },\n paginatedItems: function paginatedItems() {\n var items = this.sortedItems || this.filteredItems || this.localItems || [];\n var currentPage = Math.max(parseInt(this.currentPage, 10) || 1, 1);\n var perPage = Math.max(parseInt(this.perPage, 10) || 0, 0); // Apply local pagination\n\n if (this.localPaging && !!perPage) {\n // Grab the current page of data (which may be past filtered items limit)\n items = items.slice((currentPage - 1) * perPage, currentPage * perPage);\n } // Return the items to display in the table\n\n\n return items;\n }\n }\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/table/helpers/mixin-pagination.js\n// module id = FMWT\n// module chunks = 0","import { BFormCheckbox } from './form-checkbox';\nimport { BFormCheckboxGroup } from './form-checkbox-group';\nimport { pluginFactory } from '../../utils/plugins';\nvar FormCheckboxPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BFormCheckbox: BFormCheckbox,\n BCheckbox: BFormCheckbox,\n BCheck: BFormCheckbox,\n BFormCheckboxGroup: BFormCheckboxGroup,\n BCheckboxGroup: BFormCheckboxGroup,\n BCheckGroup: BFormCheckboxGroup\n }\n});\nexport { FormCheckboxPlugin, BFormCheckbox, BFormCheckboxGroup };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-checkbox/index.js\n// module id = FQrH\n// module chunks = 0","import Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { normalizeSlot } from '../../utils/normalize-slot';\nimport { BMediaBody } from './media-body';\nimport { BMediaAside } from './media-aside';\nexport var props = {\n tag: {\n type: String,\n default: 'div'\n },\n rightAlign: {\n type: Boolean,\n default: false\n },\n verticalAlign: {\n type: String,\n default: 'top'\n },\n noBody: {\n type: Boolean,\n default: false\n } // @vue/component\n\n};\nexport var BMedia =\n/*#__PURE__*/\nVue.extend({\n name: 'BMedia',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n slots = _ref.slots,\n scopedSlots = _ref.scopedSlots,\n children = _ref.children;\n var childNodes = props.noBody ? children : [];\n\n if (!props.noBody) {\n var $slots = slots();\n var $scopedSlots = scopedSlots || {};\n var $aside = normalizeSlot('aside', {}, $scopedSlots, $slots);\n var $default = normalizeSlot('default', {}, $scopedSlots, $slots);\n\n if ($aside && !props.rightAlign) {\n childNodes.push(h(BMediaAside, {\n staticClass: 'mr-3',\n props: {\n verticalAlign: props.verticalAlign\n }\n }, $aside));\n }\n\n childNodes.push(h(BMediaBody, {}, $default));\n\n if ($aside && props.rightAlign) {\n childNodes.push(h(BMediaAside, {\n staticClass: 'ml-3',\n props: {\n verticalAlign: props.verticalAlign\n }\n }, $aside));\n }\n }\n\n return h(props.tag, mergeData(data, {\n staticClass: 'media'\n }), childNodes);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/media/media.js\n// module id = FQxg\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var tzm = moment.defineLocale('tzm', {\n months : 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split('_'),\n monthsShort : 'ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ'.split('_'),\n weekdays : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysShort : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n weekdaysMin : 'ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS: 'HH:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY HH:mm',\n LLLL : 'dddd D MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[ⴰⵙⴷⵅ ⴴ] LT',\n nextDay: '[ⴰⵙⴽⴰ ⴴ] LT',\n nextWeek: 'dddd [ⴴ] LT',\n lastDay: '[ⴰⵚⴰⵏⵜ ⴴ] LT',\n lastWeek: 'dddd [ⴴ] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'ⴷⴰⴷⵅ ⵙ ⵢⴰⵏ %s',\n past : 'ⵢⴰⵏ %s',\n s : 'ⵉⵎⵉⴽ',\n ss : '%d ⵉⵎⵉⴽ',\n m : 'ⵎⵉⵏⵓⴺ',\n mm : '%d ⵎⵉⵏⵓⴺ',\n h : 'ⵙⴰⵄⴰ',\n hh : '%d ⵜⴰⵙⵙⴰⵄⵉⵏ',\n d : 'ⴰⵙⵙ',\n dd : '%d oⵙⵙⴰⵏ',\n M : 'ⴰⵢoⵓⵔ',\n MM : '%d ⵉⵢⵢⵉⵔⵏ',\n y : 'ⴰⵙⴳⴰⵙ',\n yy : '%d ⵉⵙⴳⴰⵙⵏ'\n },\n week : {\n dow : 6, // Saturday is the first day of the week.\n doy : 12 // The week that contains Jan 12th is the first week of the year.\n }\n });\n\n return tzm;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/tzm.js\n// module id = FRPF\n// module chunks = 0","/*\n\tMIT License http://www.opensource.org/licenses/mit-license.php\n\tAuthor Tobias Koppers @sokra\n*/\n// css base code, injected by the css-loader\nmodule.exports = function(useSourceMap) {\n\tvar list = [];\n\n\t// return the list of modules as css string\n\tlist.toString = function toString() {\n\t\treturn this.map(function (item) {\n\t\t\tvar content = cssWithMappingToString(item, useSourceMap);\n\t\t\tif(item[2]) {\n\t\t\t\treturn \"@media \" + item[2] + \"{\" + content + \"}\";\n\t\t\t} else {\n\t\t\t\treturn content;\n\t\t\t}\n\t\t}).join(\"\");\n\t};\n\n\t// import a list of modules into the list\n\tlist.i = function(modules, mediaQuery) {\n\t\tif(typeof modules === \"string\")\n\t\t\tmodules = [[null, modules, \"\"]];\n\t\tvar alreadyImportedModules = {};\n\t\tfor(var i = 0; i < this.length; i++) {\n\t\t\tvar id = this[i][0];\n\t\t\tif(typeof id === \"number\")\n\t\t\t\talreadyImportedModules[id] = true;\n\t\t}\n\t\tfor(i = 0; i < modules.length; i++) {\n\t\t\tvar item = modules[i];\n\t\t\t// skip already imported module\n\t\t\t// this implementation is not 100% perfect for weird media query combinations\n\t\t\t// when a module is imported multiple times with different media queries.\n\t\t\t// I hope this will never occur (Hey this way we have smaller bundles)\n\t\t\tif(typeof item[0] !== \"number\" || !alreadyImportedModules[item[0]]) {\n\t\t\t\tif(mediaQuery && !item[2]) {\n\t\t\t\t\titem[2] = mediaQuery;\n\t\t\t\t} else if(mediaQuery) {\n\t\t\t\t\titem[2] = \"(\" + item[2] + \") and (\" + mediaQuery + \")\";\n\t\t\t\t}\n\t\t\t\tlist.push(item);\n\t\t\t}\n\t\t}\n\t};\n\treturn list;\n};\n\nfunction cssWithMappingToString(item, useSourceMap) {\n\tvar content = item[1] || '';\n\tvar cssMapping = item[3];\n\tif (!cssMapping) {\n\t\treturn content;\n\t}\n\n\tif (useSourceMap && typeof btoa === 'function') {\n\t\tvar sourceMapping = toComment(cssMapping);\n\t\tvar sourceURLs = cssMapping.sources.map(function (source) {\n\t\t\treturn '/*# sourceURL=' + cssMapping.sourceRoot + source + ' */'\n\t\t});\n\n\t\treturn [content].concat(sourceURLs).concat([sourceMapping]).join('\\n');\n\t}\n\n\treturn [content].join('\\n');\n}\n\n// Adapted from convert-source-map (MIT)\nfunction toComment(sourceMap) {\n\t// eslint-disable-next-line no-undef\n\tvar base64 = btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap))));\n\tvar data = 'sourceMappingURL=data:application/json;charset=utf-8;base64,' + base64;\n\n\treturn '/*# ' + data + ' */';\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/css-loader/lib/css-base.js\n// module id = FZ+f\n// module chunks = 0","var core = module.exports = { version: '2.6.9' };\nif (typeof __e == 'number') __e = core; // eslint-disable-line no-undef\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_core.js\n// module id = FeBl\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var nb = moment.defineLocale('nb', {\n months : 'januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember'.split('_'),\n monthsShort : 'jan._feb._mars_april_mai_juni_juli_aug._sep._okt._nov._des.'.split('_'),\n monthsParseExact : true,\n weekdays : 'søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag'.split('_'),\n weekdaysShort : 'sø._ma._ti._on._to._fr._lø.'.split('_'),\n weekdaysMin : 'sø_ma_ti_on_to_fr_lø'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY [kl.] HH:mm',\n LLLL : 'dddd D. MMMM YYYY [kl.] HH:mm'\n },\n calendar : {\n sameDay: '[i dag kl.] LT',\n nextDay: '[i morgen kl.] LT',\n nextWeek: 'dddd [kl.] LT',\n lastDay: '[i går kl.] LT',\n lastWeek: '[forrige] dddd [kl.] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'om %s',\n past : '%s siden',\n s : 'noen sekunder',\n ss : '%d sekunder',\n m : 'ett minutt',\n mm : '%d minutter',\n h : 'en time',\n hh : '%d timer',\n d : 'en dag',\n dd : '%d dager',\n M : 'en måned',\n MM : '%d måneder',\n y : 'ett år',\n yy : '%d år'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return nb;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/nb.js\n// module id = FlzV\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var sv = moment.defineLocale('sv', {\n months : 'januari_februari_mars_april_maj_juni_juli_augusti_september_oktober_november_december'.split('_'),\n monthsShort : 'jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec'.split('_'),\n weekdays : 'söndag_måndag_tisdag_onsdag_torsdag_fredag_lördag'.split('_'),\n weekdaysShort : 'sön_mån_tis_ons_tor_fre_lör'.split('_'),\n weekdaysMin : 'sö_må_ti_on_to_fr_lö'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'YYYY-MM-DD',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [kl.] HH:mm',\n LLLL : 'dddd D MMMM YYYY [kl.] HH:mm',\n lll : 'D MMM YYYY HH:mm',\n llll : 'ddd D MMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[Idag] LT',\n nextDay: '[Imorgon] LT',\n lastDay: '[Igår] LT',\n nextWeek: '[På] dddd LT',\n lastWeek: '[I] dddd[s] LT',\n sameElse: 'L'\n },\n relativeTime : {\n future : 'om %s',\n past : 'för %s sedan',\n s : 'några sekunder',\n ss : '%d sekunder',\n m : 'en minut',\n mm : '%d minuter',\n h : 'en timme',\n hh : '%d timmar',\n d : 'en dag',\n dd : '%d dagar',\n M : 'en månad',\n MM : '%d månader',\n y : 'ett år',\n yy : '%d år'\n },\n dayOfMonthOrdinalParse: /\\d{1,2}(e|a)/,\n ordinal : function (number) {\n var b = number % 10,\n output = (~~(number % 100 / 10) === 1) ? 'e' :\n (b === 1) ? 'a' :\n (b === 2) ? 'a' :\n (b === 3) ? 'e' : 'e';\n return number + output;\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return sv;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/sv.js\n// module id = Fpqq\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n function processRelativeTime(number, withoutSuffix, key, isFuture) {\n var format = {\n 'm': ['eine Minute', 'einer Minute'],\n 'h': ['eine Stunde', 'einer Stunde'],\n 'd': ['ein Tag', 'einem Tag'],\n 'dd': [number + ' Tage', number + ' Tagen'],\n 'M': ['ein Monat', 'einem Monat'],\n 'MM': [number + ' Monate', number + ' Monaten'],\n 'y': ['ein Jahr', 'einem Jahr'],\n 'yy': [number + ' Jahre', number + ' Jahren']\n };\n return withoutSuffix ? format[key][0] : format[key][1];\n }\n\n var deCh = moment.defineLocale('de-ch', {\n months : 'Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember'.split('_'),\n monthsShort : 'Jan._Feb._März_Apr._Mai_Juni_Juli_Aug._Sep._Okt._Nov._Dez.'.split('_'),\n monthsParseExact : true,\n weekdays : 'Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag'.split('_'),\n weekdaysShort : 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysMin : 'So_Mo_Di_Mi_Do_Fr_Sa'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT: 'HH:mm',\n LTS: 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D. MMMM YYYY',\n LLL : 'D. MMMM YYYY HH:mm',\n LLLL : 'dddd, D. MMMM YYYY HH:mm'\n },\n calendar : {\n sameDay: '[heute um] LT [Uhr]',\n sameElse: 'L',\n nextDay: '[morgen um] LT [Uhr]',\n nextWeek: 'dddd [um] LT [Uhr]',\n lastDay: '[gestern um] LT [Uhr]',\n lastWeek: '[letzten] dddd [um] LT [Uhr]'\n },\n relativeTime : {\n future : 'in %s',\n past : 'vor %s',\n s : 'ein paar Sekunden',\n ss : '%d Sekunden',\n m : processRelativeTime,\n mm : '%d Minuten',\n h : processRelativeTime,\n hh : '%d Stunden',\n d : processRelativeTime,\n dd : processRelativeTime,\n M : processRelativeTime,\n MM : processRelativeTime,\n y : processRelativeTime,\n yy : processRelativeTime\n },\n dayOfMonthOrdinalParse: /\\d{1,2}\\./,\n ordinal : '%d.',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return deCh;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/de-ch.js\n// module id = Frex\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/axios/lib/core/createError.js\n// module id = FtD3\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var gl = moment.defineLocale('gl', {\n months : 'xaneiro_febreiro_marzo_abril_maio_xuño_xullo_agosto_setembro_outubro_novembro_decembro'.split('_'),\n monthsShort : 'xan._feb._mar._abr._mai._xuñ._xul._ago._set._out._nov._dec.'.split('_'),\n monthsParseExact: true,\n weekdays : 'domingo_luns_martes_mércores_xoves_venres_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mér._xov._ven._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mé_xo_ve_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'H:mm',\n LTS : 'H:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY H:mm',\n LLLL : 'dddd, D [de] MMMM [de] YYYY H:mm'\n },\n calendar : {\n sameDay : function () {\n return '[hoxe ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT';\n },\n nextDay : function () {\n return '[mañá ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT';\n },\n lastDay : function () {\n return '[onte ' + ((this.hours() !== 1) ? 'á' : 'a') + '] LT';\n },\n lastWeek : function () {\n return '[o] dddd [pasado ' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : function (str) {\n if (str.indexOf('un') === 0) {\n return 'n' + str;\n }\n return 'en ' + str;\n },\n past : 'hai %s',\n s : 'uns segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'unha hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un ano',\n yy : '%d anos'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return gl;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/gl.js\n// module id = FuaP\n// module chunks = 0","import Vue from '../../utils/vue';\nimport idMixin from '../../mixins/id';\nimport normalizeSlotMixin from '../../mixins/normalize-slot';\nimport BVTransition from '../../utils/bv-transition'; // @vue/component\n\nexport var BTab =\n/*#__PURE__*/\nVue.extend({\n name: 'BTab',\n mixins: [idMixin, normalizeSlotMixin],\n inject: {\n bvTabs: {\n default: function _default() {\n return {\n // Don't set a tab index if not rendered inside
\n noKeyNav: true\n };\n }\n }\n },\n props: {\n active: {\n type: Boolean,\n default: false\n },\n tag: {\n type: String,\n default: 'div'\n },\n buttonId: {\n type: String,\n default: ''\n },\n title: {\n type: String,\n default: ''\n },\n titleItemClass: {\n // Sniffed by tabs.js and added to nav 'li.nav-item'\n type: [String, Array, Object],\n default: null\n },\n titleLinkClass: {\n // Sniffed by tabs.js and added to nav 'a.nav-link'\n type: [String, Array, Object],\n default: null\n },\n headHtml: {\n // Is this actually ever used?\n type: String,\n default: null\n },\n disabled: {\n type: Boolean,\n default: false\n },\n noBody: {\n type: Boolean,\n default: false\n },\n lazy: {\n type: Boolean,\n default: false\n }\n },\n data: function data() {\n return {\n localActive: this.active && !this.disabled,\n show: false\n };\n },\n computed: {\n tabClasses: function tabClasses() {\n return [{\n active: this.localActive,\n disabled: this.disabled,\n 'card-body': this.bvTabs.card && !this.noBody\n }, // Apply `activeTabClass` styles when this tab is active\n this.localActive ? this.bvTabs.activeTabClass : null];\n },\n controlledBy: function controlledBy() {\n return this.buttonId || this.safeId('__BV_tab_button__');\n },\n computedNoFade: function computedNoFade() {\n return !(this.bvTabs.fade || false);\n },\n computedLazy: function computedLazy() {\n return this.bvTabs.lazy || this.lazy;\n },\n _isTab: function _isTab() {\n // For parent sniffing of child\n return true;\n }\n },\n watch: {\n localActive: function localActive(newVal, oldVal) {\n // Make 'active' prop work with `.sync` modifier\n this.$emit('update:active', newVal);\n },\n active: function active(newVal, oldVal) {\n if (newVal !== oldVal) {\n if (newVal) {\n // If activated post mount\n this.activate();\n } else {\n /* istanbul ignore next */\n if (!this.deactivate()) {\n // Tab couldn't be deactivated, so we reset the synced active prop\n // Deactivation will fail if no other tabs to activate\n this.$emit('update:active', this.localActive);\n }\n }\n }\n },\n disabled: function disabled(newVal, oldVal) {\n if (newVal !== oldVal) {\n if (newVal && this.localActive && this.bvTabs.firstTab) {\n this.localActive = false;\n this.bvTabs.firstTab();\n }\n }\n }\n },\n mounted: function mounted() {\n // Inform b-tabs of our presence\n this.registerTab(); // Initially show on mount if active and not disabled\n\n this.show = this.localActive;\n },\n updated: function updated() {\n // Force the tab button content to update (since slots are not reactive)\n // Only done if we have a title slot, as the title prop is reactive\n if (this.hasNormalizedSlot('title') && this.bvTabs.updateButton) {\n this.bvTabs.updateButton(this);\n }\n },\n destroyed: function destroyed() {\n // inform b-tabs of our departure\n this.unregisterTab();\n },\n methods: {\n // Private methods\n registerTab: function registerTab() {\n // Inform `b-tabs` of our presence\n this.bvTabs.registerTab && this.bvTabs.registerTab(this);\n },\n unregisterTab: function unregisterTab() {\n // Inform `b-tabs` of our departure\n this.bvTabs.unregisterTab && this.bvTabs.unregisterTab(this);\n },\n // Public methods\n activate: function activate() {\n if (this.bvTabs.activateTab && !this.disabled) {\n return this.bvTabs.activateTab(this);\n } else {\n // Not inside a component or tab is disabled\n return false;\n }\n },\n deactivate: function deactivate() {\n if (this.bvTabs.deactivateTab && this.localActive) {\n return this.bvTabs.deactivateTab(this);\n } else {\n // Not inside a component or not active to begin with\n return false;\n }\n }\n },\n render: function render(h) {\n var content = h(this.tag, {\n ref: 'panel',\n staticClass: 'tab-pane',\n class: this.tabClasses,\n directives: [{\n name: 'show',\n rawName: 'v-show',\n value: this.localActive,\n expression: 'localActive'\n }],\n attrs: {\n role: 'tabpanel',\n id: this.safeId(),\n tabindex: this.localActive && !this.bvTabs.noKeyNav ? '-1' : null,\n 'aria-hidden': this.localActive ? 'false' : 'true',\n 'aria-labelledby': this.controlledBy || null\n }\n }, // Render content lazily if requested\n [this.localActive || !this.computedLazy ? this.normalizeSlot('default') : h()]);\n return h(BVTransition, {\n props: {\n mode: 'out-in',\n noFade: this.computedNoFade\n }\n }, [content]);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/tabs/tab.js\n// module id = Fuc2\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var msMy = moment.defineLocale('ms-my', {\n months : 'Januari_Februari_Mac_April_Mei_Jun_Julai_Ogos_September_Oktober_November_Disember'.split('_'),\n monthsShort : 'Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ogs_Sep_Okt_Nov_Dis'.split('_'),\n weekdays : 'Ahad_Isnin_Selasa_Rabu_Khamis_Jumaat_Sabtu'.split('_'),\n weekdaysShort : 'Ahd_Isn_Sel_Rab_Kha_Jum_Sab'.split('_'),\n weekdaysMin : 'Ah_Is_Sl_Rb_Km_Jm_Sb'.split('_'),\n longDateFormat : {\n LT : 'HH.mm',\n LTS : 'HH.mm.ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [pukul] HH.mm',\n LLLL : 'dddd, D MMMM YYYY [pukul] HH.mm'\n },\n meridiemParse: /pagi|tengahari|petang|malam/,\n meridiemHour: function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'pagi') {\n return hour;\n } else if (meridiem === 'tengahari') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'petang' || meridiem === 'malam') {\n return hour + 12;\n }\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'pagi';\n } else if (hours < 15) {\n return 'tengahari';\n } else if (hours < 19) {\n return 'petang';\n } else {\n return 'malam';\n }\n },\n calendar : {\n sameDay : '[Hari ini pukul] LT',\n nextDay : '[Esok pukul] LT',\n nextWeek : 'dddd [pukul] LT',\n lastDay : '[Kelmarin pukul] LT',\n lastWeek : 'dddd [lepas pukul] LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : 'dalam %s',\n past : '%s yang lepas',\n s : 'beberapa saat',\n ss : '%d saat',\n m : 'seminit',\n mm : '%d minit',\n h : 'sejam',\n hh : '%d jam',\n d : 'sehari',\n dd : '%d hari',\n M : 'sebulan',\n MM : '%d bulan',\n y : 'setahun',\n yy : '%d tahun'\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return msMy;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/ms-my.js\n// module id = G++c\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/axios/lib/helpers/isURLSameOrigin.js\n// module id = GHBc\n// module chunks = 0","/**\n * Lo-Dash 2.3.0 (Custom Build) \n * Build: `lodash modularize modern exports=\"npm\" -o ./npm/`\n * Copyright 2012-2013 The Dojo Foundation \n * Based on Underscore.js 1.5.2 \n * Copyright 2009-2013 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n * Available under MIT license \n */\nvar objectTypes = require('lodash._objecttypes');\n\n/** Used for native method references */\nvar objectProto = Object.prototype;\n\n/** Native method shortcuts */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * A fallback implementation of `Object.keys` which produces an array of the\n * given object's own enumerable property names.\n *\n * @private\n * @type Function\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns an array of property names.\n */\nvar shimKeys = function(object) {\n var index, iterable = object, result = [];\n if (!iterable) return result;\n if (!(objectTypes[typeof object])) return result;\n for (index in iterable) {\n if (hasOwnProperty.call(iterable, index)) {\n result.push(index);\n }\n }\n return result\n};\n\nmodule.exports = shimKeys;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/lodash._shimkeys/index.js\n// module id = GNgv\n// module chunks = 0","import { BTooltip } from './tooltip';\nimport { VBTooltip } from '../../directives/tooltip/tooltip';\nimport { pluginFactory } from '../../utils/plugins';\nvar TooltipPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BTooltip: BTooltip\n },\n directives: {\n VBTooltip: VBTooltip\n }\n});\nexport { TooltipPlugin, BTooltip };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/tooltip/index.js\n// module id = GVLL\n// module chunks = 0","var convert\n , keys = require('lodash.keys')\n , each = require('lodash.foreach')\n , measures = {\n length: require('./definitions/length')\n , area: require('./definitions/area')\n , mass: require('./definitions/mass')\n , volume: require('./definitions/volume')\n , each: require('./definitions/each')\n , temperature: require('./definitions/temperature')\n , time: require('./definitions/time')\n , digital: require('./definitions/digital')\n , partsPer: require('./definitions/partsPer')\n , speed: require('./definitions/speed')\n , pace: require('./definitions/pace')\n , pressure: require('./definitions/pressure')\n , current: require('./definitions/current')\n , voltage: require('./definitions/voltage')\n , power: require('./definitions/power')\n , reactivePower: require('./definitions/reactivePower')\n , apparentPower: require('./definitions/apparentPower')\n , energy: require('./definitions/energy')\n , reactiveEnergy: require('./definitions/reactiveEnergy')\n , volumeFlowRate: require('./definitions/volumeFlowRate')\n , illuminance: require('./definitions/illuminance')\n , frequency: require('./definitions/frequency')\n , angle : require('./definitions/angle')\n }\n , Converter;\n\nConverter = function (numerator, denominator) {\n if(denominator)\n this.val = numerator / denominator;\n else\n this.val = numerator;\n};\n\n/**\n* Lets the converter know the source unit abbreviation\n*/\nConverter.prototype.from = function (from) {\n if(this.destination)\n throw new Error('.from must be called before .to');\n\n this.origin = this.getUnit(from);\n\n if(!this.origin) {\n this.throwUnsupportedUnitError(from);\n }\n\n return this;\n};\n\n/**\n* Converts the unit and returns the value\n*/\nConverter.prototype.to = function (to) {\n if(!this.origin)\n throw new Error('.to must be called after .from');\n\n this.destination = this.getUnit(to);\n\n var result\n , transform;\n\n if(!this.destination) {\n this.throwUnsupportedUnitError(to);\n }\n\n // Don't change the value if origin and destination are the same\n if (this.origin.abbr === this.destination.abbr) {\n return this.val;\n }\n\n // You can't go from liquid to mass, for example\n if(this.destination.measure != this.origin.measure) {\n throw new Error('Cannot convert incompatible measures of '\n + this.destination.measure + ' and ' + this.origin.measure);\n }\n\n /**\n * Convert from the source value to its anchor inside the system\n */\n result = this.val * this.origin.unit.to_anchor;\n\n /**\n * For some changes it's a simple shift (C to K)\n * So we'll add it when convering into the unit (later)\n * and subtract it when converting from the unit\n */\n if (this.origin.unit.anchor_shift) {\n result -= this.origin.unit.anchor_shift\n }\n\n /**\n * Convert from one system to another through the anchor ratio. Some conversions\n * aren't ratio based or require more than a simple shift. We can provide a custom\n * transform here to provide the direct result\n */\n if(this.origin.system != this.destination.system) {\n transform = measures[this.origin.measure]._anchors[this.origin.system].transform;\n if (typeof transform === 'function') {\n result = transform(result)\n }\n else {\n result *= measures[this.origin.measure]._anchors[this.origin.system].ratio;\n }\n }\n\n /**\n * This shift has to be done after the system conversion business\n */\n if (this.destination.unit.anchor_shift) {\n result += this.destination.unit.anchor_shift;\n }\n\n /**\n * Convert to another unit inside the destination system\n */\n return result / this.destination.unit.to_anchor;\n};\n\n/**\n* Converts the unit to the best available unit.\n*/\nConverter.prototype.toBest = function(options) {\n if(!this.origin)\n throw new Error('.toBest must be called after .from');\n\n var options = Object.assign({\n exclude: [],\n cutOffNumber: 1,\n }, options)\n\n var best;\n /**\n Looks through every possibility for the 'best' available unit.\n i.e. Where the value has the fewest numbers before the decimal point,\n but is still higher than 1.\n */\n each(this.possibilities(), function(possibility) {\n var unit = this.describe(possibility);\n var isIncluded = options.exclude.indexOf(possibility) === -1;\n\n if (isIncluded && unit.system === this.origin.system) {\n var result = this.to(possibility);\n if (!best || (result >= options.cutOffNumber && result < best.val)) {\n best = {\n val: result,\n unit: possibility,\n singular: unit.singular,\n plural: unit.plural\n };\n }\n }\n }.bind(this));\n\n return best;\n}\n\n/**\n* Finds the unit\n*/\nConverter.prototype.getUnit = function (abbr) {\n var found;\n\n each(measures, function (systems, measure) {\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n each(units, function (unit, testAbbr) {\n if(testAbbr == abbr) {\n found = {\n abbr: abbr\n , measure: measure\n , system: system\n , unit: unit\n };\n return false;\n }\n });\n\n if(found)\n return false;\n });\n\n if(found)\n return false;\n });\n\n return found;\n};\n\nvar describe = function(resp) {\n return {\n abbr: resp.abbr\n , measure: resp.measure\n , system: resp.system\n , singular: resp.unit.name.singular\n , plural: resp.unit.name.plural\n };\n}\n\n/**\n* An alias for getUnit\n*/\nConverter.prototype.describe = function (abbr) {\n var resp = Converter.prototype.getUnit(abbr);\n var desc = null;\n\n try {\n desc = describe(resp);\n } catch(err) {\n this.throwUnsupportedUnitError(abbr);\n }\n\n return desc;\n};\n\n/**\n* Detailed list of all supported units\n*/\nConverter.prototype.list = function (measure) {\n var list = [];\n\n each(measures, function (systems, testMeasure) {\n if(measure && measure !== testMeasure)\n return;\n\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n each(units, function (unit, abbr) {\n list = list.concat(describe({\n abbr: abbr,\n measure: testMeasure\n , system: system\n , unit: unit\n }));\n });\n });\n });\n\n return list;\n};\n\nConverter.prototype.throwUnsupportedUnitError = function (what) {\n var validUnits = [];\n\n each(measures, function (systems, measure) {\n each(systems, function (units, system) {\n if(system == '_anchors')\n return false;\n\n validUnits = validUnits.concat(keys(units));\n });\n });\n\n throw new Error('Unsupported unit ' + what + ', use one of: ' + validUnits.join(', '));\n}\n\n/**\n* Returns the abbreviated measures that the value can be\n* converted to.\n*/\nConverter.prototype.possibilities = function (measure) {\n var possibilities = [];\n if(!this.origin && !measure) {\n\t each(keys(measures), function (measure){\n\t\t each(measures[measure], function (units, system) {\n\t\t if(system == '_anchors')\n\t\t return false;\n\n\t\t possibilities = possibilities.concat(keys(units));\n\t\t });\n\t });\n } else {\n\t measure = measure || this.origin.measure;\n\t each(measures[measure], function (units, system) {\n\t if(system == '_anchors')\n\t return false;\n\n\t possibilities = possibilities.concat(keys(units));\n\t });\n }\n\n return possibilities;\n};\n\n/**\n* Returns the abbreviated measures that the value can be\n* converted to.\n*/\nConverter.prototype.measures = function () {\n return keys(measures);\n};\n\nconvert = function (value) {\n return new Converter(value);\n};\n\nmodule.exports = convert;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/convert-units/lib/index.js\n// module id = GXWi\n// module chunks = 0","import Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nexport var props = {\n tag: {\n type: String,\n default: 'span'\n } // @vue/component\n\n};\nexport var BNavText =\n/*#__PURE__*/\nVue.extend({\n name: 'BNavText',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, mergeData(data, {\n staticClass: 'navbar-text'\n }), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/nav/nav-text.js\n// module id = Ggy4\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var hyAm = moment.defineLocale('hy-am', {\n months : {\n format: 'հունվարի_փետրվարի_մարտի_ապրիլի_մայիսի_հունիսի_հուլիսի_օգոստոսի_սեպտեմբերի_հոկտեմբերի_նոյեմբերի_դեկտեմբերի'.split('_'),\n standalone: 'հունվար_փետրվար_մարտ_ապրիլ_մայիս_հունիս_հուլիս_օգոստոս_սեպտեմբեր_հոկտեմբեր_նոյեմբեր_դեկտեմբեր'.split('_')\n },\n monthsShort : 'հնվ_փտր_մրտ_ապր_մյս_հնս_հլս_օգս_սպտ_հկտ_նմբ_դկտ'.split('_'),\n weekdays : 'կիրակի_երկուշաբթի_երեքշաբթի_չորեքշաբթի_հինգշաբթի_ուրբաթ_շաբաթ'.split('_'),\n weekdaysShort : 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n weekdaysMin : 'կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ'.split('_'),\n longDateFormat : {\n LT : 'HH:mm',\n LTS : 'HH:mm:ss',\n L : 'DD.MM.YYYY',\n LL : 'D MMMM YYYY թ.',\n LLL : 'D MMMM YYYY թ., HH:mm',\n LLLL : 'dddd, D MMMM YYYY թ., HH:mm'\n },\n calendar : {\n sameDay: '[այսօր] LT',\n nextDay: '[վաղը] LT',\n lastDay: '[երեկ] LT',\n nextWeek: function () {\n return 'dddd [օրը ժամը] LT';\n },\n lastWeek: function () {\n return '[անցած] dddd [օրը ժամը] LT';\n },\n sameElse: 'L'\n },\n relativeTime : {\n future : '%s հետո',\n past : '%s առաջ',\n s : 'մի քանի վայրկյան',\n ss : '%d վայրկյան',\n m : 'րոպե',\n mm : '%d րոպե',\n h : 'ժամ',\n hh : '%d ժամ',\n d : 'օր',\n dd : '%d օր',\n M : 'ամիս',\n MM : '%d ամիս',\n y : 'տարի',\n yy : '%d տարի'\n },\n meridiemParse: /գիշերվա|առավոտվա|ցերեկվա|երեկոյան/,\n isPM: function (input) {\n return /^(ցերեկվա|երեկոյան)$/.test(input);\n },\n meridiem : function (hour) {\n if (hour < 4) {\n return 'գիշերվա';\n } else if (hour < 12) {\n return 'առավոտվա';\n } else if (hour < 17) {\n return 'ցերեկվա';\n } else {\n return 'երեկոյան';\n }\n },\n dayOfMonthOrdinalParse: /\\d{1,2}|\\d{1,2}-(ին|րդ)/,\n ordinal: function (number, period) {\n switch (period) {\n case 'DDD':\n case 'w':\n case 'W':\n case 'DDDo':\n if (number === 1) {\n return number + '-ին';\n }\n return number + '-րդ';\n default:\n return number;\n }\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return hyAm;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/hy-am.js\n// module id = GrS7\n// module chunks = 0","import looseEqual from '../../utils/loose-equal';\nimport { addClass, hasAttr, removeAttr, removeClass, setAttr } from '../../utils/dom';\nimport { isBrowser } from '../../utils/env';\nimport { bindTargets, getTargets, unbindTargets } from '../../utils/target'; // Target listen types\n\nvar listenTypes = {\n click: true // Property key for handler storage\n\n};\nvar BV_TOGGLE = '__BV_toggle__';\nvar BV_TOGGLE_STATE = '__BV_toggle_STATE__';\nvar BV_TOGGLE_CONTROLS = '__BV_toggle_CONTROLS__';\nvar BV_TOGGLE_TARGETS = '__BV_toggle_TARGETS__'; // Emitted control event for collapse (emitted to collapse)\n\nvar EVENT_TOGGLE = 'bv::toggle::collapse'; // Listen to event for toggle state update (emitted by collapse)\n\nvar EVENT_STATE = 'bv::collapse::state'; // Private event emitted on $root to ensure the toggle state is always synced.\n// Gets emitted even if the state of b-collapse has not changed.\n// This event is NOT to be documented as people should not be using it.\n\nvar EVENT_STATE_SYNC = 'bv::collapse::sync::state'; // Private event we send to collapse to request state update sync event\n\nvar EVENT_STATE_REQUEST = 'bv::request::collapse::state'; // Reset and remove a property from the provided element\n\nvar resetProp = function resetProp(el, prop) {\n el[prop] = null;\n delete el[prop];\n}; // Handle targets update\n\n\nvar handleTargets = function handleTargets(_ref) {\n var targets = _ref.targets,\n vnode = _ref.vnode;\n targets.forEach(function (target) {\n vnode.context.$root.$emit(EVENT_TOGGLE, target);\n });\n}; // Handle directive updates\n\n/* istanbul ignore next: not easy to test */\n\n\nvar handleUpdate = function handleUpdate(el, binding, vnode) {\n if (!isBrowser) {\n return;\n }\n\n if (!looseEqual(getTargets(binding), el[BV_TOGGLE_TARGETS])) {\n // Targets have changed, so update accordingly\n unbindTargets(vnode, binding, listenTypes);\n var targets = bindTargets(vnode, binding, listenTypes, handleTargets); // Update targets array to element\n\n el[BV_TOGGLE_TARGETS] = targets; // Add aria attributes to element\n\n el[BV_TOGGLE_CONTROLS] = targets.join(' '); // ensure aria-controls is up to date\n\n setAttr(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]); // Request a state update from targets so that we can ensure\n // expanded state is correct\n\n targets.forEach(function (target) {\n vnode.context.$root.$emit(EVENT_STATE_REQUEST, target);\n });\n } // Ensure the collapse class and aria-* attributes persist\n // after element is updated (either by parent re-rendering\n // or changes to this element or it's contents\n\n\n if (el[BV_TOGGLE_STATE] === true) {\n addClass(el, 'collapsed');\n setAttr(el, 'aria-expanded', 'true');\n } else if (el[BV_TOGGLE_STATE] === false) {\n removeClass(el, 'collapsed');\n setAttr(el, 'aria-expanded', 'false');\n }\n\n setAttr(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]);\n};\n/*\n * Export our directive\n */\n\n\nexport var VBToggle = {\n bind: function bind(el, binding, vnode) {\n var targets = bindTargets(vnode, binding, listenTypes, handleTargets);\n\n if (isBrowser && vnode.context && targets.length > 0) {\n // Add targets array to element\n el[BV_TOGGLE_TARGETS] = targets; // Add aria attributes to element\n\n el[BV_TOGGLE_CONTROLS] = targets.join(' '); // State is initially collapsed until we receive a state event\n\n el[BV_TOGGLE_STATE] = false;\n setAttr(el, 'aria-controls', el[BV_TOGGLE_CONTROLS]);\n setAttr(el, 'aria-expanded', 'false'); // If element is not a button, we add `role=\"button\"` for accessibility\n\n if (el.tagName !== 'BUTTON' && !hasAttr(el, 'role')) {\n setAttr(el, 'role', 'button');\n } // Toggle state handler\n\n\n var toggleDirectiveHandler = function toggleDirectiveHandler(id, state) {\n var targets = el[BV_TOGGLE_TARGETS] || [];\n\n if (targets.indexOf(id) !== -1) {\n // Set aria-expanded state\n setAttr(el, 'aria-expanded', state ? 'true' : 'false'); // Set/Clear 'collapsed' class state\n\n el[BV_TOGGLE_STATE] = state;\n\n if (state) {\n removeClass(el, 'collapsed');\n } else {\n addClass(el, 'collapsed');\n }\n }\n }; // Store the toggle handler on the element\n\n\n el[BV_TOGGLE] = toggleDirectiveHandler; // Listen for toggle state changes (public)\n\n vnode.context.$root.$on(EVENT_STATE, el[BV_TOGGLE]); // Listen for toggle state sync (private)\n\n vnode.context.$root.$on(EVENT_STATE_SYNC, el[BV_TOGGLE]);\n }\n },\n componentUpdated: handleUpdate,\n updated: handleUpdate,\n unbind: function unbind(el, binding, vnode)\n /* istanbul ignore next */\n {\n unbindTargets(vnode, binding, listenTypes); // Remove our $root listener\n\n if (el[BV_TOGGLE]) {\n vnode.context.$root.$off(EVENT_STATE, el[BV_TOGGLE]);\n vnode.context.$root.$off(EVENT_STATE_SYNC, el[BV_TOGGLE]);\n } // Reset custom props\n\n\n resetProp(el, BV_TOGGLE);\n resetProp(el, BV_TOGGLE_STATE);\n resetProp(el, BV_TOGGLE_CONTROLS);\n resetProp(el, BV_TOGGLE_TARGETS); // Reset classes/attrs\n\n removeClass(el, 'collapsed');\n removeAttr(el, 'aria-expanded');\n removeAttr(el, 'aria-controls');\n removeAttr(el, 'role');\n }\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/directives/toggle/toggle.js\n// module id = Gst8\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport pluckProps from '../../utils/pluck-props';\nimport { BLink, propsFactory } from '../link/link';\nvar linkProps = propsFactory();\nlinkProps.href.default = undefined;\nlinkProps.to.default = undefined;\nexport var props = _objectSpread({}, linkProps, {\n tag: {\n type: String,\n default: 'div'\n } // @vue/component\n\n});\nexport var BNavbarBrand =\n/*#__PURE__*/\nVue.extend({\n name: 'BNavbarBrand',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var isLink = Boolean(props.to || props.href);\n var tag = isLink ? BLink : props.tag;\n return h(tag, mergeData(data, {\n staticClass: 'navbar-brand',\n props: isLink ? pluckProps(linkProps, props) : {}\n }), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/navbar/navbar-brand.js\n// module id = HTQ3\n// module chunks = 0","/**\n * Copyright (c) 2014-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\n!(function(global) {\n \"use strict\";\n\n var Op = Object.prototype;\n var hasOwn = Op.hasOwnProperty;\n var undefined; // More compressible than void 0.\n var $Symbol = typeof Symbol === \"function\" ? Symbol : {};\n var iteratorSymbol = $Symbol.iterator || \"@@iterator\";\n var asyncIteratorSymbol = $Symbol.asyncIterator || \"@@asyncIterator\";\n var toStringTagSymbol = $Symbol.toStringTag || \"@@toStringTag\";\n\n var inModule = typeof module === \"object\";\n var runtime = global.regeneratorRuntime;\n if (runtime) {\n if (inModule) {\n // If regeneratorRuntime is defined globally and we're in a module,\n // make the exports object identical to regeneratorRuntime.\n module.exports = runtime;\n }\n // Don't bother evaluating the rest of this file if the runtime was\n // already defined globally.\n return;\n }\n\n // Define the runtime globally (as expected by generated code) as either\n // module.exports (if we're in a module) or a new, empty object.\n runtime = global.regeneratorRuntime = inModule ? module.exports : {};\n\n function wrap(innerFn, outerFn, self, tryLocsList) {\n // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.\n var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;\n var generator = Object.create(protoGenerator.prototype);\n var context = new Context(tryLocsList || []);\n\n // The ._invoke method unifies the implementations of the .next,\n // .throw, and .return methods.\n generator._invoke = makeInvokeMethod(innerFn, self, context);\n\n return generator;\n }\n runtime.wrap = wrap;\n\n // Try/catch helper to minimize deoptimizations. Returns a completion\n // record like context.tryEntries[i].completion. This interface could\n // have been (and was previously) designed to take a closure to be\n // invoked without arguments, but in all the cases we care about we\n // already have an existing method we want to call, so there's no need\n // to create a new function object. We can even get away with assuming\n // the method takes exactly one argument, since that happens to be true\n // in every case, so we don't have to touch the arguments object. The\n // only additional allocation required is the completion record, which\n // has a stable shape and so hopefully should be cheap to allocate.\n function tryCatch(fn, obj, arg) {\n try {\n return { type: \"normal\", arg: fn.call(obj, arg) };\n } catch (err) {\n return { type: \"throw\", arg: err };\n }\n }\n\n var GenStateSuspendedStart = \"suspendedStart\";\n var GenStateSuspendedYield = \"suspendedYield\";\n var GenStateExecuting = \"executing\";\n var GenStateCompleted = \"completed\";\n\n // Returning this object from the innerFn has the same effect as\n // breaking out of the dispatch switch statement.\n var ContinueSentinel = {};\n\n // Dummy constructor functions that we use as the .constructor and\n // .constructor.prototype properties for functions that return Generator\n // objects. For full spec compliance, you may wish to configure your\n // minifier not to mangle the names of these two functions.\n function Generator() {}\n function GeneratorFunction() {}\n function GeneratorFunctionPrototype() {}\n\n // This is a polyfill for %IteratorPrototype% for environments that\n // don't natively support it.\n var IteratorPrototype = {};\n IteratorPrototype[iteratorSymbol] = function () {\n return this;\n };\n\n var getProto = Object.getPrototypeOf;\n var NativeIteratorPrototype = getProto && getProto(getProto(values([])));\n if (NativeIteratorPrototype &&\n NativeIteratorPrototype !== Op &&\n hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {\n // This environment has a native %IteratorPrototype%; use it instead\n // of the polyfill.\n IteratorPrototype = NativeIteratorPrototype;\n }\n\n var Gp = GeneratorFunctionPrototype.prototype =\n Generator.prototype = Object.create(IteratorPrototype);\n GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;\n GeneratorFunctionPrototype.constructor = GeneratorFunction;\n GeneratorFunctionPrototype[toStringTagSymbol] =\n GeneratorFunction.displayName = \"GeneratorFunction\";\n\n // Helper for defining the .next, .throw, and .return methods of the\n // Iterator interface in terms of a single ._invoke method.\n function defineIteratorMethods(prototype) {\n [\"next\", \"throw\", \"return\"].forEach(function(method) {\n prototype[method] = function(arg) {\n return this._invoke(method, arg);\n };\n });\n }\n\n runtime.isGeneratorFunction = function(genFun) {\n var ctor = typeof genFun === \"function\" && genFun.constructor;\n return ctor\n ? ctor === GeneratorFunction ||\n // For the native GeneratorFunction constructor, the best we can\n // do is to check its .name property.\n (ctor.displayName || ctor.name) === \"GeneratorFunction\"\n : false;\n };\n\n runtime.mark = function(genFun) {\n if (Object.setPrototypeOf) {\n Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);\n } else {\n genFun.__proto__ = GeneratorFunctionPrototype;\n if (!(toStringTagSymbol in genFun)) {\n genFun[toStringTagSymbol] = \"GeneratorFunction\";\n }\n }\n genFun.prototype = Object.create(Gp);\n return genFun;\n };\n\n // Within the body of any async function, `await x` is transformed to\n // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test\n // `hasOwn.call(value, \"__await\")` to determine if the yielded value is\n // meant to be awaited.\n runtime.awrap = function(arg) {\n return { __await: arg };\n };\n\n function AsyncIterator(generator) {\n function invoke(method, arg, resolve, reject) {\n var record = tryCatch(generator[method], generator, arg);\n if (record.type === \"throw\") {\n reject(record.arg);\n } else {\n var result = record.arg;\n var value = result.value;\n if (value &&\n typeof value === \"object\" &&\n hasOwn.call(value, \"__await\")) {\n return Promise.resolve(value.__await).then(function(value) {\n invoke(\"next\", value, resolve, reject);\n }, function(err) {\n invoke(\"throw\", err, resolve, reject);\n });\n }\n\n return Promise.resolve(value).then(function(unwrapped) {\n // When a yielded Promise is resolved, its final value becomes\n // the .value of the Promise<{value,done}> result for the\n // current iteration. If the Promise is rejected, however, the\n // result for this iteration will be rejected with the same\n // reason. Note that rejections of yielded Promises are not\n // thrown back into the generator function, as is the case\n // when an awaited Promise is rejected. This difference in\n // behavior between yield and await is important, because it\n // allows the consumer to decide what to do with the yielded\n // rejection (swallow it and continue, manually .throw it back\n // into the generator, abandon iteration, whatever). With\n // await, by contrast, there is no opportunity to examine the\n // rejection reason outside the generator function, so the\n // only option is to throw it from the await expression, and\n // let the generator function handle the exception.\n result.value = unwrapped;\n resolve(result);\n }, reject);\n }\n }\n\n var previousPromise;\n\n function enqueue(method, arg) {\n function callInvokeWithMethodAndArg() {\n return new Promise(function(resolve, reject) {\n invoke(method, arg, resolve, reject);\n });\n }\n\n return previousPromise =\n // If enqueue has been called before, then we want to wait until\n // all previous Promises have been resolved before calling invoke,\n // so that results are always delivered in the correct order. If\n // enqueue has not been called before, then it is important to\n // call invoke immediately, without waiting on a callback to fire,\n // so that the async generator function has the opportunity to do\n // any necessary setup in a predictable way. This predictability\n // is why the Promise constructor synchronously invokes its\n // executor callback, and why async functions synchronously\n // execute code before the first await. Since we implement simple\n // async functions in terms of async generators, it is especially\n // important to get this right, even though it requires care.\n previousPromise ? previousPromise.then(\n callInvokeWithMethodAndArg,\n // Avoid propagating failures to Promises returned by later\n // invocations of the iterator.\n callInvokeWithMethodAndArg\n ) : callInvokeWithMethodAndArg();\n }\n\n // Define the unified helper method that is used to implement .next,\n // .throw, and .return (see defineIteratorMethods).\n this._invoke = enqueue;\n }\n\n defineIteratorMethods(AsyncIterator.prototype);\n AsyncIterator.prototype[asyncIteratorSymbol] = function () {\n return this;\n };\n runtime.AsyncIterator = AsyncIterator;\n\n // Note that simple async functions are implemented on top of\n // AsyncIterator objects; they just return a Promise for the value of\n // the final result produced by the iterator.\n runtime.async = function(innerFn, outerFn, self, tryLocsList) {\n var iter = new AsyncIterator(\n wrap(innerFn, outerFn, self, tryLocsList)\n );\n\n return runtime.isGeneratorFunction(outerFn)\n ? iter // If outerFn is a generator, return the full iterator.\n : iter.next().then(function(result) {\n return result.done ? result.value : iter.next();\n });\n };\n\n function makeInvokeMethod(innerFn, self, context) {\n var state = GenStateSuspendedStart;\n\n return function invoke(method, arg) {\n if (state === GenStateExecuting) {\n throw new Error(\"Generator is already running\");\n }\n\n if (state === GenStateCompleted) {\n if (method === \"throw\") {\n throw arg;\n }\n\n // Be forgiving, per 25.3.3.3.3 of the spec:\n // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume\n return doneResult();\n }\n\n context.method = method;\n context.arg = arg;\n\n while (true) {\n var delegate = context.delegate;\n if (delegate) {\n var delegateResult = maybeInvokeDelegate(delegate, context);\n if (delegateResult) {\n if (delegateResult === ContinueSentinel) continue;\n return delegateResult;\n }\n }\n\n if (context.method === \"next\") {\n // Setting context._sent for legacy support of Babel's\n // function.sent implementation.\n context.sent = context._sent = context.arg;\n\n } else if (context.method === \"throw\") {\n if (state === GenStateSuspendedStart) {\n state = GenStateCompleted;\n throw context.arg;\n }\n\n context.dispatchException(context.arg);\n\n } else if (context.method === \"return\") {\n context.abrupt(\"return\", context.arg);\n }\n\n state = GenStateExecuting;\n\n var record = tryCatch(innerFn, self, context);\n if (record.type === \"normal\") {\n // If an exception is thrown from innerFn, we leave state ===\n // GenStateExecuting and loop back for another invocation.\n state = context.done\n ? GenStateCompleted\n : GenStateSuspendedYield;\n\n if (record.arg === ContinueSentinel) {\n continue;\n }\n\n return {\n value: record.arg,\n done: context.done\n };\n\n } else if (record.type === \"throw\") {\n state = GenStateCompleted;\n // Dispatch the exception by looping back around to the\n // context.dispatchException(context.arg) call above.\n context.method = \"throw\";\n context.arg = record.arg;\n }\n }\n };\n }\n\n // Call delegate.iterator[context.method](context.arg) and handle the\n // result, either by returning a { value, done } result from the\n // delegate iterator, or by modifying context.method and context.arg,\n // setting context.delegate to null, and returning the ContinueSentinel.\n function maybeInvokeDelegate(delegate, context) {\n var method = delegate.iterator[context.method];\n if (method === undefined) {\n // A .throw or .return when the delegate iterator has no .throw\n // method always terminates the yield* loop.\n context.delegate = null;\n\n if (context.method === \"throw\") {\n if (delegate.iterator.return) {\n // If the delegate iterator has a return method, give it a\n // chance to clean up.\n context.method = \"return\";\n context.arg = undefined;\n maybeInvokeDelegate(delegate, context);\n\n if (context.method === \"throw\") {\n // If maybeInvokeDelegate(context) changed context.method from\n // \"return\" to \"throw\", let that override the TypeError below.\n return ContinueSentinel;\n }\n }\n\n context.method = \"throw\";\n context.arg = new TypeError(\n \"The iterator does not provide a 'throw' method\");\n }\n\n return ContinueSentinel;\n }\n\n var record = tryCatch(method, delegate.iterator, context.arg);\n\n if (record.type === \"throw\") {\n context.method = \"throw\";\n context.arg = record.arg;\n context.delegate = null;\n return ContinueSentinel;\n }\n\n var info = record.arg;\n\n if (! info) {\n context.method = \"throw\";\n context.arg = new TypeError(\"iterator result is not an object\");\n context.delegate = null;\n return ContinueSentinel;\n }\n\n if (info.done) {\n // Assign the result of the finished delegate to the temporary\n // variable specified by delegate.resultName (see delegateYield).\n context[delegate.resultName] = info.value;\n\n // Resume execution at the desired location (see delegateYield).\n context.next = delegate.nextLoc;\n\n // If context.method was \"throw\" but the delegate handled the\n // exception, let the outer generator proceed normally. If\n // context.method was \"next\", forget context.arg since it has been\n // \"consumed\" by the delegate iterator. If context.method was\n // \"return\", allow the original .return call to continue in the\n // outer generator.\n if (context.method !== \"return\") {\n context.method = \"next\";\n context.arg = undefined;\n }\n\n } else {\n // Re-yield the result returned by the delegate method.\n return info;\n }\n\n // The delegate iterator is finished, so forget it and continue with\n // the outer generator.\n context.delegate = null;\n return ContinueSentinel;\n }\n\n // Define Generator.prototype.{next,throw,return} in terms of the\n // unified ._invoke helper method.\n defineIteratorMethods(Gp);\n\n Gp[toStringTagSymbol] = \"Generator\";\n\n // A Generator should always return itself as the iterator object when the\n // @@iterator function is called on it. Some browsers' implementations of the\n // iterator prototype chain incorrectly implement this, causing the Generator\n // object to not be returned from this call. This ensures that doesn't happen.\n // See https://github.com/facebook/regenerator/issues/274 for more details.\n Gp[iteratorSymbol] = function() {\n return this;\n };\n\n Gp.toString = function() {\n return \"[object Generator]\";\n };\n\n function pushTryEntry(locs) {\n var entry = { tryLoc: locs[0] };\n\n if (1 in locs) {\n entry.catchLoc = locs[1];\n }\n\n if (2 in locs) {\n entry.finallyLoc = locs[2];\n entry.afterLoc = locs[3];\n }\n\n this.tryEntries.push(entry);\n }\n\n function resetTryEntry(entry) {\n var record = entry.completion || {};\n record.type = \"normal\";\n delete record.arg;\n entry.completion = record;\n }\n\n function Context(tryLocsList) {\n // The root entry object (effectively a try statement without a catch\n // or a finally block) gives us a place to store values thrown from\n // locations where there is no enclosing try statement.\n this.tryEntries = [{ tryLoc: \"root\" }];\n tryLocsList.forEach(pushTryEntry, this);\n this.reset(true);\n }\n\n runtime.keys = function(object) {\n var keys = [];\n for (var key in object) {\n keys.push(key);\n }\n keys.reverse();\n\n // Rather than returning an object with a next method, we keep\n // things simple and return the next function itself.\n return function next() {\n while (keys.length) {\n var key = keys.pop();\n if (key in object) {\n next.value = key;\n next.done = false;\n return next;\n }\n }\n\n // To avoid creating an additional object, we just hang the .value\n // and .done properties off the next function object itself. This\n // also ensures that the minifier will not anonymize the function.\n next.done = true;\n return next;\n };\n };\n\n function values(iterable) {\n if (iterable) {\n var iteratorMethod = iterable[iteratorSymbol];\n if (iteratorMethod) {\n return iteratorMethod.call(iterable);\n }\n\n if (typeof iterable.next === \"function\") {\n return iterable;\n }\n\n if (!isNaN(iterable.length)) {\n var i = -1, next = function next() {\n while (++i < iterable.length) {\n if (hasOwn.call(iterable, i)) {\n next.value = iterable[i];\n next.done = false;\n return next;\n }\n }\n\n next.value = undefined;\n next.done = true;\n\n return next;\n };\n\n return next.next = next;\n }\n }\n\n // Return an iterator with no values.\n return { next: doneResult };\n }\n runtime.values = values;\n\n function doneResult() {\n return { value: undefined, done: true };\n }\n\n Context.prototype = {\n constructor: Context,\n\n reset: function(skipTempReset) {\n this.prev = 0;\n this.next = 0;\n // Resetting context._sent for legacy support of Babel's\n // function.sent implementation.\n this.sent = this._sent = undefined;\n this.done = false;\n this.delegate = null;\n\n this.method = \"next\";\n this.arg = undefined;\n\n this.tryEntries.forEach(resetTryEntry);\n\n if (!skipTempReset) {\n for (var name in this) {\n // Not sure about the optimal order of these conditions:\n if (name.charAt(0) === \"t\" &&\n hasOwn.call(this, name) &&\n !isNaN(+name.slice(1))) {\n this[name] = undefined;\n }\n }\n }\n },\n\n stop: function() {\n this.done = true;\n\n var rootEntry = this.tryEntries[0];\n var rootRecord = rootEntry.completion;\n if (rootRecord.type === \"throw\") {\n throw rootRecord.arg;\n }\n\n return this.rval;\n },\n\n dispatchException: function(exception) {\n if (this.done) {\n throw exception;\n }\n\n var context = this;\n function handle(loc, caught) {\n record.type = \"throw\";\n record.arg = exception;\n context.next = loc;\n\n if (caught) {\n // If the dispatched exception was caught by a catch block,\n // then let that catch block handle the exception normally.\n context.method = \"next\";\n context.arg = undefined;\n }\n\n return !! caught;\n }\n\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n var record = entry.completion;\n\n if (entry.tryLoc === \"root\") {\n // Exception thrown outside of any try block that could handle\n // it, so set the completion value of the entire function to\n // throw the exception.\n return handle(\"end\");\n }\n\n if (entry.tryLoc <= this.prev) {\n var hasCatch = hasOwn.call(entry, \"catchLoc\");\n var hasFinally = hasOwn.call(entry, \"finallyLoc\");\n\n if (hasCatch && hasFinally) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n } else if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else if (hasCatch) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n }\n\n } else if (hasFinally) {\n if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else {\n throw new Error(\"try statement without catch or finally\");\n }\n }\n }\n },\n\n abrupt: function(type, arg) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc <= this.prev &&\n hasOwn.call(entry, \"finallyLoc\") &&\n this.prev < entry.finallyLoc) {\n var finallyEntry = entry;\n break;\n }\n }\n\n if (finallyEntry &&\n (type === \"break\" ||\n type === \"continue\") &&\n finallyEntry.tryLoc <= arg &&\n arg <= finallyEntry.finallyLoc) {\n // Ignore the finally entry if control is not jumping to a\n // location outside the try/catch block.\n finallyEntry = null;\n }\n\n var record = finallyEntry ? finallyEntry.completion : {};\n record.type = type;\n record.arg = arg;\n\n if (finallyEntry) {\n this.method = \"next\";\n this.next = finallyEntry.finallyLoc;\n return ContinueSentinel;\n }\n\n return this.complete(record);\n },\n\n complete: function(record, afterLoc) {\n if (record.type === \"throw\") {\n throw record.arg;\n }\n\n if (record.type === \"break\" ||\n record.type === \"continue\") {\n this.next = record.arg;\n } else if (record.type === \"return\") {\n this.rval = this.arg = record.arg;\n this.method = \"return\";\n this.next = \"end\";\n } else if (record.type === \"normal\" && afterLoc) {\n this.next = afterLoc;\n }\n\n return ContinueSentinel;\n },\n\n finish: function(finallyLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.finallyLoc === finallyLoc) {\n this.complete(entry.completion, entry.afterLoc);\n resetTryEntry(entry);\n return ContinueSentinel;\n }\n }\n },\n\n \"catch\": function(tryLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc === tryLoc) {\n var record = entry.completion;\n if (record.type === \"throw\") {\n var thrown = record.arg;\n resetTryEntry(entry);\n }\n return thrown;\n }\n }\n\n // The context.catch method must only be called with a location\n // argument that corresponds to a known catch block.\n throw new Error(\"illegal catch attempt\");\n },\n\n delegateYield: function(iterable, resultName, nextLoc) {\n this.delegate = {\n iterator: values(iterable),\n resultName: resultName,\n nextLoc: nextLoc\n };\n\n if (this.method === \"next\") {\n // Deliberately forget the last sent value so that we don't\n // accidentally pass it on to the delegate.\n this.arg = undefined;\n }\n\n return ContinueSentinel;\n }\n };\n})(\n // In sloppy mode, unbound `this` refers to the global object, fallback to\n // Function constructor if we're in global strict mode. That is sadly a form\n // of indirect eval which violates Content Security Policy.\n (function() { return this })() || Function(\"return this\")()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/babel-runtime/~/regenerator-runtime/runtime.js\n// module id = HhN8\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport normalizeSlotMixin from '../../mixins/normalize-slot';\nexport var props = {\n footVariant: {\n type: String,\n // supported values: 'lite', 'dark', or null\n default: null\n } // @vue/component\n\n};\nexport var BTfoot =\n/*#__PURE__*/\nVue.extend({\n name: 'BTfoot',\n mixins: [normalizeSlotMixin],\n inheritAttrs: false,\n provide: function provide() {\n return {\n bvTableTfoot: this\n };\n },\n inject: {\n bvTable: {\n default: null\n }\n },\n props: props,\n computed: {\n tfootClasses: function tfootClasses() {\n return [this.footVariant ? \"thead-\".concat(this.footVariant) : null];\n },\n tfootAttrs: function tfootAttrs() {\n return _objectSpread({\n role: 'rowgroup'\n }, this.$attrs);\n }\n },\n render: function render(h) {\n return h('tfoot', {\n class: this.tfootClasses,\n attrs: this.tfootAttrs,\n // Pass down any native listeners\n on: this.$listeners\n }, this.normalizeSlot('default', {}));\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/table/tfoot.js\n// module id = HmuJ\n// module chunks = 0","function _typeof(obj) { if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }\n\nfunction _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) { return call; } return _assertThisInitialized(self); }\n\nfunction _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\"); } return self; }\n\nfunction _get(target, property, receiver) { if (typeof Reflect !== \"undefined\" && Reflect.get) { _get = Reflect.get; } else { _get = function _get(target, property, receiver) { var base = _superPropBase(target, property); if (!base) return; var desc = Object.getOwnPropertyDescriptor(base, property); if (desc.get) { return desc.get.call(receiver); } return desc.value; }; } return _get(target, property, receiver || target); }\n\nfunction _superPropBase(object, property) { while (!Object.prototype.hasOwnProperty.call(object, property)) { object = _getPrototypeOf(object); if (object === null) break; } return object; }\n\nfunction _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); }\n\nfunction _inherits(subClass, superClass) { if (typeof superClass !== \"function\" && superClass !== null) { throw new TypeError(\"Super expression must either be null or a function\"); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass) _setPrototypeOf(subClass, superClass); }\n\nfunction _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); }\n\nimport { BvEvent } from '../../../utils/bv-event.class';\nimport { defineProperties, readonlyDescriptor } from '../../../utils/object';\n\nvar BvModalEvent =\n/*#__PURE__*/\nfunction (_BvEvent) {\n _inherits(BvModalEvent, _BvEvent);\n\n function BvModalEvent(type) {\n var _this;\n\n var eventInit = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n\n _classCallCheck(this, BvModalEvent);\n\n _this = _possibleConstructorReturn(this, _getPrototypeOf(BvModalEvent).call(this, type, eventInit)); // Freeze our new props as readonly, but leave them enumerable\n\n defineProperties(_assertThisInitialized(_this), {\n trigger: readonlyDescriptor()\n });\n return _this;\n }\n\n _createClass(BvModalEvent, null, [{\n key: \"Defaults\",\n get: function get() {\n return _objectSpread({}, _get(_getPrototypeOf(BvModalEvent), \"Defaults\", this), {\n trigger: null\n });\n }\n }]);\n\n return BvModalEvent;\n}(BvEvent); // Named exports\n\n\nexport { BvModalEvent };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/modal/helpers/bv-modal-event.class.js\n// module id = I/xj\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { getComponentConfig } from '../../utils/config';\nimport pluckProps from '../../utils/pluck-props';\nimport { BLink, propsFactory as linkPropsFactory } from '../link/link';\nvar NAME = 'BBadge';\nvar linkProps = linkPropsFactory();\ndelete linkProps.href.default;\ndelete linkProps.to.default;\nexport var props = _objectSpread({}, linkProps, {\n tag: {\n type: String,\n default: 'span'\n },\n variant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'variant');\n }\n },\n pill: {\n type: Boolean,\n default: false\n } // @vue/component\n\n});\nexport var BBadge =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var tag = !props.href && !props.to ? props.tag : BLink;\n var componentData = {\n staticClass: 'badge',\n class: [props.variant ? \"badge-\".concat(props.variant) : 'badge-secondary', {\n 'badge-pill': Boolean(props.pill),\n active: props.active,\n disabled: props.disabled\n }],\n props: pluckProps(linkProps, props)\n };\n return h(tag, mergeData(data, componentData), children);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/badge/badge.js\n// module id = I9lN\n// module chunks = 0","import Vue from '../../utils/vue';\nimport idMixin from '../../mixins/id';\nimport formMixin from '../../mixins/form';\nimport formOptionsMixin from '../../mixins/form-options';\nimport formRadioCheckGroupMixin from '../../mixins/form-radio-check-group';\nimport formSizeMixin from '../../mixins/form-size';\nimport formStateMixin from '../../mixins/form-state';\nexport var props = {\n switches: {\n // Custom switch styling\n type: Boolean,\n default: false\n },\n checked: {\n type: [String, Number, Object, Array, Boolean],\n default: null\n } // @vue/component\n\n};\nexport var BFormCheckboxGroup =\n/*#__PURE__*/\nVue.extend({\n name: 'BFormCheckboxGroup',\n mixins: [idMixin, formMixin, formRadioCheckGroupMixin, // Includes render function\n formOptionsMixin, formSizeMixin, formStateMixin],\n provide: function provide() {\n return {\n bvCheckGroup: this\n };\n },\n props: props,\n data: function data() {\n return {\n localChecked: this.checked || []\n };\n },\n computed: {\n isRadioGroup: function isRadioGroup() {\n return false;\n }\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-checkbox/form-checkbox-group.js\n// module id = IIow\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split('_'),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_');\n\n var monthsParse = [/^ene/i, /^feb/i, /^mar/i, /^abr/i, /^may/i, /^jun/i, /^jul/i, /^ago/i, /^sep/i, /^oct/i, /^nov/i, /^dic/i];\n var monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var esUs = moment.defineLocale('es-us', {\n months : 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split('_'),\n monthsShort : function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex: monthsRegex,\n monthsShortRegex: monthsRegex,\n monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex: /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse: monthsParse,\n longMonthsParse: monthsParse,\n shortMonthsParse: monthsParse,\n weekdays : 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'h:mm A',\n LTS : 'h:mm:ss A',\n L : 'MM/DD/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY h:mm A',\n LLLL : 'dddd, D [de] MMMM [de] YYYY h:mm A'\n },\n calendar : {\n sameDay : function () {\n return '[hoy a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextDay : function () {\n return '[mañana a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastDay : function () {\n return '[ayer a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastWeek : function () {\n return '[el] dddd [pasado a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : 'en %s',\n past : 'hace %s',\n s : 'unos segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'una hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un año',\n yy : '%d años'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 0, // Sunday is the first day of the week.\n doy : 6 // The week that contains Jan 6th is the first week of the year.\n }\n });\n\n return esUs;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/es-us.js\n// module id = INcR\n// module chunks = 0","!function(t,e){if(\"object\"==typeof exports&&\"object\"==typeof module)module.exports=e();else if(\"function\"==typeof define&&define.amd)define([],e);else{var n=e();for(var r in n)(\"object\"==typeof exports?exports:t)[r]=n[r]}}(this,function(){return function(t){function e(r){if(n[r])return n[r].exports;var i=n[r]={i:r,l:!1,exports:{}};return t[r].call(i.exports,i,i.exports,e),i.l=!0,i.exports}var n={};return e.m=t,e.c=n,e.i=function(t){return t},e.d=function(t,n,r){e.o(t,n)||Object.defineProperty(t,n,{configurable:!1,enumerable:!0,get:r})},e.n=function(t){var n=t&&t.__esModule?function(){return t.default}:function(){return t};return e.d(n,\"a\",n),n},e.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},e.p=\"/dist/\",e(e.s=6)}([function(t,e,n){\"use strict\";function r(){d=!1}function i(t){if(!t)return void(f!==m&&(f=m,r()));if(t!==f){if(t.length!==m.length)throw new Error(\"Custom alphabet for shortid must be \"+m.length+\" unique characters. You submitted \"+t.length+\" characters: \"+t);var e=t.split(\"\").filter(function(t,e,n){return e!==n.lastIndexOf(t)});if(e.length)throw new Error(\"Custom alphabet for shortid must be \"+m.length+\" unique characters. These characters were not unique: \"+e.join(\", \"));f=t,r()}}function o(t){return i(t),f}function a(t){h.seed(t),p!==t&&(r(),p=t)}function s(){f||i(m);for(var t,e=f.split(\"\"),n=[],r=h.nextValue();e.length>0;)r=h.nextValue(),t=Math.floor(r*e.length),n.push(e.splice(t,1)[0]);return n.join(\"\")}function c(){return d||(d=s())}function u(t){return c()[t]}function l(){return f||m}var f,p,d,h=n(19),m=\"0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ_-\";t.exports={get:l,characters:o,seed:a,lookup:u,shuffled:c}},function(t,e,n){\"use strict\";var r=n(5),i=n.n(r);e.a={animateIn:function(t){i()({targets:t,translateY:\"-35px\",opacity:1,duration:300,easing:\"easeOutCubic\"})},animateOut:function(t,e){i()({targets:t,opacity:0,marginTop:\"-40px\",duration:300,easing:\"easeOutExpo\",complete:e})},animateOutBottom:function(t,e){i()({targets:t,opacity:0,marginBottom:\"-40px\",duration:300,easing:\"easeOutExpo\",complete:e})},animateReset:function(t){i()({targets:t,left:0,opacity:1,duration:300,easing:\"easeOutExpo\"})},animatePanning:function(t,e,n){i()({targets:t,duration:10,easing:\"easeOutQuad\",left:e,opacity:n})},animatePanEnd:function(t,e){i()({targets:t,opacity:0,duration:300,easing:\"easeOutExpo\",complete:e})},clearAnimation:function(t){var e=i.a.timeline();t.forEach(function(t){e.add({targets:t.el,opacity:0,right:\"-40px\",duration:300,offset:\"-=150\",easing:\"easeOutExpo\",complete:function(){t.remove()}})})}}},function(t,e,n){\"use strict\";t.exports=n(16)},function(t,e,n){\"use strict\";n.d(e,\"a\",function(){return s});var r=n(8),i=n(1),o=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},a=n(2);n(11).polyfill();var s=function t(e){var n=this;return this.id=a.generate(),this.options=e,this.cached_options={},this.global={},this.groups=[],this.toasts=[],this.container=null,l(this),u(this),this.group=function(e){e||(e={}),e.globalToasts||(e.globalToasts={}),Object.assign(e.globalToasts,n.global);var r=new t(e);return n.groups.push(r),r},this.register=function(t,e,r){return r=r||{},f(n,t,e,r)},this.show=function(t,e){return c(n,t,e)},this.success=function(t,e){return e=e||{},e.type=\"success\",c(n,t,e)},this.info=function(t,e){return e=e||{},e.type=\"info\",c(n,t,e)},this.error=function(t,e){return e=e||{},e.type=\"error\",c(n,t,e)},this.remove=function(t){n.toasts=n.toasts.filter(function(e){return e.el.hash!==t.hash}),t.parentNode&&t.parentNode.removeChild(t)},this.clear=function(t){return i.a.clearAnimation(n.toasts,function(){t&&t()}),n.toasts=[],!0},this},c=function(t,e,i){i=i||{};var a=null;if(\"object\"!==(void 0===i?\"undefined\":o(i)))return console.error(\"Options should be a type of object. given : \"+i),null;t.options.singleton&&t.toasts.length>0&&(t.cached_options=i,t.toasts[t.toasts.length-1].goAway(0));var s=Object.assign({},t.options);return Object.assign(s,i),a=n.i(r.a)(t,e,s),t.toasts.push(a),a},u=function(t){var e=t.options.globalToasts,n=function(e,n){return\"string\"==typeof n&&t[n]?t[n].apply(t,[e,{}]):c(t,e,n)};e&&(t.global={},Object.keys(e).forEach(function(r){t.global[r]=function(){var t=arguments.length>0&&void 0!==arguments[0]?arguments[0]:{};return e[r].apply(null,[t,n])}}))},l=function(t){var e=document.createElement(\"div\");e.id=t.id,e.setAttribute(\"role\",\"status\"),e.setAttribute(\"aria-live\",\"polite\"),e.setAttribute(\"aria-atomic\",\"false\"),document.body.appendChild(e),t.container=e},f=function(t,e,n,r){t.options.globalToasts||(t.options.globalToasts={}),t.options.globalToasts[e]=function(t,e){var i=null;return\"string\"==typeof n&&(i=n),\"function\"==typeof n&&(i=n(t)),e(i,r)},u(t)}},function(t,e,n){n(22);var r=n(21)(null,null,null,null);t.exports=r.exports},function(t,e,n){(function(n){var r,i,o,a={scope:{}};a.defineProperty=\"function\"==typeof Object.defineProperties?Object.defineProperty:function(t,e,n){if(n.get||n.set)throw new TypeError(\"ES3 does not support getters and setters.\");t!=Array.prototype&&t!=Object.prototype&&(t[e]=n.value)},a.getGlobal=function(t){return\"undefined\"!=typeof window&&window===t?t:void 0!==n&&null!=n?n:t},a.global=a.getGlobal(this),a.SYMBOL_PREFIX=\"jscomp_symbol_\",a.initSymbol=function(){a.initSymbol=function(){},a.global.Symbol||(a.global.Symbol=a.Symbol)},a.symbolCounter_=0,a.Symbol=function(t){return a.SYMBOL_PREFIX+(t||\"\")+a.symbolCounter_++},a.initSymbolIterator=function(){a.initSymbol();var t=a.global.Symbol.iterator;t||(t=a.global.Symbol.iterator=a.global.Symbol(\"iterator\")),\"function\"!=typeof Array.prototype[t]&&a.defineProperty(Array.prototype,t,{configurable:!0,writable:!0,value:function(){return a.arrayIterator(this)}}),a.initSymbolIterator=function(){}},a.arrayIterator=function(t){var e=0;return a.iteratorPrototype(function(){return en&&(n+=1),1n?e:n<2/3?t+(e-t)*(2/3-n)*6:t}var n=/hsl\\((\\d+),\\s*([\\d.]+)%,\\s*([\\d.]+)%\\)/g.exec(t)||/hsla\\((\\d+),\\s*([\\d.]+)%,\\s*([\\d.]+)%,\\s*([\\d.]+)\\)/g.exec(t);t=parseInt(n[1])/360;var r=parseInt(n[2])/100,i=parseInt(n[3])/100,n=n[4]||1;if(0==r)i=r=t=i;else{var o=.5>i?i*(1+r):i+r-i*r,a=2*i-o,i=e(a,o,t+1/3),r=e(a,o,t);t=e(a,o,t-1/3)}return\"rgba(\"+255*i+\",\"+255*r+\",\"+255*t+\",\"+n+\")\"}function f(t){if(t=/([\\+\\-]?[0-9#\\.]+)(%|px|pt|em|rem|in|cm|mm|ex|ch|pc|vw|vh|vmin|vmax|deg|rad|turn)?$/.exec(t))return t[2]}function p(t){return-1=d.currentTime)for(var x=0;x=h||!e)&&(d.began||(d.began=!0,o(\"begin\")),o(\"run\")),g>s&&g=e&&m!==e||!e)&&(i(e),v||a())),o(\"update\"),t>=e&&(d.remaining?(u=c,\"alternate\"===d.direction&&(d.reversed=!d.reversed)):(d.pause(),d.completed||(d.completed=!0,o(\"complete\"),\"Promise\"in window&&(f(),p=n()))),l=0)}t=void 0===t?{}:t;var c,u,l=0,f=null,p=n(),d=L(t);return d.reset=function(){var t=d.direction,e=d.loop;for(d.currentTime=0,d.progress=0,d.paused=!0,d.began=!1,d.completed=!1,d.reversed=\"reverse\"===t,d.remaining=\"alternate\"===t&&1===e?2:e,i(0),t=d.children.length;t--;)d.children[t].reset()},d.tick=function(t){c=t,u||(u=c),s((l+c-u)*j.speed)},d.seek=function(t){s(r(t))},d.pause=function(){var t=H.indexOf(d);-1=e&&0<=r&&1>=r){var o=new Float32Array(11);if(e!==n||r!==i)for(var a=0;11>a;++a)o[a]=t(.1*a,e,r);return function(a){if(e===n&&r===i)return a;if(0===a)return 0;if(1===a)return 1;for(var s=0,c=1;10!==c&&o[c]<=a;++c)s+=.1;--c;var c=s+(a-o[c])/(o[c+1]-o[c])*.1,u=3*(1-3*r+3*e)*c*c+2*(3*r-6*e)*c+3*e;if(.001<=u){for(s=0;4>s&&0!==(u=3*(1-3*r+3*e)*c*c+2*(3*r-6*e)*c+3*e);++s)var l=t(c,e,r)-a,c=c-l/u;a=c}else if(0===u)a=c;else{var c=s,s=s+.1,f=0;do{l=c+(s-c)/2,u=t(l,e,r)-a,0++f);a=l}return t(a,n,i)}}}}(),z=function(){function t(t,e){return 0===t||1===t?t:-Math.pow(2,10*(t-1))*Math.sin(2*(t-1-e/(2*Math.PI)*Math.asin(1))*Math.PI/e)}var e,n=\"Quad Cubic Quart Quint Sine Expo Circ Back Elastic\".split(\" \"),r={In:[[.55,.085,.68,.53],[.55,.055,.675,.19],[.895,.03,.685,.22],[.755,.05,.855,.06],[.47,0,.745,.715],[.95,.05,.795,.035],[.6,.04,.98,.335],[.6,-.28,.735,.045],t],Out:[[.25,.46,.45,.94],[.215,.61,.355,1],[.165,.84,.44,1],[.23,1,.32,1],[.39,.575,.565,1],[.19,1,.22,1],[.075,.82,.165,1],[.175,.885,.32,1.275],function(e,n){return 1-t(1-e,n)}],InOut:[[.455,.03,.515,.955],[.645,.045,.355,1],[.77,0,.175,1],[.86,0,.07,1],[.445,.05,.55,.95],[1,0,0,1],[.785,.135,.15,.86],[.68,-.55,.265,1.55],function(e,n){return.5>e?t(2*e,n)/2:1-t(-2*e+2,n)/2}]},i={linear:F(.25,.25,.75,.75)},o={};for(e in r)o.type=e,r[o.type].forEach(function(t){return function(e,r){i[\"ease\"+t.type+n[r]]=R.fnc(e)?e:F.apply(s,e)}}(o)),o={type:o.type};return i}(),Y={css:function(t,e,n){return t.style[e]=n},attribute:function(t,e,n){return t.setAttribute(e,n)},object:function(t,e,n){return t[e]=n},transform:function(t,e,n,r,i){r[i]||(r[i]=[]),r[i].push(e+\"(\"+n+\")\")}},H=[],q=0,V=function(){function t(){q=requestAnimationFrame(e)}function e(e){var n=H.length;if(n){for(var r=0;rn&&(e.duration=r.duration),e.children.push(r)}),e.seek(0),e.reset(),e.autoplay&&e.restart(),e},e},j.random=function(t,e){return Math.floor(Math.random()*(e-t+1))+t},j})}).call(e,n(25))},function(t,e,n){\"use strict\";Object.defineProperty(e,\"__esModule\",{value:!0});var r=n(3),i=n(4),o=n.n(i),a={install:function(t,e){e||(e={});var n=new r.a(e);t.component(\"toasted\",o.a),t.toasted=t.prototype.$toasted=n}};\"undefined\"!=typeof window&&window.Vue&&(window.Toasted=a),e.default=a},function(t,e,n){\"use strict\";n.d(e,\"a\",function(){return c});var r=n(1),i=this,o=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},a=function(t,e,n){return setTimeout(function(){if(n.cached_options.position&&n.cached_options.position.includes(\"bottom\"))return void r.a.animateOutBottom(t,function(){n.remove(t)});r.a.animateOut(t,function(){n.remove(t)})},e),!0},s=function(t,e){return(\"object\"===(\"undefined\"==typeof HTMLElement?\"undefined\":o(HTMLElement))?e instanceof HTMLElement:e&&\"object\"===(void 0===e?\"undefined\":o(e))&&null!==e&&1===e.nodeType&&\"string\"==typeof e.nodeName)?t.appendChild(e):t.innerHTML=e,i},c=function(t,e){var n=!1;return{el:t,text:function(e){return s(t,e),this},goAway:function(){var r=arguments.length>0&&void 0!==arguments[0]?arguments[0]:800;return n=!0,a(t,r,e)},remove:function(){e.remove(t)},disposed:function(){return n}}}},function(t,e,n){\"use strict\";var r=n(12),i=n.n(r),o=n(1),a=n(7),s=\"function\"==typeof Symbol&&\"symbol\"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&\"function\"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?\"symbol\":typeof t},c=n(2);String.prototype.includes||Object.defineProperty(String.prototype,\"includes\",{value:function(t,e){return\"number\"!=typeof e&&(e=0),!(e+t.length>this.length)&&-1!==this.indexOf(t,e)}});var u={},l=null,f=function(t){return t.className=t.className||null,t.onComplete=t.onComplete||null,t.position=t.position||\"top-right\",t.duration=t.duration||null,t.keepOnHover=t.keepOnHover||!1,t.theme=t.theme||\"toasted-primary\",t.type=t.type||\"default\",t.containerClass=t.containerClass||null,t.fullWidth=t.fullWidth||!1,t.icon=t.icon||null,t.action=t.action||null,t.fitToScreen=t.fitToScreen||null,t.closeOnSwipe=void 0===t.closeOnSwipe||t.closeOnSwipe,t.iconPack=t.iconPack||\"material\",t.className&&\"string\"==typeof t.className&&(t.className=t.className.split(\" \")),t.className||(t.className=[]),t.theme&&t.className.push(t.theme.trim()),t.type&&t.className.push(t.type),t.containerClass&&\"string\"==typeof t.containerClass&&(t.containerClass=t.containerClass.split(\" \")),t.containerClass||(t.containerClass=[]),t.position&&t.containerClass.push(t.position.trim()),t.fullWidth&&t.containerClass.push(\"full-width\"),t.fitToScreen&&t.containerClass.push(\"fit-to-screen\"),u=t,t},p=function(t,e){var r=document.createElement(\"div\");if(r.classList.add(\"toasted\"),r.hash=c.generate(),e.className&&e.className.forEach(function(t){r.classList.add(t)}),(\"object\"===(\"undefined\"==typeof HTMLElement?\"undefined\":s(HTMLElement))?t instanceof HTMLElement:t&&\"object\"===(void 0===t?\"undefined\":s(t))&&null!==t&&1===t.nodeType&&\"string\"==typeof t.nodeName)?r.appendChild(t):r.innerHTML=t,d(e,r),e.closeOnSwipe){var u=new i.a(r,{prevent_default:!1});u.on(\"pan\",function(t){var e=t.deltaX;r.classList.contains(\"panning\")||r.classList.add(\"panning\");var n=1-Math.abs(e/80);n<0&&(n=0),o.a.animatePanning(r,e,n)}),u.on(\"panend\",function(t){var n=t.deltaX;Math.abs(n)>80?o.a.animatePanEnd(r,function(){\"function\"==typeof e.onComplete&&e.onComplete(),r.parentNode&&l.remove(r)}):(r.classList.remove(\"panning\"),o.a.animateReset(r))})}if(Array.isArray(e.action))e.action.forEach(function(t){var e=m(t,n.i(a.a)(r,l));e&&r.appendChild(e)});else if(\"object\"===s(e.action)){var f=m(e.action,n.i(a.a)(r,l));f&&r.appendChild(f)}return r},d=function(t,e){if(t.icon){var n=document.createElement(\"i\");switch(n.setAttribute(\"aria-hidden\",\"true\"),t.iconPack){case\"fontawesome\":n.classList.add(\"fa\");var r=t.icon.name?t.icon.name:t.icon;r.includes(\"fa-\")?n.classList.add(r.trim()):n.classList.add(\"fa-\"+r.trim());break;case\"mdi\":n.classList.add(\"mdi\");var i=t.icon.name?t.icon.name:t.icon;i.includes(\"mdi-\")?n.classList.add(i.trim()):n.classList.add(\"mdi-\"+i.trim());break;case\"custom-class\":var o=t.icon.name?t.icon.name:t.icon;\"string\"==typeof o?o.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(o)&&o.forEach(function(t){n.classList.add(t.trim())});break;case\"callback\":var a=t.icon&&t.icon instanceof Function?t.icon:null;a&&(n=a(n));break;default:n.classList.add(\"material-icons\"),n.textContent=t.icon.name?t.icon.name:t.icon}t.icon.after&&n.classList.add(\"after\"),h(t,n,e)}},h=function(t,e,n){t.icon&&(t.icon.after&&t.icon.name?n.appendChild(e):(t.icon.name,n.insertBefore(e,n.firstChild)))},m=function(t,e){if(!t)return null;var n=document.createElement(\"a\");if(n.classList.add(\"action\"),n.classList.add(\"ripple\"),t.text&&(n.text=t.text),t.href&&(n.href=t.href),t.target&&(n.target=t.target),t.icon){n.classList.add(\"icon\");var r=document.createElement(\"i\");switch(u.iconPack){case\"fontawesome\":r.classList.add(\"fa\"),t.icon.includes(\"fa-\")?r.classList.add(t.icon.trim()):r.classList.add(\"fa-\"+t.icon.trim());break;case\"mdi\":r.classList.add(\"mdi\"),t.icon.includes(\"mdi-\")?r.classList.add(t.icon.trim()):r.classList.add(\"mdi-\"+t.icon.trim());break;case\"custom-class\":\"string\"==typeof t.icon?t.icon.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(t.icon)&&t.icon.forEach(function(t){n.classList.add(t.trim())});break;default:r.classList.add(\"material-icons\"),r.textContent=t.icon}n.appendChild(r)}return t.class&&(\"string\"==typeof t.class?t.class.split(\" \").forEach(function(t){n.classList.add(t)}):Array.isArray(t.class)&&t.class.forEach(function(t){n.classList.add(t.trim())})),t.push&&n.addEventListener(\"click\",function(n){if(n.preventDefault(),!u.router)return void console.warn(\"[vue-toasted] : Vue Router instance is not attached. please check the docs\");u.router.push(t.push),t.push.dontClose||e.goAway(0)}),t.onClick&&\"function\"==typeof t.onClick&&n.addEventListener(\"click\",function(n){t.onClick&&(n.preventDefault(),t.onClick(n,e))}),n};e.a=function(t,e,r){l=t,r=f(r);var i=l.container;r.containerClass.unshift(\"toasted-container\"),i.className!==r.containerClass.join(\" \")&&(i.className=\"\",r.containerClass.forEach(function(t){i.classList.add(t)}));var s=p(e,r);e&&i.appendChild(s),s.style.opacity=0,o.a.animateIn(s);var c=r.duration,u=void 0;if(null!==c){var d=function(){return setInterval(function(){null===s.parentNode&&window.clearInterval(u),s.classList.contains(\"panning\")||(c-=20),c<=0&&(o.a.animateOut(s,function(){\"function\"==typeof r.onComplete&&r.onComplete(),s.parentNode&&l.remove(s)}),window.clearInterval(u))},20)};u=d(),r.keepOnHover&&(s.addEventListener(\"mouseover\",function(){window.clearInterval(u)}),s.addEventListener(\"mouseout\",function(){u=d()}))}return n.i(a.a)(s,l)}},function(t,e,n){e=t.exports=n(10)(),e.push([t.i,\".toasted{padding:0 20px}.toasted.rounded{border-radius:24px}.toasted .primary,.toasted.toasted-primary{border-radius:2px;min-height:38px;line-height:1.1em;background-color:#353535;padding:6px 20px;font-size:15px;font-weight:300;color:#fff;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24)}.toasted .primary.success,.toasted.toasted-primary.success{background:#4caf50}.toasted .primary.error,.toasted.toasted-primary.error{background:#f44336}.toasted .primary.info,.toasted.toasted-primary.info{background:#3f51b5}.toasted .primary .action,.toasted.toasted-primary .action{color:#a1c2fa}.toasted.bubble{border-radius:30px;min-height:38px;line-height:1.1em;background-color:#ff7043;padding:0 20px;font-size:15px;font-weight:300;color:#fff;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24)}.toasted.bubble.success{background:#4caf50}.toasted.bubble.error{background:#f44336}.toasted.bubble.info{background:#3f51b5}.toasted.bubble .action{color:#8e2b0c}.toasted.outline{border-radius:30px;min-height:38px;line-height:1.1em;background-color:#fff;border:1px solid #676767;padding:0 20px;font-size:15px;color:#676767;box-shadow:0 1px 3px rgba(0,0,0,.12),0 1px 2px rgba(0,0,0,.24);font-weight:700}.toasted.outline.success{color:#4caf50;border-color:#4caf50}.toasted.outline.error{color:#f44336;border-color:#f44336}.toasted.outline.info{color:#3f51b5;border-color:#3f51b5}.toasted.outline .action{color:#607d8b}.toasted-container{position:fixed;z-index:10000}.toasted-container,.toasted-container.full-width{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.toasted-container.full-width{max-width:86%;width:100%}.toasted-container.full-width.fit-to-screen{min-width:100%}.toasted-container.full-width.fit-to-screen .toasted:first-child{margin-top:0}.toasted-container.full-width.fit-to-screen.top-right{top:0;right:0}.toasted-container.full-width.fit-to-screen.top-left{top:0;left:0}.toasted-container.full-width.fit-to-screen.top-center{top:0;left:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.full-width.fit-to-screen.bottom-right{right:0;bottom:0}.toasted-container.full-width.fit-to-screen.bottom-left{left:0;bottom:0}.toasted-container.full-width.fit-to-screen.bottom-center{left:0;bottom:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.top-right{top:10%;right:7%}.toasted-container.top-left{top:10%;left:7%}.toasted-container.top-center{top:10%;left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}.toasted-container.bottom-right{right:5%;bottom:7%}.toasted-container.bottom-left{left:5%;bottom:7%}.toasted-container.bottom-center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%);bottom:7%}.toasted-container.bottom-left .toasted,.toasted-container.top-left .toasted{float:left}.toasted-container.bottom-right .toasted,.toasted-container.top-right .toasted{float:right}.toasted-container .toasted{top:35px;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;word-break:normal;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;box-sizing:inherit}.toasted-container .toasted .fa,.toasted-container .toasted .fab,.toasted-container .toasted .far,.toasted-container .toasted .fas,.toasted-container .toasted .material-icons,.toasted-container .toasted .mdi{margin-right:.5rem;margin-left:-.4rem}.toasted-container .toasted .fa.after,.toasted-container .toasted .fab.after,.toasted-container .toasted .far.after,.toasted-container .toasted .fas.after,.toasted-container .toasted .material-icons.after,.toasted-container .toasted .mdi.after{margin-left:.5rem;margin-right:-.4rem}.toasted-container .toasted .action{text-decoration:none;font-size:.8rem;padding:8px;margin:5px -7px 5px 7px;border-radius:3px;text-transform:uppercase;letter-spacing:.03em;font-weight:600;cursor:pointer}.toasted-container .toasted .action.icon{padding:4px;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.toasted-container .toasted .action.icon .fa,.toasted-container .toasted .action.icon .material-icons,.toasted-container .toasted .action.icon .mdi{margin-right:0;margin-left:4px}.toasted-container .toasted .action.icon:hover{text-decoration:none}.toasted-container .toasted .action:hover{text-decoration:underline}@media only screen and (max-width:600px){.toasted-container{min-width:100%}.toasted-container .toasted:first-child{margin-top:0}.toasted-container.top-right{top:0;right:0}.toasted-container.top-left{top:0;left:0}.toasted-container.top-center{top:0;left:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.bottom-right{right:0;bottom:0}.toasted-container.bottom-left{left:0;bottom:0}.toasted-container.bottom-center{left:0;bottom:0;-webkit-transform:translateX(0);transform:translateX(0)}.toasted-container.bottom-center,.toasted-container.top-center{-ms-flex-align:stretch!important;align-items:stretch!important}.toasted-container.bottom-left .toasted,.toasted-container.bottom-right .toasted,.toasted-container.top-left .toasted,.toasted-container.top-right .toasted{float:none}.toasted-container .toasted{border-radius:0}}\",\"\"])},function(t,e){t.exports=function(){var t=[];return t.toString=function(){for(var t=[],e=0;e\\s*\\(/gm,\"{anonymous}()@\"):\"Unknown Stack Trace\",o=i.console&&(i.console.warn||i.console.log);return o&&o.call(i.console,r,n),t.apply(this,arguments)}}function p(t,e,n){var r,i=e.prototype;r=t.prototype=Object.create(i),r.constructor=t,r._super=i,n&&ht(r,n)}function d(t,e){return function(){return t.apply(e,arguments)}}function h(t,e){return typeof t==gt?t.apply(e?e[0]||s:s,e):t}function m(t,e){return t===s?e:t}function v(t,e,n){l(x(e),function(e){t.addEventListener(e,n,!1)})}function g(t,e,n){l(x(e),function(e){t.removeEventListener(e,n,!1)})}function y(t,e){for(;t;){if(t==e)return!0;t=t.parentNode}return!1}function b(t,e){return t.indexOf(e)>-1}function x(t){return t.trim().split(/\\s+/g)}function T(t,e,n){if(t.indexOf&&!n)return t.indexOf(e);for(var r=0;rn[e]}):r.sort()),r}function C(t,e){for(var n,r,i=e[0].toUpperCase()+e.slice(1),o=0;o1&&!n.firstMultiple?n.firstMultiple=j(e):1===i&&(n.firstMultiple=!1);var o=n.firstInput,a=n.firstMultiple,s=a?a.center:o.center,c=e.center=N(r);e.timeStamp=xt(),e.deltaTime=e.timeStamp-o.timeStamp,e.angle=R(s,c),e.distance=D(s,c),P(n,e),e.offsetDirection=X(e.deltaX,e.deltaY);var u=_(e.deltaTime,e.deltaX,e.deltaY);e.overallVelocityX=u.x,e.overallVelocityY=u.y,e.overallVelocity=bt(u.x)>bt(u.y)?u.x:u.y,e.scale=a?z(a.pointers,r):1,e.rotation=a?F(a.pointers,r):0,e.maxPointers=n.prevInput?e.pointers.length>n.prevInput.maxPointers?e.pointers.length:n.prevInput.maxPointers:e.pointers.length,L(n,e);var l=t.element;y(e.srcEvent.target,l)&&(l=e.srcEvent.target),e.target=l}function P(t,e){var n=e.center,r=t.offsetDelta||{},i=t.prevDelta||{},o=t.prevInput||{};e.eventType!==Mt&&o.eventType!==Pt||(i=t.prevDelta={x:o.deltaX||0,y:o.deltaY||0},r=t.offsetDelta={x:n.x,y:n.y}),e.deltaX=i.x+(n.x-r.x),e.deltaY=i.y+(n.y-r.y)}function L(t,e){var n,r,i,o,a=t.lastInterval||e,c=e.timeStamp-a.timeStamp;if(e.eventType!=Lt&&(c>It||a.velocity===s)){var u=e.deltaX-a.deltaX,l=e.deltaY-a.deltaY,f=_(c,u,l);r=f.x,i=f.y,n=bt(f.x)>bt(f.y)?f.x:f.y,o=X(u,l),t.lastInterval=e}else n=a.velocity,r=a.velocityX,i=a.velocityY,o=a.direction;e.velocity=n,e.velocityX=r,e.velocityY=i,e.direction=o}function j(t){for(var e=[],n=0;n=bt(e)?t<0?Nt:_t:e<0?Xt:Dt}function D(t,e,n){n||(n=Yt);var r=e[n[0]]-t[n[0]],i=e[n[1]]-t[n[1]];return Math.sqrt(r*r+i*i)}function R(t,e,n){n||(n=Yt);var r=e[n[0]]-t[n[0]],i=e[n[1]]-t[n[1]];return 180*Math.atan2(i,r)/Math.PI}function F(t,e){return R(e[1],e[0],Ht)+R(t[1],t[0],Ht)}function z(t,e){return D(e[0],e[1],Ht)/D(t[0],t[1],Ht)}function Y(){this.evEl=Vt,this.evWin=Wt,this.pressed=!1,A.apply(this,arguments)}function H(){this.evEl=$t,this.evWin=Gt,A.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function q(){this.evTarget=Qt,this.evWin=Jt,this.started=!1,A.apply(this,arguments)}function V(t,e){var n=w(t.touches),r=w(t.changedTouches);return e&(Pt|Lt)&&(n=E(n.concat(r),\"identifier\",!0)),[n,r]}function W(){this.evTarget=te,this.targetIds={},A.apply(this,arguments)}function U(t,e){var n=w(t.touches),r=this.targetIds;if(e&(Mt|kt)&&1===n.length)return r[n[0].identifier]=!0,[n,n];var i,o,a=w(t.changedTouches),s=[],c=this.target;if(o=n.filter(function(t){return y(t.target,c)}),e===Mt)for(i=0;i-1&&r.splice(t,1)};setTimeout(i,ee)}}function Z(t){for(var e=t.srcEvent.clientX,n=t.srcEvent.clientY,r=0;r-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){n.manager.emit(e,t)}var n=this,r=this.state;r=he&&e(n.options.event+tt(r))},tryEmit:function(t){if(this.canEmit())return this.emit(t);this.state=32},canEmit:function(){for(var t=0;te.threshold&&i&e.direction},attrTest:function(t){return rt.prototype.attrTest.call(this,t)&&(this.state&pe||!(this.state&pe)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=et(t.direction);e&&(t.additionalEvent=this.options.event+e),this._super.emit.call(this,t)}}),p(ot,rt,{defaults:{event:\"pinch\",threshold:0,pointers:2},getTouchAction:function(){return[se]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&pe)},emit:function(t){if(1!==t.scale){var e=t.scale<1?\"in\":\"out\";t.additionalEvent=this.options.event+e}this._super.emit.call(this,t)}}),p(at,K,{defaults:{event:\"press\",pointers:1,time:251,threshold:9},getTouchAction:function(){return[oe]},process:function(t){var e=this.options,n=t.pointers.length===e.pointers,r=t.distancee.time;if(this._input=t,!r||!n||t.eventType&(Pt|Lt)&&!i)this.reset();else if(t.eventType&Mt)this.reset(),this._timer=c(function(){this.state=me,this.tryEmit()},e.time,this);else if(t.eventType&Pt)return me;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===me&&(t&&t.eventType&Pt?this.manager.emit(this.options.event+\"up\",t):(this._input.timeStamp=xt(),this.manager.emit(this.options.event,this._input)))}}),p(st,rt,{defaults:{event:\"rotate\",threshold:0,pointers:2},getTouchAction:function(){return[se]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&pe)}}),p(ct,rt,{defaults:{event:\"swipe\",threshold:10,velocity:.3,direction:Rt|Ft,pointers:1},getTouchAction:function(){return it.prototype.getTouchAction.call(this)},attrTest:function(t){var e,n=this.options.direction;return n&(Rt|Ft)?e=t.overallVelocity:n&Rt?e=t.overallVelocityX:n&Ft&&(e=t.overallVelocityY),this._super.attrTest.call(this,t)&&n&t.offsetDirection&&t.distance>this.options.threshold&&t.maxPointers==this.options.pointers&&bt(e)>this.options.velocity&&t.eventType&Pt},emit:function(t){var e=et(t.offsetDirection);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),p(ut,K,{defaults:{event:\"tap\",pointers:1,taps:1,interval:300,time:250,threshold:9,posThreshold:10},getTouchAction:function(){return[ae]},process:function(t){var e=this.options,n=t.pointers.length===e.pointers,r=t.distance0&&(e+=a(i)),e+=a(n)}var i,o,a=n(15),s=(n(0),1459707606518),c=6;t.exports=r},function(t,e,n){\"use strict\";function r(t){for(var e,n=0,r=\"\";!e;)r+=a(o,i.get(),1),e=tn.parts.length&&(r.parts.length=n.parts.length)}else{for(var a=[],i=0;i i) if (has(O, key = names[i++])) {\n ~arrayIndexOf(result, key) || result.push(key);\n }\n return result;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_object-keys-internal.js\n// module id = Ibhu\n// module chunks = 0","/*!\n * Viewer.js v1.3.5\n * https://fengyuanchen.github.io/viewerjs\n *\n * Copyright 2015-present Chen Fengyuan\n * Released under the MIT license\n *\n * Date: 2019-07-04T11:00:16.790Z\n */\n\n(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :\n typeof define === 'function' && define.amd ? define(factory) :\n (global = global || self, global.Viewer = factory());\n}(this, function () { 'use strict';\n\n function _typeof(obj) {\n if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") {\n _typeof = function (obj) {\n return typeof obj;\n };\n } else {\n _typeof = function (obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj;\n };\n }\n\n return _typeof(obj);\n }\n\n function _classCallCheck(instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n }\n\n function _defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, descriptor.key, descriptor);\n }\n }\n\n function _createClass(Constructor, protoProps, staticProps) {\n if (protoProps) _defineProperties(Constructor.prototype, protoProps);\n if (staticProps) _defineProperties(Constructor, staticProps);\n return Constructor;\n }\n\n var DEFAULTS = {\n /**\n * Enable a modal backdrop, specify `static` for a backdrop\n * which doesn't close the modal on click.\n * @type {boolean}\n */\n backdrop: true,\n\n /**\n * Show the button on the top-right of the viewer.\n * @type {boolean}\n */\n button: true,\n\n /**\n * Show the navbar.\n * @type {boolean | number}\n */\n navbar: true,\n\n /**\n * Specify the visibility and the content of the title.\n * @type {boolean | number | Function | Array}\n */\n title: true,\n\n /**\n * Show the toolbar.\n * @type {boolean | number | Object}\n */\n toolbar: true,\n\n /**\n * Custom class name(s) to add to the viewer's root element.\n * @type {string}\n */\n className: '',\n\n /**\n * Define where to put the viewer in modal mode.\n * @type {string | Element}\n */\n container: 'body',\n\n /**\n * Filter the images for viewing. Return true if the image is viewable.\n * @type {Function}\n */\n filter: null,\n\n /**\n * Enable to request fullscreen when play.\n * @type {boolean}\n */\n fullscreen: true,\n\n /**\n * Define the initial index of image for viewing.\n * @type {number}\n */\n initialViewIndex: 0,\n\n /**\n * Enable inline mode.\n * @type {boolean}\n */\n inline: false,\n\n /**\n * The amount of time to delay between automatically cycling an image when playing.\n * @type {number}\n */\n interval: 5000,\n\n /**\n * Enable keyboard support.\n * @type {boolean}\n */\n keyboard: true,\n\n /**\n * Indicate if show a loading spinner when load image or not.\n * @type {boolean}\n */\n loading: true,\n\n /**\n * Indicate if enable loop viewing or not.\n * @type {boolean}\n */\n loop: true,\n\n /**\n * Min width of the viewer in inline mode.\n * @type {number}\n */\n minWidth: 200,\n\n /**\n * Min height of the viewer in inline mode.\n * @type {number}\n */\n minHeight: 100,\n\n /**\n * Enable to move the image.\n * @type {boolean}\n */\n movable: true,\n\n /**\n * Enable to zoom the image.\n * @type {boolean}\n */\n zoomable: true,\n\n /**\n * Enable to rotate the image.\n * @type {boolean}\n */\n rotatable: true,\n\n /**\n * Enable to scale the image.\n * @type {boolean}\n */\n scalable: true,\n\n /**\n * Indicate if toggle the image size between its natural size\n * and initial size when double click on the image or not.\n * @type {boolean}\n */\n toggleOnDblclick: true,\n\n /**\n * Show the tooltip with image ratio (percentage) when zoom in or zoom out.\n * @type {boolean}\n */\n tooltip: true,\n\n /**\n * Enable CSS3 Transition for some special elements.\n * @type {boolean}\n */\n transition: true,\n\n /**\n * Define the CSS `z-index` value of viewer in modal mode.\n * @type {number}\n */\n zIndex: 2015,\n\n /**\n * Define the CSS `z-index` value of viewer in inline mode.\n * @type {number}\n */\n zIndexInline: 0,\n\n /**\n * Define the ratio when zoom the image by wheeling mouse.\n * @type {number}\n */\n zoomRatio: 0.1,\n\n /**\n * Define the min ratio of the image when zoom out.\n * @type {number}\n */\n minZoomRatio: 0.01,\n\n /**\n * Define the max ratio of the image when zoom in.\n * @type {number}\n */\n maxZoomRatio: 100,\n\n /**\n * Define where to get the original image URL for viewing.\n * @type {string | Function}\n */\n url: 'src',\n\n /**\n * Event shortcuts.\n * @type {Function}\n */\n ready: null,\n show: null,\n shown: null,\n hide: null,\n hidden: null,\n view: null,\n viewed: null,\n zoom: null,\n zoomed: null\n };\n\n var TEMPLATE = '' + '
' + '' + '
' + '
' + '
' + '
';\n\n var IS_BROWSER = typeof window !== 'undefined';\n var WINDOW = IS_BROWSER ? window : {};\n var IS_TOUCH_DEVICE = IS_BROWSER ? 'ontouchstart' in WINDOW.document.documentElement : false;\n var HAS_POINTER_EVENT = IS_BROWSER ? 'PointerEvent' in WINDOW : false;\n var NAMESPACE = 'viewer'; // Actions\n\n var ACTION_MOVE = 'move';\n var ACTION_SWITCH = 'switch';\n var ACTION_ZOOM = 'zoom'; // Classes\n\n var CLASS_ACTIVE = \"\".concat(NAMESPACE, \"-active\");\n var CLASS_CLOSE = \"\".concat(NAMESPACE, \"-close\");\n var CLASS_FADE = \"\".concat(NAMESPACE, \"-fade\");\n var CLASS_FIXED = \"\".concat(NAMESPACE, \"-fixed\");\n var CLASS_FULLSCREEN = \"\".concat(NAMESPACE, \"-fullscreen\");\n var CLASS_FULLSCREEN_EXIT = \"\".concat(NAMESPACE, \"-fullscreen-exit\");\n var CLASS_HIDE = \"\".concat(NAMESPACE, \"-hide\");\n var CLASS_HIDE_MD_DOWN = \"\".concat(NAMESPACE, \"-hide-md-down\");\n var CLASS_HIDE_SM_DOWN = \"\".concat(NAMESPACE, \"-hide-sm-down\");\n var CLASS_HIDE_XS_DOWN = \"\".concat(NAMESPACE, \"-hide-xs-down\");\n var CLASS_IN = \"\".concat(NAMESPACE, \"-in\");\n var CLASS_INVISIBLE = \"\".concat(NAMESPACE, \"-invisible\");\n var CLASS_LOADING = \"\".concat(NAMESPACE, \"-loading\");\n var CLASS_MOVE = \"\".concat(NAMESPACE, \"-move\");\n var CLASS_OPEN = \"\".concat(NAMESPACE, \"-open\");\n var CLASS_SHOW = \"\".concat(NAMESPACE, \"-show\");\n var CLASS_TRANSITION = \"\".concat(NAMESPACE, \"-transition\"); // Events\n\n var EVENT_CLICK = 'click';\n var EVENT_DBLCLICK = 'dblclick';\n var EVENT_DRAG_START = 'dragstart';\n var EVENT_HIDDEN = 'hidden';\n var EVENT_HIDE = 'hide';\n var EVENT_KEY_DOWN = 'keydown';\n var EVENT_LOAD = 'load';\n var EVENT_TOUCH_START = IS_TOUCH_DEVICE ? 'touchstart' : 'mousedown';\n var EVENT_TOUCH_MOVE = IS_TOUCH_DEVICE ? 'touchmove' : 'mousemove';\n var EVENT_TOUCH_END = IS_TOUCH_DEVICE ? 'touchend touchcancel' : 'mouseup';\n var EVENT_POINTER_DOWN = HAS_POINTER_EVENT ? 'pointerdown' : EVENT_TOUCH_START;\n var EVENT_POINTER_MOVE = HAS_POINTER_EVENT ? 'pointermove' : EVENT_TOUCH_MOVE;\n var EVENT_POINTER_UP = HAS_POINTER_EVENT ? 'pointerup pointercancel' : EVENT_TOUCH_END;\n var EVENT_READY = 'ready';\n var EVENT_RESIZE = 'resize';\n var EVENT_SHOW = 'show';\n var EVENT_SHOWN = 'shown';\n var EVENT_TRANSITION_END = 'transitionend';\n var EVENT_VIEW = 'view';\n var EVENT_VIEWED = 'viewed';\n var EVENT_WHEEL = 'wheel';\n var EVENT_ZOOM = 'zoom';\n var EVENT_ZOOMED = 'zoomed'; // Data keys\n\n var DATA_ACTION = \"\".concat(NAMESPACE, \"Action\"); // RegExps\n\n var REGEXP_SPACES = /\\s\\s*/; // Misc\n\n var BUTTONS = ['zoom-in', 'zoom-out', 'one-to-one', 'reset', 'prev', 'play', 'next', 'rotate-left', 'rotate-right', 'flip-horizontal', 'flip-vertical'];\n\n /**\n * Check if the given value is a string.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a string, else `false`.\n */\n\n function isString(value) {\n return typeof value === 'string';\n }\n /**\n * Check if the given value is not a number.\n */\n\n var isNaN = Number.isNaN || WINDOW.isNaN;\n /**\n * Check if the given value is a number.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a number, else `false`.\n */\n\n function isNumber(value) {\n return typeof value === 'number' && !isNaN(value);\n }\n /**\n * Check if the given value is undefined.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is undefined, else `false`.\n */\n\n function isUndefined(value) {\n return typeof value === 'undefined';\n }\n /**\n * Check if the given value is an object.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is an object, else `false`.\n */\n\n function isObject(value) {\n return _typeof(value) === 'object' && value !== null;\n }\n var hasOwnProperty = Object.prototype.hasOwnProperty;\n /**\n * Check if the given value is a plain object.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a plain object, else `false`.\n */\n\n function isPlainObject(value) {\n if (!isObject(value)) {\n return false;\n }\n\n try {\n var _constructor = value.constructor;\n var prototype = _constructor.prototype;\n return _constructor && prototype && hasOwnProperty.call(prototype, 'isPrototypeOf');\n } catch (error) {\n return false;\n }\n }\n /**\n * Check if the given value is a function.\n * @param {*} value - The value to check.\n * @returns {boolean} Returns `true` if the given value is a function, else `false`.\n */\n\n function isFunction(value) {\n return typeof value === 'function';\n }\n /**\n * Iterate the given data.\n * @param {*} data - The data to iterate.\n * @param {Function} callback - The process function for each element.\n * @returns {*} The original data.\n */\n\n function forEach(data, callback) {\n if (data && isFunction(callback)) {\n if (Array.isArray(data) || isNumber(data.length)\n /* array-like */\n ) {\n var length = data.length;\n var i;\n\n for (i = 0; i < length; i += 1) {\n if (callback.call(data, data[i], i, data) === false) {\n break;\n }\n }\n } else if (isObject(data)) {\n Object.keys(data).forEach(function (key) {\n callback.call(data, data[key], key, data);\n });\n }\n }\n\n return data;\n }\n /**\n * Extend the given object.\n * @param {*} obj - The object to be extended.\n * @param {*} args - The rest objects which will be merged to the first object.\n * @returns {Object} The extended object.\n */\n\n var assign = Object.assign || function assign(obj) {\n for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n args[_key - 1] = arguments[_key];\n }\n\n if (isObject(obj) && args.length > 0) {\n args.forEach(function (arg) {\n if (isObject(arg)) {\n Object.keys(arg).forEach(function (key) {\n obj[key] = arg[key];\n });\n }\n });\n }\n\n return obj;\n };\n var REGEXP_SUFFIX = /^(?:width|height|left|top|marginLeft|marginTop)$/;\n /**\n * Apply styles to the given element.\n * @param {Element} element - The target element.\n * @param {Object} styles - The styles for applying.\n */\n\n function setStyle(element, styles) {\n var style = element.style;\n forEach(styles, function (value, property) {\n if (REGEXP_SUFFIX.test(property) && isNumber(value)) {\n value += 'px';\n }\n\n style[property] = value;\n });\n }\n /**\n * Escape a string for using in HTML.\n * @param {String} value - The string to escape.\n * @returns {String} Returns the escaped string.\n */\n\n function escapeHTMLEntities(value) {\n return isString(value) ? value.replace(/&(?!amp;|quot;|#39;|lt;|gt;)/g, '&').replace(/\"/g, '"').replace(/'/g, ''').replace(//g, '>') : value;\n }\n /**\n * Check if the given element has a special class.\n * @param {Element} element - The element to check.\n * @param {string} value - The class to search.\n * @returns {boolean} Returns `true` if the special class was found.\n */\n\n function hasClass(element, value) {\n return element.classList ? element.classList.contains(value) : element.className.indexOf(value) > -1;\n }\n /**\n * Add classes to the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be added.\n */\n\n function addClass(element, value) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n addClass(elem, value);\n });\n return;\n }\n\n if (element.classList) {\n element.classList.add(value);\n return;\n }\n\n var className = element.className.trim();\n\n if (!className) {\n element.className = value;\n } else if (className.indexOf(value) < 0) {\n element.className = \"\".concat(className, \" \").concat(value);\n }\n }\n /**\n * Remove classes from the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be removed.\n */\n\n function removeClass(element, value) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n removeClass(elem, value);\n });\n return;\n }\n\n if (element.classList) {\n element.classList.remove(value);\n return;\n }\n\n if (element.className.indexOf(value) >= 0) {\n element.className = element.className.replace(value, '');\n }\n }\n /**\n * Add or remove classes from the given element.\n * @param {Element} element - The target element.\n * @param {string} value - The classes to be toggled.\n * @param {boolean} added - Add only.\n */\n\n function toggleClass(element, value, added) {\n if (!value) {\n return;\n }\n\n if (isNumber(element.length)) {\n forEach(element, function (elem) {\n toggleClass(elem, value, added);\n });\n return;\n } // IE10-11 doesn't support the second parameter of `classList.toggle`\n\n\n if (added) {\n addClass(element, value);\n } else {\n removeClass(element, value);\n }\n }\n var REGEXP_HYPHENATE = /([a-z\\d])([A-Z])/g;\n /**\n * Transform the given string from camelCase to kebab-case\n * @param {string} value - The value to transform.\n * @returns {string} The transformed value.\n */\n\n function hyphenate(value) {\n return value.replace(REGEXP_HYPHENATE, '$1-$2').toLowerCase();\n }\n /**\n * Get data from the given element.\n * @param {Element} element - The target element.\n * @param {string} name - The data key to get.\n * @returns {string} The data value.\n */\n\n function getData(element, name) {\n if (isObject(element[name])) {\n return element[name];\n }\n\n if (element.dataset) {\n return element.dataset[name];\n }\n\n return element.getAttribute(\"data-\".concat(hyphenate(name)));\n }\n /**\n * Set data to the given element.\n * @param {Element} element - The target element.\n * @param {string} name - The data key to set.\n * @param {string} data - The data value.\n */\n\n function setData(element, name, data) {\n if (isObject(data)) {\n element[name] = data;\n } else if (element.dataset) {\n element.dataset[name] = data;\n } else {\n element.setAttribute(\"data-\".concat(hyphenate(name)), data);\n }\n }\n\n var onceSupported = function () {\n var supported = false;\n\n if (IS_BROWSER) {\n var once = false;\n\n var listener = function listener() {};\n\n var options = Object.defineProperty({}, 'once', {\n get: function get() {\n supported = true;\n return once;\n },\n\n /**\n * This setter can fix a `TypeError` in strict mode\n * {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Errors/Getter_only}\n * @param {boolean} value - The value to set\n */\n set: function set(value) {\n once = value;\n }\n });\n WINDOW.addEventListener('test', listener, options);\n WINDOW.removeEventListener('test', listener, options);\n }\n\n return supported;\n }();\n /**\n * Remove event listener from the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Function} listener - The event listener.\n * @param {Object} options - The event options.\n */\n\n\n function removeListener(element, type, listener) {\n var options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {};\n var handler = listener;\n type.trim().split(REGEXP_SPACES).forEach(function (event) {\n if (!onceSupported) {\n var listeners = element.listeners;\n\n if (listeners && listeners[event] && listeners[event][listener]) {\n handler = listeners[event][listener];\n delete listeners[event][listener];\n\n if (Object.keys(listeners[event]).length === 0) {\n delete listeners[event];\n }\n\n if (Object.keys(listeners).length === 0) {\n delete element.listeners;\n }\n }\n }\n\n element.removeEventListener(event, handler, options);\n });\n }\n /**\n * Add event listener to the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Function} listener - The event listener.\n * @param {Object} options - The event options.\n */\n\n function addListener(element, type, listener) {\n var options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {};\n var _handler = listener;\n type.trim().split(REGEXP_SPACES).forEach(function (event) {\n if (options.once && !onceSupported) {\n var _element$listeners = element.listeners,\n listeners = _element$listeners === void 0 ? {} : _element$listeners;\n\n _handler = function handler() {\n delete listeners[event][listener];\n element.removeEventListener(event, _handler, options);\n\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n\n listener.apply(element, args);\n };\n\n if (!listeners[event]) {\n listeners[event] = {};\n }\n\n if (listeners[event][listener]) {\n element.removeEventListener(event, listeners[event][listener], options);\n }\n\n listeners[event][listener] = _handler;\n element.listeners = listeners;\n }\n\n element.addEventListener(event, _handler, options);\n });\n }\n /**\n * Dispatch event on the target element.\n * @param {Element} element - The event target.\n * @param {string} type - The event type(s).\n * @param {Object} data - The additional event data.\n * @returns {boolean} Indicate if the event is default prevented or not.\n */\n\n function dispatchEvent(element, type, data) {\n var event; // Event and CustomEvent on IE9-11 are global objects, not constructors\n\n if (isFunction(Event) && isFunction(CustomEvent)) {\n event = new CustomEvent(type, {\n detail: data,\n bubbles: true,\n cancelable: true\n });\n } else {\n event = document.createEvent('CustomEvent');\n event.initCustomEvent(type, true, true, data);\n }\n\n return element.dispatchEvent(event);\n }\n /**\n * Get the offset base on the document.\n * @param {Element} element - The target element.\n * @returns {Object} The offset data.\n */\n\n function getOffset(element) {\n var box = element.getBoundingClientRect();\n return {\n left: box.left + (window.pageXOffset - document.documentElement.clientLeft),\n top: box.top + (window.pageYOffset - document.documentElement.clientTop)\n };\n }\n /**\n * Get transforms base on the given object.\n * @param {Object} obj - The target object.\n * @returns {string} A string contains transform values.\n */\n\n function getTransforms(_ref) {\n var rotate = _ref.rotate,\n scaleX = _ref.scaleX,\n scaleY = _ref.scaleY,\n translateX = _ref.translateX,\n translateY = _ref.translateY;\n var values = [];\n\n if (isNumber(translateX) && translateX !== 0) {\n values.push(\"translateX(\".concat(translateX, \"px)\"));\n }\n\n if (isNumber(translateY) && translateY !== 0) {\n values.push(\"translateY(\".concat(translateY, \"px)\"));\n } // Rotate should come first before scale to match orientation transform\n\n\n if (isNumber(rotate) && rotate !== 0) {\n values.push(\"rotate(\".concat(rotate, \"deg)\"));\n }\n\n if (isNumber(scaleX) && scaleX !== 1) {\n values.push(\"scaleX(\".concat(scaleX, \")\"));\n }\n\n if (isNumber(scaleY) && scaleY !== 1) {\n values.push(\"scaleY(\".concat(scaleY, \")\"));\n }\n\n var transform = values.length ? values.join(' ') : 'none';\n return {\n WebkitTransform: transform,\n msTransform: transform,\n transform: transform\n };\n }\n /**\n * Get an image name from an image url.\n * @param {string} url - The target url.\n * @example\n * // picture.jpg\n * getImageNameFromURL('http://domain.com/path/to/picture.jpg?size=1280×960')\n * @returns {string} A string contains the image name.\n */\n\n function getImageNameFromURL(url) {\n return isString(url) ? decodeURIComponent(url.replace(/^.*\\//, '').replace(/[?].*$/, '')) : '';\n }\n var IS_SAFARI = WINDOW.navigator && /(Macintosh|iPhone|iPod|iPad).*AppleWebKit/i.test(WINDOW.navigator.userAgent);\n /**\n * Get an image's natural sizes.\n * @param {string} image - The target image.\n * @param {Function} callback - The callback function.\n * @returns {HTMLImageElement} The new image.\n */\n\n function getImageNaturalSizes(image, callback) {\n var newImage = document.createElement('img'); // Modern browsers (except Safari)\n\n if (image.naturalWidth && !IS_SAFARI) {\n callback(image.naturalWidth, image.naturalHeight);\n return newImage;\n }\n\n var body = document.body || document.documentElement;\n\n newImage.onload = function () {\n callback(newImage.width, newImage.height);\n\n if (!IS_SAFARI) {\n body.removeChild(newImage);\n }\n };\n\n newImage.src = image.src; // iOS Safari will convert the image automatically\n // with its orientation once append it into DOM\n\n if (!IS_SAFARI) {\n newImage.style.cssText = 'left:0;' + 'max-height:none!important;' + 'max-width:none!important;' + 'min-height:0!important;' + 'min-width:0!important;' + 'opacity:0;' + 'position:absolute;' + 'top:0;' + 'z-index:-1;';\n body.appendChild(newImage);\n }\n\n return newImage;\n }\n /**\n * Get the related class name of a responsive type number.\n * @param {string} type - The responsive type.\n * @returns {string} The related class name.\n */\n\n function getResponsiveClass(type) {\n switch (type) {\n case 2:\n return CLASS_HIDE_XS_DOWN;\n\n case 3:\n return CLASS_HIDE_SM_DOWN;\n\n case 4:\n return CLASS_HIDE_MD_DOWN;\n\n default:\n return '';\n }\n }\n /**\n * Get the max ratio of a group of pointers.\n * @param {string} pointers - The target pointers.\n * @returns {number} The result ratio.\n */\n\n function getMaxZoomRatio(pointers) {\n var pointers2 = assign({}, pointers);\n var ratios = [];\n forEach(pointers, function (pointer, pointerId) {\n delete pointers2[pointerId];\n forEach(pointers2, function (pointer2) {\n var x1 = Math.abs(pointer.startX - pointer2.startX);\n var y1 = Math.abs(pointer.startY - pointer2.startY);\n var x2 = Math.abs(pointer.endX - pointer2.endX);\n var y2 = Math.abs(pointer.endY - pointer2.endY);\n var z1 = Math.sqrt(x1 * x1 + y1 * y1);\n var z2 = Math.sqrt(x2 * x2 + y2 * y2);\n var ratio = (z2 - z1) / z1;\n ratios.push(ratio);\n });\n });\n ratios.sort(function (a, b) {\n return Math.abs(a) < Math.abs(b);\n });\n return ratios[0];\n }\n /**\n * Get a pointer from an event object.\n * @param {Object} event - The target event object.\n * @param {boolean} endOnly - Indicates if only returns the end point coordinate or not.\n * @returns {Object} The result pointer contains start and/or end point coordinates.\n */\n\n function getPointer(_ref2, endOnly) {\n var pageX = _ref2.pageX,\n pageY = _ref2.pageY;\n var end = {\n endX: pageX,\n endY: pageY\n };\n return endOnly ? end : assign({\n timeStamp: Date.now(),\n startX: pageX,\n startY: pageY\n }, end);\n }\n /**\n * Get the center point coordinate of a group of pointers.\n * @param {Object} pointers - The target pointers.\n * @returns {Object} The center point coordinate.\n */\n\n function getPointersCenter(pointers) {\n var pageX = 0;\n var pageY = 0;\n var count = 0;\n forEach(pointers, function (_ref3) {\n var startX = _ref3.startX,\n startY = _ref3.startY;\n pageX += startX;\n pageY += startY;\n count += 1;\n });\n pageX /= count;\n pageY /= count;\n return {\n pageX: pageX,\n pageY: pageY\n };\n }\n\n var render = {\n render: function render() {\n this.initContainer();\n this.initViewer();\n this.initList();\n this.renderViewer();\n },\n initContainer: function initContainer() {\n this.containerData = {\n width: window.innerWidth,\n height: window.innerHeight\n };\n },\n initViewer: function initViewer() {\n var options = this.options,\n parent = this.parent;\n var viewerData;\n\n if (options.inline) {\n viewerData = {\n width: Math.max(parent.offsetWidth, options.minWidth),\n height: Math.max(parent.offsetHeight, options.minHeight)\n };\n this.parentData = viewerData;\n }\n\n if (this.fulled || !viewerData) {\n viewerData = this.containerData;\n }\n\n this.viewerData = assign({}, viewerData);\n },\n renderViewer: function renderViewer() {\n if (this.options.inline && !this.fulled) {\n setStyle(this.viewer, this.viewerData);\n }\n },\n initList: function initList() {\n var _this = this;\n\n var element = this.element,\n options = this.options,\n list = this.list;\n var items = [];\n forEach(this.images, function (image, index) {\n var src = image.src;\n var alt = escapeHTMLEntities(image.alt || getImageNameFromURL(src));\n var url = options.url;\n\n if (isString(url)) {\n url = image.getAttribute(url);\n } else if (isFunction(url)) {\n url = url.call(_this, image);\n }\n\n if (src || url) {\n var item = document.createElement('li');\n var img = document.createElement('img');\n img.src = src || url;\n img.alt = alt;\n img.setAttribute('data-index', index);\n img.setAttribute('data-original-url', url || src);\n img.setAttribute('data-viewer-action', 'view');\n img.setAttribute('role', 'button');\n item.appendChild(img);\n list.appendChild(item);\n items.push(item);\n }\n });\n this.items = items;\n forEach(items, function (item) {\n var image = item.firstElementChild;\n setData(image, 'filled', true);\n\n if (options.loading) {\n addClass(item, CLASS_LOADING);\n }\n\n addListener(image, EVENT_LOAD, function (event) {\n if (options.loading) {\n removeClass(item, CLASS_LOADING);\n }\n\n _this.loadImage(event);\n }, {\n once: true\n });\n });\n\n if (options.transition) {\n addListener(element, EVENT_VIEWED, function () {\n addClass(list, CLASS_TRANSITION);\n }, {\n once: true\n });\n }\n },\n renderList: function renderList(index) {\n var i = index || this.index;\n var width = this.items[i].offsetWidth || 30;\n var outerWidth = width + 1; // 1 pixel of `margin-left` width\n // Place the active item in the center of the screen\n\n setStyle(this.list, assign({\n width: outerWidth * this.length\n }, getTransforms({\n translateX: (this.viewerData.width - width) / 2 - outerWidth * i\n })));\n },\n resetList: function resetList() {\n var list = this.list;\n list.innerHTML = '';\n removeClass(list, CLASS_TRANSITION);\n setStyle(list, getTransforms({\n translateX: 0\n }));\n },\n initImage: function initImage(done) {\n var _this2 = this;\n\n var options = this.options,\n image = this.image,\n viewerData = this.viewerData;\n var footerHeight = this.footer.offsetHeight;\n var viewerWidth = viewerData.width;\n var viewerHeight = Math.max(viewerData.height - footerHeight, footerHeight);\n var oldImageData = this.imageData || {};\n var sizingImage;\n this.imageInitializing = {\n abort: function abort() {\n sizingImage.onload = null;\n }\n };\n sizingImage = getImageNaturalSizes(image, function (naturalWidth, naturalHeight) {\n var aspectRatio = naturalWidth / naturalHeight;\n var width = viewerWidth;\n var height = viewerHeight;\n _this2.imageInitializing = false;\n\n if (viewerHeight * aspectRatio > viewerWidth) {\n height = viewerWidth / aspectRatio;\n } else {\n width = viewerHeight * aspectRatio;\n }\n\n width = Math.min(width * 0.9, naturalWidth);\n height = Math.min(height * 0.9, naturalHeight);\n var imageData = {\n naturalWidth: naturalWidth,\n naturalHeight: naturalHeight,\n aspectRatio: aspectRatio,\n ratio: width / naturalWidth,\n width: width,\n height: height,\n left: (viewerWidth - width) / 2,\n top: (viewerHeight - height) / 2\n };\n var initialImageData = assign({}, imageData);\n\n if (options.rotatable) {\n imageData.rotate = oldImageData.rotate || 0;\n initialImageData.rotate = 0;\n }\n\n if (options.scalable) {\n imageData.scaleX = oldImageData.scaleX || 1;\n imageData.scaleY = oldImageData.scaleY || 1;\n initialImageData.scaleX = 1;\n initialImageData.scaleY = 1;\n }\n\n _this2.imageData = imageData;\n _this2.initialImageData = initialImageData;\n\n if (done) {\n done();\n }\n });\n },\n renderImage: function renderImage(done) {\n var _this3 = this;\n\n var image = this.image,\n imageData = this.imageData;\n setStyle(image, assign({\n width: imageData.width,\n height: imageData.height,\n // XXX: Not to use translateX/Y to avoid image shaking when zooming\n marginLeft: imageData.left,\n marginTop: imageData.top\n }, getTransforms(imageData)));\n\n if (done) {\n if ((this.viewing || this.zooming) && this.options.transition) {\n var onTransitionEnd = function onTransitionEnd() {\n _this3.imageRendering = false;\n done();\n };\n\n this.imageRendering = {\n abort: function abort() {\n removeListener(image, EVENT_TRANSITION_END, onTransitionEnd);\n }\n };\n addListener(image, EVENT_TRANSITION_END, onTransitionEnd, {\n once: true\n });\n } else {\n done();\n }\n }\n },\n resetImage: function resetImage() {\n // this.image only defined after viewed\n if (this.viewing || this.viewed) {\n var image = this.image;\n\n if (this.viewing) {\n this.viewing.abort();\n }\n\n image.parentNode.removeChild(image);\n this.image = null;\n }\n }\n };\n\n var events = {\n bind: function bind() {\n var options = this.options,\n viewer = this.viewer,\n canvas = this.canvas;\n var document = this.element.ownerDocument;\n addListener(viewer, EVENT_CLICK, this.onClick = this.click.bind(this));\n addListener(viewer, EVENT_WHEEL, this.onWheel = this.wheel.bind(this), {\n passive: false,\n capture: true\n });\n addListener(viewer, EVENT_DRAG_START, this.onDragStart = this.dragstart.bind(this));\n addListener(canvas, EVENT_POINTER_DOWN, this.onPointerDown = this.pointerdown.bind(this));\n addListener(document, EVENT_POINTER_MOVE, this.onPointerMove = this.pointermove.bind(this));\n addListener(document, EVENT_POINTER_UP, this.onPointerUp = this.pointerup.bind(this));\n addListener(document, EVENT_KEY_DOWN, this.onKeyDown = this.keydown.bind(this));\n addListener(window, EVENT_RESIZE, this.onResize = this.resize.bind(this));\n\n if (options.toggleOnDblclick) {\n addListener(canvas, EVENT_DBLCLICK, this.onDblclick = this.dblclick.bind(this));\n }\n },\n unbind: function unbind() {\n var options = this.options,\n viewer = this.viewer,\n canvas = this.canvas;\n var document = this.element.ownerDocument;\n removeListener(viewer, EVENT_CLICK, this.onClick);\n removeListener(viewer, EVENT_WHEEL, this.onWheel, {\n passive: false,\n capture: true\n });\n removeListener(viewer, EVENT_DRAG_START, this.onDragStart);\n removeListener(canvas, EVENT_POINTER_DOWN, this.onPointerDown);\n removeListener(document, EVENT_POINTER_MOVE, this.onPointerMove);\n removeListener(document, EVENT_POINTER_UP, this.onPointerUp);\n removeListener(document, EVENT_KEY_DOWN, this.onKeyDown);\n removeListener(window, EVENT_RESIZE, this.onResize);\n\n if (options.toggleOnDblclick) {\n removeListener(canvas, EVENT_DBLCLICK, this.onDblclick);\n }\n }\n };\n\n var handlers = {\n click: function click(event) {\n var target = event.target;\n var options = this.options,\n imageData = this.imageData;\n var action = getData(target, DATA_ACTION); // Cancel the emulated click when the native click event was triggered.\n\n if (IS_TOUCH_DEVICE && event.isTrusted && target === this.canvas) {\n clearTimeout(this.clickCanvasTimeout);\n }\n\n switch (action) {\n case 'mix':\n if (this.played) {\n this.stop();\n } else if (options.inline) {\n if (this.fulled) {\n this.exit();\n } else {\n this.full();\n }\n } else {\n this.hide();\n }\n\n break;\n\n case 'hide':\n this.hide();\n break;\n\n case 'view':\n this.view(getData(target, 'index'));\n break;\n\n case 'zoom-in':\n this.zoom(0.1, true);\n break;\n\n case 'zoom-out':\n this.zoom(-0.1, true);\n break;\n\n case 'one-to-one':\n this.toggle();\n break;\n\n case 'reset':\n this.reset();\n break;\n\n case 'prev':\n this.prev(options.loop);\n break;\n\n case 'play':\n this.play(options.fullscreen);\n break;\n\n case 'next':\n this.next(options.loop);\n break;\n\n case 'rotate-left':\n this.rotate(-90);\n break;\n\n case 'rotate-right':\n this.rotate(90);\n break;\n\n case 'flip-horizontal':\n this.scaleX(-imageData.scaleX || -1);\n break;\n\n case 'flip-vertical':\n this.scaleY(-imageData.scaleY || -1);\n break;\n\n default:\n if (this.played) {\n this.stop();\n }\n\n }\n },\n dblclick: function dblclick(event) {\n event.preventDefault();\n\n if (this.viewed && event.target === this.image) {\n // Cancel the emulated double click when the native dblclick event was triggered.\n if (IS_TOUCH_DEVICE && event.isTrusted) {\n clearTimeout(this.doubleClickImageTimeout);\n }\n\n this.toggle();\n }\n },\n load: function load() {\n var _this = this;\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n this.timeout = false;\n }\n\n var element = this.element,\n options = this.options,\n image = this.image,\n index = this.index,\n viewerData = this.viewerData;\n removeClass(image, CLASS_INVISIBLE);\n\n if (options.loading) {\n removeClass(this.canvas, CLASS_LOADING);\n }\n\n image.style.cssText = 'height:0;' + \"margin-left:\".concat(viewerData.width / 2, \"px;\") + \"margin-top:\".concat(viewerData.height / 2, \"px;\") + 'max-width:none!important;' + 'position:absolute;' + 'width:0;';\n this.initImage(function () {\n toggleClass(image, CLASS_MOVE, options.movable);\n toggleClass(image, CLASS_TRANSITION, options.transition);\n\n _this.renderImage(function () {\n _this.viewed = true;\n _this.viewing = false;\n\n if (isFunction(options.viewed)) {\n addListener(element, EVENT_VIEWED, options.viewed, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_VIEWED, {\n originalImage: _this.images[index],\n index: index,\n image: image\n });\n });\n });\n },\n loadImage: function loadImage(event) {\n var image = event.target;\n var parent = image.parentNode;\n var parentWidth = parent.offsetWidth || 30;\n var parentHeight = parent.offsetHeight || 50;\n var filled = !!getData(image, 'filled');\n getImageNaturalSizes(image, function (naturalWidth, naturalHeight) {\n var aspectRatio = naturalWidth / naturalHeight;\n var width = parentWidth;\n var height = parentHeight;\n\n if (parentHeight * aspectRatio > parentWidth) {\n if (filled) {\n width = parentHeight * aspectRatio;\n } else {\n height = parentWidth / aspectRatio;\n }\n } else if (filled) {\n height = parentWidth / aspectRatio;\n } else {\n width = parentHeight * aspectRatio;\n }\n\n setStyle(image, assign({\n width: width,\n height: height\n }, getTransforms({\n translateX: (parentWidth - width) / 2,\n translateY: (parentHeight - height) / 2\n })));\n });\n },\n keydown: function keydown(event) {\n var options = this.options;\n\n if (!this.fulled || !options.keyboard) {\n return;\n }\n\n switch (event.keyCode || event.which || event.charCode) {\n // Escape\n case 27:\n if (this.played) {\n this.stop();\n } else if (options.inline) {\n if (this.fulled) {\n this.exit();\n }\n } else {\n this.hide();\n }\n\n break;\n // Space\n\n case 32:\n if (this.played) {\n this.stop();\n }\n\n break;\n // ArrowLeft\n\n case 37:\n this.prev(options.loop);\n break;\n // ArrowUp\n\n case 38:\n // Prevent scroll on Firefox\n event.preventDefault(); // Zoom in\n\n this.zoom(options.zoomRatio, true);\n break;\n // ArrowRight\n\n case 39:\n this.next(options.loop);\n break;\n // ArrowDown\n\n case 40:\n // Prevent scroll on Firefox\n event.preventDefault(); // Zoom out\n\n this.zoom(-options.zoomRatio, true);\n break;\n // Ctrl + 0\n\n case 48: // Fall through\n // Ctrl + 1\n // eslint-disable-next-line no-fallthrough\n\n case 49:\n if (event.ctrlKey) {\n event.preventDefault();\n this.toggle();\n }\n\n break;\n\n default:\n }\n },\n dragstart: function dragstart(event) {\n if (event.target.tagName.toLowerCase() === 'img') {\n event.preventDefault();\n }\n },\n pointerdown: function pointerdown(event) {\n var options = this.options,\n pointers = this.pointers;\n var buttons = event.buttons,\n button = event.button;\n\n if (!this.viewed || this.showing || this.viewing || this.hiding // No primary button (Usually the left button)\n // Note that touch events have no `buttons` or `button` property\n || isNumber(buttons) && buttons !== 1 || isNumber(button) && button !== 0 // Open context menu\n || event.ctrlKey) {\n return;\n } // Prevent default behaviours as page zooming in touch devices.\n\n\n event.preventDefault();\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n pointers[touch.identifier] = getPointer(touch);\n });\n } else {\n pointers[event.pointerId || 0] = getPointer(event);\n }\n\n var action = options.movable ? ACTION_MOVE : false;\n\n if (Object.keys(pointers).length > 1) {\n action = ACTION_ZOOM;\n } else if ((event.pointerType === 'touch' || event.type === 'touchstart') && this.isSwitchable()) {\n action = ACTION_SWITCH;\n }\n\n if (options.transition && (action === ACTION_MOVE || action === ACTION_ZOOM)) {\n removeClass(this.image, CLASS_TRANSITION);\n }\n\n this.action = action;\n },\n pointermove: function pointermove(event) {\n var pointers = this.pointers,\n action = this.action;\n\n if (!this.viewed || !action) {\n return;\n }\n\n event.preventDefault();\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n assign(pointers[touch.identifier] || {}, getPointer(touch, true));\n });\n } else {\n assign(pointers[event.pointerId || 0] || {}, getPointer(event, true));\n }\n\n this.change(event);\n },\n pointerup: function pointerup(event) {\n var _this2 = this;\n\n var options = this.options,\n action = this.action,\n pointers = this.pointers;\n var pointer;\n\n if (event.changedTouches) {\n forEach(event.changedTouches, function (touch) {\n pointer = pointers[touch.identifier];\n delete pointers[touch.identifier];\n });\n } else {\n pointer = pointers[event.pointerId || 0];\n delete pointers[event.pointerId || 0];\n }\n\n if (!action) {\n return;\n }\n\n event.preventDefault();\n\n if (options.transition && (action === ACTION_MOVE || action === ACTION_ZOOM)) {\n addClass(this.image, CLASS_TRANSITION);\n }\n\n this.action = false; // Emulate click and double click in touch devices to support backdrop and image zooming (#210).\n\n if (IS_TOUCH_DEVICE && action !== ACTION_ZOOM && pointer && Date.now() - pointer.timeStamp < 500) {\n clearTimeout(this.clickCanvasTimeout);\n clearTimeout(this.doubleClickImageTimeout);\n\n if (options.toggleOnDblclick && this.viewed && event.target === this.image) {\n if (this.imageClicked) {\n this.imageClicked = false; // This timeout will be cleared later when a native dblclick event is triggering\n\n this.doubleClickImageTimeout = setTimeout(function () {\n dispatchEvent(_this2.image, EVENT_DBLCLICK);\n }, 50);\n } else {\n this.imageClicked = true; // The default timing of a double click in Windows is 500 ms\n\n this.doubleClickImageTimeout = setTimeout(function () {\n _this2.imageClicked = false;\n }, 500);\n }\n } else {\n this.imageClicked = false;\n\n if (options.backdrop && options.backdrop !== 'static' && event.target === this.canvas) {\n // This timeout will be cleared later when a native click event is triggering\n this.clickCanvasTimeout = setTimeout(function () {\n dispatchEvent(_this2.canvas, EVENT_CLICK);\n }, 50);\n }\n }\n }\n },\n resize: function resize() {\n var _this3 = this;\n\n if (!this.isShown || this.hiding) {\n return;\n }\n\n this.initContainer();\n this.initViewer();\n this.renderViewer();\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this3.renderImage();\n });\n }\n\n if (this.played) {\n if (this.options.fullscreen && this.fulled && !(document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n this.stop();\n return;\n }\n\n forEach(this.player.getElementsByTagName('img'), function (image) {\n addListener(image, EVENT_LOAD, _this3.loadImage.bind(_this3), {\n once: true\n });\n dispatchEvent(image, EVENT_LOAD);\n });\n }\n },\n wheel: function wheel(event) {\n var _this4 = this;\n\n if (!this.viewed) {\n return;\n }\n\n event.preventDefault(); // Limit wheel speed to prevent zoom too fast\n\n if (this.wheeling) {\n return;\n }\n\n this.wheeling = true;\n setTimeout(function () {\n _this4.wheeling = false;\n }, 50);\n var ratio = Number(this.options.zoomRatio) || 0.1;\n var delta = 1;\n\n if (event.deltaY) {\n delta = event.deltaY > 0 ? 1 : -1;\n } else if (event.wheelDelta) {\n delta = -event.wheelDelta / 120;\n } else if (event.detail) {\n delta = event.detail > 0 ? 1 : -1;\n }\n\n this.zoom(-delta * ratio, true, event);\n }\n };\n\n var methods = {\n /** Show the viewer (only available in modal mode)\n * @param {boolean} [immediate=false] - Indicates if show the viewer immediately or not.\n * @returns {Viewer} this\n */\n show: function show() {\n var immediate = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var element = this.element,\n options = this.options;\n\n if (options.inline || this.showing || this.isShown || this.showing) {\n return this;\n }\n\n if (!this.ready) {\n this.build();\n\n if (this.ready) {\n this.show(immediate);\n }\n\n return this;\n }\n\n if (isFunction(options.show)) {\n addListener(element, EVENT_SHOW, options.show, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_SHOW) === false || !this.ready) {\n return this;\n }\n\n if (this.hiding) {\n this.transitioning.abort();\n }\n\n this.showing = true;\n this.open();\n var viewer = this.viewer;\n removeClass(viewer, CLASS_HIDE);\n\n if (options.transition && !immediate) {\n var shown = this.shown.bind(this);\n this.transitioning = {\n abort: function abort() {\n removeListener(viewer, EVENT_TRANSITION_END, shown);\n removeClass(viewer, CLASS_IN);\n }\n };\n addClass(viewer, CLASS_TRANSITION); // Force reflow to enable CSS3 transition\n // eslint-disable-next-line\n\n viewer.offsetWidth;\n addListener(viewer, EVENT_TRANSITION_END, shown, {\n once: true\n });\n addClass(viewer, CLASS_IN);\n } else {\n addClass(viewer, CLASS_IN);\n this.shown();\n }\n\n return this;\n },\n\n /**\n * Hide the viewer (only available in modal mode)\n * @param {boolean} [immediate=false] - Indicates if hide the viewer immediately or not.\n * @returns {Viewer} this\n */\n hide: function hide() {\n var immediate = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var element = this.element,\n options = this.options;\n\n if (options.inline || this.hiding || !(this.isShown || this.showing)) {\n return this;\n }\n\n if (isFunction(options.hide)) {\n addListener(element, EVENT_HIDE, options.hide, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_HIDE) === false) {\n return this;\n }\n\n if (this.showing) {\n this.transitioning.abort();\n }\n\n this.hiding = true;\n\n if (this.played) {\n this.stop();\n } else if (this.viewing) {\n this.viewing.abort();\n }\n\n var viewer = this.viewer;\n\n if (options.transition && !immediate) {\n var hidden = this.hidden.bind(this);\n\n var hide = function hide() {\n // XXX: It seems the `event.stopPropagation()` method does not work here\n setTimeout(function () {\n addListener(viewer, EVENT_TRANSITION_END, hidden, {\n once: true\n });\n removeClass(viewer, CLASS_IN);\n }, 0);\n };\n\n this.transitioning = {\n abort: function abort() {\n if (this.viewed) {\n removeListener(this.image, EVENT_TRANSITION_END, hide);\n } else {\n removeListener(viewer, EVENT_TRANSITION_END, hidden);\n }\n }\n }; // Note that the `CLASS_TRANSITION` class will be removed on pointer down (#255)\n\n if (this.viewed && hasClass(this.image, CLASS_TRANSITION)) {\n addListener(this.image, EVENT_TRANSITION_END, hide, {\n once: true\n });\n this.zoomTo(0, false, false, true);\n } else {\n hide();\n }\n } else {\n removeClass(viewer, CLASS_IN);\n this.hidden();\n }\n\n return this;\n },\n\n /**\n * View one of the images with image's index\n * @param {number} index - The index of the image to view.\n * @returns {Viewer} this\n */\n view: function view() {\n var _this = this;\n\n var index = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.options.initialViewIndex;\n index = Number(index) || 0;\n\n if (!this.isShown) {\n this.index = index;\n return this.show();\n }\n\n if (this.hiding || this.played || index < 0 || index >= this.length || this.viewed && index === this.index) {\n return this;\n }\n\n if (this.viewing) {\n this.viewing.abort();\n }\n\n var element = this.element,\n options = this.options,\n title = this.title,\n canvas = this.canvas;\n var item = this.items[index];\n var img = item.querySelector('img');\n var url = getData(img, 'originalUrl');\n var alt = escapeHTMLEntities(img.getAttribute('alt'));\n var image = document.createElement('img');\n image.src = url;\n image.alt = alt;\n\n if (isFunction(options.view)) {\n addListener(element, EVENT_VIEW, options.view, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_VIEW, {\n originalImage: this.images[index],\n index: index,\n image: image\n }) === false || !this.isShown || this.hiding || this.played) {\n return this;\n }\n\n this.image = image;\n removeClass(this.items[this.index], CLASS_ACTIVE);\n addClass(item, CLASS_ACTIVE);\n this.viewed = false;\n this.index = index;\n this.imageData = {};\n addClass(image, CLASS_INVISIBLE);\n\n if (options.loading) {\n addClass(canvas, CLASS_LOADING);\n }\n\n canvas.innerHTML = '';\n canvas.appendChild(image); // Center current item\n\n this.renderList(); // Clear title\n\n title.innerHTML = ''; // Generate title after viewed\n\n var onViewed = function onViewed() {\n var imageData = _this.imageData;\n var render = Array.isArray(options.title) ? options.title[1] : options.title;\n title.innerHTML = escapeHTMLEntities(isFunction(render) ? render.call(_this, image, imageData) : \"\".concat(alt, \" (\").concat(imageData.naturalWidth, \" \\xD7 \").concat(imageData.naturalHeight, \")\"));\n };\n\n var onLoad;\n addListener(element, EVENT_VIEWED, onViewed, {\n once: true\n });\n this.viewing = {\n abort: function abort() {\n removeListener(element, EVENT_VIEWED, onViewed);\n\n if (image.complete) {\n if (this.imageRendering) {\n this.imageRendering.abort();\n } else if (this.imageInitializing) {\n this.imageInitializing.abort();\n }\n } else {\n // Cancel download to save bandwidth.\n image.src = '';\n removeListener(image, EVENT_LOAD, onLoad);\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n }\n }\n }\n };\n\n if (image.complete) {\n this.load();\n } else {\n addListener(image, EVENT_LOAD, onLoad = this.load.bind(this), {\n once: true\n });\n\n if (this.timeout) {\n clearTimeout(this.timeout);\n } // Make the image visible if it fails to load within 1s\n\n\n this.timeout = setTimeout(function () {\n removeClass(image, CLASS_INVISIBLE);\n _this.timeout = false;\n }, 1000);\n }\n\n return this;\n },\n\n /**\n * View the previous image\n * @param {boolean} [loop=false] - Indicate if view the last one\n * when it is the first one at present.\n * @returns {Viewer} this\n */\n prev: function prev() {\n var loop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var index = this.index - 1;\n\n if (index < 0) {\n index = loop ? this.length - 1 : 0;\n }\n\n this.view(index);\n return this;\n },\n\n /**\n * View the next image\n * @param {boolean} [loop=false] - Indicate if view the first one\n * when it is the last one at present.\n * @returns {Viewer} this\n */\n next: function next() {\n var loop = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n var maxIndex = this.length - 1;\n var index = this.index + 1;\n\n if (index > maxIndex) {\n index = loop ? 0 : maxIndex;\n }\n\n this.view(index);\n return this;\n },\n\n /**\n * Move the image with relative offsets.\n * @param {number} offsetX - The relative offset distance on the x-axis.\n * @param {number} offsetY - The relative offset distance on the y-axis.\n * @returns {Viewer} this\n */\n move: function move(offsetX, offsetY) {\n var imageData = this.imageData;\n this.moveTo(isUndefined(offsetX) ? offsetX : imageData.left + Number(offsetX), isUndefined(offsetY) ? offsetY : imageData.top + Number(offsetY));\n return this;\n },\n\n /**\n * Move the image to an absolute point.\n * @param {number} x - The x-axis coordinate.\n * @param {number} [y=x] - The y-axis coordinate.\n * @returns {Viewer} this\n */\n moveTo: function moveTo(x) {\n var y = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : x;\n var imageData = this.imageData;\n x = Number(x);\n y = Number(y);\n\n if (this.viewed && !this.played && this.options.movable) {\n var changed = false;\n\n if (isNumber(x)) {\n imageData.left = x;\n changed = true;\n }\n\n if (isNumber(y)) {\n imageData.top = y;\n changed = true;\n }\n\n if (changed) {\n this.renderImage();\n }\n }\n\n return this;\n },\n\n /**\n * Zoom the image with a relative ratio.\n * @param {number} ratio - The target ratio.\n * @param {boolean} [hasTooltip=false] - Indicates if it has a tooltip or not.\n * @param {Event} [_originalEvent=null] - The original event if any.\n * @returns {Viewer} this\n */\n zoom: function zoom(ratio) {\n var hasTooltip = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var _originalEvent = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;\n\n var imageData = this.imageData;\n ratio = Number(ratio);\n\n if (ratio < 0) {\n ratio = 1 / (1 - ratio);\n } else {\n ratio = 1 + ratio;\n }\n\n this.zoomTo(imageData.width * ratio / imageData.naturalWidth, hasTooltip, _originalEvent);\n return this;\n },\n\n /**\n * Zoom the image to an absolute ratio.\n * @param {number} ratio - The target ratio.\n * @param {boolean} [hasTooltip=false] - Indicates if it has a tooltip or not.\n * @param {Event} [_originalEvent=null] - The original event if any.\n * @param {Event} [_zoomable=false] - Indicates if the current zoom is available or not.\n * @returns {Viewer} this\n */\n zoomTo: function zoomTo(ratio) {\n var _this2 = this;\n\n var hasTooltip = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var _originalEvent = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;\n\n var _zoomable = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false;\n\n var element = this.element,\n options = this.options,\n pointers = this.pointers,\n imageData = this.imageData;\n var width = imageData.width,\n height = imageData.height,\n left = imageData.left,\n top = imageData.top,\n naturalWidth = imageData.naturalWidth,\n naturalHeight = imageData.naturalHeight;\n ratio = Math.max(0, ratio);\n\n if (isNumber(ratio) && this.viewed && !this.played && (_zoomable || options.zoomable)) {\n if (!_zoomable) {\n var minZoomRatio = Math.max(0.01, options.minZoomRatio);\n var maxZoomRatio = Math.min(100, options.maxZoomRatio);\n ratio = Math.min(Math.max(ratio, minZoomRatio), maxZoomRatio);\n }\n\n if (_originalEvent && ratio > 0.95 && ratio < 1.05) {\n ratio = 1;\n }\n\n var newWidth = naturalWidth * ratio;\n var newHeight = naturalHeight * ratio;\n var offsetWidth = newWidth - width;\n var offsetHeight = newHeight - height;\n var oldRatio = width / naturalWidth;\n\n if (isFunction(options.zoom)) {\n addListener(element, EVENT_ZOOM, options.zoom, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_ZOOM, {\n ratio: ratio,\n oldRatio: oldRatio,\n originalEvent: _originalEvent\n }) === false) {\n return this;\n }\n\n this.zooming = true;\n\n if (_originalEvent) {\n var offset = getOffset(this.viewer);\n var center = pointers && Object.keys(pointers).length ? getPointersCenter(pointers) : {\n pageX: _originalEvent.pageX,\n pageY: _originalEvent.pageY\n }; // Zoom from the triggering point of the event\n\n imageData.left -= offsetWidth * ((center.pageX - offset.left - left) / width);\n imageData.top -= offsetHeight * ((center.pageY - offset.top - top) / height);\n } else {\n // Zoom from the center of the image\n imageData.left -= offsetWidth / 2;\n imageData.top -= offsetHeight / 2;\n }\n\n imageData.width = newWidth;\n imageData.height = newHeight;\n imageData.ratio = ratio;\n this.renderImage(function () {\n _this2.zooming = false;\n\n if (isFunction(options.zoomed)) {\n addListener(element, EVENT_ZOOMED, options.zoomed, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_ZOOMED, {\n ratio: ratio,\n oldRatio: oldRatio,\n originalEvent: _originalEvent\n });\n });\n\n if (hasTooltip) {\n this.tooltip();\n }\n }\n\n return this;\n },\n\n /**\n * Rotate the image with a relative degree.\n * @param {number} degree - The rotate degree.\n * @returns {Viewer} this\n */\n rotate: function rotate(degree) {\n this.rotateTo((this.imageData.rotate || 0) + Number(degree));\n return this;\n },\n\n /**\n * Rotate the image to an absolute degree.\n * @param {number} degree - The rotate degree.\n * @returns {Viewer} this\n */\n rotateTo: function rotateTo(degree) {\n var imageData = this.imageData;\n degree = Number(degree);\n\n if (isNumber(degree) && this.viewed && !this.played && this.options.rotatable) {\n imageData.rotate = degree;\n this.renderImage();\n }\n\n return this;\n },\n\n /**\n * Scale the image on the x-axis.\n * @param {number} scaleX - The scale ratio on the x-axis.\n * @returns {Viewer} this\n */\n scaleX: function scaleX(_scaleX) {\n this.scale(_scaleX, this.imageData.scaleY);\n return this;\n },\n\n /**\n * Scale the image on the y-axis.\n * @param {number} scaleY - The scale ratio on the y-axis.\n * @returns {Viewer} this\n */\n scaleY: function scaleY(_scaleY) {\n this.scale(this.imageData.scaleX, _scaleY);\n return this;\n },\n\n /**\n * Scale the image.\n * @param {number} scaleX - The scale ratio on the x-axis.\n * @param {number} [scaleY=scaleX] - The scale ratio on the y-axis.\n * @returns {Viewer} this\n */\n scale: function scale(scaleX) {\n var scaleY = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : scaleX;\n var imageData = this.imageData;\n scaleX = Number(scaleX);\n scaleY = Number(scaleY);\n\n if (this.viewed && !this.played && this.options.scalable) {\n var changed = false;\n\n if (isNumber(scaleX)) {\n imageData.scaleX = scaleX;\n changed = true;\n }\n\n if (isNumber(scaleY)) {\n imageData.scaleY = scaleY;\n changed = true;\n }\n\n if (changed) {\n this.renderImage();\n }\n }\n\n return this;\n },\n\n /**\n * Play the images\n * @param {boolean} [fullscreen=false] - Indicate if request fullscreen or not.\n * @returns {Viewer} this\n */\n play: function play() {\n var _this3 = this;\n\n var fullscreen = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;\n\n if (!this.isShown || this.played) {\n return this;\n }\n\n var options = this.options,\n player = this.player;\n var onLoad = this.loadImage.bind(this);\n var list = [];\n var total = 0;\n var index = 0;\n this.played = true;\n this.onLoadWhenPlay = onLoad;\n\n if (fullscreen) {\n this.requestFullscreen();\n }\n\n addClass(player, CLASS_SHOW);\n forEach(this.items, function (item, i) {\n var img = item.querySelector('img');\n var image = document.createElement('img');\n image.src = getData(img, 'originalUrl');\n image.alt = escapeHTMLEntities(img.getAttribute('alt'));\n total += 1;\n addClass(image, CLASS_FADE);\n toggleClass(image, CLASS_TRANSITION, options.transition);\n\n if (hasClass(item, CLASS_ACTIVE)) {\n addClass(image, CLASS_IN);\n index = i;\n }\n\n list.push(image);\n addListener(image, EVENT_LOAD, onLoad, {\n once: true\n });\n player.appendChild(image);\n });\n\n if (isNumber(options.interval) && options.interval > 0) {\n var play = function play() {\n _this3.playing = setTimeout(function () {\n removeClass(list[index], CLASS_IN);\n index += 1;\n index = index < total ? index : 0;\n addClass(list[index], CLASS_IN);\n play();\n }, options.interval);\n };\n\n if (total > 1) {\n play();\n }\n }\n\n return this;\n },\n // Stop play\n stop: function stop() {\n var _this4 = this;\n\n if (!this.played) {\n return this;\n }\n\n var player = this.player;\n this.played = false;\n clearTimeout(this.playing);\n forEach(player.getElementsByTagName('img'), function (image) {\n removeListener(image, EVENT_LOAD, _this4.onLoadWhenPlay);\n });\n removeClass(player, CLASS_SHOW);\n player.innerHTML = '';\n this.exitFullscreen();\n return this;\n },\n // Enter modal mode (only available in inline mode)\n full: function full() {\n var _this5 = this;\n\n var options = this.options,\n viewer = this.viewer,\n image = this.image,\n list = this.list;\n\n if (!this.isShown || this.played || this.fulled || !options.inline) {\n return this;\n }\n\n this.fulled = true;\n this.open();\n addClass(this.button, CLASS_FULLSCREEN_EXIT);\n\n if (options.transition) {\n removeClass(list, CLASS_TRANSITION);\n\n if (this.viewed) {\n removeClass(image, CLASS_TRANSITION);\n }\n }\n\n addClass(viewer, CLASS_FIXED);\n viewer.setAttribute('style', '');\n setStyle(viewer, {\n zIndex: options.zIndex\n });\n this.initContainer();\n this.viewerData = assign({}, this.containerData);\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this5.renderImage(function () {\n if (options.transition) {\n setTimeout(function () {\n addClass(image, CLASS_TRANSITION);\n addClass(list, CLASS_TRANSITION);\n }, 0);\n }\n });\n });\n }\n\n return this;\n },\n // Exit modal mode (only available in inline mode)\n exit: function exit() {\n var _this6 = this;\n\n var options = this.options,\n viewer = this.viewer,\n image = this.image,\n list = this.list;\n\n if (!this.isShown || this.played || !this.fulled || !options.inline) {\n return this;\n }\n\n this.fulled = false;\n this.close();\n removeClass(this.button, CLASS_FULLSCREEN_EXIT);\n\n if (options.transition) {\n removeClass(list, CLASS_TRANSITION);\n\n if (this.viewed) {\n removeClass(image, CLASS_TRANSITION);\n }\n }\n\n removeClass(viewer, CLASS_FIXED);\n setStyle(viewer, {\n zIndex: options.zIndexInline\n });\n this.viewerData = assign({}, this.parentData);\n this.renderViewer();\n this.renderList();\n\n if (this.viewed) {\n this.initImage(function () {\n _this6.renderImage(function () {\n if (options.transition) {\n setTimeout(function () {\n addClass(image, CLASS_TRANSITION);\n addClass(list, CLASS_TRANSITION);\n }, 0);\n }\n });\n });\n }\n\n return this;\n },\n // Show the current ratio of the image with percentage\n tooltip: function tooltip() {\n var _this7 = this;\n\n var options = this.options,\n tooltipBox = this.tooltipBox,\n imageData = this.imageData;\n\n if (!this.viewed || this.played || !options.tooltip) {\n return this;\n }\n\n tooltipBox.textContent = \"\".concat(Math.round(imageData.ratio * 100), \"%\");\n\n if (!this.tooltipping) {\n if (options.transition) {\n if (this.fading) {\n dispatchEvent(tooltipBox, EVENT_TRANSITION_END);\n }\n\n addClass(tooltipBox, CLASS_SHOW);\n addClass(tooltipBox, CLASS_FADE);\n addClass(tooltipBox, CLASS_TRANSITION); // Force reflow to enable CSS3 transition\n // eslint-disable-next-line\n\n tooltipBox.offsetWidth;\n addClass(tooltipBox, CLASS_IN);\n } else {\n addClass(tooltipBox, CLASS_SHOW);\n }\n } else {\n clearTimeout(this.tooltipping);\n }\n\n this.tooltipping = setTimeout(function () {\n if (options.transition) {\n addListener(tooltipBox, EVENT_TRANSITION_END, function () {\n removeClass(tooltipBox, CLASS_SHOW);\n removeClass(tooltipBox, CLASS_FADE);\n removeClass(tooltipBox, CLASS_TRANSITION);\n _this7.fading = false;\n }, {\n once: true\n });\n removeClass(tooltipBox, CLASS_IN);\n _this7.fading = true;\n } else {\n removeClass(tooltipBox, CLASS_SHOW);\n }\n\n _this7.tooltipping = false;\n }, 1000);\n return this;\n },\n // Toggle the image size between its natural size and initial size\n toggle: function toggle() {\n if (this.imageData.ratio === 1) {\n this.zoomTo(this.initialImageData.ratio, true);\n } else {\n this.zoomTo(1, true);\n }\n\n return this;\n },\n // Reset the image to its initial state\n reset: function reset() {\n if (this.viewed && !this.played) {\n this.imageData = assign({}, this.initialImageData);\n this.renderImage();\n }\n\n return this;\n },\n // Update viewer when images changed\n update: function update() {\n var element = this.element,\n options = this.options,\n isImg = this.isImg; // Destroy viewer if the target image was deleted\n\n if (isImg && !element.parentNode) {\n return this.destroy();\n }\n\n var images = [];\n forEach(isImg ? [element] : element.querySelectorAll('img'), function (image) {\n if (options.filter) {\n if (options.filter(image)) {\n images.push(image);\n }\n } else {\n images.push(image);\n }\n });\n\n if (!images.length) {\n return this;\n }\n\n this.images = images;\n this.length = images.length;\n\n if (this.ready) {\n var indexes = [];\n forEach(this.items, function (item, i) {\n var img = item.querySelector('img');\n var image = images[i];\n\n if (image) {\n if (image.src !== img.src) {\n indexes.push(i);\n }\n } else {\n indexes.push(i);\n }\n });\n setStyle(this.list, {\n width: 'auto'\n });\n this.initList();\n\n if (this.isShown) {\n if (this.length) {\n if (this.viewed) {\n var index = indexes.indexOf(this.index);\n\n if (index >= 0) {\n this.viewed = false;\n this.view(Math.max(this.index - (index + 1), 0));\n } else {\n addClass(this.items[this.index], CLASS_ACTIVE);\n }\n }\n } else {\n this.image = null;\n this.viewed = false;\n this.index = 0;\n this.imageData = {};\n this.canvas.innerHTML = '';\n this.title.innerHTML = '';\n }\n }\n } else {\n this.build();\n }\n\n return this;\n },\n // Destroy the viewer\n destroy: function destroy() {\n var element = this.element,\n options = this.options;\n\n if (!element[NAMESPACE]) {\n return this;\n }\n\n this.destroyed = true;\n\n if (this.ready) {\n if (this.played) {\n this.stop();\n }\n\n if (options.inline) {\n if (this.fulled) {\n this.exit();\n }\n\n this.unbind();\n } else if (this.isShown) {\n if (this.viewing) {\n if (this.imageRendering) {\n this.imageRendering.abort();\n } else if (this.imageInitializing) {\n this.imageInitializing.abort();\n }\n }\n\n if (this.hiding) {\n this.transitioning.abort();\n }\n\n this.hidden();\n } else if (this.showing) {\n this.transitioning.abort();\n this.hidden();\n }\n\n this.ready = false;\n this.viewer.parentNode.removeChild(this.viewer);\n } else if (options.inline) {\n if (this.delaying) {\n this.delaying.abort();\n } else if (this.initializing) {\n this.initializing.abort();\n }\n }\n\n if (!options.inline) {\n removeListener(element, EVENT_CLICK, this.onStart);\n }\n\n element[NAMESPACE] = undefined;\n return this;\n }\n };\n\n var others = {\n open: function open() {\n var body = this.body;\n addClass(body, CLASS_OPEN);\n body.style.paddingRight = \"\".concat(this.scrollbarWidth + (parseFloat(this.initialBodyPaddingRight) || 0), \"px\");\n },\n close: function close() {\n var body = this.body;\n removeClass(body, CLASS_OPEN);\n body.style.paddingRight = this.initialBodyPaddingRight;\n },\n shown: function shown() {\n var element = this.element,\n options = this.options;\n this.fulled = true;\n this.isShown = true;\n this.render();\n this.bind();\n this.showing = false;\n\n if (isFunction(options.shown)) {\n addListener(element, EVENT_SHOWN, options.shown, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_SHOWN) === false) {\n return;\n }\n\n if (this.ready && this.isShown && !this.hiding) {\n this.view(this.index);\n }\n },\n hidden: function hidden() {\n var element = this.element,\n options = this.options;\n this.fulled = false;\n this.viewed = false;\n this.isShown = false;\n this.close();\n this.unbind();\n addClass(this.viewer, CLASS_HIDE);\n this.resetList();\n this.resetImage();\n this.hiding = false;\n\n if (!this.destroyed) {\n if (isFunction(options.hidden)) {\n addListener(element, EVENT_HIDDEN, options.hidden, {\n once: true\n });\n }\n\n dispatchEvent(element, EVENT_HIDDEN);\n }\n },\n requestFullscreen: function requestFullscreen() {\n var document = this.element.ownerDocument;\n\n if (this.fulled && !(document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n var documentElement = document.documentElement; // Element.requestFullscreen()\n\n if (documentElement.requestFullscreen) {\n documentElement.requestFullscreen();\n } else if (documentElement.webkitRequestFullscreen) {\n documentElement.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);\n } else if (documentElement.mozRequestFullScreen) {\n documentElement.mozRequestFullScreen();\n } else if (documentElement.msRequestFullscreen) {\n documentElement.msRequestFullscreen();\n }\n }\n },\n exitFullscreen: function exitFullscreen() {\n var document = this.element.ownerDocument;\n\n if (this.fulled && (document.fullscreenElement || document.webkitFullscreenElement || document.mozFullScreenElement || document.msFullscreenElement)) {\n // Document.exitFullscreen()\n if (document.exitFullscreen) {\n document.exitFullscreen();\n } else if (document.webkitExitFullscreen) {\n document.webkitExitFullscreen();\n } else if (document.mozCancelFullScreen) {\n document.mozCancelFullScreen();\n } else if (document.msExitFullscreen) {\n document.msExitFullscreen();\n }\n }\n },\n change: function change(event) {\n var options = this.options,\n pointers = this.pointers;\n var pointer = pointers[Object.keys(pointers)[0]];\n var offsetX = pointer.endX - pointer.startX;\n var offsetY = pointer.endY - pointer.startY;\n\n switch (this.action) {\n // Move the current image\n case ACTION_MOVE:\n this.move(offsetX, offsetY);\n break;\n // Zoom the current image\n\n case ACTION_ZOOM:\n this.zoom(getMaxZoomRatio(pointers), false, event);\n break;\n\n case ACTION_SWITCH:\n {\n this.action = 'switched';\n var absoluteOffsetX = Math.abs(offsetX);\n\n if (absoluteOffsetX > 1 && absoluteOffsetX > Math.abs(offsetY)) {\n // Empty `pointers` as `touchend` event will not be fired after swiped in iOS browsers.\n this.pointers = {};\n\n if (offsetX > 1) {\n this.prev(options.loop);\n } else if (offsetX < -1) {\n this.next(options.loop);\n }\n }\n\n break;\n }\n\n default:\n } // Override\n\n\n forEach(pointers, function (p) {\n p.startX = p.endX;\n p.startY = p.endY;\n });\n },\n isSwitchable: function isSwitchable() {\n var imageData = this.imageData,\n viewerData = this.viewerData;\n return this.length > 1 && imageData.left >= 0 && imageData.top >= 0 && imageData.width <= viewerData.width && imageData.height <= viewerData.height;\n }\n };\n\n var AnotherViewer = WINDOW.Viewer;\n\n var Viewer =\n /*#__PURE__*/\n function () {\n /**\n * Create a new Viewer.\n * @param {Element} element - The target element for viewing.\n * @param {Object} [options={}] - The configuration options.\n */\n function Viewer(element) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n\n _classCallCheck(this, Viewer);\n\n if (!element || element.nodeType !== 1) {\n throw new Error('The first argument is required and must be an element.');\n }\n\n this.element = element;\n this.options = assign({}, DEFAULTS, isPlainObject(options) && options);\n this.action = false;\n this.fading = false;\n this.fulled = false;\n this.hiding = false;\n this.imageClicked = false;\n this.imageData = {};\n this.index = this.options.initialViewIndex;\n this.isImg = false;\n this.isShown = false;\n this.length = 0;\n this.played = false;\n this.playing = false;\n this.pointers = {};\n this.ready = false;\n this.showing = false;\n this.timeout = false;\n this.tooltipping = false;\n this.viewed = false;\n this.viewing = false;\n this.wheeling = false;\n this.zooming = false;\n this.init();\n }\n\n _createClass(Viewer, [{\n key: \"init\",\n value: function init() {\n var _this = this;\n\n var element = this.element,\n options = this.options;\n\n if (element[NAMESPACE]) {\n return;\n }\n\n element[NAMESPACE] = this;\n var isImg = element.tagName.toLowerCase() === 'img';\n var images = [];\n forEach(isImg ? [element] : element.querySelectorAll('img'), function (image) {\n if (isFunction(options.filter)) {\n if (options.filter.call(_this, image)) {\n images.push(image);\n }\n } else {\n images.push(image);\n }\n });\n this.isImg = isImg;\n this.length = images.length;\n this.images = images;\n var ownerDocument = element.ownerDocument;\n var body = ownerDocument.body || ownerDocument.documentElement;\n this.body = body;\n this.scrollbarWidth = window.innerWidth - ownerDocument.documentElement.clientWidth;\n this.initialBodyPaddingRight = window.getComputedStyle(body).paddingRight; // Override `transition` option if it is not supported\n\n if (isUndefined(document.createElement(NAMESPACE).style.transition)) {\n options.transition = false;\n }\n\n if (options.inline) {\n var count = 0;\n\n var progress = function progress() {\n count += 1;\n\n if (count === _this.length) {\n var timeout;\n _this.initializing = false;\n _this.delaying = {\n abort: function abort() {\n clearTimeout(timeout);\n }\n }; // build asynchronously to keep `this.viewer` is accessible in `ready` event handler.\n\n timeout = setTimeout(function () {\n _this.delaying = false;\n\n _this.build();\n }, 0);\n }\n };\n\n this.initializing = {\n abort: function abort() {\n forEach(images, function (image) {\n if (!image.complete) {\n removeListener(image, EVENT_LOAD, progress);\n }\n });\n }\n };\n forEach(images, function (image) {\n if (image.complete) {\n progress();\n } else {\n addListener(image, EVENT_LOAD, progress, {\n once: true\n });\n }\n });\n } else {\n addListener(element, EVENT_CLICK, this.onStart = function (_ref) {\n var target = _ref.target;\n\n if (target.tagName.toLowerCase() === 'img' && (!isFunction(options.filter) || options.filter.call(_this, target))) {\n _this.view(_this.images.indexOf(target));\n }\n });\n }\n }\n }, {\n key: \"build\",\n value: function build() {\n if (this.ready) {\n return;\n }\n\n var element = this.element,\n options = this.options;\n var parent = element.parentNode;\n var template = document.createElement('div');\n template.innerHTML = TEMPLATE;\n var viewer = template.querySelector(\".\".concat(NAMESPACE, \"-container\"));\n var title = viewer.querySelector(\".\".concat(NAMESPACE, \"-title\"));\n var toolbar = viewer.querySelector(\".\".concat(NAMESPACE, \"-toolbar\"));\n var navbar = viewer.querySelector(\".\".concat(NAMESPACE, \"-navbar\"));\n var button = viewer.querySelector(\".\".concat(NAMESPACE, \"-button\"));\n var canvas = viewer.querySelector(\".\".concat(NAMESPACE, \"-canvas\"));\n this.parent = parent;\n this.viewer = viewer;\n this.title = title;\n this.toolbar = toolbar;\n this.navbar = navbar;\n this.button = button;\n this.canvas = canvas;\n this.footer = viewer.querySelector(\".\".concat(NAMESPACE, \"-footer\"));\n this.tooltipBox = viewer.querySelector(\".\".concat(NAMESPACE, \"-tooltip\"));\n this.player = viewer.querySelector(\".\".concat(NAMESPACE, \"-player\"));\n this.list = viewer.querySelector(\".\".concat(NAMESPACE, \"-list\"));\n addClass(title, !options.title ? CLASS_HIDE : getResponsiveClass(Array.isArray(options.title) ? options.title[0] : options.title));\n addClass(navbar, !options.navbar ? CLASS_HIDE : getResponsiveClass(options.navbar));\n toggleClass(button, CLASS_HIDE, !options.button);\n\n if (options.backdrop) {\n addClass(viewer, \"\".concat(NAMESPACE, \"-backdrop\"));\n\n if (!options.inline && options.backdrop !== 'static') {\n setData(canvas, DATA_ACTION, 'hide');\n }\n }\n\n if (isString(options.className) && options.className) {\n // In case there are multiple class names\n options.className.split(REGEXP_SPACES).forEach(function (className) {\n addClass(viewer, className);\n });\n }\n\n if (options.toolbar) {\n var list = document.createElement('ul');\n var custom = isPlainObject(options.toolbar);\n var zoomButtons = BUTTONS.slice(0, 3);\n var rotateButtons = BUTTONS.slice(7, 9);\n var scaleButtons = BUTTONS.slice(9);\n\n if (!custom) {\n addClass(toolbar, getResponsiveClass(options.toolbar));\n }\n\n forEach(custom ? options.toolbar : BUTTONS, function (value, index) {\n var deep = custom && isPlainObject(value);\n var name = custom ? hyphenate(index) : value;\n var show = deep && !isUndefined(value.show) ? value.show : value;\n\n if (!show || !options.zoomable && zoomButtons.indexOf(name) !== -1 || !options.rotatable && rotateButtons.indexOf(name) !== -1 || !options.scalable && scaleButtons.indexOf(name) !== -1) {\n return;\n }\n\n var size = deep && !isUndefined(value.size) ? value.size : value;\n var click = deep && !isUndefined(value.click) ? value.click : value;\n var item = document.createElement('li');\n item.setAttribute('role', 'button');\n addClass(item, \"\".concat(NAMESPACE, \"-\").concat(name));\n\n if (!isFunction(click)) {\n setData(item, DATA_ACTION, name);\n }\n\n if (isNumber(show)) {\n addClass(item, getResponsiveClass(show));\n }\n\n if (['small', 'large'].indexOf(size) !== -1) {\n addClass(item, \"\".concat(NAMESPACE, \"-\").concat(size));\n } else if (name === 'play') {\n addClass(item, \"\".concat(NAMESPACE, \"-large\"));\n }\n\n if (isFunction(click)) {\n addListener(item, EVENT_CLICK, click);\n }\n\n list.appendChild(item);\n });\n toolbar.appendChild(list);\n } else {\n addClass(toolbar, CLASS_HIDE);\n }\n\n if (!options.rotatable) {\n var rotates = toolbar.querySelectorAll('li[class*=\"rotate\"]');\n addClass(rotates, CLASS_INVISIBLE);\n forEach(rotates, function (rotate) {\n toolbar.appendChild(rotate);\n });\n }\n\n if (options.inline) {\n addClass(button, CLASS_FULLSCREEN);\n setStyle(viewer, {\n zIndex: options.zIndexInline\n });\n\n if (window.getComputedStyle(parent).position === 'static') {\n setStyle(parent, {\n position: 'relative'\n });\n }\n\n parent.insertBefore(viewer, element.nextSibling);\n } else {\n addClass(button, CLASS_CLOSE);\n addClass(viewer, CLASS_FIXED);\n addClass(viewer, CLASS_FADE);\n addClass(viewer, CLASS_HIDE);\n setStyle(viewer, {\n zIndex: options.zIndex\n });\n var container = options.container;\n\n if (isString(container)) {\n container = element.ownerDocument.querySelector(container);\n }\n\n if (!container) {\n container = this.body;\n }\n\n container.appendChild(viewer);\n }\n\n if (options.inline) {\n this.render();\n this.bind();\n this.isShown = true;\n }\n\n this.ready = true;\n\n if (isFunction(options.ready)) {\n addListener(element, EVENT_READY, options.ready, {\n once: true\n });\n }\n\n if (dispatchEvent(element, EVENT_READY) === false) {\n this.ready = false;\n return;\n }\n\n if (this.ready && options.inline) {\n this.view(this.index);\n }\n }\n /**\n * Get the no conflict viewer class.\n * @returns {Viewer} The viewer class.\n */\n\n }], [{\n key: \"noConflict\",\n value: function noConflict() {\n window.Viewer = AnotherViewer;\n return Viewer;\n }\n /**\n * Change the default options.\n * @param {Object} options - The new default options.\n */\n\n }, {\n key: \"setDefaults\",\n value: function setDefaults(options) {\n assign(DEFAULTS, isPlainObject(options) && options);\n }\n }]);\n\n return Viewer;\n }();\n\n assign(Viewer.prototype, render, events, handlers, methods, others);\n\n return Viewer;\n\n}));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/viewerjs/dist/viewer.js\n// module id = IinW\n// module chunks = 0","function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { getComponentConfig } from '../../utils/config';\nimport { requestAF } from '../../utils/dom';\nimport { isBoolean } from '../../utils/inspect';\nimport BVTransition from '../../utils/bv-transition';\nimport normalizeSlotMixin from '../../mixins/normalize-slot';\nimport { BButtonClose } from '../button/button-close';\nvar NAME = 'BAlert'; // Convert `show` value to a number\n\nvar parseCountDown = function parseCountDown(show) {\n if (show === '' || isBoolean(show)) {\n return 0;\n }\n\n show = parseInt(show, 10);\n return show > 0 ? show : 0;\n}; // Convert `show` value to a boolean\n\n\nvar parseShow = function parseShow(show) {\n if (show === '' || show === true) {\n return true;\n }\n\n if (parseInt(show, 10) < 1) {\n // Boolean will always return false for the above comparison\n return false;\n }\n\n return Boolean(show);\n}; // Is a value number like (i.e. a number or a number as string)\n\n\nvar isNumericLike = function isNumericLike(value) {\n return !isNaN(parseInt(value, 10));\n}; // @vue/component\n\n\nexport var BAlert =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n mixins: [normalizeSlotMixin],\n model: {\n prop: 'show',\n event: 'input'\n },\n props: {\n variant: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'variant');\n }\n },\n dismissible: {\n type: Boolean,\n default: false\n },\n dismissLabel: {\n type: String,\n default: function _default() {\n return getComponentConfig(NAME, 'dismissLabel');\n }\n },\n show: {\n type: [Boolean, Number, String],\n default: false\n },\n fade: {\n type: Boolean,\n default: false\n }\n },\n data: function data() {\n return {\n countDownTimerId: null,\n countDown: 0,\n // If initially shown, we need to set these for SSR\n localShow: parseShow(this.show)\n };\n },\n watch: {\n show: function show(newVal) {\n this.countDown = parseCountDown(newVal);\n this.localShow = parseShow(newVal);\n },\n countDown: function countDown(newVal) {\n var _this = this;\n\n this.clearTimer();\n\n if (isNumericLike(this.show)) {\n // Ignore if this.show transitions to a boolean value.\n this.$emit('dismiss-count-down', newVal);\n\n if (this.show !== newVal) {\n // Update the v-model if needed\n this.$emit('input', newVal);\n }\n\n if (newVal > 0) {\n this.localShow = true;\n this.countDownTimerId = setTimeout(function () {\n _this.countDown--;\n }, 1000);\n } else {\n // Slightly delay the hide to allow any UI updates\n this.$nextTick(function () {\n requestAF(function () {\n _this.localShow = false;\n });\n });\n }\n }\n },\n localShow: function localShow(newVal) {\n if (!newVal && (this.dismissible || isNumericLike(this.show))) {\n // Only emit dismissed events for dismissible or auto dismissing alerts\n this.$emit('dismissed');\n }\n\n if (!isNumericLike(this.show) && this.show !== newVal) {\n // Only emit booleans if we weren't passed a number via `this.show`\n this.$emit('input', newVal);\n }\n }\n },\n created: function created() {\n this.countDown = parseCountDown(this.show);\n this.localShow = parseShow(this.show);\n },\n mounted: function mounted() {\n this.countDown = parseCountDown(this.show);\n this.localShow = parseShow(this.show);\n },\n beforeDestroy: function beforeDestroy() {\n this.clearTimer();\n },\n methods: {\n dismiss: function dismiss() {\n this.clearTimer();\n this.countDown = 0;\n this.localShow = false;\n },\n clearTimer: function clearTimer() {\n if (this.countDownTimerId) {\n clearInterval(this.countDownTimerId);\n this.countDownTimerId = null;\n }\n }\n },\n render: function render(h) {\n var $alert; // undefined\n\n if (this.localShow) {\n var $dismissBtn = h();\n\n if (this.dismissible) {\n // Add dismiss button\n $dismissBtn = h(BButtonClose, {\n attrs: {\n 'aria-label': this.dismissLabel\n },\n on: {\n click: this.dismiss\n }\n }, [this.normalizeSlot('dismiss')]);\n }\n\n $alert = h('div', {\n key: this._uid,\n staticClass: 'alert',\n class: _defineProperty({\n 'alert-dismissible': this.dismissible\n }, \"alert-\".concat(this.variant), this.variant),\n attrs: {\n role: 'alert',\n 'aria-live': 'polite',\n 'aria-atomic': true\n }\n }, [$dismissBtn, this.normalizeSlot('default')]);\n $alert = [$alert];\n }\n\n return h(BVTransition, {\n props: {\n noFade: !this.fade\n }\n }, $alert);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/alert/alert.js\n// module id = It76\n// module chunks = 0","import { BDropdown } from './dropdown';\nimport { BDropdownItem } from './dropdown-item';\nimport { BDropdownItemButton } from './dropdown-item-button';\nimport { BDropdownHeader } from './dropdown-header';\nimport { BDropdownDivider } from './dropdown-divider';\nimport { BDropdownForm } from './dropdown-form';\nimport { BDropdownText } from './dropdown-text';\nimport { BDropdownGroup } from './dropdown-group';\nimport { pluginFactory } from '../../utils/plugins';\nvar DropdownPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BDropdown: BDropdown,\n BDd: BDropdown,\n BDropdownItem: BDropdownItem,\n BDdItem: BDropdownItem,\n BDropdownItemButton: BDropdownItemButton,\n BDropdownItemBtn: BDropdownItemButton,\n BDdItemButton: BDropdownItemButton,\n BDdItemBtn: BDropdownItemButton,\n BDropdownHeader: BDropdownHeader,\n BDdHeader: BDropdownHeader,\n BDropdownDivider: BDropdownDivider,\n BDdDivider: BDropdownDivider,\n BDropdownForm: BDropdownForm,\n BDdForm: BDropdownForm,\n BDropdownText: BDropdownText,\n BDdText: BDropdownText,\n BDropdownGroup: BDropdownGroup,\n BDdGroup: BDropdownGroup\n }\n});\nexport { DropdownPlugin, BDropdown, BDropdownItem, BDropdownItemButton, BDropdownHeader, BDropdownDivider, BDropdownForm, BDropdownText, BDropdownGroup };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/dropdown/index.js\n// module id = IwQL\n// module chunks = 0","import { isObject } from '../../../utils/inspect';\nimport sanitizeRow from './sanitize-row';\nimport stringifyObjectValues from './stringify-object-values'; // Stringifies the values of a record, ignoring any special top level field keys\n// TODO: Add option to stringify `scopedSlot` items\n\nvar stringifyRecordValues = function stringifyRecordValues(row, ignoreFields, includeFields, fieldsObj) {\n return isObject(row) ? stringifyObjectValues(sanitizeRow(row, ignoreFields, includeFields, fieldsObj)) : '';\n};\n\nexport default stringifyRecordValues;\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/table/helpers/stringify-record-values.js\n// module id = JCoq\n// module chunks = 0","/**\n * Lo-Dash 2.3.0 (Custom Build) \n * Build: `lodash modularize modern exports=\"npm\" -o ./npm/`\n * Copyright 2012-2013 The Dojo Foundation \n * Based on Underscore.js 1.5.2 \n * Copyright 2009-2013 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n * Available under MIT license \n */\nvar bind = require('lodash.bind'),\n identity = require('lodash.identity'),\n setBindData = require('lodash._setbinddata'),\n support = require('lodash.support');\n\n/** Used to detected named functions */\nvar reFuncName = /^\\s*function[ \\n\\r\\t]+\\w/;\n\n/** Used to detect functions containing a `this` reference */\nvar reThis = /\\bthis\\b/;\n\n/** Native method shortcuts */\nvar fnToString = Function.prototype.toString;\n\n/**\n * The base implementation of `_.createCallback` without support for creating\n * \"_.pluck\" or \"_.where\" style callbacks.\n *\n * @private\n * @param {*} [func=identity] The value to convert to a callback.\n * @param {*} [thisArg] The `this` binding of the created callback.\n * @param {number} [argCount] The number of arguments the callback accepts.\n * @returns {Function} Returns a callback function.\n */\nfunction baseCreateCallback(func, thisArg, argCount) {\n if (typeof func != 'function') {\n return identity;\n }\n // exit early for no `thisArg` or already bound by `Function#bind`\n if (typeof thisArg == 'undefined' || !('prototype' in func)) {\n return func;\n }\n var bindData = func.__bindData__;\n if (typeof bindData == 'undefined') {\n if (support.funcNames) {\n bindData = !func.name;\n }\n bindData = bindData || !support.funcDecomp;\n if (!bindData) {\n var source = fnToString.call(func);\n if (!support.funcNames) {\n bindData = !reFuncName.test(source);\n }\n if (!bindData) {\n // checks if `func` references the `this` keyword and stores the result\n bindData = reThis.test(source);\n setBindData(func, bindData);\n }\n }\n }\n // exit early if there are no `this` references or `func` is bound\n if (bindData === false || (bindData !== true && bindData[1] & 1)) {\n return func;\n }\n switch (argCount) {\n case 1: return function(value) {\n return func.call(thisArg, value);\n };\n case 2: return function(a, b) {\n return func.call(thisArg, a, b);\n };\n case 3: return function(value, index, collection) {\n return func.call(thisArg, value, index, collection);\n };\n case 4: return function(accumulator, value, index, collection) {\n return func.call(thisArg, accumulator, value, index, collection);\n };\n }\n return bind(func, thisArg);\n}\n\nmodule.exports = baseCreateCallback;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/lodash._basecreatecallback/index.js\n// module id = JKMF\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/axios/lib/helpers/bind.js\n// module id = JP+z\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { BForm, props as formProps } from '../form/form';\nexport var BDropdownForm =\n/*#__PURE__*/\nVue.extend({\n name: 'BDropdownForm',\n functional: true,\n props: _objectSpread({}, formProps, {\n disabled: {\n type: Boolean,\n default: false\n }\n }),\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n var $attrs = data.attrs || {};\n var $listeners = data.on || {};\n data.attrs = {};\n data.on = {};\n return h('li', mergeData(data, {\n attrs: {\n role: 'presentation'\n }\n }), [h(BForm, {\n ref: 'form',\n staticClass: 'b-dropdown-form',\n class: {\n disabled: props.disabled\n },\n props: props,\n attrs: _objectSpread({}, $attrs, {\n disabled: props.disabled,\n // Tab index of -1 for keyboard navigation\n tabindex: props.disabled ? null : '-1'\n }),\n on: $listeners\n }, children)]);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/dropdown/dropdown-form.js\n// module id = Jfy9\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport getScopId from '../../utils/get-scope-id';\nimport looseEqual from '../../utils/loose-equal';\nimport { concat } from '../../utils/array';\nimport { getComponentConfig } from '../../utils/config';\nimport { isBrowser } from '../../utils/env';\nimport { isFunction, isObject, isString, isUndefined } from '../../utils/inspect';\nimport { keys } from '../../utils/object';\nimport { BVTooltip } from '../../components/tooltip/helpers/bv-tooltip'; // Key which we use to store tooltip object on element\n\nvar BV_TOOLTIP = '__BV_Tooltip__'; // Default trigger\n\nvar DefaultTrigger = 'hover focus'; // Valid event triggers\n\nvar validTriggers = {\n focus: true,\n hover: true,\n click: true,\n blur: true,\n manual: true // Directive modifier test regular expressions. Pre-compile for performance\n\n};\nvar htmlRE = /^html$/i;\nvar noFadeRE = /^nofade$/i;\nvar placementRE = /^(auto|top(left|right)?|bottom(left|right)?|left(top|bottom)?|right(top|bottom)?)$/i;\nvar boundaryRE = /^(window|viewport|scrollParent)$/i;\nvar delayRE = /^d\\d+$/i;\nvar delayShowRE = /^ds\\d+$/i;\nvar delayHideRE = /^dh\\d+$/i;\nvar offsetRE = /^o-?\\d+$/i;\nvar variantRE = /^v-.+$/i; // Build a Tooltip config based on bindings (if any)\n// Arguments and modifiers take precedence over passed value config object\n\nvar parseBindings = function parseBindings(bindings, vnode)\n/* istanbul ignore next: not easy to test */\n{\n // We start out with a basic config\n var NAME = 'BTooltip'; // Default config\n\n var config = {\n title: undefined,\n trigger: '',\n // Default set below if needed\n placement: 'top',\n fallbackPlacement: 'flip',\n container: false,\n // Default of body\n animation: true,\n offset: 0,\n id: null,\n html: false,\n delay: getComponentConfig(NAME, 'delay'),\n boundary: String(getComponentConfig(NAME, 'boundary')),\n boundaryPadding: parseInt(getComponentConfig(NAME, 'boundaryPadding'), 10) || 0,\n variant: getComponentConfig(NAME, 'variant'),\n customClass: getComponentConfig(NAME, 'customClass') // Process `bindings.value`\n\n };\n\n if (isString(bindings.value)) {\n // Value is tooltip content (HTML optionally supported)\n config.title = bindings.value;\n } else if (isFunction(bindings.value)) {\n // Title generator function\n config.title = bindings.value;\n } else if (isObject(bindings.value)) {\n // Value is config object, so merge\n config = _objectSpread({}, config, {}, bindings.value);\n } // If title is not provided, try title attribute\n\n\n if (isUndefined(config.title)) {\n // Try attribute\n var data = vnode.data || {};\n config.title = data.attrs && data.attrs.title ? data.attrs.title : '';\n } // Normalize delay\n\n\n if (!isObject(config.delay)) {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n } // If argument, assume element ID of container element\n\n\n if (bindings.arg) {\n // Element ID specified as arg\n // We must prepend '#' to become a CSS selector\n config.container = \"#\".concat(bindings.arg);\n } // Process modifiers\n\n\n keys(bindings.modifiers).forEach(function (mod) {\n if (htmlRE.test(mod)) {\n // Title allows HTML\n config.html = true;\n } else if (noFadeRE.test(mod)) {\n // No animation\n config.animation = false;\n } else if (placementRE.test(mod)) {\n // Placement of tooltip\n config.placement = mod;\n } else if (boundaryRE.test(mod)) {\n // Boundary of tooltip\n mod = mod === 'scrollparent' ? 'scrollParent' : mod;\n config.boundary = mod;\n } else if (delayRE.test(mod)) {\n // Delay value\n var delay = parseInt(mod.slice(1), 10) || 0;\n config.delay.show = delay;\n config.delay.hide = delay;\n } else if (delayShowRE.test(mod)) {\n // Delay show value\n config.delay.show = parseInt(mod.slice(2), 10) || 0;\n } else if (delayHideRE.test(mod)) {\n // Delay hide value\n config.delay.hide = parseInt(mod.slice(2), 10) || 0;\n } else if (offsetRE.test(mod)) {\n // Offset value, negative allowed\n config.offset = parseInt(mod.slice(1), 10) || 0;\n } else if (variantRE.test(mod)) {\n // Variant\n config.variant = mod.slice(2) || null;\n }\n }); // Special handling of event trigger modifiers trigger is\n // a space separated list\n\n var selectedTriggers = {}; // Parse current config object trigger\n\n concat(config.trigger || '').filter(Boolean).join(' ').trim().toLowerCase().split(/\\s+/).forEach(function (trigger) {\n if (validTriggers[trigger]) {\n selectedTriggers[trigger] = true;\n }\n }); // Parse modifiers for triggers\n\n keys(bindings.modifiers).forEach(function (mod) {\n mod = mod.toLowerCase();\n\n if (validTriggers[mod]) {\n // If modifier is a valid trigger\n selectedTriggers[mod] = true;\n }\n }); // Sanitize triggers\n\n config.trigger = keys(selectedTriggers).join(' ');\n\n if (config.trigger === 'blur') {\n // Blur by itself is useless, so convert it to 'focus'\n config.trigger = 'focus';\n }\n\n if (!config.trigger) {\n // Use default trigger\n config.trigger = DefaultTrigger;\n } // Return the config\n\n\n return config;\n}; // Add/update Tooltip on our element\n\n\nvar applyTooltip = function applyTooltip(el, bindings, vnode) {\n if (!isBrowser) {\n /* istanbul ignore next */\n return;\n }\n\n var config = parseBindings(bindings, vnode);\n\n if (!el[BV_TOOLTIP]) {\n var $parent = vnode.context;\n el[BV_TOOLTIP] = new BVTooltip({\n parent: $parent,\n // Add the parent's scoped style attribute data\n _scopeId: getScopId($parent, undefined)\n });\n el[BV_TOOLTIP].__bv_prev_data__ = {};\n el[BV_TOOLTIP].$on('show', function ()\n /* istanbul ignore next: for now */\n {\n // Before showing the tooltip, we update the title if it is a function\n if (isFunction(config.title)) {\n el[BV_TOOLTIP].updateData({\n title: config.title()\n });\n }\n });\n }\n\n var data = {\n title: config.title,\n triggers: config.trigger,\n placement: config.placement,\n fallbackPlacement: config.fallbackPlacement,\n variant: config.variant,\n customClass: config.customClass,\n container: config.container,\n boundary: config.boundary,\n delay: config.delay,\n offset: config.offset,\n noFade: !config.animation,\n id: config.id,\n html: config.html\n };\n var oldData = el[BV_TOOLTIP].__bv_prev_data__;\n el[BV_TOOLTIP].__bv_prev_data__ = data;\n\n if (!looseEqual(data, oldData)) {\n // We only update the instance if data has changed\n var newData = {\n target: el\n };\n keys(data).forEach(function (prop) {\n // We only pass data properties that have changed\n if (data[prop] !== oldData[prop]) {\n // if title is a function, we execute it here\n newData[prop] = prop === 'title' && isFunction(data[prop]) ? data[prop]() : data[prop];\n }\n });\n el[BV_TOOLTIP].updateData(newData);\n }\n}; // Remove Tooltip on our element\n\n\nvar removeTooltip = function removeTooltip(el) {\n if (el[BV_TOOLTIP]) {\n el[BV_TOOLTIP].$destroy();\n el[BV_TOOLTIP] = null;\n }\n\n delete el[BV_TOOLTIP];\n}; // Export our directive\n\n\nexport var VBTooltip = {\n bind: function bind(el, bindings, vnode) {\n applyTooltip(el, bindings, vnode);\n },\n // We use `componentUpdated` here instead of `update`, as the former\n // waits until the containing component and children have finished updating\n componentUpdated: function componentUpdated(el, bindings, vnode) {\n // Performed in a `$nextTick()` to prevent render update loops\n vnode.context.$nextTick(function () {\n applyTooltip(el, bindings, vnode);\n });\n },\n unbind: function unbind(el) {\n removeTooltip(el);\n }\n};\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/directives/tooltip/tooltip.js\n// module id = JmX5\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var jv = moment.defineLocale('jv', {\n months : 'Januari_Februari_Maret_April_Mei_Juni_Juli_Agustus_September_Oktober_Nopember_Desember'.split('_'),\n monthsShort : 'Jan_Feb_Mar_Apr_Mei_Jun_Jul_Ags_Sep_Okt_Nop_Des'.split('_'),\n weekdays : 'Minggu_Senen_Seloso_Rebu_Kemis_Jemuwah_Septu'.split('_'),\n weekdaysShort : 'Min_Sen_Sel_Reb_Kem_Jem_Sep'.split('_'),\n weekdaysMin : 'Mg_Sn_Sl_Rb_Km_Jm_Sp'.split('_'),\n longDateFormat : {\n LT : 'HH.mm',\n LTS : 'HH.mm.ss',\n L : 'DD/MM/YYYY',\n LL : 'D MMMM YYYY',\n LLL : 'D MMMM YYYY [pukul] HH.mm',\n LLLL : 'dddd, D MMMM YYYY [pukul] HH.mm'\n },\n meridiemParse: /enjing|siyang|sonten|ndalu/,\n meridiemHour : function (hour, meridiem) {\n if (hour === 12) {\n hour = 0;\n }\n if (meridiem === 'enjing') {\n return hour;\n } else if (meridiem === 'siyang') {\n return hour >= 11 ? hour : hour + 12;\n } else if (meridiem === 'sonten' || meridiem === 'ndalu') {\n return hour + 12;\n }\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours < 11) {\n return 'enjing';\n } else if (hours < 15) {\n return 'siyang';\n } else if (hours < 19) {\n return 'sonten';\n } else {\n return 'ndalu';\n }\n },\n calendar : {\n sameDay : '[Dinten puniko pukul] LT',\n nextDay : '[Mbenjang pukul] LT',\n nextWeek : 'dddd [pukul] LT',\n lastDay : '[Kala wingi pukul] LT',\n lastWeek : 'dddd [kepengker pukul] LT',\n sameElse : 'L'\n },\n relativeTime : {\n future : 'wonten ing %s',\n past : '%s ingkang kepengker',\n s : 'sawetawis detik',\n ss : '%d detik',\n m : 'setunggal menit',\n mm : '%d menit',\n h : 'setunggal jam',\n hh : '%d jam',\n d : 'sedinten',\n dd : '%d dinten',\n M : 'sewulan',\n MM : '%d wulan',\n y : 'setaun',\n yy : '%d taun'\n },\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 7 // The week that contains Jan 7th is the first week of the year.\n }\n });\n\n return jv;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/jv.js\n// module id = JwiF\n// module chunks = 0","import upperFirst from './upper-first';\n/**\n * Suffix can be a falsey value so nothing is appended to string.\n * (helps when looping over props & some shouldn't change)\n * Use data last parameters to allow for currying.\n * @param {string} suffix\n * @param {string} str\n */\n\nvar suffixPropName = function suffixPropName(suffix, str) {\n return str + (suffix ? upperFirst(suffix) : '');\n};\n\nexport default suffixPropName;\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/utils/suffix-prop-name.js\n// module id = KB1b\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/axios/lib/defaults.js\n// module id = KCLY\n// module chunks = 0","import { pluginFactory } from '../utils/plugins';\nimport { VBModalPlugin } from './modal';\nimport { VBPopoverPlugin } from './popover';\nimport { VBScrollspyPlugin } from './scrollspy';\nimport { VBTogglePlugin } from './toggle';\nimport { VBTooltipPlugin } from './tooltip'; // Main plugin for installing all directive plugins\n\nexport var directivesPlugin =\n/*#__PURE__*/\npluginFactory({\n plugins: {\n VBModalPlugin: VBModalPlugin,\n VBPopoverPlugin: VBPopoverPlugin,\n VBScrollspyPlugin: VBScrollspyPlugin,\n VBTogglePlugin: VBTogglePlugin,\n VBTooltipPlugin: VBTooltipPlugin\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/directives/index.js\n// module id = KcC9\n// module chunks = 0","import { BFormGroup } from './form-group';\nimport { pluginFactory } from '../../utils/plugins';\nvar FormGroupPlugin =\n/*#__PURE__*/\npluginFactory({\n components: {\n BFormGroup: BFormGroup,\n BFormFieldset: BFormGroup\n }\n});\nexport { FormGroupPlugin, BFormGroup };\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-group/index.js\n// module id = KoNO\n// module chunks = 0","var ctx = require('./_ctx');\nvar invoke = require('./_invoke');\nvar html = require('./_html');\nvar cel = require('./_dom-create');\nvar global = require('./_global');\nvar process = global.process;\nvar setTask = global.setImmediate;\nvar clearTask = global.clearImmediate;\nvar MessageChannel = global.MessageChannel;\nvar Dispatch = global.Dispatch;\nvar counter = 0;\nvar queue = {};\nvar ONREADYSTATECHANGE = 'onreadystatechange';\nvar defer, channel, port;\nvar run = function () {\n var id = +this;\n // eslint-disable-next-line no-prototype-builtins\n if (queue.hasOwnProperty(id)) {\n var fn = queue[id];\n delete queue[id];\n fn();\n }\n};\nvar listener = function (event) {\n run.call(event.data);\n};\n// Node.js 0.9+ & IE10+ has setImmediate, otherwise:\nif (!setTask || !clearTask) {\n setTask = function setImmediate(fn) {\n var args = [];\n var i = 1;\n while (arguments.length > i) args.push(arguments[i++]);\n queue[++counter] = function () {\n // eslint-disable-next-line no-new-func\n invoke(typeof fn == 'function' ? fn : Function(fn), args);\n };\n defer(counter);\n return counter;\n };\n clearTask = function clearImmediate(id) {\n delete queue[id];\n };\n // Node.js 0.8-\n if (require('./_cof')(process) == 'process') {\n defer = function (id) {\n process.nextTick(ctx(run, id, 1));\n };\n // Sphere (JS game engine) Dispatch API\n } else if (Dispatch && Dispatch.now) {\n defer = function (id) {\n Dispatch.now(ctx(run, id, 1));\n };\n // Browsers with MessageChannel, includes WebWorkers\n } else if (MessageChannel) {\n channel = new MessageChannel();\n port = channel.port2;\n channel.port1.onmessage = listener;\n defer = ctx(port.postMessage, port, 1);\n // Browsers with postMessage, skip WebWorkers\n // IE8 has postMessage, but it's sync & typeof its postMessage is 'object'\n } else if (global.addEventListener && typeof postMessage == 'function' && !global.importScripts) {\n defer = function (id) {\n global.postMessage(id + '', '*');\n };\n global.addEventListener('message', listener, false);\n // IE8-\n } else if (ONREADYSTATECHANGE in cel('script')) {\n defer = function (id) {\n html.appendChild(cel('script'))[ONREADYSTATECHANGE] = function () {\n html.removeChild(this);\n run.call(id);\n };\n };\n // Rest old browsers\n } else {\n defer = function (id) {\n setTimeout(ctx(run, id, 1), 0);\n };\n }\n}\nmodule.exports = {\n set: setTask,\n clear: clearTask\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/core-js/library/modules/_task.js\n// module id = L42u\n// module chunks = 0","import Vue from '../../../utils/vue';\nimport { isFunction, isUndefinedOrNull } from '../../../utils/inspect';\nimport { BVTooltipTemplate } from '../../tooltip/helpers/bv-tooltip-template';\nvar NAME = 'BVPopoverTemplate'; // @vue/component\n\nexport var BVPopoverTemplate =\n/*#__PURE__*/\nVue.extend({\n name: NAME,\n extends: BVTooltipTemplate,\n computed: {\n templateType: function templateType() {\n return 'popover';\n }\n },\n methods: {\n renderTemplate: function renderTemplate(h) {\n // Title and content could be a scoped slot function\n var $title = isFunction(this.title) ? this.title({}) : this.title;\n var $content = isFunction(this.content) ? this.content({}) : this.content; // Directive usage only\n\n var titleDomProps = this.html && !isFunction(this.title) ? {\n innerHTML: this.title\n } : {};\n var contentDomProps = this.html && !isFunction(this.content) ? {\n innerHTML: this.content\n } : {};\n return h('div', {\n staticClass: 'popover b-popover',\n class: this.templateClasses,\n attrs: this.templateAttributes,\n on: this.templateListeners\n }, [h('div', {\n ref: 'arrow',\n staticClass: 'arrow'\n }), isUndefinedOrNull($title) ? h() : h('h3', {\n staticClass: 'popover-header',\n domProps: titleDomProps\n }, [$title]), isUndefinedOrNull($content) ? h() : h('div', {\n staticClass: 'popover-body',\n domProps: contentDomProps\n }, [$content])]);\n }\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/popover/helpers/bv-popover-template.js\n// module id = LHzE\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split('_'),\n monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_');\n\n var monthsParse = [/^ene/i, /^feb/i, /^mar/i, /^abr/i, /^may/i, /^jun/i, /^jul/i, /^ago/i, /^sep/i, /^oct/i, /^nov/i, /^dic/i];\n var monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i;\n\n var es = moment.defineLocale('es', {\n months : 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split('_'),\n monthsShort : function (m, format) {\n if (!m) {\n return monthsShortDot;\n } else if (/-MMM-/.test(format)) {\n return monthsShort[m.month()];\n } else {\n return monthsShortDot[m.month()];\n }\n },\n monthsRegex : monthsRegex,\n monthsShortRegex : monthsRegex,\n monthsStrictRegex : /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,\n monthsShortStrictRegex : /^(ene\\.?|feb\\.?|mar\\.?|abr\\.?|may\\.?|jun\\.?|jul\\.?|ago\\.?|sep\\.?|oct\\.?|nov\\.?|dic\\.?)/i,\n monthsParse : monthsParse,\n longMonthsParse : monthsParse,\n shortMonthsParse : monthsParse,\n weekdays : 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),\n weekdaysShort : 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),\n weekdaysMin : 'do_lu_ma_mi_ju_vi_sá'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'H:mm',\n LTS : 'H:mm:ss',\n L : 'DD/MM/YYYY',\n LL : 'D [de] MMMM [de] YYYY',\n LLL : 'D [de] MMMM [de] YYYY H:mm',\n LLLL : 'dddd, D [de] MMMM [de] YYYY H:mm'\n },\n calendar : {\n sameDay : function () {\n return '[hoy a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextDay : function () {\n return '[mañana a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n nextWeek : function () {\n return 'dddd [a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastDay : function () {\n return '[ayer a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n lastWeek : function () {\n return '[el] dddd [pasado a la' + ((this.hours() !== 1) ? 's' : '') + '] LT';\n },\n sameElse : 'L'\n },\n relativeTime : {\n future : 'en %s',\n past : 'hace %s',\n s : 'unos segundos',\n ss : '%d segundos',\n m : 'un minuto',\n mm : '%d minutos',\n h : 'una hora',\n hh : '%d horas',\n d : 'un día',\n dd : '%d días',\n M : 'un mes',\n MM : '%d meses',\n y : 'un año',\n yy : '%d años'\n },\n dayOfMonthOrdinalParse : /\\d{1,2}º/,\n ordinal : '%dº',\n week : {\n dow : 1, // Monday is the first day of the week.\n doy : 4 // The week that contains Jan 4th is the first week of the year.\n }\n });\n\n return es;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/es.js\n// module id = LT9G\n// module chunks = 0","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }\n\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }\n\nfunction _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport idMixin from '../../mixins/id';\nimport formOptionsMixin from '../../mixins/form-options';\nimport formMixin from '../../mixins/form';\nimport formSizeMixin from '../../mixins/form-size';\nimport formStateMixin from '../../mixins/form-state';\nimport formCustomMixin from '../../mixins/form-custom';\nimport normalizeSlotMixin from '../../mixins/normalize-slot';\nimport { from as arrayFrom } from '../../utils/array';\nimport { htmlOrText } from '../../utils/html'; // @vue/component\n\nexport var BFormSelect =\n/*#__PURE__*/\nVue.extend({\n name: 'BFormSelect',\n mixins: [idMixin, normalizeSlotMixin, formMixin, formSizeMixin, formStateMixin, formCustomMixin, formOptionsMixin],\n model: {\n prop: 'value',\n event: 'input'\n },\n props: {\n value: {// type: [Object, Array, String, Number, Boolean],\n // default: undefined\n },\n multiple: {\n type: Boolean,\n default: false\n },\n selectSize: {\n // Browsers default size to 0, which shows 4 rows in most browsers in multiple mode\n // Size of 1 can bork out Firefox\n type: Number,\n default: 0\n },\n ariaInvalid: {\n type: [Boolean, String],\n default: false\n }\n },\n data: function data() {\n return {\n localValue: this.value\n };\n },\n computed: {\n computedSelectSize: function computedSelectSize() {\n // Custom selects with a size of zero causes the arrows to be hidden,\n // so dont render the size attribute in this case\n return !this.plain && this.selectSize === 0 ? null : this.selectSize;\n },\n inputClass: function inputClass() {\n return [this.plain ? 'form-control' : 'custom-select', this.size && this.plain ? \"form-control-\".concat(this.size) : null, this.size && !this.plain ? \"custom-select-\".concat(this.size) : null, this.stateClass];\n },\n computedAriaInvalid: function computedAriaInvalid() {\n if (this.ariaInvalid === true || this.ariaInvalid === 'true') {\n return 'true';\n }\n\n return this.stateClass === 'is-invalid' ? 'true' : null;\n }\n },\n watch: {\n value: function value(newVal, oldVal) {\n this.localValue = newVal;\n },\n localValue: function localValue(newVal, oldVal) {\n this.$emit('input', this.localValue);\n }\n },\n methods: {\n focus: function focus() {\n this.$refs.input.focus();\n },\n blur: function blur() {\n this.$refs.input.blur();\n }\n },\n render: function render(h) {\n var _this = this;\n\n var options = this.formOptions.map(function (option, index) {\n return h('option', {\n key: \"option_\".concat(index, \"_opt\"),\n attrs: {\n disabled: Boolean(option.disabled)\n },\n domProps: _objectSpread({}, htmlOrText(option.html, option.text), {\n value: option.value\n })\n });\n });\n return h('select', {\n ref: 'input',\n class: this.inputClass,\n directives: [{\n name: 'model',\n rawName: 'v-model',\n value: this.localValue,\n expression: 'localValue'\n }],\n attrs: {\n id: this.safeId(),\n name: this.name,\n form: this.form || null,\n multiple: this.multiple || null,\n size: this.computedSelectSize,\n disabled: this.disabled,\n required: this.required,\n 'aria-required': this.required ? 'true' : null,\n 'aria-invalid': this.computedAriaInvalid\n },\n on: {\n change: function change(evt) {\n var target = evt.target;\n var selectedVal = arrayFrom(target.options).filter(function (o) {\n return o.selected;\n }).map(function (o) {\n return '_value' in o ? o._value : o.value;\n });\n _this.localValue = target.multiple ? selectedVal : selectedVal[0];\n\n _this.$nextTick(function () {\n _this.$emit('change', _this.localValue);\n });\n }\n }\n }, [this.normalizeSlot('first'), options, this.normalizeSlot('default')]);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/form-select/form-select.js\n// module id = Lb6b\n// module chunks = 0","function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\n\nimport Vue from '../../utils/vue';\nimport { mergeData } from 'vue-functional-data-merge';\nimport { arrayIncludes } from '../../utils/array';\nexport var props = {\n type: {\n type: String,\n default: 'iframe',\n validator: function validator(str) {\n return arrayIncludes(['iframe', 'embed', 'video', 'object', 'img', 'b-img', 'b-img-lazy'], str);\n }\n },\n tag: {\n type: String,\n default: 'div'\n },\n aspect: {\n type: String,\n default: '16by9'\n } // @vue/component\n\n};\nexport var BEmbed =\n/*#__PURE__*/\nVue.extend({\n name: 'BEmbed',\n functional: true,\n props: props,\n render: function render(h, _ref) {\n var props = _ref.props,\n data = _ref.data,\n children = _ref.children;\n return h(props.tag, {\n ref: data.ref,\n staticClass: 'embed-responsive',\n class: _defineProperty({}, \"embed-responsive-\".concat(props.aspect), Boolean(props.aspect))\n }, [h(props.type, mergeData(data, {\n ref: '',\n staticClass: 'embed-responsive-item'\n }), children)]);\n }\n});\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/bootstrap-vue/esm/components/embed/embed.js\n// module id = LdD8\n// module chunks = 0","//! moment.js locale configuration\n\n;(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined'\n && typeof require === 'function' ? factory(require('../moment')) :\n typeof define === 'function' && define.amd ? define(['../moment'], factory) :\n factory(global.moment)\n}(this, (function (moment) { 'use strict';\n\n\n /*jshint -W100*/\n var si = moment.defineLocale('si', {\n months : 'ජනවාරි_පෙබරවාරි_මාර්තු_අප්රේල්_මැයි_ජූනි_ජූලි_අගෝස්තු_සැප්තැම්බර්_ඔක්තෝබර්_නොවැම්බර්_දෙසැම්බර්'.split('_'),\n monthsShort : 'ජන_පෙබ_මාර්_අප්_මැයි_ජූනි_ජූලි_අගෝ_සැප්_ඔක්_නොවැ_දෙසැ'.split('_'),\n weekdays : 'ඉරිදා_සඳුදා_අඟහරුවාදා_බදාදා_බ්රහස්පතින්දා_සිකුරාදා_සෙනසුරාදා'.split('_'),\n weekdaysShort : 'ඉරි_සඳු_අඟ_බදා_බ්රහ_සිකු_සෙන'.split('_'),\n weekdaysMin : 'ඉ_ස_අ_බ_බ්ර_සි_සෙ'.split('_'),\n weekdaysParseExact : true,\n longDateFormat : {\n LT : 'a h:mm',\n LTS : 'a h:mm:ss',\n L : 'YYYY/MM/DD',\n LL : 'YYYY MMMM D',\n LLL : 'YYYY MMMM D, a h:mm',\n LLLL : 'YYYY MMMM D [වැනි] dddd, a h:mm:ss'\n },\n calendar : {\n sameDay : '[අද] LT[ට]',\n nextDay : '[හෙට] LT[ට]',\n nextWeek : 'dddd LT[ට]',\n lastDay : '[ඊයේ] LT[ට]',\n lastWeek : '[පසුගිය] dddd LT[ට]',\n sameElse : 'L'\n },\n relativeTime : {\n future : '%sකින්',\n past : '%sකට පෙර',\n s : 'තත්පර කිහිපය',\n ss : 'තත්පර %d',\n m : 'මිනිත්තුව',\n mm : 'මිනිත්තු %d',\n h : 'පැය',\n hh : 'පැය %d',\n d : 'දිනය',\n dd : 'දින %d',\n M : 'මාසය',\n MM : 'මාස %d',\n y : 'වසර',\n yy : 'වසර %d'\n },\n dayOfMonthOrdinalParse: /\\d{1,2} වැනි/,\n ordinal : function (number) {\n return number + ' වැනි';\n },\n meridiemParse : /පෙර වරු|පස් වරු|පෙ.ව|ප.ව./,\n isPM : function (input) {\n return input === 'ප.ව.' || input === 'පස් වරු';\n },\n meridiem : function (hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'ප.ව.' : 'පස් වරු';\n } else {\n return isLower ? 'පෙ.ව.' : 'පෙර වරු';\n }\n }\n });\n\n return si;\n\n})));\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/moment/locale/si.js\n// module id = Lgqo\n// module chunks = 0","/**\n * @license\n * Lodash \n * Copyright OpenJS Foundation and other contributors \n * Released under MIT license \n * Based on Underscore.js 1.8.3 \n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n;(function() {\n\n /** Used as a safe reference for `undefined` in pre-ES5 environments. */\n var undefined;\n\n /** Used as the semantic version number. */\n var VERSION = '4.17.15';\n\n /** Used as the size to enable large array optimizations. */\n var LARGE_ARRAY_SIZE = 200;\n\n /** Error message constants. */\n var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',\n FUNC_ERROR_TEXT = 'Expected a function';\n\n /** Used to stand-in for `undefined` hash values. */\n var HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n /** Used as the maximum memoize cache size. */\n var MAX_MEMOIZE_SIZE = 500;\n\n /** Used as the internal argument placeholder. */\n var PLACEHOLDER = '__lodash_placeholder__';\n\n /** Used to compose bitmasks for cloning. */\n var CLONE_DEEP_FLAG = 1,\n CLONE_FLAT_FLAG = 2,\n CLONE_SYMBOLS_FLAG = 4;\n\n /** Used to compose bitmasks for value comparisons. */\n var COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n /** Used to compose bitmasks for function metadata. */\n var WRAP_BIND_FLAG = 1,\n WRAP_BIND_KEY_FLAG = 2,\n WRAP_CURRY_BOUND_FLAG = 4,\n WRAP_CURRY_FLAG = 8,\n WRAP_CURRY_RIGHT_FLAG = 16,\n WRAP_PARTIAL_FLAG = 32,\n WRAP_PARTIAL_RIGHT_FLAG = 64,\n WRAP_ARY_FLAG = 128,\n WRAP_REARG_FLAG = 256,\n WRAP_FLIP_FLAG = 512;\n\n /** Used as default options for `_.truncate`. */\n var DEFAULT_TRUNC_LENGTH = 30,\n DEFAULT_TRUNC_OMISSION = '...';\n\n /** Used to detect hot functions by number of calls within a span of milliseconds. */\n var HOT_COUNT = 800,\n HOT_SPAN = 16;\n\n /** Used to indicate the type of lazy iteratees. */\n var LAZY_FILTER_FLAG = 1,\n LAZY_MAP_FLAG = 2,\n LAZY_WHILE_FLAG = 3;\n\n /** Used as references for various `Number` constants. */\n var INFINITY = 1 / 0,\n MAX_SAFE_INTEGER = 9007199254740991,\n MAX_INTEGER = 1.7976931348623157e+308,\n NAN = 0 / 0;\n\n /** Used as references for the maximum length and index of an array. */\n var MAX_ARRAY_LENGTH = 4294967295,\n MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,\n HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;\n\n /** Used to associate wrap methods with their bit flags. */\n var wrapFlags = [\n ['ary', WRAP_ARY_FLAG],\n ['bind', WRAP_BIND_FLAG],\n ['bindKey', WRAP_BIND_KEY_FLAG],\n ['curry', WRAP_CURRY_FLAG],\n ['curryRight', WRAP_CURRY_RIGHT_FLAG],\n ['flip', WRAP_FLIP_FLAG],\n ['partial', WRAP_PARTIAL_FLAG],\n ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],\n ['rearg', WRAP_REARG_FLAG]\n ];\n\n /** `Object#toString` result references. */\n var argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n asyncTag = '[object AsyncFunction]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n domExcTag = '[object DOMException]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n nullTag = '[object Null]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n proxyTag = '[object Proxy]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]',\n undefinedTag = '[object Undefined]',\n weakMapTag = '[object WeakMap]',\n weakSetTag = '[object WeakSet]';\n\n var arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n /** Used to match empty string literals in compiled template source. */\n var reEmptyStringLeading = /\\b__p \\+= '';/g,\n reEmptyStringMiddle = /\\b(__p \\+=) '' \\+/g,\n reEmptyStringTrailing = /(__e\\(.*?\\)|\\b__t\\)) \\+\\n'';/g;\n\n /** Used to match HTML entities and HTML characters. */\n var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,\n reUnescapedHtml = /[&<>\"']/g,\n reHasEscapedHtml = RegExp(reEscapedHtml.source),\n reHasUnescapedHtml = RegExp(reUnescapedHtml.source);\n\n /** Used to match template delimiters. */\n var reEscape = /<%-([\\s\\S]+?)%>/g,\n reEvaluate = /<%([\\s\\S]+?)%>/g,\n reInterpolate = /<%=([\\s\\S]+?)%>/g;\n\n /** Used to match property names within property paths. */\n var reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n reIsPlainProp = /^\\w*$/,\n rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n /**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\n var reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g,\n reHasRegExpChar = RegExp(reRegExpChar.source);\n\n /** Used to match leading and trailing whitespace. */\n var reTrim = /^\\s+|\\s+$/g,\n reTrimStart = /^\\s+/,\n reTrimEnd = /\\s+$/;\n\n /** Used to match wrap detail comments. */\n var reWrapComment = /\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,\n reWrapDetails = /\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,\n reSplitDetails = /,? & /;\n\n /** Used to match words composed of alphanumeric characters. */\n var reAsciiWord = /[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g;\n\n /** Used to match backslashes in property paths. */\n var reEscapeChar = /\\\\(\\\\)?/g;\n\n /**\n * Used to match\n * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).\n */\n var reEsTemplate = /\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g;\n\n /** Used to match `RegExp` flags from their coerced string values. */\n var reFlags = /\\w*$/;\n\n /** Used to detect bad signed hexadecimal string values. */\n var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n /** Used to detect binary string values. */\n var reIsBinary = /^0b[01]+$/i;\n\n /** Used to detect host constructors (Safari). */\n var reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n /** Used to detect octal string values. */\n var reIsOctal = /^0o[0-7]+$/i;\n\n /** Used to detect unsigned integer values. */\n var reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n /** Used to match Latin Unicode letters (excluding mathematical operators). */\n var reLatin = /[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g;\n\n /** Used to ensure capturing order of template delimiters. */\n var reNoMatch = /($^)/;\n\n /** Used to match unescaped characters in compiled string literals. */\n var reUnescapedString = /['\\n\\r\\u2028\\u2029\\\\]/g;\n\n /** Used to compose unicode character classes. */\n var rsAstralRange = '\\\\ud800-\\\\udfff',\n rsComboMarksRange = '\\\\u0300-\\\\u036f',\n reComboHalfMarksRange = '\\\\ufe20-\\\\ufe2f',\n rsComboSymbolsRange = '\\\\u20d0-\\\\u20ff',\n rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,\n rsDingbatRange = '\\\\u2700-\\\\u27bf',\n rsLowerRange = 'a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff',\n rsMathOpRange = '\\\\xac\\\\xb1\\\\xd7\\\\xf7',\n rsNonCharRange = '\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf',\n rsPunctuationRange = '\\\\u2000-\\\\u206f',\n rsSpaceRange = ' \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000',\n rsUpperRange = 'A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde',\n rsVarRange = '\\\\ufe0e\\\\ufe0f',\n rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;\n\n /** Used to compose unicode capture groups. */\n var rsApos = \"['\\u2019]\",\n rsAstral = '[' + rsAstralRange + ']',\n rsBreak = '[' + rsBreakRange + ']',\n rsCombo = '[' + rsComboRange + ']',\n rsDigits = '\\\\d+',\n rsDingbat = '[' + rsDingbatRange + ']',\n rsLower = '[' + rsLowerRange + ']',\n rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',\n rsFitz = '\\\\ud83c[\\\\udffb-\\\\udfff]',\n rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',\n rsNonAstral = '[^' + rsAstralRange + ']',\n rsRegional = '(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}',\n rsSurrPair = '[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]',\n rsUpper = '[' + rsUpperRange + ']',\n rsZWJ = '\\\\u200d';\n\n /** Used to compose unicode regexes. */\n var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',\n rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',\n rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',\n rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',\n reOptMod = rsModifier + '?',\n rsOptVar = '[' + rsVarRange + ']?',\n rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',\n rsOrdLower = '\\\\d*(?:1st|2nd|3rd|(?![123])\\\\dth)(?=\\\\b|[A-Z_])',\n rsOrdUpper = '\\\\d*(?:1ST|2ND|3RD|(?![123])\\\\dTH)(?=\\\\b|[a-z_])',\n rsSeq = rsOptVar + reOptMod + rsOptJoin,\n rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,\n rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';\n\n /** Used to match apostrophes. */\n var reApos = RegExp(rsApos, 'g');\n\n /**\n * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and\n * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).\n */\n var reComboMark = RegExp(rsCombo, 'g');\n\n /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */\n var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');\n\n /** Used to match complex or compound words. */\n var reUnicodeWord = RegExp([\n rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',\n rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',\n rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,\n rsUpper + '+' + rsOptContrUpper,\n rsOrdUpper,\n rsOrdLower,\n rsDigits,\n rsEmoji\n ].join('|'), 'g');\n\n /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */\n var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');\n\n /** Used to detect strings that need a more robust regexp to match words. */\n var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;\n\n /** Used to assign default `context` object properties. */\n var contextProps = [\n 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',\n 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',\n 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',\n 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',\n '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'\n ];\n\n /** Used to make template sourceURLs easier to identify. */\n var templateCounter = -1;\n\n /** Used to identify `toStringTag` values of typed arrays. */\n var typedArrayTags = {};\n typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\n typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\n typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\n typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\n typedArrayTags[uint32Tag] = true;\n typedArrayTags[argsTag] = typedArrayTags[arrayTag] =\n typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\n typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\n typedArrayTags[errorTag] = typedArrayTags[funcTag] =\n typedArrayTags[mapTag] = typedArrayTags[numberTag] =\n typedArrayTags[objectTag] = typedArrayTags[regexpTag] =\n typedArrayTags[setTag] = typedArrayTags[stringTag] =\n typedArrayTags[weakMapTag] = false;\n\n /** Used to identify `toStringTag` values supported by `_.clone`. */\n var cloneableTags = {};\n cloneableTags[argsTag] = cloneableTags[arrayTag] =\n cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\n cloneableTags[boolTag] = cloneableTags[dateTag] =\n cloneableTags[float32Tag] = cloneableTags[float64Tag] =\n cloneableTags[int8Tag] = cloneableTags[int16Tag] =\n cloneableTags[int32Tag] = cloneableTags[mapTag] =\n cloneableTags[numberTag] = cloneableTags[objectTag] =\n cloneableTags[regexpTag] = cloneableTags[setTag] =\n cloneableTags[stringTag] = cloneableTags[symbolTag] =\n cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\n cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\n cloneableTags[errorTag] = cloneableTags[funcTag] =\n cloneableTags[weakMapTag] = false;\n\n /** Used to map Latin Unicode letters to basic Latin letters. */\n var deburredLetters = {\n // Latin-1 Supplement block.\n '\\xc0': 'A', '\\xc1': 'A', '\\xc2': 'A', '\\xc3': 'A', '\\xc4': 'A', '\\xc5': 'A',\n '\\xe0': 'a', '\\xe1': 'a', '\\xe2': 'a', '\\xe3': 'a', '\\xe4': 'a', '\\xe5': 'a',\n '\\xc7': 'C', '\\xe7': 'c',\n '\\xd0': 'D', '\\xf0': 'd',\n '\\xc8': 'E', '\\xc9': 'E', '\\xca': 'E', '\\xcb': 'E',\n '\\xe8': 'e', '\\xe9': 'e', '\\xea': 'e', '\\xeb': 'e',\n '\\xcc': 'I', '\\xcd': 'I', '\\xce': 'I', '\\xcf': 'I',\n '\\xec': 'i', '\\xed': 'i', '\\xee': 'i', '\\xef': 'i',\n '\\xd1': 'N', '\\xf1': 'n',\n '\\xd2': 'O', '\\xd3': 'O', '\\xd4': 'O', '\\xd5': 'O', '\\xd6': 'O', '\\xd8': 'O',\n '\\xf2': 'o', '\\xf3': 'o', '\\xf4': 'o', '\\xf5': 'o', '\\xf6': 'o', '\\xf8': 'o',\n '\\xd9': 'U', '\\xda': 'U', '\\xdb': 'U', '\\xdc': 'U',\n '\\xf9': 'u', '\\xfa': 'u', '\\xfb': 'u', '\\xfc': 'u',\n '\\xdd': 'Y', '\\xfd': 'y', '\\xff': 'y',\n '\\xc6': 'Ae', '\\xe6': 'ae',\n '\\xde': 'Th', '\\xfe': 'th',\n '\\xdf': 'ss',\n // Latin Extended-A block.\n '\\u0100': 'A', '\\u0102': 'A', '\\u0104': 'A',\n '\\u0101': 'a', '\\u0103': 'a', '\\u0105': 'a',\n '\\u0106': 'C', '\\u0108': 'C', '\\u010a': 'C', '\\u010c': 'C',\n '\\u0107': 'c', '\\u0109': 'c', '\\u010b': 'c', '\\u010d': 'c',\n '\\u010e': 'D', '\\u0110': 'D', '\\u010f': 'd', '\\u0111': 'd',\n '\\u0112': 'E', '\\u0114': 'E', '\\u0116': 'E', '\\u0118': 'E', '\\u011a': 'E',\n '\\u0113': 'e', '\\u0115': 'e', '\\u0117': 'e', '\\u0119': 'e', '\\u011b': 'e',\n '\\u011c': 'G', '\\u011e': 'G', '\\u0120': 'G', '\\u0122': 'G',\n '\\u011d': 'g', '\\u011f': 'g', '\\u0121': 'g', '\\u0123': 'g',\n '\\u0124': 'H', '\\u0126': 'H', '\\u0125': 'h', '\\u0127': 'h',\n '\\u0128': 'I', '\\u012a': 'I', '\\u012c': 'I', '\\u012e': 'I', '\\u0130': 'I',\n '\\u0129': 'i', '\\u012b': 'i', '\\u012d': 'i', '\\u012f': 'i', '\\u0131': 'i',\n '\\u0134': 'J', '\\u0135': 'j',\n '\\u0136': 'K', '\\u0137': 'k', '\\u0138': 'k',\n '\\u0139': 'L', '\\u013b': 'L', '\\u013d': 'L', '\\u013f': 'L', '\\u0141': 'L',\n '\\u013a': 'l', '\\u013c': 'l', '\\u013e': 'l', '\\u0140': 'l', '\\u0142': 'l',\n '\\u0143': 'N', '\\u0145': 'N', '\\u0147': 'N', '\\u014a': 'N',\n '\\u0144': 'n', '\\u0146': 'n', '\\u0148': 'n', '\\u014b': 'n',\n '\\u014c': 'O', '\\u014e': 'O', '\\u0150': 'O',\n '\\u014d': 'o', '\\u014f': 'o', '\\u0151': 'o',\n '\\u0154': 'R', '\\u0156': 'R', '\\u0158': 'R',\n '\\u0155': 'r', '\\u0157': 'r', '\\u0159': 'r',\n '\\u015a': 'S', '\\u015c': 'S', '\\u015e': 'S', '\\u0160': 'S',\n '\\u015b': 's', '\\u015d': 's', '\\u015f': 's', '\\u0161': 's',\n '\\u0162': 'T', '\\u0164': 'T', '\\u0166': 'T',\n '\\u0163': 't', '\\u0165': 't', '\\u0167': 't',\n '\\u0168': 'U', '\\u016a': 'U', '\\u016c': 'U', '\\u016e': 'U', '\\u0170': 'U', '\\u0172': 'U',\n '\\u0169': 'u', '\\u016b': 'u', '\\u016d': 'u', '\\u016f': 'u', '\\u0171': 'u', '\\u0173': 'u',\n '\\u0174': 'W', '\\u0175': 'w',\n '\\u0176': 'Y', '\\u0177': 'y', '\\u0178': 'Y',\n '\\u0179': 'Z', '\\u017b': 'Z', '\\u017d': 'Z',\n '\\u017a': 'z', '\\u017c': 'z', '\\u017e': 'z',\n '\\u0132': 'IJ', '\\u0133': 'ij',\n '\\u0152': 'Oe', '\\u0153': 'oe',\n '\\u0149': \"'n\", '\\u017f': 's'\n };\n\n /** Used to map characters to HTML entities. */\n var htmlEscapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '\"': '"',\n \"'\": '''\n };\n\n /** Used to map HTML entities to characters. */\n var htmlUnescapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '"': '\"',\n ''': \"'\"\n };\n\n /** Used to escape characters for inclusion in compiled string literals. */\n var stringEscapes = {\n '\\\\': '\\\\',\n \"'\": \"'\",\n '\\n': 'n',\n '\\r': 'r',\n '\\u2028': 'u2028',\n '\\u2029': 'u2029'\n };\n\n /** Built-in method references without a dependency on `root`. */\n var freeParseFloat = parseFloat,\n freeParseInt = parseInt;\n\n /** Detect free variable `global` from Node.js. */\n var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n /** Detect free variable `self`. */\n var freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n /** Used as a reference to the global object. */\n var root = freeGlobal || freeSelf || Function('return this')();\n\n /** Detect free variable `exports`. */\n var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n /** Detect free variable `module`. */\n var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n /** Detect the popular CommonJS extension `module.exports`. */\n var moduleExports = freeModule && freeModule.exports === freeExports;\n\n /** Detect free variable `process` from Node.js. */\n var freeProcess = moduleExports && freeGlobal.process;\n\n /** Used to access faster Node.js helpers. */\n var nodeUtil = (function() {\n try {\n // Use `util.types` for Node.js 10+.\n var types = freeModule && freeModule.require && freeModule.require('util').types;\n\n if (types) {\n return types;\n }\n\n // Legacy `process.binding('util')` for Node.js < 10.\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n }());\n\n /* Node.js helper references. */\n var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,\n nodeIsDate = nodeUtil && nodeUtil.isDate,\n nodeIsMap = nodeUtil && nodeUtil.isMap,\n nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,\n nodeIsSet = nodeUtil && nodeUtil.isSet,\n nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * A faster alternative to `Function#apply`, this function invokes `func`\n * with the `this` binding of `thisArg` and the arguments of `args`.\n *\n * @private\n * @param {Function} func The function to invoke.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} args The arguments to invoke `func` with.\n * @returns {*} Returns the result of `func`.\n */\n function apply(func, thisArg, args) {\n switch (args.length) {\n case 0: return func.call(thisArg);\n case 1: return func.call(thisArg, args[0]);\n case 2: return func.call(thisArg, args[0], args[1]);\n case 3: return func.call(thisArg, args[0], args[1], args[2]);\n }\n return func.apply(thisArg, args);\n }\n\n /**\n * A specialized version of `baseAggregator` for arrays.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function arrayAggregator(array, setter, iteratee, accumulator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n var value = array[index];\n setter(accumulator, value, iteratee(value), array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEach(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (iteratee(array[index], index, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.forEachRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEachRight(array, iteratee) {\n var length = array == null ? 0 : array.length;\n\n while (length--) {\n if (iteratee(array[length], length, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.every` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n */\n function arrayEvery(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (!predicate(array[index], index, array)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.includes` for arrays without support for\n * specifying an index to search from.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludes(array, value) {\n var length = array == null ? 0 : array.length;\n return !!length && baseIndexOf(array, value, 0) > -1;\n }\n\n /**\n * This function is like `arrayIncludes` except that it accepts a comparator.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludesWith(array, value, comparator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (comparator(value, array[index])) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `_.map` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function arrayMap(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length,\n result = Array(length);\n\n while (++index < length) {\n result[index] = iteratee(array[index], index, array);\n }\n return result;\n }\n\n /**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\n function arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n }\n\n /**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduce(array, iteratee, accumulator, initAccum) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n if (initAccum && length) {\n accumulator = array[++index];\n }\n while (++index < length) {\n accumulator = iteratee(accumulator, array[index], index, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.reduceRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the last element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduceRight(array, iteratee, accumulator, initAccum) {\n var length = array == null ? 0 : array.length;\n if (initAccum && length) {\n accumulator = array[--length];\n }\n while (length--) {\n accumulator = iteratee(accumulator, array[length], length, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * Gets the size of an ASCII `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n var asciiSize = baseProperty('length');\n\n /**\n * Converts an ASCII `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function asciiToArray(string) {\n return string.split('');\n }\n\n /**\n * Splits an ASCII `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function asciiWords(string) {\n return string.match(reAsciiWord) || [];\n }\n\n /**\n * The base implementation of methods like `_.findKey` and `_.findLastKey`,\n * without support for iteratee shorthands, which iterates over `collection`\n * using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the found element or its key, else `undefined`.\n */\n function baseFindKey(collection, predicate, eachFunc) {\n var result;\n eachFunc(collection, function(value, key, collection) {\n if (predicate(value, key, collection)) {\n result = key;\n return false;\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.findIndex` and `_.findLastIndex` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {number} fromIndex The index to search from.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseFindIndex(array, predicate, fromIndex, fromRight) {\n var length = array.length,\n index = fromIndex + (fromRight ? 1 : -1);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (predicate(array[index], index, array)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.indexOf` without `fromIndex` bounds checks.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOf(array, value, fromIndex) {\n return value === value\n ? strictIndexOf(array, value, fromIndex)\n : baseFindIndex(array, baseIsNaN, fromIndex);\n }\n\n /**\n * This function is like `baseIndexOf` except that it accepts a comparator.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOfWith(array, value, fromIndex, comparator) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (comparator(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.isNaN` without support for number objects.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n */\n function baseIsNaN(value) {\n return value !== value;\n }\n\n /**\n * The base implementation of `_.mean` and `_.meanBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the mean.\n */\n function baseMean(array, iteratee) {\n var length = array == null ? 0 : array.length;\n return length ? (baseSum(array, iteratee) / length) : NAN;\n }\n\n /**\n * The base implementation of `_.property` without support for deep paths.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function baseProperty(key) {\n return function(object) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.propertyOf` without support for deep paths.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyOf(object) {\n return function(key) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.reduce` and `_.reduceRight`, without support\n * for iteratee shorthands, which iterates over `collection` using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} accumulator The initial value.\n * @param {boolean} initAccum Specify using the first or last element of\n * `collection` as the initial value.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the accumulated value.\n */\n function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {\n eachFunc(collection, function(value, index, collection) {\n accumulator = initAccum\n ? (initAccum = false, value)\n : iteratee(accumulator, value, index, collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.sortBy` which uses `comparer` to define the\n * sort order of `array` and replaces criteria objects with their corresponding\n * values.\n *\n * @private\n * @param {Array} array The array to sort.\n * @param {Function} comparer The function to define sort order.\n * @returns {Array} Returns `array`.\n */\n function baseSortBy(array, comparer) {\n var length = array.length;\n\n array.sort(comparer);\n while (length--) {\n array[length] = array[length].value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.sum` and `_.sumBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the sum.\n */\n function baseSum(array, iteratee) {\n var result,\n index = -1,\n length = array.length;\n\n while (++index < length) {\n var current = iteratee(array[index]);\n if (current !== undefined) {\n result = result === undefined ? current : (result + current);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\n function baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array\n * of key-value pairs for `object` corresponding to the property names of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the key-value pairs.\n */\n function baseToPairs(object, props) {\n return arrayMap(props, function(key) {\n return [key, object[key]];\n });\n }\n\n /**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\n function baseUnary(func) {\n return function(value) {\n return func(value);\n };\n }\n\n /**\n * The base implementation of `_.values` and `_.valuesIn` which creates an\n * array of `object` property values corresponding to the property names\n * of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the array of property values.\n */\n function baseValues(object, props) {\n return arrayMap(props, function(key) {\n return object[key];\n });\n }\n\n /**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function cacheHas(cache, key) {\n return cache.has(key);\n }\n\n /**\n * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the first unmatched string symbol.\n */\n function charsStartIndex(strSymbols, chrSymbols) {\n var index = -1,\n length = strSymbols.length;\n\n while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the last unmatched string symbol.\n */\n function charsEndIndex(strSymbols, chrSymbols) {\n var index = strSymbols.length;\n\n while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Gets the number of `placeholder` occurrences in `array`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} placeholder The placeholder to search for.\n * @returns {number} Returns the placeholder count.\n */\n function countHolders(array, placeholder) {\n var length = array.length,\n result = 0;\n\n while (length--) {\n if (array[length] === placeholder) {\n ++result;\n }\n }\n return result;\n }\n\n /**\n * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A\n * letters to basic Latin letters.\n *\n * @private\n * @param {string} letter The matched letter to deburr.\n * @returns {string} Returns the deburred letter.\n */\n var deburrLetter = basePropertyOf(deburredLetters);\n\n /**\n * Used by `_.escape` to convert characters to HTML entities.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n var escapeHtmlChar = basePropertyOf(htmlEscapes);\n\n /**\n * Used by `_.template` to escape characters for inclusion in compiled string literals.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n function escapeStringChar(chr) {\n return '\\\\' + stringEscapes[chr];\n }\n\n /**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function getValue(object, key) {\n return object == null ? undefined : object[key];\n }\n\n /**\n * Checks if `string` contains Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a symbol is found, else `false`.\n */\n function hasUnicode(string) {\n return reHasUnicode.test(string);\n }\n\n /**\n * Checks if `string` contains a word composed of Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a word is found, else `false`.\n */\n function hasUnicodeWord(string) {\n return reHasUnicodeWord.test(string);\n }\n\n /**\n * Converts `iterator` to an array.\n *\n * @private\n * @param {Object} iterator The iterator to convert.\n * @returns {Array} Returns the converted array.\n */\n function iteratorToArray(iterator) {\n var data,\n result = [];\n\n while (!(data = iterator.next()).done) {\n result.push(data.value);\n }\n return result;\n }\n\n /**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\n function mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n }\n\n /**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n }\n\n /**\n * Replaces all `placeholder` elements in `array` with an internal placeholder\n * and returns an array of their indexes.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {*} placeholder The placeholder to replace.\n * @returns {Array} Returns the new array of placeholder indexes.\n */\n function replaceHolders(array, placeholder) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value === placeholder || value === PLACEHOLDER) {\n array[index] = PLACEHOLDER;\n result[resIndex++] = index;\n }\n }\n return result;\n }\n\n /**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\n function setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n }\n\n /**\n * Converts `set` to its value-value pairs.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the value-value pairs.\n */\n function setToPairs(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = [value, value];\n });\n return result;\n }\n\n /**\n * A specialized version of `_.indexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictIndexOf(array, value, fromIndex) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (array[index] === value) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * A specialized version of `_.lastIndexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictLastIndexOf(array, value, fromIndex) {\n var index = fromIndex + 1;\n while (index--) {\n if (array[index] === value) {\n return index;\n }\n }\n return index;\n }\n\n /**\n * Gets the number of symbols in `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the string size.\n */\n function stringSize(string) {\n return hasUnicode(string)\n ? unicodeSize(string)\n : asciiSize(string);\n }\n\n /**\n * Converts `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function stringToArray(string) {\n return hasUnicode(string)\n ? unicodeToArray(string)\n : asciiToArray(string);\n }\n\n /**\n * Used by `_.unescape` to convert HTML entities to characters.\n *\n * @private\n * @param {string} chr The matched character to unescape.\n * @returns {string} Returns the unescaped character.\n */\n var unescapeHtmlChar = basePropertyOf(htmlUnescapes);\n\n /**\n * Gets the size of a Unicode `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n function unicodeSize(string) {\n var result = reUnicode.lastIndex = 0;\n while (reUnicode.test(string)) {\n ++result;\n }\n return result;\n }\n\n /**\n * Converts a Unicode `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function unicodeToArray(string) {\n return string.match(reUnicode) || [];\n }\n\n /**\n * Splits a Unicode `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function unicodeWords(string) {\n return string.match(reUnicodeWord) || [];\n }\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Create a new pristine `lodash` function using the `context` object.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Util\n * @param {Object} [context=root] The context object.\n * @returns {Function} Returns a new `lodash` function.\n * @example\n *\n * _.mixin({ 'foo': _.constant('foo') });\n *\n * var lodash = _.runInContext();\n * lodash.mixin({ 'bar': lodash.constant('bar') });\n *\n * _.isFunction(_.foo);\n * // => true\n * _.isFunction(_.bar);\n * // => false\n *\n * lodash.isFunction(lodash.foo);\n * // => false\n * lodash.isFunction(lodash.bar);\n * // => true\n *\n * // Create a suped-up `defer` in Node.js.\n * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;\n */\n var runInContext = (function runInContext(context) {\n context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));\n\n /** Built-in constructor references. */\n var Array = context.Array,\n Date = context.Date,\n Error = context.Error,\n Function = context.Function,\n Math = context.Math,\n Object = context.Object,\n RegExp = context.RegExp,\n String = context.String,\n TypeError = context.TypeError;\n\n /** Used for built-in method references. */\n var arrayProto = Array.prototype,\n funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n /** Used to detect overreaching core-js shims. */\n var coreJsData = context['__core-js_shared__'];\n\n /** Used to resolve the decompiled source of functions. */\n var funcToString = funcProto.toString;\n\n /** Used to check objects for own properties. */\n var hasOwnProperty = objectProto.hasOwnProperty;\n\n /** Used to generate unique IDs. */\n var idCounter = 0;\n\n /** Used to detect methods masquerading as native. */\n var maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n }());\n\n /**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\n var nativeObjectToString = objectProto.toString;\n\n /** Used to infer the `Object` constructor. */\n var objectCtorString = funcToString.call(Object);\n\n /** Used to restore the original `_` reference in `_.noConflict`. */\n var oldDash = root._;\n\n /** Used to detect if a method is native. */\n var reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n );\n\n /** Built-in value references. */\n var Buffer = moduleExports ? context.Buffer : undefined,\n Symbol = context.Symbol,\n Uint8Array = context.Uint8Array,\n allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,\n getPrototype = overArg(Object.getPrototypeOf, Object),\n objectCreate = Object.create,\n propertyIsEnumerable = objectProto.propertyIsEnumerable,\n splice = arrayProto.splice,\n spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,\n symIterator = Symbol ? Symbol.iterator : undefined,\n symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n var defineProperty = (function() {\n try {\n var func = getNative(Object, 'defineProperty');\n func({}, '', {});\n return func;\n } catch (e) {}\n }());\n\n /** Mocked built-ins. */\n var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,\n ctxNow = Date && Date.now !== root.Date.now && Date.now,\n ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;\n\n /* Built-in method references for those with the same name as other `lodash` methods. */\n var nativeCeil = Math.ceil,\n nativeFloor = Math.floor,\n nativeGetSymbols = Object.getOwnPropertySymbols,\n nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n nativeIsFinite = context.isFinite,\n nativeJoin = arrayProto.join,\n nativeKeys = overArg(Object.keys, Object),\n nativeMax = Math.max,\n nativeMin = Math.min,\n nativeNow = Date.now,\n nativeParseInt = context.parseInt,\n nativeRandom = Math.random,\n nativeReverse = arrayProto.reverse;\n\n /* Built-in method references that are verified to be native. */\n var DataView = getNative(context, 'DataView'),\n Map = getNative(context, 'Map'),\n Promise = getNative(context, 'Promise'),\n Set = getNative(context, 'Set'),\n WeakMap = getNative(context, 'WeakMap'),\n nativeCreate = getNative(Object, 'create');\n\n /** Used to store function metadata. */\n var metaMap = WeakMap && new WeakMap;\n\n /** Used to lookup unminified function names. */\n var realNames = {};\n\n /** Used to detect maps, sets, and weakmaps. */\n var dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n /** Used to convert symbols to primitives and strings. */\n var symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,\n symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` object which wraps `value` to enable implicit method\n * chain sequences. Methods that operate on and return arrays, collections,\n * and functions can be chained together. Methods that retrieve a single value\n * or may return a primitive value will automatically end the chain sequence\n * and return the unwrapped value. Otherwise, the value must be unwrapped\n * with `_#value`.\n *\n * Explicit chain sequences, which must be unwrapped with `_#value`, may be\n * enabled using `_.chain`.\n *\n * The execution of chained methods is lazy, that is, it's deferred until\n * `_#value` is implicitly or explicitly called.\n *\n * Lazy evaluation allows several methods to support shortcut fusion.\n * Shortcut fusion is an optimization to merge iteratee calls; this avoids\n * the creation of intermediate arrays and can greatly reduce the number of\n * iteratee executions. Sections of a chain sequence qualify for shortcut\n * fusion if the section is applied to an array and iteratees accept only\n * one argument. The heuristic for whether a section qualifies for shortcut\n * fusion is subject to change.\n *\n * Chaining is supported in custom builds as long as the `_#value` method is\n * directly or indirectly included in the build.\n *\n * In addition to lodash methods, wrappers have `Array` and `String` methods.\n *\n * The wrapper `Array` methods are:\n * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`\n *\n * The wrapper `String` methods are:\n * `replace` and `split`\n *\n * The wrapper methods that support shortcut fusion are:\n * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,\n * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,\n * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`\n *\n * The chainable wrapper methods are:\n * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,\n * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,\n * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,\n * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,\n * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,\n * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,\n * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,\n * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,\n * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,\n * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,\n * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,\n * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,\n * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,\n * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,\n * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,\n * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,\n * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,\n * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,\n * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,\n * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,\n * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,\n * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,\n * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,\n * `zipObject`, `zipObjectDeep`, and `zipWith`\n *\n * The wrapper methods that are **not** chainable by default are:\n * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,\n * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,\n * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,\n * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,\n * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,\n * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,\n * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,\n * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,\n * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,\n * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,\n * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,\n * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,\n * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,\n * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,\n * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,\n * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,\n * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,\n * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,\n * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,\n * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,\n * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,\n * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,\n * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,\n * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,\n * `upperFirst`, `value`, and `words`\n *\n * @name _\n * @constructor\n * @category Seq\n * @param {*} value The value to wrap in a `lodash` instance.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2, 3]);\n *\n * // Returns an unwrapped value.\n * wrapped.reduce(_.add);\n * // => 6\n *\n * // Returns a wrapped value.\n * var squares = wrapped.map(square);\n *\n * _.isArray(squares);\n * // => false\n *\n * _.isArray(squares.value());\n * // => true\n */\n function lodash(value) {\n if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {\n if (value instanceof LodashWrapper) {\n return value;\n }\n if (hasOwnProperty.call(value, '__wrapped__')) {\n return wrapperClone(value);\n }\n }\n return new LodashWrapper(value);\n }\n\n /**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} proto The object to inherit from.\n * @returns {Object} Returns the new object.\n */\n var baseCreate = (function() {\n function object() {}\n return function(proto) {\n if (!isObject(proto)) {\n return {};\n }\n if (objectCreate) {\n return objectCreate(proto);\n }\n object.prototype = proto;\n var result = new object;\n object.prototype = undefined;\n return result;\n };\n }());\n\n /**\n * The function whose prototype chain sequence wrappers inherit from.\n *\n * @private\n */\n function baseLodash() {\n // No operation performed.\n }\n\n /**\n * The base constructor for creating `lodash` wrapper objects.\n *\n * @private\n * @param {*} value The value to wrap.\n * @param {boolean} [chainAll] Enable explicit method chain sequences.\n */\n function LodashWrapper(value, chainAll) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__chain__ = !!chainAll;\n this.__index__ = 0;\n this.__values__ = undefined;\n }\n\n /**\n * By default, the template delimiters used by lodash are like those in\n * embedded Ruby (ERB) as well as ES2015 template strings. Change the\n * following template settings to use alternative delimiters.\n *\n * @static\n * @memberOf _\n * @type {Object}\n */\n lodash.templateSettings = {\n\n /**\n * Used to detect `data` property values to be HTML-escaped.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'escape': reEscape,\n\n /**\n * Used to detect code to be evaluated.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'evaluate': reEvaluate,\n\n /**\n * Used to detect `data` property values to inject.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'interpolate': reInterpolate,\n\n /**\n * Used to reference the data object in the template text.\n *\n * @memberOf _.templateSettings\n * @type {string}\n */\n 'variable': '',\n\n /**\n * Used to import variables into the compiled template.\n *\n * @memberOf _.templateSettings\n * @type {Object}\n */\n 'imports': {\n\n /**\n * A reference to the `lodash` function.\n *\n * @memberOf _.templateSettings.imports\n * @type {Function}\n */\n '_': lodash\n }\n };\n\n // Ensure wrappers are instances of `baseLodash`.\n lodash.prototype = baseLodash.prototype;\n lodash.prototype.constructor = lodash;\n\n LodashWrapper.prototype = baseCreate(baseLodash.prototype);\n LodashWrapper.prototype.constructor = LodashWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.\n *\n * @private\n * @constructor\n * @param {*} value The value to wrap.\n */\n function LazyWrapper(value) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__dir__ = 1;\n this.__filtered__ = false;\n this.__iteratees__ = [];\n this.__takeCount__ = MAX_ARRAY_LENGTH;\n this.__views__ = [];\n }\n\n /**\n * Creates a clone of the lazy wrapper object.\n *\n * @private\n * @name clone\n * @memberOf LazyWrapper\n * @returns {Object} Returns the cloned `LazyWrapper` object.\n */\n function lazyClone() {\n var result = new LazyWrapper(this.__wrapped__);\n result.__actions__ = copyArray(this.__actions__);\n result.__dir__ = this.__dir__;\n result.__filtered__ = this.__filtered__;\n result.__iteratees__ = copyArray(this.__iteratees__);\n result.__takeCount__ = this.__takeCount__;\n result.__views__ = copyArray(this.__views__);\n return result;\n }\n\n /**\n * Reverses the direction of lazy iteration.\n *\n * @private\n * @name reverse\n * @memberOf LazyWrapper\n * @returns {Object} Returns the new reversed `LazyWrapper` object.\n */\n function lazyReverse() {\n if (this.__filtered__) {\n var result = new LazyWrapper(this);\n result.__dir__ = -1;\n result.__filtered__ = true;\n } else {\n result = this.clone();\n result.__dir__ *= -1;\n }\n return result;\n }\n\n /**\n * Extracts the unwrapped value from its lazy wrapper.\n *\n * @private\n * @name value\n * @memberOf LazyWrapper\n * @returns {*} Returns the unwrapped value.\n */\n function lazyValue() {\n var array = this.__wrapped__.value(),\n dir = this.__dir__,\n isArr = isArray(array),\n isRight = dir < 0,\n arrLength = isArr ? array.length : 0,\n view = getView(0, arrLength, this.__views__),\n start = view.start,\n end = view.end,\n length = end - start,\n index = isRight ? end : (start - 1),\n iteratees = this.__iteratees__,\n iterLength = iteratees.length,\n resIndex = 0,\n takeCount = nativeMin(length, this.__takeCount__);\n\n if (!isArr || (!isRight && arrLength == length && takeCount == length)) {\n return baseWrapperValue(array, this.__actions__);\n }\n var result = [];\n\n outer:\n while (length-- && resIndex < takeCount) {\n index += dir;\n\n var iterIndex = -1,\n value = array[index];\n\n while (++iterIndex < iterLength) {\n var data = iteratees[iterIndex],\n iteratee = data.iteratee,\n type = data.type,\n computed = iteratee(value);\n\n if (type == LAZY_MAP_FLAG) {\n value = computed;\n } else if (!computed) {\n if (type == LAZY_FILTER_FLAG) {\n continue outer;\n } else {\n break outer;\n }\n }\n }\n result[resIndex++] = value;\n }\n return result;\n }\n\n // Ensure `LazyWrapper` is an instance of `baseLodash`.\n LazyWrapper.prototype = baseCreate(baseLodash.prototype);\n LazyWrapper.prototype.constructor = LazyWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\n function hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n }\n\n /**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n }\n\n /**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\n function hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n }\n\n // Add methods to `Hash`.\n Hash.prototype.clear = hashClear;\n Hash.prototype['delete'] = hashDelete;\n Hash.prototype.get = hashGet;\n Hash.prototype.has = hashHas;\n Hash.prototype.set = hashSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\n function listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n }\n\n /**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n }\n\n /**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n }\n\n /**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\n function listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n }\n\n // Add methods to `ListCache`.\n ListCache.prototype.clear = listCacheClear;\n ListCache.prototype['delete'] = listCacheDelete;\n ListCache.prototype.get = listCacheGet;\n ListCache.prototype.has = listCacheHas;\n ListCache.prototype.set = listCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\n function mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n }\n\n /**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function mapCacheGet(key) {\n return getMapData(this, key).get(key);\n }\n\n /**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function mapCacheHas(key) {\n return getMapData(this, key).has(key);\n }\n\n /**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\n function mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n }\n\n // Add methods to `MapCache`.\n MapCache.prototype.clear = mapCacheClear;\n MapCache.prototype['delete'] = mapCacheDelete;\n MapCache.prototype.get = mapCacheGet;\n MapCache.prototype.has = mapCacheHas;\n MapCache.prototype.set = mapCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\n function SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n }\n\n /**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\n function setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n }\n\n /**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\n function setCacheHas(value) {\n return this.__data__.has(value);\n }\n\n // Add methods to `SetCache`.\n SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\n SetCache.prototype.has = setCacheHas;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n }\n\n /**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\n function stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n }\n\n /**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function stackGet(key) {\n return this.__data__.get(key);\n }\n\n /**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function stackHas(key) {\n return this.__data__.has(key);\n }\n\n /**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\n function stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n }\n\n // Add methods to `Stack`.\n Stack.prototype.clear = stackClear;\n Stack.prototype['delete'] = stackDelete;\n Stack.prototype.get = stackGet;\n Stack.prototype.has = stackHas;\n Stack.prototype.set = stackSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\n function arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.sample` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @returns {*} Returns the random element.\n */\n function arraySample(array) {\n var length = array.length;\n return length ? array[baseRandom(0, length - 1)] : undefined;\n }\n\n /**\n * A specialized version of `_.sampleSize` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function arraySampleSize(array, n) {\n return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));\n }\n\n /**\n * A specialized version of `_.shuffle` for arrays.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function arrayShuffle(array) {\n return shuffleSelf(copyArray(array));\n }\n\n /**\n * This function is like `assignValue` except that it doesn't assign\n * `undefined` values.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignMergeValue(object, key, value) {\n if ((value !== undefined && !eq(object[key], value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignValue(object, key, value) {\n var objValue = object[key];\n if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n }\n\n /**\n * Aggregates elements of `collection` on `accumulator` with keys transformed\n * by `iteratee` and values set by `setter`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseAggregator(collection, setter, iteratee, accumulator) {\n baseEach(collection, function(value, key, collection) {\n setter(accumulator, value, iteratee(value), collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssign(object, source) {\n return object && copyObject(source, keys(source), object);\n }\n\n /**\n * The base implementation of `_.assignIn` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssignIn(object, source) {\n return object && copyObject(source, keysIn(source), object);\n }\n\n /**\n * The base implementation of `assignValue` and `assignMergeValue` without\n * value checks.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function baseAssignValue(object, key, value) {\n if (key == '__proto__' && defineProperty) {\n defineProperty(object, key, {\n 'configurable': true,\n 'enumerable': true,\n 'value': value,\n 'writable': true\n });\n } else {\n object[key] = value;\n }\n }\n\n /**\n * The base implementation of `_.at` without support for individual paths.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {string[]} paths The property paths to pick.\n * @returns {Array} Returns the picked elements.\n */\n function baseAt(object, paths) {\n var index = -1,\n length = paths.length,\n result = Array(length),\n skip = object == null;\n\n while (++index < length) {\n result[index] = skip ? undefined : get(object, paths[index]);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.clamp` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n */\n function baseClamp(number, lower, upper) {\n if (number === number) {\n if (upper !== undefined) {\n number = number <= upper ? number : upper;\n }\n if (lower !== undefined) {\n number = number >= lower ? number : lower;\n }\n }\n return number;\n }\n\n /**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Deep clone\n * 2 - Flatten inherited properties\n * 4 - Clone symbols\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\n function baseClone(value, bitmask, customizer, key, object, stack) {\n var result,\n isDeep = bitmask & CLONE_DEEP_FLAG,\n isFlat = bitmask & CLONE_FLAT_FLAG,\n isFull = bitmask & CLONE_SYMBOLS_FLAG;\n\n if (customizer) {\n result = object ? customizer(value, key, object, stack) : customizer(value);\n }\n if (result !== undefined) {\n return result;\n }\n if (!isObject(value)) {\n return value;\n }\n var isArr = isArray(value);\n if (isArr) {\n result = initCloneArray(value);\n if (!isDeep) {\n return copyArray(value, result);\n }\n } else {\n var tag = getTag(value),\n isFunc = tag == funcTag || tag == genTag;\n\n if (isBuffer(value)) {\n return cloneBuffer(value, isDeep);\n }\n if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n result = (isFlat || isFunc) ? {} : initCloneObject(value);\n if (!isDeep) {\n return isFlat\n ? copySymbolsIn(value, baseAssignIn(result, value))\n : copySymbols(value, baseAssign(result, value));\n }\n } else {\n if (!cloneableTags[tag]) {\n return object ? value : {};\n }\n result = initCloneByTag(value, tag, isDeep);\n }\n }\n // Check for circular references and return its corresponding clone.\n stack || (stack = new Stack);\n var stacked = stack.get(value);\n if (stacked) {\n return stacked;\n }\n stack.set(value, result);\n\n if (isSet(value)) {\n value.forEach(function(subValue) {\n result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));\n });\n } else if (isMap(value)) {\n value.forEach(function(subValue, key) {\n result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n }\n\n var keysFunc = isFull\n ? (isFlat ? getAllKeysIn : getAllKeys)\n : (isFlat ? keysIn : keys);\n\n var props = isArr ? undefined : keysFunc(value);\n arrayEach(props || value, function(subValue, key) {\n if (props) {\n key = subValue;\n subValue = value[key];\n }\n // Recursively populate clone (susceptible to call stack limits).\n assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n return result;\n }\n\n /**\n * The base implementation of `_.conforms` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n */\n function baseConforms(source) {\n var props = keys(source);\n return function(object) {\n return baseConformsTo(object, source, props);\n };\n }\n\n /**\n * The base implementation of `_.conformsTo` which accepts `props` to check.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n */\n function baseConformsTo(object, source, props) {\n var length = props.length;\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (length--) {\n var key = props[length],\n predicate = source[key],\n value = object[key];\n\n if ((value === undefined && !(key in object)) || !predicate(value)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.delay` and `_.defer` which accepts `args`\n * to provide to `func`.\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {Array} args The arguments to provide to `func`.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n function baseDelay(func, wait, args) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return setTimeout(function() { func.apply(undefined, args); }, wait);\n }\n\n /**\n * The base implementation of methods like `_.difference` without support\n * for excluding multiple arrays or iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Array} values The values to exclude.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n */\n function baseDifference(array, values, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n isCommon = true,\n length = array.length,\n result = [],\n valuesLength = values.length;\n\n if (!length) {\n return result;\n }\n if (iteratee) {\n values = arrayMap(values, baseUnary(iteratee));\n }\n if (comparator) {\n includes = arrayIncludesWith;\n isCommon = false;\n }\n else if (values.length >= LARGE_ARRAY_SIZE) {\n includes = cacheHas;\n isCommon = false;\n values = new SetCache(values);\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee == null ? value : iteratee(value);\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var valuesIndex = valuesLength;\n while (valuesIndex--) {\n if (values[valuesIndex] === computed) {\n continue outer;\n }\n }\n result.push(value);\n }\n else if (!includes(values, computed, comparator)) {\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEach = createBaseEach(baseForOwn);\n\n /**\n * The base implementation of `_.forEachRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEachRight = createBaseEach(baseForOwnRight, true);\n\n /**\n * The base implementation of `_.every` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`\n */\n function baseEvery(collection, predicate) {\n var result = true;\n baseEach(collection, function(value, index, collection) {\n result = !!predicate(value, index, collection);\n return result;\n });\n return result;\n }\n\n /**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\n function baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.fill` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n */\n function baseFill(array, value, start, end) {\n var length = array.length;\n\n start = toInteger(start);\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = (end === undefined || end > length) ? length : toInteger(end);\n if (end < 0) {\n end += length;\n }\n end = start > end ? 0 : toLength(end);\n while (start < end) {\n array[start++] = value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.filter` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function baseFilter(collection, predicate) {\n var result = [];\n baseEach(collection, function(value, index, collection) {\n if (predicate(value, index, collection)) {\n result.push(value);\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.flatten` with support for restricting flattening.\n *\n * @private\n * @param {Array} array The array to flatten.\n * @param {number} depth The maximum recursion depth.\n * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.\n * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.\n * @param {Array} [result=[]] The initial result value.\n * @returns {Array} Returns the new flattened array.\n */\n function baseFlatten(array, depth, predicate, isStrict, result) {\n var index = -1,\n length = array.length;\n\n predicate || (predicate = isFlattenable);\n result || (result = []);\n\n while (++index < length) {\n var value = array[index];\n if (depth > 0 && predicate(value)) {\n if (depth > 1) {\n // Recursively flatten arrays (susceptible to call stack limits).\n baseFlatten(value, depth - 1, predicate, isStrict, result);\n } else {\n arrayPush(result, value);\n }\n } else if (!isStrict) {\n result[result.length] = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `baseForOwn` which iterates over `object`\n * properties returned by `keysFunc` and invokes `iteratee` for each property.\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseFor = createBaseFor();\n\n /**\n * This function is like `baseFor` except that it iterates over properties\n * in the opposite order.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseForRight = createBaseFor(true);\n\n /**\n * The base implementation of `_.forOwn` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwn(object, iteratee) {\n return object && baseFor(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.forOwnRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwnRight(object, iteratee) {\n return object && baseForRight(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.functions` which creates an array of\n * `object` function property names filtered from `props`.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Array} props The property names to filter.\n * @returns {Array} Returns the function names.\n */\n function baseFunctions(object, props) {\n return arrayFilter(props, function(key) {\n return isFunction(object[key]);\n });\n }\n\n /**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\n function baseGet(object, path) {\n path = castPath(path, object);\n\n var index = 0,\n length = path.length;\n\n while (object != null && index < length) {\n object = object[toKey(path[index++])];\n }\n return (index && index == length) ? object : undefined;\n }\n\n /**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n }\n\n /**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n function baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n }\n\n /**\n * The base implementation of `_.gt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n */\n function baseGt(value, other) {\n return value > other;\n }\n\n /**\n * The base implementation of `_.has` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHas(object, key) {\n return object != null && hasOwnProperty.call(object, key);\n }\n\n /**\n * The base implementation of `_.hasIn` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHasIn(object, key) {\n return object != null && key in Object(object);\n }\n\n /**\n * The base implementation of `_.inRange` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to check.\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n */\n function baseInRange(number, start, end) {\n return number >= nativeMin(start, end) && number < nativeMax(start, end);\n }\n\n /**\n * The base implementation of methods like `_.intersection`, without support\n * for iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of shared values.\n */\n function baseIntersection(arrays, iteratee, comparator) {\n var includes = comparator ? arrayIncludesWith : arrayIncludes,\n length = arrays[0].length,\n othLength = arrays.length,\n othIndex = othLength,\n caches = Array(othLength),\n maxLength = Infinity,\n result = [];\n\n while (othIndex--) {\n var array = arrays[othIndex];\n if (othIndex && iteratee) {\n array = arrayMap(array, baseUnary(iteratee));\n }\n maxLength = nativeMin(array.length, maxLength);\n caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))\n ? new SetCache(othIndex && array)\n : undefined;\n }\n array = arrays[0];\n\n var index = -1,\n seen = caches[0];\n\n outer:\n while (++index < length && result.length < maxLength) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (!(seen\n ? cacheHas(seen, computed)\n : includes(result, computed, comparator)\n )) {\n othIndex = othLength;\n while (--othIndex) {\n var cache = caches[othIndex];\n if (!(cache\n ? cacheHas(cache, computed)\n : includes(arrays[othIndex], computed, comparator))\n ) {\n continue outer;\n }\n }\n if (seen) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.invert` and `_.invertBy` which inverts\n * `object` with values transformed by `iteratee` and set by `setter`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform values.\n * @param {Object} accumulator The initial inverted object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseInverter(object, setter, iteratee, accumulator) {\n baseForOwn(object, function(value, key, object) {\n setter(accumulator, iteratee(value), key, object);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.invoke` without support for individual\n * method arguments.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {Array} args The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n */\n function baseInvoke(object, path, args) {\n path = castPath(path, object);\n object = parent(object, path);\n var func = object == null ? object : object[toKey(last(path))];\n return func == null ? undefined : apply(func, object, args);\n }\n\n /**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\n function baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n }\n\n /**\n * The base implementation of `_.isArrayBuffer` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n */\n function baseIsArrayBuffer(value) {\n return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;\n }\n\n /**\n * The base implementation of `_.isDate` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n */\n function baseIsDate(value) {\n return isObjectLike(value) && baseGetTag(value) == dateTag;\n }\n\n /**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\n function baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n }\n\n /**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n }\n\n /**\n * The base implementation of `_.isMap` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n */\n function baseIsMap(value) {\n return isObjectLike(value) && getTag(value) == mapTag;\n }\n\n /**\n * The base implementation of `_.isMatch` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Array} matchData The property names, values, and compare flags to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n */\n function baseIsMatch(object, source, matchData, customizer) {\n var index = matchData.length,\n length = index,\n noCustomizer = !customizer;\n\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (index--) {\n var data = matchData[index];\n if ((noCustomizer && data[2])\n ? data[1] !== object[data[0]]\n : !(data[0] in object)\n ) {\n return false;\n }\n }\n while (++index < length) {\n data = matchData[index];\n var key = data[0],\n objValue = object[key],\n srcValue = data[1];\n\n if (noCustomizer && data[2]) {\n if (objValue === undefined && !(key in object)) {\n return false;\n }\n } else {\n var stack = new Stack;\n if (customizer) {\n var result = customizer(objValue, srcValue, key, object, source, stack);\n }\n if (!(result === undefined\n ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)\n : result\n )) {\n return false;\n }\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\n function baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n }\n\n /**\n * The base implementation of `_.isRegExp` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n */\n function baseIsRegExp(value) {\n return isObjectLike(value) && baseGetTag(value) == regexpTag;\n }\n\n /**\n * The base implementation of `_.isSet` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n */\n function baseIsSet(value) {\n return isObjectLike(value) && getTag(value) == setTag;\n }\n\n /**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\n function baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n }\n\n /**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\n function baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n }\n\n /**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeysIn(object) {\n if (!isObject(object)) {\n return nativeKeysIn(object);\n }\n var isProto = isPrototype(object),\n result = [];\n\n for (var key in object) {\n if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.lt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n */\n function baseLt(value, other) {\n return value < other;\n }\n\n /**\n * The base implementation of `_.map` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function baseMap(collection, iteratee) {\n var index = -1,\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value, key, collection) {\n result[++index] = iteratee(value, key, collection);\n });\n return result;\n }\n\n /**\n * The base implementation of `_.matches` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatches(source) {\n var matchData = getMatchData(source);\n if (matchData.length == 1 && matchData[0][2]) {\n return matchesStrictComparable(matchData[0][0], matchData[0][1]);\n }\n return function(object) {\n return object === source || baseIsMatch(object, source, matchData);\n };\n }\n\n /**\n * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.\n *\n * @private\n * @param {string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatchesProperty(path, srcValue) {\n if (isKey(path) && isStrictComparable(srcValue)) {\n return matchesStrictComparable(toKey(path), srcValue);\n }\n return function(object) {\n var objValue = get(object, path);\n return (objValue === undefined && objValue === srcValue)\n ? hasIn(object, path)\n : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);\n };\n }\n\n /**\n * The base implementation of `_.merge` without support for multiple sources.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} [customizer] The function to customize merged values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMerge(object, source, srcIndex, customizer, stack) {\n if (object === source) {\n return;\n }\n baseFor(source, function(srcValue, key) {\n stack || (stack = new Stack);\n if (isObject(srcValue)) {\n baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);\n }\n else {\n var newValue = customizer\n ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)\n : undefined;\n\n if (newValue === undefined) {\n newValue = srcValue;\n }\n assignMergeValue(object, key, newValue);\n }\n }, keysIn);\n }\n\n /**\n * A specialized version of `baseMerge` for arrays and objects which performs\n * deep merges and tracks traversed objects enabling objects with circular\n * references to be merged.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {string} key The key of the value to merge.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} mergeFunc The function to merge values.\n * @param {Function} [customizer] The function to customize assigned values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {\n var objValue = safeGet(object, key),\n srcValue = safeGet(source, key),\n stacked = stack.get(srcValue);\n\n if (stacked) {\n assignMergeValue(object, key, stacked);\n return;\n }\n var newValue = customizer\n ? customizer(objValue, srcValue, (key + ''), object, source, stack)\n : undefined;\n\n var isCommon = newValue === undefined;\n\n if (isCommon) {\n var isArr = isArray(srcValue),\n isBuff = !isArr && isBuffer(srcValue),\n isTyped = !isArr && !isBuff && isTypedArray(srcValue);\n\n newValue = srcValue;\n if (isArr || isBuff || isTyped) {\n if (isArray(objValue)) {\n newValue = objValue;\n }\n else if (isArrayLikeObject(objValue)) {\n newValue = copyArray(objValue);\n }\n else if (isBuff) {\n isCommon = false;\n newValue = cloneBuffer(srcValue, true);\n }\n else if (isTyped) {\n isCommon = false;\n newValue = cloneTypedArray(srcValue, true);\n }\n else {\n newValue = [];\n }\n }\n else if (isPlainObject(srcValue) || isArguments(srcValue)) {\n newValue = objValue;\n if (isArguments(objValue)) {\n newValue = toPlainObject(objValue);\n }\n else if (!isObject(objValue) || isFunction(objValue)) {\n newValue = initCloneObject(srcValue);\n }\n }\n else {\n isCommon = false;\n }\n }\n if (isCommon) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, newValue);\n mergeFunc(newValue, srcValue, srcIndex, customizer, stack);\n stack['delete'](srcValue);\n }\n assignMergeValue(object, key, newValue);\n }\n\n /**\n * The base implementation of `_.nth` which doesn't coerce arguments.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {number} n The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n */\n function baseNth(array, n) {\n var length = array.length;\n if (!length) {\n return;\n }\n n += n < 0 ? length : 0;\n return isIndex(n, length) ? array[n] : undefined;\n }\n\n /**\n * The base implementation of `_.orderBy` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.\n * @param {string[]} orders The sort orders of `iteratees`.\n * @returns {Array} Returns the new sorted array.\n */\n function baseOrderBy(collection, iteratees, orders) {\n var index = -1;\n iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));\n\n var result = baseMap(collection, function(value, key, collection) {\n var criteria = arrayMap(iteratees, function(iteratee) {\n return iteratee(value);\n });\n return { 'criteria': criteria, 'index': ++index, 'value': value };\n });\n\n return baseSortBy(result, function(object, other) {\n return compareMultiple(object, other, orders);\n });\n }\n\n /**\n * The base implementation of `_.pick` without support for individual\n * property identifiers.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @returns {Object} Returns the new object.\n */\n function basePick(object, paths) {\n return basePickBy(object, paths, function(value, path) {\n return hasIn(object, path);\n });\n }\n\n /**\n * The base implementation of `_.pickBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @param {Function} predicate The function invoked per property.\n * @returns {Object} Returns the new object.\n */\n function basePickBy(object, paths, predicate) {\n var index = -1,\n length = paths.length,\n result = {};\n\n while (++index < length) {\n var path = paths[index],\n value = baseGet(object, path);\n\n if (predicate(value, path)) {\n baseSet(result, castPath(path, object), value);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `baseProperty` which supports deep paths.\n *\n * @private\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyDeep(path) {\n return function(object) {\n return baseGet(object, path);\n };\n }\n\n /**\n * The base implementation of `_.pullAllBy` without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n */\n function basePullAll(array, values, iteratee, comparator) {\n var indexOf = comparator ? baseIndexOfWith : baseIndexOf,\n index = -1,\n length = values.length,\n seen = array;\n\n if (array === values) {\n values = copyArray(values);\n }\n if (iteratee) {\n seen = arrayMap(array, baseUnary(iteratee));\n }\n while (++index < length) {\n var fromIndex = 0,\n value = values[index],\n computed = iteratee ? iteratee(value) : value;\n\n while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {\n if (seen !== array) {\n splice.call(seen, fromIndex, 1);\n }\n splice.call(array, fromIndex, 1);\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.pullAt` without support for individual\n * indexes or capturing the removed elements.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {number[]} indexes The indexes of elements to remove.\n * @returns {Array} Returns `array`.\n */\n function basePullAt(array, indexes) {\n var length = array ? indexes.length : 0,\n lastIndex = length - 1;\n\n while (length--) {\n var index = indexes[length];\n if (length == lastIndex || index !== previous) {\n var previous = index;\n if (isIndex(index)) {\n splice.call(array, index, 1);\n } else {\n baseUnset(array, index);\n }\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.random` without support for returning\n * floating-point numbers.\n *\n * @private\n * @param {number} lower The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the random number.\n */\n function baseRandom(lower, upper) {\n return lower + nativeFloor(nativeRandom() * (upper - lower + 1));\n }\n\n /**\n * The base implementation of `_.range` and `_.rangeRight` which doesn't\n * coerce arguments.\n *\n * @private\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @param {number} step The value to increment or decrement by.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the range of numbers.\n */\n function baseRange(start, end, step, fromRight) {\n var index = -1,\n length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),\n result = Array(length);\n\n while (length--) {\n result[fromRight ? length : ++index] = start;\n start += step;\n }\n return result;\n }\n\n /**\n * The base implementation of `_.repeat` which doesn't coerce arguments.\n *\n * @private\n * @param {string} string The string to repeat.\n * @param {number} n The number of times to repeat the string.\n * @returns {string} Returns the repeated string.\n */\n function baseRepeat(string, n) {\n var result = '';\n if (!string || n < 1 || n > MAX_SAFE_INTEGER) {\n return result;\n }\n // Leverage the exponentiation by squaring algorithm for a faster repeat.\n // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.\n do {\n if (n % 2) {\n result += string;\n }\n n = nativeFloor(n / 2);\n if (n) {\n string += string;\n }\n } while (n);\n\n return result;\n }\n\n /**\n * The base implementation of `_.rest` which doesn't validate or coerce arguments.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n */\n function baseRest(func, start) {\n return setToString(overRest(func, start, identity), func + '');\n }\n\n /**\n * The base implementation of `_.sample`.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n */\n function baseSample(collection) {\n return arraySample(values(collection));\n }\n\n /**\n * The base implementation of `_.sampleSize` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function baseSampleSize(collection, n) {\n var array = values(collection);\n return shuffleSelf(array, baseClamp(n, 0, array.length));\n }\n\n /**\n * The base implementation of `_.set`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseSet(object, path, value, customizer) {\n if (!isObject(object)) {\n return object;\n }\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n nested = object;\n\n while (nested != null && ++index < length) {\n var key = toKey(path[index]),\n newValue = value;\n\n if (index != lastIndex) {\n var objValue = nested[key];\n newValue = customizer ? customizer(objValue, key, nested) : undefined;\n if (newValue === undefined) {\n newValue = isObject(objValue)\n ? objValue\n : (isIndex(path[index + 1]) ? [] : {});\n }\n }\n assignValue(nested, key, newValue);\n nested = nested[key];\n }\n return object;\n }\n\n /**\n * The base implementation of `setData` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var baseSetData = !metaMap ? identity : function(func, data) {\n metaMap.set(func, data);\n return func;\n };\n\n /**\n * The base implementation of `setToString` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var baseSetToString = !defineProperty ? identity : function(func, string) {\n return defineProperty(func, 'toString', {\n 'configurable': true,\n 'enumerable': false,\n 'value': constant(string),\n 'writable': true\n });\n };\n\n /**\n * The base implementation of `_.shuffle`.\n *\n * @private\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function baseShuffle(collection) {\n return shuffleSelf(values(collection));\n }\n\n /**\n * The base implementation of `_.slice` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseSlice(array, start, end) {\n var index = -1,\n length = array.length;\n\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = end > length ? length : end;\n if (end < 0) {\n end += length;\n }\n length = start > end ? 0 : ((end - start) >>> 0);\n start >>>= 0;\n\n var result = Array(length);\n while (++index < length) {\n result[index] = array[index + start];\n }\n return result;\n }\n\n /**\n * The base implementation of `_.some` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function baseSome(collection, predicate) {\n var result;\n\n baseEach(collection, function(value, index, collection) {\n result = predicate(value, index, collection);\n return !result;\n });\n return !!result;\n }\n\n /**\n * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which\n * performs a binary search of `array` to determine the index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndex(array, value, retHighest) {\n var low = 0,\n high = array == null ? low : array.length;\n\n if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {\n while (low < high) {\n var mid = (low + high) >>> 1,\n computed = array[mid];\n\n if (computed !== null && !isSymbol(computed) &&\n (retHighest ? (computed <= value) : (computed < value))) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return high;\n }\n return baseSortedIndexBy(array, value, identity, retHighest);\n }\n\n /**\n * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`\n * which invokes `iteratee` for `value` and each element of `array` to compute\n * their sort ranking. The iteratee is invoked with one argument; (value).\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} iteratee The iteratee invoked per element.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndexBy(array, value, iteratee, retHighest) {\n value = iteratee(value);\n\n var low = 0,\n high = array == null ? 0 : array.length,\n valIsNaN = value !== value,\n valIsNull = value === null,\n valIsSymbol = isSymbol(value),\n valIsUndefined = value === undefined;\n\n while (low < high) {\n var mid = nativeFloor((low + high) / 2),\n computed = iteratee(array[mid]),\n othIsDefined = computed !== undefined,\n othIsNull = computed === null,\n othIsReflexive = computed === computed,\n othIsSymbol = isSymbol(computed);\n\n if (valIsNaN) {\n var setLow = retHighest || othIsReflexive;\n } else if (valIsUndefined) {\n setLow = othIsReflexive && (retHighest || othIsDefined);\n } else if (valIsNull) {\n setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);\n } else if (valIsSymbol) {\n setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);\n } else if (othIsNull || othIsSymbol) {\n setLow = false;\n } else {\n setLow = retHighest ? (computed <= value) : (computed < value);\n }\n if (setLow) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return nativeMin(high, MAX_ARRAY_INDEX);\n }\n\n /**\n * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseSortedUniq(array, iteratee) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n if (!index || !eq(computed, seen)) {\n var seen = computed;\n result[resIndex++] = value === 0 ? 0 : value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toNumber` which doesn't ensure correct\n * conversions of binary, hexadecimal, or octal string values.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n */\n function baseToNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n return +value;\n }\n\n /**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\n function baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n if (isArray(value)) {\n // Recursively convert values (susceptible to call stack limits).\n return arrayMap(value, baseToString) + '';\n }\n if (isSymbol(value)) {\n return symbolToString ? symbolToString.call(value) : '';\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * The base implementation of `_.uniqBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseUniq(array, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n length = array.length,\n isCommon = true,\n result = [],\n seen = result;\n\n if (comparator) {\n isCommon = false;\n includes = arrayIncludesWith;\n }\n else if (length >= LARGE_ARRAY_SIZE) {\n var set = iteratee ? null : createSet(array);\n if (set) {\n return setToArray(set);\n }\n isCommon = false;\n includes = cacheHas;\n seen = new SetCache;\n }\n else {\n seen = iteratee ? [] : result;\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var seenIndex = seen.length;\n while (seenIndex--) {\n if (seen[seenIndex] === computed) {\n continue outer;\n }\n }\n if (iteratee) {\n seen.push(computed);\n }\n result.push(value);\n }\n else if (!includes(seen, computed, comparator)) {\n if (seen !== result) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.unset`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The property path to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n */\n function baseUnset(object, path) {\n path = castPath(path, object);\n object = parent(object, path);\n return object == null || delete object[toKey(last(path))];\n }\n\n /**\n * The base implementation of `_.update`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to update.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseUpdate(object, path, updater, customizer) {\n return baseSet(object, path, updater(baseGet(object, path)), customizer);\n }\n\n /**\n * The base implementation of methods like `_.dropWhile` and `_.takeWhile`\n * without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {Function} predicate The function invoked per iteration.\n * @param {boolean} [isDrop] Specify dropping elements instead of taking them.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseWhile(array, predicate, isDrop, fromRight) {\n var length = array.length,\n index = fromRight ? length : -1;\n\n while ((fromRight ? index-- : ++index < length) &&\n predicate(array[index], index, array)) {}\n\n return isDrop\n ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))\n : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));\n }\n\n /**\n * The base implementation of `wrapperValue` which returns the result of\n * performing a sequence of actions on the unwrapped `value`, where each\n * successive action is supplied the return value of the previous.\n *\n * @private\n * @param {*} value The unwrapped value.\n * @param {Array} actions Actions to perform to resolve the unwrapped value.\n * @returns {*} Returns the resolved value.\n */\n function baseWrapperValue(value, actions) {\n var result = value;\n if (result instanceof LazyWrapper) {\n result = result.value();\n }\n return arrayReduce(actions, function(result, action) {\n return action.func.apply(action.thisArg, arrayPush([result], action.args));\n }, result);\n }\n\n /**\n * The base implementation of methods like `_.xor`, without support for\n * iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of values.\n */\n function baseXor(arrays, iteratee, comparator) {\n var length = arrays.length;\n if (length < 2) {\n return length ? baseUniq(arrays[0]) : [];\n }\n var index = -1,\n result = Array(length);\n\n while (++index < length) {\n var array = arrays[index],\n othIndex = -1;\n\n while (++othIndex < length) {\n if (othIndex != index) {\n result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);\n }\n }\n }\n return baseUniq(baseFlatten(result, 1), iteratee, comparator);\n }\n\n /**\n * This base implementation of `_.zipObject` which assigns values using `assignFunc`.\n *\n * @private\n * @param {Array} props The property identifiers.\n * @param {Array} values The property values.\n * @param {Function} assignFunc The function to assign values.\n * @returns {Object} Returns the new object.\n */\n function baseZipObject(props, values, assignFunc) {\n var index = -1,\n length = props.length,\n valsLength = values.length,\n result = {};\n\n while (++index < length) {\n var value = index < valsLength ? values[index] : undefined;\n assignFunc(result, props[index], value);\n }\n return result;\n }\n\n /**\n * Casts `value` to an empty array if it's not an array like object.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array|Object} Returns the cast array-like object.\n */\n function castArrayLikeObject(value) {\n return isArrayLikeObject(value) ? value : [];\n }\n\n /**\n * Casts `value` to `identity` if it's not a function.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Function} Returns cast function.\n */\n function castFunction(value) {\n return typeof value == 'function' ? value : identity;\n }\n\n /**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {Object} [object] The object to query keys on.\n * @returns {Array} Returns the cast property path array.\n */\n function castPath(value, object) {\n if (isArray(value)) {\n return value;\n }\n return isKey(value, object) ? [value] : stringToPath(toString(value));\n }\n\n /**\n * A `baseRest` alias which can be replaced with `identity` by module\n * replacement plugins.\n *\n * @private\n * @type {Function}\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n var castRest = baseRest;\n\n /**\n * Casts `array` to a slice if it's needed.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {number} start The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the cast slice.\n */\n function castSlice(array, start, end) {\n var length = array.length;\n end = end === undefined ? length : end;\n return (!start && end >= length) ? array : baseSlice(array, start, end);\n }\n\n /**\n * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).\n *\n * @private\n * @param {number|Object} id The timer id or timeout object of the timer to clear.\n */\n var clearTimeout = ctxClearTimeout || function(id) {\n return root.clearTimeout(id);\n };\n\n /**\n * Creates a clone of `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\n function cloneBuffer(buffer, isDeep) {\n if (isDeep) {\n return buffer.slice();\n }\n var length = buffer.length,\n result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);\n\n buffer.copy(result);\n return result;\n }\n\n /**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\n function cloneArrayBuffer(arrayBuffer) {\n var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n return result;\n }\n\n /**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\n function cloneDataView(dataView, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n }\n\n /**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\n function cloneRegExp(regexp) {\n var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n result.lastIndex = regexp.lastIndex;\n return result;\n }\n\n /**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\n function cloneSymbol(symbol) {\n return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n }\n\n /**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\n function cloneTypedArray(typedArray, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n }\n\n /**\n * Compares values to sort them in ascending order.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {number} Returns the sort order indicator for `value`.\n */\n function compareAscending(value, other) {\n if (value !== other) {\n var valIsDefined = value !== undefined,\n valIsNull = value === null,\n valIsReflexive = value === value,\n valIsSymbol = isSymbol(value);\n\n var othIsDefined = other !== undefined,\n othIsNull = other === null,\n othIsReflexive = other === other,\n othIsSymbol = isSymbol(other);\n\n if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||\n (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||\n (valIsNull && othIsDefined && othIsReflexive) ||\n (!valIsDefined && othIsReflexive) ||\n !valIsReflexive) {\n return 1;\n }\n if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||\n (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||\n (othIsNull && valIsDefined && valIsReflexive) ||\n (!othIsDefined && valIsReflexive) ||\n !othIsReflexive) {\n return -1;\n }\n }\n return 0;\n }\n\n /**\n * Used by `_.orderBy` to compare multiple properties of a value to another\n * and stable sort them.\n *\n * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,\n * specify an order of \"desc\" for descending or \"asc\" for ascending sort order\n * of corresponding values.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {boolean[]|string[]} orders The order to sort by for each property.\n * @returns {number} Returns the sort order indicator for `object`.\n */\n function compareMultiple(object, other, orders) {\n var index = -1,\n objCriteria = object.criteria,\n othCriteria = other.criteria,\n length = objCriteria.length,\n ordersLength = orders.length;\n\n while (++index < length) {\n var result = compareAscending(objCriteria[index], othCriteria[index]);\n if (result) {\n if (index >= ordersLength) {\n return result;\n }\n var order = orders[index];\n return result * (order == 'desc' ? -1 : 1);\n }\n }\n // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications\n // that causes it, under certain circumstances, to provide the same value for\n // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247\n // for more details.\n //\n // This also ensures a stable sort in V8 and other engines.\n // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.\n return object.index - other.index;\n }\n\n /**\n * Creates an array that is the composition of partially applied arguments,\n * placeholders, and provided arguments into a single array of arguments.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to prepend to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgs(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersLength = holders.length,\n leftIndex = -1,\n leftLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(leftLength + rangeLength),\n isUncurried = !isCurried;\n\n while (++leftIndex < leftLength) {\n result[leftIndex] = partials[leftIndex];\n }\n while (++argsIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[holders[argsIndex]] = args[argsIndex];\n }\n }\n while (rangeLength--) {\n result[leftIndex++] = args[argsIndex++];\n }\n return result;\n }\n\n /**\n * This function is like `composeArgs` except that the arguments composition\n * is tailored for `_.partialRight`.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to append to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgsRight(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersIndex = -1,\n holdersLength = holders.length,\n rightIndex = -1,\n rightLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(rangeLength + rightLength),\n isUncurried = !isCurried;\n\n while (++argsIndex < rangeLength) {\n result[argsIndex] = args[argsIndex];\n }\n var offset = argsIndex;\n while (++rightIndex < rightLength) {\n result[offset + rightIndex] = partials[rightIndex];\n }\n while (++holdersIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[offset + holders[holdersIndex]] = args[argsIndex++];\n }\n }\n return result;\n }\n\n /**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\n function copyArray(source, array) {\n var index = -1,\n length = source.length;\n\n array || (array = Array(length));\n while (++index < length) {\n array[index] = source[index];\n }\n return array;\n }\n\n /**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\n function copyObject(source, props, object, customizer) {\n var isNew = !object;\n object || (object = {});\n\n var index = -1,\n length = props.length;\n\n while (++index < length) {\n var key = props[index];\n\n var newValue = customizer\n ? customizer(object[key], source[key], key, object, source)\n : undefined;\n\n if (newValue === undefined) {\n newValue = source[key];\n }\n if (isNew) {\n baseAssignValue(object, key, newValue);\n } else {\n assignValue(object, key, newValue);\n }\n }\n return object;\n }\n\n /**\n * Copies own symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbols(source, object) {\n return copyObject(source, getSymbols(source), object);\n }\n\n /**\n * Copies own and inherited symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbolsIn(source, object) {\n return copyObject(source, getSymbolsIn(source), object);\n }\n\n /**\n * Creates a function like `_.groupBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} [initializer] The accumulator object initializer.\n * @returns {Function} Returns the new aggregator function.\n */\n function createAggregator(setter, initializer) {\n return function(collection, iteratee) {\n var func = isArray(collection) ? arrayAggregator : baseAggregator,\n accumulator = initializer ? initializer() : {};\n\n return func(collection, setter, getIteratee(iteratee, 2), accumulator);\n };\n }\n\n /**\n * Creates a function like `_.assign`.\n *\n * @private\n * @param {Function} assigner The function to assign values.\n * @returns {Function} Returns the new assigner function.\n */\n function createAssigner(assigner) {\n return baseRest(function(object, sources) {\n var index = -1,\n length = sources.length,\n customizer = length > 1 ? sources[length - 1] : undefined,\n guard = length > 2 ? sources[2] : undefined;\n\n customizer = (assigner.length > 3 && typeof customizer == 'function')\n ? (length--, customizer)\n : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n customizer = length < 3 ? undefined : customizer;\n length = 1;\n }\n object = Object(object);\n while (++index < length) {\n var source = sources[index];\n if (source) {\n assigner(object, source, index, customizer);\n }\n }\n return object;\n });\n }\n\n /**\n * Creates a `baseEach` or `baseEachRight` function.\n *\n * @private\n * @param {Function} eachFunc The function to iterate over a collection.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseEach(eachFunc, fromRight) {\n return function(collection, iteratee) {\n if (collection == null) {\n return collection;\n }\n if (!isArrayLike(collection)) {\n return eachFunc(collection, iteratee);\n }\n var length = collection.length,\n index = fromRight ? length : -1,\n iterable = Object(collection);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (iteratee(iterable[index], index, iterable) === false) {\n break;\n }\n }\n return collection;\n };\n }\n\n /**\n * Creates a base function for methods like `_.forIn` and `_.forOwn`.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseFor(fromRight) {\n return function(object, iteratee, keysFunc) {\n var index = -1,\n iterable = Object(object),\n props = keysFunc(object),\n length = props.length;\n\n while (length--) {\n var key = props[fromRight ? length : ++index];\n if (iteratee(iterable[key], key, iterable) === false) {\n break;\n }\n }\n return object;\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the optional `this`\n * binding of `thisArg`.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createBind(func, bitmask, thisArg) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return fn.apply(isBind ? thisArg : this, arguments);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.lowerFirst`.\n *\n * @private\n * @param {string} methodName The name of the `String` case method to use.\n * @returns {Function} Returns the new case function.\n */\n function createCaseFirst(methodName) {\n return function(string) {\n string = toString(string);\n\n var strSymbols = hasUnicode(string)\n ? stringToArray(string)\n : undefined;\n\n var chr = strSymbols\n ? strSymbols[0]\n : string.charAt(0);\n\n var trailing = strSymbols\n ? castSlice(strSymbols, 1).join('')\n : string.slice(1);\n\n return chr[methodName]() + trailing;\n };\n }\n\n /**\n * Creates a function like `_.camelCase`.\n *\n * @private\n * @param {Function} callback The function to combine each word.\n * @returns {Function} Returns the new compounder function.\n */\n function createCompounder(callback) {\n return function(string) {\n return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');\n };\n }\n\n /**\n * Creates a function that produces an instance of `Ctor` regardless of\n * whether it was invoked as part of a `new` expression or by `call` or `apply`.\n *\n * @private\n * @param {Function} Ctor The constructor to wrap.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCtor(Ctor) {\n return function() {\n // Use a `switch` statement to work with class constructors. See\n // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist\n // for more details.\n var args = arguments;\n switch (args.length) {\n case 0: return new Ctor;\n case 1: return new Ctor(args[0]);\n case 2: return new Ctor(args[0], args[1]);\n case 3: return new Ctor(args[0], args[1], args[2]);\n case 4: return new Ctor(args[0], args[1], args[2], args[3]);\n case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);\n case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);\n case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);\n }\n var thisBinding = baseCreate(Ctor.prototype),\n result = Ctor.apply(thisBinding, args);\n\n // Mimic the constructor's `return` behavior.\n // See https://es5.github.io/#x13.2.2 for more details.\n return isObject(result) ? result : thisBinding;\n };\n }\n\n /**\n * Creates a function that wraps `func` to enable currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {number} arity The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCurry(func, bitmask, arity) {\n var Ctor = createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length,\n placeholder = getHolder(wrapper);\n\n while (index--) {\n args[index] = arguments[index];\n }\n var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)\n ? []\n : replaceHolders(args, placeholder);\n\n length -= holders.length;\n if (length < arity) {\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, undefined,\n args, holders, undefined, undefined, arity - length);\n }\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return apply(fn, this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.find` or `_.findLast` function.\n *\n * @private\n * @param {Function} findIndexFunc The function to find the collection index.\n * @returns {Function} Returns the new find function.\n */\n function createFind(findIndexFunc) {\n return function(collection, predicate, fromIndex) {\n var iterable = Object(collection);\n if (!isArrayLike(collection)) {\n var iteratee = getIteratee(predicate, 3);\n collection = keys(collection);\n predicate = function(key) { return iteratee(iterable[key], key, iterable); };\n }\n var index = findIndexFunc(collection, predicate, fromIndex);\n return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;\n };\n }\n\n /**\n * Creates a `_.flow` or `_.flowRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new flow function.\n */\n function createFlow(fromRight) {\n return flatRest(function(funcs) {\n var length = funcs.length,\n index = length,\n prereq = LodashWrapper.prototype.thru;\n\n if (fromRight) {\n funcs.reverse();\n }\n while (index--) {\n var func = funcs[index];\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (prereq && !wrapper && getFuncName(func) == 'wrapper') {\n var wrapper = new LodashWrapper([], true);\n }\n }\n index = wrapper ? index : length;\n while (++index < length) {\n func = funcs[index];\n\n var funcName = getFuncName(func),\n data = funcName == 'wrapper' ? getData(func) : undefined;\n\n if (data && isLaziable(data[0]) &&\n data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&\n !data[4].length && data[9] == 1\n ) {\n wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);\n } else {\n wrapper = (func.length == 1 && isLaziable(func))\n ? wrapper[funcName]()\n : wrapper.thru(func);\n }\n }\n return function() {\n var args = arguments,\n value = args[0];\n\n if (wrapper && args.length == 1 && isArray(value)) {\n return wrapper.plant(value).value();\n }\n var index = 0,\n result = length ? funcs[index].apply(this, args) : value;\n\n while (++index < length) {\n result = funcs[index].call(this, result);\n }\n return result;\n };\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with optional `this`\n * binding of `thisArg`, partial application, and currying.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [partialsRight] The arguments to append to those provided\n * to the new function.\n * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {\n var isAry = bitmask & WRAP_ARY_FLAG,\n isBind = bitmask & WRAP_BIND_FLAG,\n isBindKey = bitmask & WRAP_BIND_KEY_FLAG,\n isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),\n isFlip = bitmask & WRAP_FLIP_FLAG,\n Ctor = isBindKey ? undefined : createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length;\n\n while (index--) {\n args[index] = arguments[index];\n }\n if (isCurried) {\n var placeholder = getHolder(wrapper),\n holdersCount = countHolders(args, placeholder);\n }\n if (partials) {\n args = composeArgs(args, partials, holders, isCurried);\n }\n if (partialsRight) {\n args = composeArgsRight(args, partialsRight, holdersRight, isCurried);\n }\n length -= holdersCount;\n if (isCurried && length < arity) {\n var newHolders = replaceHolders(args, placeholder);\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, thisArg,\n args, newHolders, argPos, ary, arity - length\n );\n }\n var thisBinding = isBind ? thisArg : this,\n fn = isBindKey ? thisBinding[func] : func;\n\n length = args.length;\n if (argPos) {\n args = reorder(args, argPos);\n } else if (isFlip && length > 1) {\n args.reverse();\n }\n if (isAry && ary < length) {\n args.length = ary;\n }\n if (this && this !== root && this instanceof wrapper) {\n fn = Ctor || createCtor(fn);\n }\n return fn.apply(thisBinding, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.invertBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} toIteratee The function to resolve iteratees.\n * @returns {Function} Returns the new inverter function.\n */\n function createInverter(setter, toIteratee) {\n return function(object, iteratee) {\n return baseInverter(object, setter, toIteratee(iteratee), {});\n };\n }\n\n /**\n * Creates a function that performs a mathematical operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @param {number} [defaultValue] The value used for `undefined` arguments.\n * @returns {Function} Returns the new mathematical operation function.\n */\n function createMathOperation(operator, defaultValue) {\n return function(value, other) {\n var result;\n if (value === undefined && other === undefined) {\n return defaultValue;\n }\n if (value !== undefined) {\n result = value;\n }\n if (other !== undefined) {\n if (result === undefined) {\n return other;\n }\n if (typeof value == 'string' || typeof other == 'string') {\n value = baseToString(value);\n other = baseToString(other);\n } else {\n value = baseToNumber(value);\n other = baseToNumber(other);\n }\n result = operator(value, other);\n }\n return result;\n };\n }\n\n /**\n * Creates a function like `_.over`.\n *\n * @private\n * @param {Function} arrayFunc The function to iterate over iteratees.\n * @returns {Function} Returns the new over function.\n */\n function createOver(arrayFunc) {\n return flatRest(function(iteratees) {\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n return baseRest(function(args) {\n var thisArg = this;\n return arrayFunc(iteratees, function(iteratee) {\n return apply(iteratee, thisArg, args);\n });\n });\n });\n }\n\n /**\n * Creates the padding for `string` based on `length`. The `chars` string\n * is truncated if the number of characters exceeds `length`.\n *\n * @private\n * @param {number} length The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padding for `string`.\n */\n function createPadding(length, chars) {\n chars = chars === undefined ? ' ' : baseToString(chars);\n\n var charsLength = chars.length;\n if (charsLength < 2) {\n return charsLength ? baseRepeat(chars, length) : chars;\n }\n var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));\n return hasUnicode(chars)\n ? castSlice(stringToArray(result), 0, length).join('')\n : result.slice(0, length);\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the `this` binding\n * of `thisArg` and `partials` prepended to the arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} partials The arguments to prepend to those provided to\n * the new function.\n * @returns {Function} Returns the new wrapped function.\n */\n function createPartial(func, bitmask, thisArg, partials) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var argsIndex = -1,\n argsLength = arguments.length,\n leftIndex = -1,\n leftLength = partials.length,\n args = Array(leftLength + argsLength),\n fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n\n while (++leftIndex < leftLength) {\n args[leftIndex] = partials[leftIndex];\n }\n while (argsLength--) {\n args[leftIndex++] = arguments[++argsIndex];\n }\n return apply(fn, isBind ? thisArg : this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.range` or `_.rangeRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new range function.\n */\n function createRange(fromRight) {\n return function(start, end, step) {\n if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {\n end = step = undefined;\n }\n // Ensure the sign of `-0` is preserved.\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);\n return baseRange(start, end, step, fromRight);\n };\n }\n\n /**\n * Creates a function that performs a relational operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @returns {Function} Returns the new relational operation function.\n */\n function createRelationalOperation(operator) {\n return function(value, other) {\n if (!(typeof value == 'string' && typeof other == 'string')) {\n value = toNumber(value);\n other = toNumber(other);\n }\n return operator(value, other);\n };\n }\n\n /**\n * Creates a function that wraps `func` to continue currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {Function} wrapFunc The function to create the `func` wrapper.\n * @param {*} placeholder The placeholder value.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {\n var isCurry = bitmask & WRAP_CURRY_FLAG,\n newHolders = isCurry ? holders : undefined,\n newHoldersRight = isCurry ? undefined : holders,\n newPartials = isCurry ? partials : undefined,\n newPartialsRight = isCurry ? undefined : partials;\n\n bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);\n bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);\n\n if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {\n bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);\n }\n var newData = [\n func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,\n newHoldersRight, argPos, ary, arity\n ];\n\n var result = wrapFunc.apply(undefined, newData);\n if (isLaziable(func)) {\n setData(result, newData);\n }\n result.placeholder = placeholder;\n return setWrapToString(result, func, bitmask);\n }\n\n /**\n * Creates a function like `_.round`.\n *\n * @private\n * @param {string} methodName The name of the `Math` method to use when rounding.\n * @returns {Function} Returns the new round function.\n */\n function createRound(methodName) {\n var func = Math[methodName];\n return function(number, precision) {\n number = toNumber(number);\n precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);\n if (precision && nativeIsFinite(number)) {\n // Shift with exponential notation to avoid floating-point issues.\n // See [MDN](https://mdn.io/round#Examples) for more details.\n var pair = (toString(number) + 'e').split('e'),\n value = func(pair[0] + 'e' + (+pair[1] + precision));\n\n pair = (toString(value) + 'e').split('e');\n return +(pair[0] + 'e' + (+pair[1] - precision));\n }\n return func(number);\n };\n }\n\n /**\n * Creates a set object of `values`.\n *\n * @private\n * @param {Array} values The values to add to the set.\n * @returns {Object} Returns the new set.\n */\n var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {\n return new Set(values);\n };\n\n /**\n * Creates a `_.toPairs` or `_.toPairsIn` function.\n *\n * @private\n * @param {Function} keysFunc The function to get the keys of a given object.\n * @returns {Function} Returns the new pairs function.\n */\n function createToPairs(keysFunc) {\n return function(object) {\n var tag = getTag(object);\n if (tag == mapTag) {\n return mapToArray(object);\n }\n if (tag == setTag) {\n return setToPairs(object);\n }\n return baseToPairs(object, keysFunc(object));\n };\n }\n\n /**\n * Creates a function that either curries or invokes `func` with optional\n * `this` binding and partially applied arguments.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags.\n * 1 - `_.bind`\n * 2 - `_.bindKey`\n * 4 - `_.curry` or `_.curryRight` of a bound function\n * 8 - `_.curry`\n * 16 - `_.curryRight`\n * 32 - `_.partial`\n * 64 - `_.partialRight`\n * 128 - `_.rearg`\n * 256 - `_.ary`\n * 512 - `_.flip`\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to be partially applied.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {\n var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;\n if (!isBindKey && typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var length = partials ? partials.length : 0;\n if (!length) {\n bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);\n partials = holders = undefined;\n }\n ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);\n arity = arity === undefined ? arity : toInteger(arity);\n length -= holders ? holders.length : 0;\n\n if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {\n var partialsRight = partials,\n holdersRight = holders;\n\n partials = holders = undefined;\n }\n var data = isBindKey ? undefined : getData(func);\n\n var newData = [\n func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,\n argPos, ary, arity\n ];\n\n if (data) {\n mergeData(newData, data);\n }\n func = newData[0];\n bitmask = newData[1];\n thisArg = newData[2];\n partials = newData[3];\n holders = newData[4];\n arity = newData[9] = newData[9] === undefined\n ? (isBindKey ? 0 : func.length)\n : nativeMax(newData[9] - length, 0);\n\n if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {\n bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);\n }\n if (!bitmask || bitmask == WRAP_BIND_FLAG) {\n var result = createBind(func, bitmask, thisArg);\n } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {\n result = createCurry(func, bitmask, arity);\n } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {\n result = createPartial(func, bitmask, thisArg, partials);\n } else {\n result = createHybrid.apply(undefined, newData);\n }\n var setter = data ? baseSetData : setData;\n return setWrapToString(setter(result, newData), func, bitmask);\n }\n\n /**\n * Used by `_.defaults` to customize its `_.assignIn` use to assign properties\n * of source objects to the destination object for all destination properties\n * that resolve to `undefined`.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to assign.\n * @param {Object} object The parent object of `objValue`.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsAssignIn(objValue, srcValue, key, object) {\n if (objValue === undefined ||\n (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n return srcValue;\n }\n return objValue;\n }\n\n /**\n * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source\n * objects into destination objects that are passed thru.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to merge.\n * @param {Object} object The parent object of `objValue`.\n * @param {Object} source The parent object of `srcValue`.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {\n if (isObject(objValue) && isObject(srcValue)) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, objValue);\n baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);\n stack['delete'](srcValue);\n }\n return objValue;\n }\n\n /**\n * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain\n * objects.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {string} key The key of the property to inspect.\n * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.\n */\n function customOmitClone(value) {\n return isPlainObject(value) ? undefined : value;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\n function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(array);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseRest` which flattens the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n function flatRest(func) {\n return setToString(overRest(func, undefined, flatten), func + '');\n }\n\n /**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n }\n\n /**\n * Creates an array of own and inherited enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeysIn(object) {\n return baseGetAllKeys(object, keysIn, getSymbolsIn);\n }\n\n /**\n * Gets metadata for `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {*} Returns the metadata for `func`.\n */\n var getData = !metaMap ? noop : function(func) {\n return metaMap.get(func);\n };\n\n /**\n * Gets the name of `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {string} Returns the function name.\n */\n function getFuncName(func) {\n var result = (func.name + ''),\n array = realNames[result],\n length = hasOwnProperty.call(realNames, result) ? array.length : 0;\n\n while (length--) {\n var data = array[length],\n otherFunc = data.func;\n if (otherFunc == null || otherFunc == func) {\n return data.name;\n }\n }\n return result;\n }\n\n /**\n * Gets the argument placeholder value for `func`.\n *\n * @private\n * @param {Function} func The function to inspect.\n * @returns {*} Returns the placeholder value.\n */\n function getHolder(func) {\n var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;\n return object.placeholder;\n }\n\n /**\n * Gets the appropriate \"iteratee\" function. If `_.iteratee` is customized,\n * this function returns the custom method, otherwise it returns `baseIteratee`.\n * If arguments are provided, the chosen function is invoked with them and\n * its result is returned.\n *\n * @private\n * @param {*} [value] The value to convert to an iteratee.\n * @param {number} [arity] The arity of the created iteratee.\n * @returns {Function} Returns the chosen function or its result.\n */\n function getIteratee() {\n var result = lodash.iteratee || iteratee;\n result = result === iteratee ? baseIteratee : result;\n return arguments.length ? result(arguments[0], arguments[1]) : result;\n }\n\n /**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\n function getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n }\n\n /**\n * Gets the property names, values, and compare flags of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the match data of `object`.\n */\n function getMatchData(object) {\n var result = keys(object),\n length = result.length;\n\n while (length--) {\n var key = result[length],\n value = object[key];\n\n result[length] = [key, value, isStrictComparable(value)];\n }\n return result;\n }\n\n /**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\n function getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n }\n\n /**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\n function getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n }\n\n /**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n };\n\n /**\n * Creates an array of the own and inherited enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {\n var result = [];\n while (object) {\n arrayPush(result, getSymbols(object));\n object = getPrototype(object);\n }\n return result;\n };\n\n /**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n var getTag = baseGetTag;\n\n // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\n if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n }\n\n /**\n * Gets the view, applying any `transforms` to the `start` and `end` positions.\n *\n * @private\n * @param {number} start The start of the view.\n * @param {number} end The end of the view.\n * @param {Array} transforms The transformations to apply to the view.\n * @returns {Object} Returns an object containing the `start` and `end`\n * positions of the view.\n */\n function getView(start, end, transforms) {\n var index = -1,\n length = transforms.length;\n\n while (++index < length) {\n var data = transforms[index],\n size = data.size;\n\n switch (data.type) {\n case 'drop': start += size; break;\n case 'dropRight': end -= size; break;\n case 'take': end = nativeMin(end, start + size); break;\n case 'takeRight': start = nativeMax(start, end - size); break;\n }\n }\n return { 'start': start, 'end': end };\n }\n\n /**\n * Extracts wrapper details from the `source` body comment.\n *\n * @private\n * @param {string} source The source to inspect.\n * @returns {Array} Returns the wrapper details.\n */\n function getWrapDetails(source) {\n var match = source.match(reWrapDetails);\n return match ? match[1].split(reSplitDetails) : [];\n }\n\n /**\n * Checks if `path` exists on `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @param {Function} hasFunc The function to check properties.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n */\n function hasPath(object, path, hasFunc) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n result = false;\n\n while (++index < length) {\n var key = toKey(path[index]);\n if (!(result = object != null && hasFunc(object, key))) {\n break;\n }\n object = object[key];\n }\n if (result || ++index != length) {\n return result;\n }\n length = object == null ? 0 : object.length;\n return !!length && isLength(length) && isIndex(key, length) &&\n (isArray(object) || isArguments(object));\n }\n\n /**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\n function initCloneArray(array) {\n var length = array.length,\n result = new array.constructor(length);\n\n // Add properties assigned by `RegExp#exec`.\n if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n result.index = array.index;\n result.input = array.input;\n }\n return result;\n }\n\n /**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneObject(object) {\n return (typeof object.constructor == 'function' && !isPrototype(object))\n ? baseCreate(getPrototype(object))\n : {};\n }\n\n /**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneByTag(object, tag, isDeep) {\n var Ctor = object.constructor;\n switch (tag) {\n case arrayBufferTag:\n return cloneArrayBuffer(object);\n\n case boolTag:\n case dateTag:\n return new Ctor(+object);\n\n case dataViewTag:\n return cloneDataView(object, isDeep);\n\n case float32Tag: case float64Tag:\n case int8Tag: case int16Tag: case int32Tag:\n case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n return cloneTypedArray(object, isDeep);\n\n case mapTag:\n return new Ctor;\n\n case numberTag:\n case stringTag:\n return new Ctor(object);\n\n case regexpTag:\n return cloneRegExp(object);\n\n case setTag:\n return new Ctor;\n\n case symbolTag:\n return cloneSymbol(object);\n }\n }\n\n /**\n * Inserts wrapper `details` in a comment at the top of the `source` body.\n *\n * @private\n * @param {string} source The source to modify.\n * @returns {Array} details The details to insert.\n * @returns {string} Returns the modified source.\n */\n function insertWrapDetails(source, details) {\n var length = details.length;\n if (!length) {\n return source;\n }\n var lastIndex = length - 1;\n details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];\n details = details.join(length > 2 ? ', ' : ' ');\n return source.replace(reWrapComment, '{\\n/* [wrapped with ' + details + '] */\\n');\n }\n\n /**\n * Checks if `value` is a flattenable `arguments` object or array.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.\n */\n function isFlattenable(value) {\n return isArray(value) || isArguments(value) ||\n !!(spreadableSymbol && value && value[spreadableSymbol]);\n }\n\n /**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\n function isIndex(value, length) {\n var type = typeof value;\n length = length == null ? MAX_SAFE_INTEGER : length;\n\n return !!length &&\n (type == 'number' ||\n (type != 'symbol' && reIsUint.test(value))) &&\n (value > -1 && value % 1 == 0 && value < length);\n }\n\n /**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\n function isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n }\n\n /**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\n function isKey(value, object) {\n if (isArray(value)) {\n return false;\n }\n var type = typeof value;\n if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n value == null || isSymbol(value)) {\n return true;\n }\n return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n (object != null && value in Object(object));\n }\n\n /**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\n function isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n }\n\n /**\n * Checks if `func` has a lazy counterpart.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` has a lazy counterpart,\n * else `false`.\n */\n function isLaziable(func) {\n var funcName = getFuncName(func),\n other = lodash[funcName];\n\n if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {\n return false;\n }\n if (func === other) {\n return true;\n }\n var data = getData(other);\n return !!data && func === data[0];\n }\n\n /**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\n function isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n }\n\n /**\n * Checks if `func` is capable of being masked.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `func` is maskable, else `false`.\n */\n var isMaskable = coreJsData ? isFunction : stubFalse;\n\n /**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\n function isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n }\n\n /**\n * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` if suitable for strict\n * equality comparisons, else `false`.\n */\n function isStrictComparable(value) {\n return value === value && !isObject(value);\n }\n\n /**\n * A specialized version of `matchesProperty` for source values suitable\n * for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function matchesStrictComparable(key, srcValue) {\n return function(object) {\n if (object == null) {\n return false;\n }\n return object[key] === srcValue &&\n (srcValue !== undefined || (key in Object(object)));\n };\n }\n\n /**\n * A specialized version of `_.memoize` which clears the memoized function's\n * cache when it exceeds `MAX_MEMOIZE_SIZE`.\n *\n * @private\n * @param {Function} func The function to have its output memoized.\n * @returns {Function} Returns the new memoized function.\n */\n function memoizeCapped(func) {\n var result = memoize(func, function(key) {\n if (cache.size === MAX_MEMOIZE_SIZE) {\n cache.clear();\n }\n return key;\n });\n\n var cache = result.cache;\n return result;\n }\n\n /**\n * Merges the function metadata of `source` into `data`.\n *\n * Merging metadata reduces the number of wrappers used to invoke a function.\n * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`\n * may be applied regardless of execution order. Methods like `_.ary` and\n * `_.rearg` modify function arguments, making the order in which they are\n * executed important, preventing the merging of metadata. However, we make\n * an exception for a safe combined case where curried functions have `_.ary`\n * and or `_.rearg` applied.\n *\n * @private\n * @param {Array} data The destination metadata.\n * @param {Array} source The source metadata.\n * @returns {Array} Returns `data`.\n */\n function mergeData(data, source) {\n var bitmask = data[1],\n srcBitmask = source[1],\n newBitmask = bitmask | srcBitmask,\n isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);\n\n var isCombo =\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||\n ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));\n\n // Exit early if metadata can't be merged.\n if (!(isCommon || isCombo)) {\n return data;\n }\n // Use source `thisArg` if available.\n if (srcBitmask & WRAP_BIND_FLAG) {\n data[2] = source[2];\n // Set when currying a bound function.\n newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;\n }\n // Compose partial arguments.\n var value = source[3];\n if (value) {\n var partials = data[3];\n data[3] = partials ? composeArgs(partials, value, source[4]) : value;\n data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];\n }\n // Compose partial right arguments.\n value = source[5];\n if (value) {\n partials = data[5];\n data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;\n data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];\n }\n // Use source `argPos` if available.\n value = source[7];\n if (value) {\n data[7] = value;\n }\n // Use source `ary` if it's smaller.\n if (srcBitmask & WRAP_ARY_FLAG) {\n data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);\n }\n // Use source `arity` if one is not provided.\n if (data[9] == null) {\n data[9] = source[9];\n }\n // Use source `func` and merge bitmasks.\n data[0] = source[0];\n data[1] = newBitmask;\n\n return data;\n }\n\n /**\n * This function is like\n * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * except that it includes inherited enumerable properties.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function nativeKeysIn(object) {\n var result = [];\n if (object != null) {\n for (var key in Object(object)) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\n function objectToString(value) {\n return nativeObjectToString.call(value);\n }\n\n /**\n * A specialized version of `baseRest` which transforms the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @param {Function} transform The rest array transform.\n * @returns {Function} Returns the new function.\n */\n function overRest(func, start, transform) {\n start = nativeMax(start === undefined ? (func.length - 1) : start, 0);\n return function() {\n var args = arguments,\n index = -1,\n length = nativeMax(args.length - start, 0),\n array = Array(length);\n\n while (++index < length) {\n array[index] = args[start + index];\n }\n index = -1;\n var otherArgs = Array(start + 1);\n while (++index < start) {\n otherArgs[index] = args[index];\n }\n otherArgs[start] = transform(array);\n return apply(func, this, otherArgs);\n };\n }\n\n /**\n * Gets the parent value at `path` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} path The path to get the parent value of.\n * @returns {*} Returns the parent value.\n */\n function parent(object, path) {\n return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));\n }\n\n /**\n * Reorder `array` according to the specified indexes where the element at\n * the first index is assigned as the first element, the element at\n * the second index is assigned as the second element, and so on.\n *\n * @private\n * @param {Array} array The array to reorder.\n * @param {Array} indexes The arranged array indexes.\n * @returns {Array} Returns `array`.\n */\n function reorder(array, indexes) {\n var arrLength = array.length,\n length = nativeMin(indexes.length, arrLength),\n oldArray = copyArray(array);\n\n while (length--) {\n var index = indexes[length];\n array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;\n }\n return array;\n }\n\n /**\n * Gets the value at `key`, unless `key` is \"__proto__\" or \"constructor\".\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function safeGet(object, key) {\n if (key === 'constructor' && typeof object[key] === 'function') {\n return;\n }\n\n if (key == '__proto__') {\n return;\n }\n\n return object[key];\n }\n\n /**\n * Sets metadata for `func`.\n *\n * **Note:** If this function becomes hot, i.e. is invoked a lot in a short\n * period of time, it will trip its breaker and transition to an identity\n * function to avoid garbage collection pauses in V8. See\n * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)\n * for more details.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var setData = shortOut(baseSetData);\n\n /**\n * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n var setTimeout = ctxSetTimeout || function(func, wait) {\n return root.setTimeout(func, wait);\n };\n\n /**\n * Sets the `toString` method of `func` to return `string`.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var setToString = shortOut(baseSetToString);\n\n /**\n * Sets the `toString` method of `wrapper` to mimic the source of `reference`\n * with wrapper details in a comment at the top of the source body.\n *\n * @private\n * @param {Function} wrapper The function to modify.\n * @param {Function} reference The reference function.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Function} Returns `wrapper`.\n */\n function setWrapToString(wrapper, reference, bitmask) {\n var source = (reference + '');\n return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));\n }\n\n /**\n * Creates a function that'll short out and invoke `identity` instead\n * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`\n * milliseconds.\n *\n * @private\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new shortable function.\n */\n function shortOut(func) {\n var count = 0,\n lastCalled = 0;\n\n return function() {\n var stamp = nativeNow(),\n remaining = HOT_SPAN - (stamp - lastCalled);\n\n lastCalled = stamp;\n if (remaining > 0) {\n if (++count >= HOT_COUNT) {\n return arguments[0];\n }\n } else {\n count = 0;\n }\n return func.apply(undefined, arguments);\n };\n }\n\n /**\n * A specialized version of `_.shuffle` which mutates and sets the size of `array`.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @param {number} [size=array.length] The size of `array`.\n * @returns {Array} Returns `array`.\n */\n function shuffleSelf(array, size) {\n var index = -1,\n length = array.length,\n lastIndex = length - 1;\n\n size = size === undefined ? length : size;\n while (++index < size) {\n var rand = baseRandom(index, lastIndex),\n value = array[rand];\n\n array[rand] = array[index];\n array[index] = value;\n }\n array.length = size;\n return array;\n }\n\n /**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\n var stringToPath = memoizeCapped(function(string) {\n var result = [];\n if (string.charCodeAt(0) === 46 /* . */) {\n result.push('');\n }\n string.replace(rePropName, function(match, number, quote, subString) {\n result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));\n });\n return result;\n });\n\n /**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\n function toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\n function toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n }\n\n /**\n * Updates wrapper `details` based on `bitmask` flags.\n *\n * @private\n * @returns {Array} details The details to modify.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Array} Returns `details`.\n */\n function updateWrapDetails(details, bitmask) {\n arrayEach(wrapFlags, function(pair) {\n var value = '_.' + pair[0];\n if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {\n details.push(value);\n }\n });\n return details.sort();\n }\n\n /**\n * Creates a clone of `wrapper`.\n *\n * @private\n * @param {Object} wrapper The wrapper to clone.\n * @returns {Object} Returns the cloned wrapper.\n */\n function wrapperClone(wrapper) {\n if (wrapper instanceof LazyWrapper) {\n return wrapper.clone();\n }\n var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);\n result.__actions__ = copyArray(wrapper.__actions__);\n result.__index__ = wrapper.__index__;\n result.__values__ = wrapper.__values__;\n return result;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of elements split into groups the length of `size`.\n * If `array` can't be split evenly, the final chunk will be the remaining\n * elements.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to process.\n * @param {number} [size=1] The length of each chunk\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the new array of chunks.\n * @example\n *\n * _.chunk(['a', 'b', 'c', 'd'], 2);\n * // => [['a', 'b'], ['c', 'd']]\n *\n * _.chunk(['a', 'b', 'c', 'd'], 3);\n * // => [['a', 'b', 'c'], ['d']]\n */\n function chunk(array, size, guard) {\n if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {\n size = 1;\n } else {\n size = nativeMax(toInteger(size), 0);\n }\n var length = array == null ? 0 : array.length;\n if (!length || size < 1) {\n return [];\n }\n var index = 0,\n resIndex = 0,\n result = Array(nativeCeil(length / size));\n\n while (index < length) {\n result[resIndex++] = baseSlice(array, index, (index += size));\n }\n return result;\n }\n\n /**\n * Creates an array with all falsey values removed. The values `false`, `null`,\n * `0`, `\"\"`, `undefined`, and `NaN` are falsey.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to compact.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.compact([0, 1, false, 2, '', 3]);\n * // => [1, 2, 3]\n */\n function compact(array) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * Creates a new array concatenating `array` with any additional arrays\n * and/or values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to concatenate.\n * @param {...*} [values] The values to concatenate.\n * @returns {Array} Returns the new concatenated array.\n * @example\n *\n * var array = [1];\n * var other = _.concat(array, 2, [3], [[4]]);\n *\n * console.log(other);\n * // => [1, 2, 3, [4]]\n *\n * console.log(array);\n * // => [1]\n */\n function concat() {\n var length = arguments.length;\n if (!length) {\n return [];\n }\n var args = Array(length - 1),\n array = arguments[0],\n index = length;\n\n while (index--) {\n args[index - 1] = arguments[index];\n }\n return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));\n }\n\n /**\n * Creates an array of `array` values not included in the other given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * **Note:** Unlike `_.pullAll`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.without, _.xor\n * @example\n *\n * _.difference([2, 1], [2, 3]);\n * // => [1]\n */\n var difference = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `iteratee` which\n * is invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * **Note:** Unlike `_.pullAllBy`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var differenceBy = baseRest(function(array, values) {\n var iteratee = last(values);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `comparator`\n * which is invoked to compare elements of `array` to `values`. The order and\n * references of result values are determined by the first array. The comparator\n * is invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.pullAllWith`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n *\n * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }]\n */\n var differenceWith = baseRest(function(array, values) {\n var comparator = last(values);\n if (isArrayLikeObject(comparator)) {\n comparator = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)\n : [];\n });\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.drop([1, 2, 3]);\n * // => [2, 3]\n *\n * _.drop([1, 2, 3], 2);\n * // => [3]\n *\n * _.drop([1, 2, 3], 5);\n * // => []\n *\n * _.drop([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function drop(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.dropRight([1, 2, 3]);\n * // => [1, 2]\n *\n * _.dropRight([1, 2, 3], 2);\n * // => [1]\n *\n * _.dropRight([1, 2, 3], 5);\n * // => []\n *\n * _.dropRight([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function dropRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the end.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.dropRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropRightWhile(users, ['active', false]);\n * // => objects for ['barney']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropRightWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the beginning.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.dropWhile(users, function(o) { return !o.active; });\n * // => objects for ['pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropWhile(users, ['active', false]);\n * // => objects for ['pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true)\n : [];\n }\n\n /**\n * Fills elements of `array` with `value` from `start` up to, but not\n * including, `end`.\n *\n * **Note:** This method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Array\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.fill(array, 'a');\n * console.log(array);\n * // => ['a', 'a', 'a']\n *\n * _.fill(Array(3), 2);\n * // => [2, 2, 2]\n *\n * _.fill([4, 6, 8, 10], '*', 1, 3);\n * // => [4, '*', '*', 10]\n */\n function fill(array, value, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {\n start = 0;\n end = length;\n }\n return baseFill(array, value, start, end);\n }\n\n /**\n * This method is like `_.find` except that it returns the index of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.findIndex(users, function(o) { return o.user == 'barney'; });\n * // => 0\n *\n * // The `_.matches` iteratee shorthand.\n * _.findIndex(users, { 'user': 'fred', 'active': false });\n * // => 1\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findIndex(users, ['active', false]);\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.findIndex(users, 'active');\n * // => 2\n */\n function findIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index);\n }\n\n /**\n * This method is like `_.findIndex` except that it iterates over elements\n * of `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });\n * // => 2\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastIndex(users, { 'user': 'barney', 'active': true });\n * // => 0\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastIndex(users, ['active', false]);\n * // => 2\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastIndex(users, 'active');\n * // => 0\n */\n function findLastIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length - 1;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = fromIndex < 0\n ? nativeMax(length + index, 0)\n : nativeMin(index, length - 1);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index, true);\n }\n\n /**\n * Flattens `array` a single level deep.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flatten([1, [2, [3, [4]], 5]]);\n * // => [1, 2, [3, [4]], 5]\n */\n function flatten(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, 1) : [];\n }\n\n /**\n * Recursively flattens `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flattenDeep([1, [2, [3, [4]], 5]]);\n * // => [1, 2, 3, 4, 5]\n */\n function flattenDeep(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, INFINITY) : [];\n }\n\n /**\n * Recursively flatten `array` up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * var array = [1, [2, [3, [4]], 5]];\n *\n * _.flattenDepth(array, 1);\n * // => [1, 2, [3, [4]], 5]\n *\n * _.flattenDepth(array, 2);\n * // => [1, 2, 3, [4], 5]\n */\n function flattenDepth(array, depth) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(array, depth);\n }\n\n /**\n * The inverse of `_.toPairs`; this method returns an object composed\n * from key-value `pairs`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} pairs The key-value pairs.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.fromPairs([['a', 1], ['b', 2]]);\n * // => { 'a': 1, 'b': 2 }\n */\n function fromPairs(pairs) {\n var index = -1,\n length = pairs == null ? 0 : pairs.length,\n result = {};\n\n while (++index < length) {\n var pair = pairs[index];\n result[pair[0]] = pair[1];\n }\n return result;\n }\n\n /**\n * Gets the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias first\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the first element of `array`.\n * @example\n *\n * _.head([1, 2, 3]);\n * // => 1\n *\n * _.head([]);\n * // => undefined\n */\n function head(array) {\n return (array && array.length) ? array[0] : undefined;\n }\n\n /**\n * Gets the index at which the first occurrence of `value` is found in `array`\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. If `fromIndex` is negative, it's used as the\n * offset from the end of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.indexOf([1, 2, 1, 2], 2);\n * // => 1\n *\n * // Search from the `fromIndex`.\n * _.indexOf([1, 2, 1, 2], 2, 2);\n * // => 3\n */\n function indexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseIndexOf(array, value, index);\n }\n\n /**\n * Gets all but the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.initial([1, 2, 3]);\n * // => [1, 2]\n */\n function initial(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 0, -1) : [];\n }\n\n /**\n * Creates an array of unique values that are included in all given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersection([2, 1], [2, 3]);\n * // => [2]\n */\n var intersection = baseRest(function(arrays) {\n var mapped = arrayMap(arrays, castArrayLikeObject);\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped)\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `iteratee`\n * which is invoked for each element of each `arrays` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [2.1]\n *\n * // The `_.property` iteratee shorthand.\n * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }]\n */\n var intersectionBy = baseRest(function(arrays) {\n var iteratee = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n if (iteratee === last(mapped)) {\n iteratee = undefined;\n } else {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `comparator`\n * which is invoked to compare elements of `arrays`. The order and references\n * of result values are determined by the first array. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.intersectionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }]\n */\n var intersectionWith = baseRest(function(arrays) {\n var comparator = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n comparator = typeof comparator == 'function' ? comparator : undefined;\n if (comparator) {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, undefined, comparator)\n : [];\n });\n\n /**\n * Converts all elements in `array` into a string separated by `separator`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to convert.\n * @param {string} [separator=','] The element separator.\n * @returns {string} Returns the joined string.\n * @example\n *\n * _.join(['a', 'b', 'c'], '~');\n * // => 'a~b~c'\n */\n function join(array, separator) {\n return array == null ? '' : nativeJoin.call(array, separator);\n }\n\n /**\n * Gets the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the last element of `array`.\n * @example\n *\n * _.last([1, 2, 3]);\n * // => 3\n */\n function last(array) {\n var length = array == null ? 0 : array.length;\n return length ? array[length - 1] : undefined;\n }\n\n /**\n * This method is like `_.indexOf` except that it iterates over elements of\n * `array` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.lastIndexOf([1, 2, 1, 2], 2);\n * // => 3\n *\n * // Search from the `fromIndex`.\n * _.lastIndexOf([1, 2, 1, 2], 2, 2);\n * // => 1\n */\n function lastIndexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);\n }\n return value === value\n ? strictLastIndexOf(array, value, index)\n : baseFindIndex(array, baseIsNaN, index, true);\n }\n\n /**\n * Gets the element at index `n` of `array`. If `n` is negative, the nth\n * element from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.11.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=0] The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n *\n * _.nth(array, 1);\n * // => 'b'\n *\n * _.nth(array, -2);\n * // => 'c';\n */\n function nth(array, n) {\n return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;\n }\n\n /**\n * Removes all given values from `array` using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`\n * to remove elements from an array by predicate.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...*} [values] The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pull(array, 'a', 'c');\n * console.log(array);\n * // => ['b', 'b']\n */\n var pull = baseRest(pullAll);\n\n /**\n * This method is like `_.pull` except that it accepts an array of values to remove.\n *\n * **Note:** Unlike `_.difference`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pullAll(array, ['a', 'c']);\n * console.log(array);\n * // => ['b', 'b']\n */\n function pullAll(array, values) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values)\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `iteratee` which is\n * invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The iteratee is invoked with one argument: (value).\n *\n * **Note:** Unlike `_.differenceBy`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];\n *\n * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');\n * console.log(array);\n * // => [{ 'x': 2 }]\n */\n function pullAllBy(array, values, iteratee) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, getIteratee(iteratee, 2))\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `comparator` which\n * is invoked to compare elements of `array` to `values`. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.differenceWith`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];\n *\n * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);\n * console.log(array);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]\n */\n function pullAllWith(array, values, comparator) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, undefined, comparator)\n : array;\n }\n\n /**\n * Removes elements from `array` corresponding to `indexes` and returns an\n * array of removed elements.\n *\n * **Note:** Unlike `_.at`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...(number|number[])} [indexes] The indexes of elements to remove.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n * var pulled = _.pullAt(array, [1, 3]);\n *\n * console.log(array);\n * // => ['a', 'c']\n *\n * console.log(pulled);\n * // => ['b', 'd']\n */\n var pullAt = flatRest(function(array, indexes) {\n var length = array == null ? 0 : array.length,\n result = baseAt(array, indexes);\n\n basePullAt(array, arrayMap(indexes, function(index) {\n return isIndex(index, length) ? +index : index;\n }).sort(compareAscending));\n\n return result;\n });\n\n /**\n * Removes all elements from `array` that `predicate` returns truthy for\n * and returns an array of the removed elements. The predicate is invoked\n * with three arguments: (value, index, array).\n *\n * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`\n * to pull elements from an array by value.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = [1, 2, 3, 4];\n * var evens = _.remove(array, function(n) {\n * return n % 2 == 0;\n * });\n *\n * console.log(array);\n * // => [1, 3]\n *\n * console.log(evens);\n * // => [2, 4]\n */\n function remove(array, predicate) {\n var result = [];\n if (!(array && array.length)) {\n return result;\n }\n var index = -1,\n indexes = [],\n length = array.length;\n\n predicate = getIteratee(predicate, 3);\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result.push(value);\n indexes.push(index);\n }\n }\n basePullAt(array, indexes);\n return result;\n }\n\n /**\n * Reverses `array` so that the first element becomes the last, the second\n * element becomes the second to last, and so on.\n *\n * **Note:** This method mutates `array` and is based on\n * [`Array#reverse`](https://mdn.io/Array/reverse).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.reverse(array);\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function reverse(array) {\n return array == null ? array : nativeReverse.call(array);\n }\n\n /**\n * Creates a slice of `array` from `start` up to, but not including, `end`.\n *\n * **Note:** This method is used instead of\n * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are\n * returned.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function slice(array, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {\n start = 0;\n end = length;\n }\n else {\n start = start == null ? 0 : toInteger(start);\n end = end === undefined ? length : toInteger(end);\n }\n return baseSlice(array, start, end);\n }\n\n /**\n * Uses a binary search to determine the lowest index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedIndex([30, 50], 40);\n * // => 1\n */\n function sortedIndex(array, value) {\n return baseSortedIndex(array, value);\n }\n\n /**\n * This method is like `_.sortedIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedIndexBy(objects, { 'x': 4 }, 'x');\n * // => 0\n */\n function sortedIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));\n }\n\n /**\n * This method is like `_.indexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedIndexOf([4, 5, 5, 5, 6], 5);\n * // => 1\n */\n function sortedIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value);\n if (index < length && eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.sortedIndex` except that it returns the highest\n * index at which `value` should be inserted into `array` in order to\n * maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedLastIndex([4, 5, 5, 5, 6], 5);\n * // => 4\n */\n function sortedLastIndex(array, value) {\n return baseSortedIndex(array, value, true);\n }\n\n /**\n * This method is like `_.sortedLastIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 1\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');\n * // => 1\n */\n function sortedLastIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);\n }\n\n /**\n * This method is like `_.lastIndexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);\n * // => 3\n */\n function sortedLastIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value, true) - 1;\n if (eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.uniq` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniq([1, 1, 2]);\n * // => [1, 2]\n */\n function sortedUniq(array) {\n return (array && array.length)\n ? baseSortedUniq(array)\n : [];\n }\n\n /**\n * This method is like `_.uniqBy` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);\n * // => [1.1, 2.3]\n */\n function sortedUniqBy(array, iteratee) {\n return (array && array.length)\n ? baseSortedUniq(array, getIteratee(iteratee, 2))\n : [];\n }\n\n /**\n * Gets all but the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.tail([1, 2, 3]);\n * // => [2, 3]\n */\n function tail(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 1, length) : [];\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.take([1, 2, 3]);\n * // => [1]\n *\n * _.take([1, 2, 3], 2);\n * // => [1, 2]\n *\n * _.take([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.take([1, 2, 3], 0);\n * // => []\n */\n function take(array, n, guard) {\n if (!(array && array.length)) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.takeRight([1, 2, 3]);\n * // => [3]\n *\n * _.takeRight([1, 2, 3], 2);\n * // => [2, 3]\n *\n * _.takeRight([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.takeRight([1, 2, 3], 0);\n * // => []\n */\n function takeRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with elements taken from the end. Elements are\n * taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.takeRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeRightWhile(users, ['active', false]);\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeRightWhile(users, 'active');\n * // => []\n */\n function takeRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), false, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` with elements taken from the beginning. Elements\n * are taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.takeWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeWhile(users, ['active', false]);\n * // => objects for ['barney', 'fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeWhile(users, 'active');\n * // => []\n */\n function takeWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3))\n : [];\n }\n\n /**\n * Creates an array of unique values, in order, from all given arrays using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.union([2], [1, 2]);\n * // => [2, 1]\n */\n var union = baseRest(function(arrays) {\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));\n });\n\n /**\n * This method is like `_.union` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which uniqueness is computed. Result values are chosen from the first\n * array in which the value occurs. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.unionBy([2.1], [1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n var unionBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.union` except that it accepts `comparator` which\n * is invoked to compare elements of `arrays`. Result values are chosen from\n * the first array in which the value occurs. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.unionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var unionWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);\n });\n\n /**\n * Creates a duplicate-free version of an array, using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons, in which only the first occurrence of each element\n * is kept. The order of result values is determined by the order they occur\n * in the array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniq([2, 1, 2]);\n * // => [2, 1]\n */\n function uniq(array) {\n return (array && array.length) ? baseUniq(array) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n function uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `comparator` which\n * is invoked to compare elements of `array`. The order of result values is\n * determined by the order they occur in the array.The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.uniqWith(objects, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]\n */\n function uniqWith(array, comparator) {\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return (array && array.length) ? baseUniq(array, undefined, comparator) : [];\n }\n\n /**\n * This method is like `_.zip` except that it accepts an array of grouped\n * elements and creates an array regrouping the elements to their pre-zip\n * configuration.\n *\n * @static\n * @memberOf _\n * @since 1.2.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n *\n * _.unzip(zipped);\n * // => [['a', 'b'], [1, 2], [true, false]]\n */\n function unzip(array) {\n if (!(array && array.length)) {\n return [];\n }\n var length = 0;\n array = arrayFilter(array, function(group) {\n if (isArrayLikeObject(group)) {\n length = nativeMax(group.length, length);\n return true;\n }\n });\n return baseTimes(length, function(index) {\n return arrayMap(array, baseProperty(index));\n });\n }\n\n /**\n * This method is like `_.unzip` except that it accepts `iteratee` to specify\n * how regrouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * regrouped values.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip([1, 2], [10, 20], [100, 200]);\n * // => [[1, 10, 100], [2, 20, 200]]\n *\n * _.unzipWith(zipped, _.add);\n * // => [3, 30, 300]\n */\n function unzipWith(array, iteratee) {\n if (!(array && array.length)) {\n return [];\n }\n var result = unzip(array);\n if (iteratee == null) {\n return result;\n }\n return arrayMap(result, function(group) {\n return apply(iteratee, undefined, group);\n });\n }\n\n /**\n * Creates an array excluding all given values using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.pull`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...*} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.xor\n * @example\n *\n * _.without([2, 1, 2, 3], 1, 2);\n * // => [3]\n */\n var without = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, values)\n : [];\n });\n\n /**\n * Creates an array of unique values that is the\n * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)\n * of the given arrays. The order of result values is determined by the order\n * they occur in the arrays.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.without\n * @example\n *\n * _.xor([2, 1], [2, 3]);\n * // => [1, 3]\n */\n var xor = baseRest(function(arrays) {\n return baseXor(arrayFilter(arrays, isArrayLikeObject));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which by which they're compared. The order of result values is determined\n * by the order they occur in the arrays. The iteratee is invoked with one\n * argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2, 3.4]\n *\n * // The `_.property` iteratee shorthand.\n * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var xorBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `comparator` which is\n * invoked to compare elements of `arrays`. The order of result values is\n * determined by the order they occur in the arrays. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.xorWith(objects, others, _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var xorWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);\n });\n\n /**\n * Creates an array of grouped elements, the first of which contains the\n * first elements of the given arrays, the second of which contains the\n * second elements of the given arrays, and so on.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n */\n var zip = baseRest(unzip);\n\n /**\n * This method is like `_.fromPairs` except that it accepts two arrays,\n * one of property identifiers and one of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 0.4.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObject(['a', 'b'], [1, 2]);\n * // => { 'a': 1, 'b': 2 }\n */\n function zipObject(props, values) {\n return baseZipObject(props || [], values || [], assignValue);\n }\n\n /**\n * This method is like `_.zipObject` except that it supports property paths.\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);\n * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }\n */\n function zipObjectDeep(props, values) {\n return baseZipObject(props || [], values || [], baseSet);\n }\n\n /**\n * This method is like `_.zip` except that it accepts `iteratee` to specify\n * how grouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * grouped values.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {\n * return a + b + c;\n * });\n * // => [111, 222]\n */\n var zipWith = baseRest(function(arrays) {\n var length = arrays.length,\n iteratee = length > 1 ? arrays[length - 1] : undefined;\n\n iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;\n return unzipWith(arrays, iteratee);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` wrapper instance that wraps `value` with explicit method\n * chain sequences enabled. The result of such sequences must be unwrapped\n * with `_#value`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Seq\n * @param {*} value The value to wrap.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'pebbles', 'age': 1 }\n * ];\n *\n * var youngest = _\n * .chain(users)\n * .sortBy('age')\n * .map(function(o) {\n * return o.user + ' is ' + o.age;\n * })\n * .head()\n * .value();\n * // => 'pebbles is 1'\n */\n function chain(value) {\n var result = lodash(value);\n result.__chain__ = true;\n return result;\n }\n\n /**\n * This method invokes `interceptor` and returns `value`. The interceptor\n * is invoked with one argument; (value). The purpose of this method is to\n * \"tap into\" a method chain sequence in order to modify intermediate results.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns `value`.\n * @example\n *\n * _([1, 2, 3])\n * .tap(function(array) {\n * // Mutate input array.\n * array.pop();\n * })\n * .reverse()\n * .value();\n * // => [2, 1]\n */\n function tap(value, interceptor) {\n interceptor(value);\n return value;\n }\n\n /**\n * This method is like `_.tap` except that it returns the result of `interceptor`.\n * The purpose of this method is to \"pass thru\" values replacing intermediate\n * results in a method chain sequence.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns the result of `interceptor`.\n * @example\n *\n * _(' abc ')\n * .chain()\n * .trim()\n * .thru(function(value) {\n * return [value];\n * })\n * .value();\n * // => ['abc']\n */\n function thru(value, interceptor) {\n return interceptor(value);\n }\n\n /**\n * This method is the wrapper version of `_.at`.\n *\n * @name at\n * @memberOf _\n * @since 1.0.0\n * @category Seq\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _(object).at(['a[0].b.c', 'a[1]']).value();\n * // => [3, 4]\n */\n var wrapperAt = flatRest(function(paths) {\n var length = paths.length,\n start = length ? paths[0] : 0,\n value = this.__wrapped__,\n interceptor = function(object) { return baseAt(object, paths); };\n\n if (length > 1 || this.__actions__.length ||\n !(value instanceof LazyWrapper) || !isIndex(start)) {\n return this.thru(interceptor);\n }\n value = value.slice(start, +start + (length ? 1 : 0));\n value.__actions__.push({\n 'func': thru,\n 'args': [interceptor],\n 'thisArg': undefined\n });\n return new LodashWrapper(value, this.__chain__).thru(function(array) {\n if (length && !array.length) {\n array.push(undefined);\n }\n return array;\n });\n });\n\n /**\n * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.\n *\n * @name chain\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 }\n * ];\n *\n * // A sequence without explicit chaining.\n * _(users).head();\n * // => { 'user': 'barney', 'age': 36 }\n *\n * // A sequence with explicit chaining.\n * _(users)\n * .chain()\n * .head()\n * .pick('user')\n * .value();\n * // => { 'user': 'barney' }\n */\n function wrapperChain() {\n return chain(this);\n }\n\n /**\n * Executes the chain sequence and returns the wrapped result.\n *\n * @name commit\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2];\n * var wrapped = _(array).push(3);\n *\n * console.log(array);\n * // => [1, 2]\n *\n * wrapped = wrapped.commit();\n * console.log(array);\n * // => [1, 2, 3]\n *\n * wrapped.last();\n * // => 3\n *\n * console.log(array);\n * // => [1, 2, 3]\n */\n function wrapperCommit() {\n return new LodashWrapper(this.value(), this.__chain__);\n }\n\n /**\n * Gets the next value on a wrapped object following the\n * [iterator protocol](https://mdn.io/iteration_protocols#iterator).\n *\n * @name next\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the next iterator value.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 1 }\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 2 }\n *\n * wrapped.next();\n * // => { 'done': true, 'value': undefined }\n */\n function wrapperNext() {\n if (this.__values__ === undefined) {\n this.__values__ = toArray(this.value());\n }\n var done = this.__index__ >= this.__values__.length,\n value = done ? undefined : this.__values__[this.__index__++];\n\n return { 'done': done, 'value': value };\n }\n\n /**\n * Enables the wrapper to be iterable.\n *\n * @name Symbol.iterator\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the wrapper object.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped[Symbol.iterator]() === wrapped;\n * // => true\n *\n * Array.from(wrapped);\n * // => [1, 2]\n */\n function wrapperToIterator() {\n return this;\n }\n\n /**\n * Creates a clone of the chain sequence planting `value` as the wrapped value.\n *\n * @name plant\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @param {*} value The value to plant.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2]).map(square);\n * var other = wrapped.plant([3, 4]);\n *\n * other.value();\n * // => [9, 16]\n *\n * wrapped.value();\n * // => [1, 4]\n */\n function wrapperPlant(value) {\n var result,\n parent = this;\n\n while (parent instanceof baseLodash) {\n var clone = wrapperClone(parent);\n clone.__index__ = 0;\n clone.__values__ = undefined;\n if (result) {\n previous.__wrapped__ = clone;\n } else {\n result = clone;\n }\n var previous = clone;\n parent = parent.__wrapped__;\n }\n previous.__wrapped__ = value;\n return result;\n }\n\n /**\n * This method is the wrapper version of `_.reverse`.\n *\n * **Note:** This method mutates the wrapped array.\n *\n * @name reverse\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _(array).reverse().value()\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function wrapperReverse() {\n var value = this.__wrapped__;\n if (value instanceof LazyWrapper) {\n var wrapped = value;\n if (this.__actions__.length) {\n wrapped = new LazyWrapper(this);\n }\n wrapped = wrapped.reverse();\n wrapped.__actions__.push({\n 'func': thru,\n 'args': [reverse],\n 'thisArg': undefined\n });\n return new LodashWrapper(wrapped, this.__chain__);\n }\n return this.thru(reverse);\n }\n\n /**\n * Executes the chain sequence to resolve the unwrapped value.\n *\n * @name value\n * @memberOf _\n * @since 0.1.0\n * @alias toJSON, valueOf\n * @category Seq\n * @returns {*} Returns the resolved unwrapped value.\n * @example\n *\n * _([1, 2, 3]).value();\n * // => [1, 2, 3]\n */\n function wrapperValue() {\n return baseWrapperValue(this.__wrapped__, this.__actions__);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the number of times the key was returned by `iteratee`. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.countBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': 1, '6': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.countBy(['one', 'two', 'three'], 'length');\n * // => { '3': 2, '5': 1 }\n */\n var countBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n ++result[key];\n } else {\n baseAssignValue(result, key, 1);\n }\n });\n\n /**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\n function every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning an array of all elements\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * **Note:** Unlike `_.remove`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.reject\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * _.filter(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, { 'age': 36, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.filter(users, 'active');\n * // => objects for ['barney']\n */\n function filter(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning the first element\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false },\n * { 'user': 'pebbles', 'age': 1, 'active': true }\n * ];\n *\n * _.find(users, function(o) { return o.age < 40; });\n * // => object for 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.find(users, { 'age': 1, 'active': true });\n * // => object for 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.find(users, ['active', false]);\n * // => object for 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.find(users, 'active');\n * // => object for 'barney'\n */\n var find = createFind(findIndex);\n\n /**\n * This method is like `_.find` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=collection.length-1] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * _.findLast([1, 2, 3, 4], function(n) {\n * return n % 2 == 1;\n * });\n * // => 3\n */\n var findLast = createFind(findLastIndex);\n\n /**\n * Creates a flattened array of values by running each element in `collection`\n * thru `iteratee` and flattening the mapped results. The iteratee is invoked\n * with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [n, n];\n * }\n *\n * _.flatMap([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMap(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), 1);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDeep([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMapDeep(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), INFINITY);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDepth([1, 2], duplicate, 2);\n * // => [[1, 1], [2, 2]]\n */\n function flatMapDepth(collection, iteratee, depth) {\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(map(collection, iteratee), depth);\n }\n\n /**\n * Iterates over elements of `collection` and invokes `iteratee` for each element.\n * The iteratee is invoked with three arguments: (value, index|key, collection).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * **Note:** As with other \"Collections\" methods, objects with a \"length\"\n * property are iterated like arrays. To avoid this behavior use `_.forIn`\n * or `_.forOwn` for object iteration.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias each\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEachRight\n * @example\n *\n * _.forEach([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `1` then `2`.\n *\n * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forEach(collection, iteratee) {\n var func = isArray(collection) ? arrayEach : baseEach;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forEach` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @alias eachRight\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEach\n * @example\n *\n * _.forEachRight([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `2` then `1`.\n */\n function forEachRight(collection, iteratee) {\n var func = isArray(collection) ? arrayEachRight : baseEachRight;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The order of grouped values\n * is determined by the order they occur in `collection`. The corresponding\n * value of each key is an array of elements responsible for generating the\n * key. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.groupBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': [4.2], '6': [6.1, 6.3] }\n *\n * // The `_.property` iteratee shorthand.\n * _.groupBy(['one', 'two', 'three'], 'length');\n * // => { '3': ['one', 'two'], '5': ['three'] }\n */\n var groupBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n result[key].push(value);\n } else {\n baseAssignValue(result, key, [value]);\n }\n });\n\n /**\n * Checks if `value` is in `collection`. If `collection` is a string, it's\n * checked for a substring of `value`, otherwise\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * is used for equality comparisons. If `fromIndex` is negative, it's used as\n * the offset from the end of `collection`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {boolean} Returns `true` if `value` is found, else `false`.\n * @example\n *\n * _.includes([1, 2, 3], 1);\n * // => true\n *\n * _.includes([1, 2, 3], 1, 2);\n * // => false\n *\n * _.includes({ 'a': 1, 'b': 2 }, 1);\n * // => true\n *\n * _.includes('abcd', 'bc');\n * // => true\n */\n function includes(collection, value, fromIndex, guard) {\n collection = isArrayLike(collection) ? collection : values(collection);\n fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;\n\n var length = collection.length;\n if (fromIndex < 0) {\n fromIndex = nativeMax(length + fromIndex, 0);\n }\n return isString(collection)\n ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)\n : (!!length && baseIndexOf(collection, value, fromIndex) > -1);\n }\n\n /**\n * Invokes the method at `path` of each element in `collection`, returning\n * an array of the results of each invoked method. Any additional arguments\n * are provided to each invoked method. If `path` is a function, it's invoked\n * for, and `this` bound to, each element in `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array|Function|string} path The path of the method to invoke or\n * the function invoked per iteration.\n * @param {...*} [args] The arguments to invoke each method with.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');\n * // => [[1, 5, 7], [1, 2, 3]]\n *\n * _.invokeMap([123, 456], String.prototype.split, '');\n * // => [['1', '2', '3'], ['4', '5', '6']]\n */\n var invokeMap = baseRest(function(collection, path, args) {\n var index = -1,\n isFunc = typeof path == 'function',\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value) {\n result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);\n });\n return result;\n });\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the last element responsible for generating the key. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * var array = [\n * { 'dir': 'left', 'code': 97 },\n * { 'dir': 'right', 'code': 100 }\n * ];\n *\n * _.keyBy(array, function(o) {\n * return String.fromCharCode(o.code);\n * });\n * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }\n *\n * _.keyBy(array, 'dir');\n * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }\n */\n var keyBy = createAggregator(function(result, value, key) {\n baseAssignValue(result, key, value);\n });\n\n /**\n * Creates an array of values by running each element in `collection` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.\n *\n * The guarded methods are:\n * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,\n * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,\n * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,\n * `template`, `trim`, `trimEnd`, `trimStart`, and `words`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * _.map([4, 8], square);\n * // => [16, 64]\n *\n * _.map({ 'a': 4, 'b': 8 }, square);\n * // => [16, 64] (iteration order is not guaranteed)\n *\n * var users = [\n * { 'user': 'barney' },\n * { 'user': 'fred' }\n * ];\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, 'user');\n * // => ['barney', 'fred']\n */\n function map(collection, iteratee) {\n var func = isArray(collection) ? arrayMap : baseMap;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.sortBy` except that it allows specifying the sort\n * orders of the iteratees to sort by. If `orders` is unspecified, all values\n * are sorted in ascending order. Otherwise, specify an order of \"desc\" for\n * descending or \"asc\" for ascending sort order of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @param {string[]} [orders] The sort orders of `iteratees`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 34 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 36 }\n * ];\n *\n * // Sort by `user` in ascending order and by `age` in descending order.\n * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n */\n function orderBy(collection, iteratees, orders, guard) {\n if (collection == null) {\n return [];\n }\n if (!isArray(iteratees)) {\n iteratees = iteratees == null ? [] : [iteratees];\n }\n orders = guard ? undefined : orders;\n if (!isArray(orders)) {\n orders = orders == null ? [] : [orders];\n }\n return baseOrderBy(collection, iteratees, orders);\n }\n\n /**\n * Creates an array of elements split into two groups, the first of which\n * contains elements `predicate` returns truthy for, the second of which\n * contains elements `predicate` returns falsey for. The predicate is\n * invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of grouped elements.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true },\n * { 'user': 'pebbles', 'age': 1, 'active': false }\n * ];\n *\n * _.partition(users, function(o) { return o.active; });\n * // => objects for [['fred'], ['barney', 'pebbles']]\n *\n * // The `_.matches` iteratee shorthand.\n * _.partition(users, { 'age': 1, 'active': false });\n * // => objects for [['pebbles'], ['barney', 'fred']]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.partition(users, ['active', false]);\n * // => objects for [['barney', 'pebbles'], ['fred']]\n *\n * // The `_.property` iteratee shorthand.\n * _.partition(users, 'active');\n * // => objects for [['fred'], ['barney', 'pebbles']]\n */\n var partition = createAggregator(function(result, value, key) {\n result[key ? 0 : 1].push(value);\n }, function() { return [[], []]; });\n\n /**\n * Reduces `collection` to a value which is the accumulated result of running\n * each element in `collection` thru `iteratee`, where each successive\n * invocation is supplied the return value of the previous. If `accumulator`\n * is not given, the first element of `collection` is used as the initial\n * value. The iteratee is invoked with four arguments:\n * (accumulator, value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.reduce`, `_.reduceRight`, and `_.transform`.\n *\n * The guarded methods are:\n * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,\n * and `sortBy`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduceRight\n * @example\n *\n * _.reduce([1, 2], function(sum, n) {\n * return sum + n;\n * }, 0);\n * // => 3\n *\n * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * return result;\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)\n */\n function reduce(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduce : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);\n }\n\n /**\n * This method is like `_.reduce` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduce\n * @example\n *\n * var array = [[0, 1], [2, 3], [4, 5]];\n *\n * _.reduceRight(array, function(flattened, other) {\n * return flattened.concat(other);\n * }, []);\n * // => [4, 5, 2, 3, 0, 1]\n */\n function reduceRight(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduceRight : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);\n }\n\n /**\n * The opposite of `_.filter`; this method returns the elements of `collection`\n * that `predicate` does **not** return truthy for.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.filter\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true }\n * ];\n *\n * _.reject(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.reject(users, { 'age': 40, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.reject(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.reject(users, 'active');\n * // => objects for ['barney']\n */\n function reject(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, negate(getIteratee(predicate, 3)));\n }\n\n /**\n * Gets a random element from `collection`.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n * @example\n *\n * _.sample([1, 2, 3, 4]);\n * // => 2\n */\n function sample(collection) {\n var func = isArray(collection) ? arraySample : baseSample;\n return func(collection);\n }\n\n /**\n * Gets `n` random elements at unique keys from `collection` up to the\n * size of `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @param {number} [n=1] The number of elements to sample.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the random elements.\n * @example\n *\n * _.sampleSize([1, 2, 3], 2);\n * // => [3, 1]\n *\n * _.sampleSize([1, 2, 3], 4);\n * // => [2, 3, 1]\n */\n function sampleSize(collection, n, guard) {\n if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n var func = isArray(collection) ? arraySampleSize : baseSampleSize;\n return func(collection, n);\n }\n\n /**\n * Creates an array of shuffled values, using a version of the\n * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n * @example\n *\n * _.shuffle([1, 2, 3, 4]);\n * // => [4, 1, 3, 2]\n */\n function shuffle(collection) {\n var func = isArray(collection) ? arrayShuffle : baseShuffle;\n return func(collection);\n }\n\n /**\n * Gets the size of `collection` by returning its length for array-like\n * values or the number of own enumerable string keyed properties for objects.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @returns {number} Returns the collection size.\n * @example\n *\n * _.size([1, 2, 3]);\n * // => 3\n *\n * _.size({ 'a': 1, 'b': 2 });\n * // => 2\n *\n * _.size('pebbles');\n * // => 7\n */\n function size(collection) {\n if (collection == null) {\n return 0;\n }\n if (isArrayLike(collection)) {\n return isString(collection) ? stringSize(collection) : collection.length;\n }\n var tag = getTag(collection);\n if (tag == mapTag || tag == setTag) {\n return collection.size;\n }\n return baseKeys(collection).length;\n }\n\n /**\n * Checks if `predicate` returns truthy for **any** element of `collection`.\n * Iteration is stopped once `predicate` returns truthy. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n * @example\n *\n * _.some([null, 0, 'yes', false], Boolean);\n * // => true\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.some(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.some(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.some(users, 'active');\n * // => true\n */\n function some(collection, predicate, guard) {\n var func = isArray(collection) ? arraySome : baseSome;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]\n */\n var sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\n var now = ctxNow || function() {\n return root.Date.now();\n };\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The opposite of `_.before`; this method creates a function that invokes\n * `func` once it's called `n` or more times.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {number} n The number of calls before `func` is invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var saves = ['profile', 'settings'];\n *\n * var done = _.after(saves.length, function() {\n * console.log('done saving!');\n * });\n *\n * _.forEach(saves, function(type) {\n * asyncSave({ 'type': type, 'complete': done });\n * });\n * // => Logs 'done saving!' after the two async saves have completed.\n */\n function after(n, func) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n < 1) {\n return func.apply(this, arguments);\n }\n };\n }\n\n /**\n * Creates a function that invokes `func`, with up to `n` arguments,\n * ignoring any additional arguments.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @param {number} [n=func.length] The arity cap.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.ary(parseInt, 1));\n * // => [6, 8, 10]\n */\n function ary(func, n, guard) {\n n = guard ? undefined : n;\n n = (func && n == null) ? func.length : n;\n return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);\n }\n\n /**\n * Creates a function that invokes `func`, with the `this` binding and arguments\n * of the created function, while it's called less than `n` times. Subsequent\n * calls to the created function return the result of the last `func` invocation.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {number} n The number of calls at which `func` is no longer invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * jQuery(element).on('click', _.before(5, addContactToList));\n * // => Allows adding up to 4 contacts to the list.\n */\n function before(n, func) {\n var result;\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n > 0) {\n result = func.apply(this, arguments);\n }\n if (n <= 1) {\n func = undefined;\n }\n return result;\n };\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of `thisArg`\n * and `partials` prepended to the arguments it receives.\n *\n * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for partially applied arguments.\n *\n * **Note:** Unlike native `Function#bind`, this method doesn't set the \"length\"\n * property of bound functions.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to bind.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * function greet(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n *\n * var object = { 'user': 'fred' };\n *\n * var bound = _.bind(greet, object, 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bind(greet, object, _, '!');\n * bound('hi');\n * // => 'hi fred!'\n */\n var bind = baseRest(function(func, thisArg, partials) {\n var bitmask = WRAP_BIND_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bind));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(func, bitmask, thisArg, partials, holders);\n });\n\n /**\n * Creates a function that invokes the method at `object[key]` with `partials`\n * prepended to the arguments it receives.\n *\n * This method differs from `_.bind` by allowing bound functions to reference\n * methods that may be redefined or don't yet exist. See\n * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)\n * for more details.\n *\n * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Function\n * @param {Object} object The object to invoke the method on.\n * @param {string} key The key of the method.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * var object = {\n * 'user': 'fred',\n * 'greet': function(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n * };\n *\n * var bound = _.bindKey(object, 'greet', 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * object.greet = function(greeting, punctuation) {\n * return greeting + 'ya ' + this.user + punctuation;\n * };\n *\n * bound('!');\n * // => 'hiya fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bindKey(object, 'greet', _, '!');\n * bound('hi');\n * // => 'hiya fred!'\n */\n var bindKey = baseRest(function(object, key, partials) {\n var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bindKey));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(key, bitmask, object, partials, holders);\n });\n\n /**\n * Creates a function that accepts arguments of `func` and either invokes\n * `func` returning its result, if at least `arity` number of arguments have\n * been provided, or returns a function that accepts the remaining `func`\n * arguments, and so on. The arity of `func` may be specified if `func.length`\n * is not sufficient.\n *\n * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curry(abc);\n *\n * curried(1)(2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(1)(_, 3)(2);\n * // => [1, 2, 3]\n */\n function curry(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curry.placeholder;\n return result;\n }\n\n /**\n * This method is like `_.curry` except that arguments are applied to `func`\n * in the manner of `_.partialRight` instead of `_.partial`.\n *\n * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curryRight(abc);\n *\n * curried(3)(2)(1);\n * // => [1, 2, 3]\n *\n * curried(2, 3)(1);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(3)(1, _)(2);\n * // => [1, 2, 3]\n */\n function curryRight(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curryRight.placeholder;\n return result;\n }\n\n /**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\n function debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n timeWaiting = wait - timeSinceLastCall;\n\n return maxing\n ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)\n : timeWaiting;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n clearTimeout(timerId);\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n }\n\n /**\n * Defers invoking the `func` until the current call stack has cleared. Any\n * additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to defer.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.defer(function(text) {\n * console.log(text);\n * }, 'deferred');\n * // => Logs 'deferred' after one millisecond.\n */\n var defer = baseRest(function(func, args) {\n return baseDelay(func, 1, args);\n });\n\n /**\n * Invokes `func` after `wait` milliseconds. Any additional arguments are\n * provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.delay(function(text) {\n * console.log(text);\n * }, 1000, 'later');\n * // => Logs 'later' after one second.\n */\n var delay = baseRest(function(func, wait, args) {\n return baseDelay(func, toNumber(wait) || 0, args);\n });\n\n /**\n * Creates a function that invokes `func` with arguments reversed.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to flip arguments for.\n * @returns {Function} Returns the new flipped function.\n * @example\n *\n * var flipped = _.flip(function() {\n * return _.toArray(arguments);\n * });\n *\n * flipped('a', 'b', 'c', 'd');\n * // => ['d', 'c', 'b', 'a']\n */\n function flip(func) {\n return createWrap(func, WRAP_FLIP_FLAG);\n }\n\n /**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `clear`, `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\n function memoize(func, resolver) {\n if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var memoized = function() {\n var args = arguments,\n key = resolver ? resolver.apply(this, args) : args[0],\n cache = memoized.cache;\n\n if (cache.has(key)) {\n return cache.get(key);\n }\n var result = func.apply(this, args);\n memoized.cache = cache.set(key, result) || cache;\n return result;\n };\n memoized.cache = new (memoize.Cache || MapCache);\n return memoized;\n }\n\n // Expose `MapCache`.\n memoize.Cache = MapCache;\n\n /**\n * Creates a function that negates the result of the predicate `func`. The\n * `func` predicate is invoked with the `this` binding and arguments of the\n * created function.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} predicate The predicate to negate.\n * @returns {Function} Returns the new negated function.\n * @example\n *\n * function isEven(n) {\n * return n % 2 == 0;\n * }\n *\n * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));\n * // => [1, 3, 5]\n */\n function negate(predicate) {\n if (typeof predicate != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return function() {\n var args = arguments;\n switch (args.length) {\n case 0: return !predicate.call(this);\n case 1: return !predicate.call(this, args[0]);\n case 2: return !predicate.call(this, args[0], args[1]);\n case 3: return !predicate.call(this, args[0], args[1], args[2]);\n }\n return !predicate.apply(this, args);\n };\n }\n\n /**\n * Creates a function that is restricted to invoking `func` once. Repeat calls\n * to the function return the value of the first invocation. The `func` is\n * invoked with the `this` binding and arguments of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var initialize = _.once(createApplication);\n * initialize();\n * initialize();\n * // => `createApplication` is invoked once\n */\n function once(func) {\n return before(2, func);\n }\n\n /**\n * Creates a function that invokes `func` with its arguments transformed.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Function\n * @param {Function} func The function to wrap.\n * @param {...(Function|Function[])} [transforms=[_.identity]]\n * The argument transforms.\n * @returns {Function} Returns the new function.\n * @example\n *\n * function doubled(n) {\n * return n * 2;\n * }\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var func = _.overArgs(function(x, y) {\n * return [x, y];\n * }, [square, doubled]);\n *\n * func(9, 3);\n * // => [81, 6]\n *\n * func(10, 5);\n * // => [100, 10]\n */\n var overArgs = castRest(function(func, transforms) {\n transforms = (transforms.length == 1 && isArray(transforms[0]))\n ? arrayMap(transforms[0], baseUnary(getIteratee()))\n : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));\n\n var funcsLength = transforms.length;\n return baseRest(function(args) {\n var index = -1,\n length = nativeMin(args.length, funcsLength);\n\n while (++index < length) {\n args[index] = transforms[index].call(this, args[index]);\n }\n return apply(func, this, args);\n });\n });\n\n /**\n * Creates a function that invokes `func` with `partials` prepended to the\n * arguments it receives. This method is like `_.bind` except it does **not**\n * alter the `this` binding.\n *\n * The `_.partial.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 0.2.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var sayHelloTo = _.partial(greet, 'hello');\n * sayHelloTo('fred');\n * // => 'hello fred'\n *\n * // Partially applied with placeholders.\n * var greetFred = _.partial(greet, _, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n */\n var partial = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partial));\n return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);\n });\n\n /**\n * This method is like `_.partial` except that partially applied arguments\n * are appended to the arguments it receives.\n *\n * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var greetFred = _.partialRight(greet, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n *\n * // Partially applied with placeholders.\n * var sayHelloTo = _.partialRight(greet, 'hello', _);\n * sayHelloTo('fred');\n * // => 'hello fred'\n */\n var partialRight = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partialRight));\n return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);\n });\n\n /**\n * Creates a function that invokes `func` with arguments arranged according\n * to the specified `indexes` where the argument value at the first index is\n * provided as the first argument, the argument value at the second index is\n * provided as the second argument, and so on.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to rearrange arguments for.\n * @param {...(number|number[])} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var rearged = _.rearg(function(a, b, c) {\n * return [a, b, c];\n * }, [2, 0, 1]);\n *\n * rearged('b', 'c', 'a')\n * // => ['a', 'b', 'c']\n */\n var rearg = flatRest(function(func, indexes) {\n return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);\n });\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * created function and arguments from `start` and beyond provided as\n * an array.\n *\n * **Note:** This method is based on the\n * [rest parameter](https://mdn.io/rest_parameters).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.rest(function(what, names) {\n * return what + ' ' + _.initial(names).join(', ') +\n * (_.size(names) > 1 ? ', & ' : '') + _.last(names);\n * });\n *\n * say('hello', 'fred', 'barney', 'pebbles');\n * // => 'hello fred, barney, & pebbles'\n */\n function rest(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start === undefined ? start : toInteger(start);\n return baseRest(func, start);\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * create function and an array of arguments much like\n * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).\n *\n * **Note:** This method is based on the\n * [spread operator](https://mdn.io/spread_operator).\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Function\n * @param {Function} func The function to spread arguments over.\n * @param {number} [start=0] The start position of the spread.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.spread(function(who, what) {\n * return who + ' says ' + what;\n * });\n *\n * say(['fred', 'hello']);\n * // => 'fred says hello'\n *\n * var numbers = Promise.all([\n * Promise.resolve(40),\n * Promise.resolve(36)\n * ]);\n *\n * numbers.then(_.spread(function(x, y) {\n * return x + y;\n * }));\n * // => a Promise of 76\n */\n function spread(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start == null ? 0 : nativeMax(toInteger(start), 0);\n return baseRest(function(args) {\n var array = args[start],\n otherArgs = castSlice(args, 0, start);\n\n if (array) {\n arrayPush(otherArgs, array);\n }\n return apply(func, this, otherArgs);\n });\n }\n\n /**\n * Creates a throttled function that only invokes `func` at most once per\n * every `wait` milliseconds. The throttled function comes with a `cancel`\n * method to cancel delayed `func` invocations and a `flush` method to\n * immediately invoke them. Provide `options` to indicate whether `func`\n * should be invoked on the leading and/or trailing edge of the `wait`\n * timeout. The `func` is invoked with the last arguments provided to the\n * throttled function. Subsequent calls to the throttled function return the\n * result of the last `func` invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the throttled function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.throttle` and `_.debounce`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to throttle.\n * @param {number} [wait=0] The number of milliseconds to throttle invocations to.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=true]\n * Specify invoking on the leading edge of the timeout.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new throttled function.\n * @example\n *\n * // Avoid excessively updating the position while scrolling.\n * jQuery(window).on('scroll', _.throttle(updatePosition, 100));\n *\n * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.\n * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });\n * jQuery(element).on('click', throttled);\n *\n * // Cancel the trailing throttled invocation.\n * jQuery(window).on('popstate', throttled.cancel);\n */\n function throttle(func, wait, options) {\n var leading = true,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (isObject(options)) {\n leading = 'leading' in options ? !!options.leading : leading;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n return debounce(func, wait, {\n 'leading': leading,\n 'maxWait': wait,\n 'trailing': trailing\n });\n }\n\n /**\n * Creates a function that accepts up to one argument, ignoring any\n * additional arguments.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.unary(parseInt));\n * // => [6, 8, 10]\n */\n function unary(func) {\n return ary(func, 1);\n }\n\n /**\n * Creates a function that provides `value` to `wrapper` as its first\n * argument. Any additional arguments provided to the function are appended\n * to those provided to the `wrapper`. The wrapper is invoked with the `this`\n * binding of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {*} value The value to wrap.\n * @param {Function} [wrapper=identity] The wrapper function.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var p = _.wrap(_.escape, function(func, text) {\n * return '' + func(text) + '
';\n * });\n *\n * p('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles
'\n */\n function wrap(value, wrapper) {\n return partial(castFunction(wrapper), value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Casts `value` as an array if it's not one.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Lang\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast array.\n * @example\n *\n * _.castArray(1);\n * // => [1]\n *\n * _.castArray({ 'a': 1 });\n * // => [{ 'a': 1 }]\n *\n * _.castArray('abc');\n * // => ['abc']\n *\n * _.castArray(null);\n * // => [null]\n *\n * _.castArray(undefined);\n * // => [undefined]\n *\n * _.castArray();\n * // => []\n *\n * var array = [1, 2, 3];\n * console.log(_.castArray(array) === array);\n * // => true\n */\n function castArray() {\n if (!arguments.length) {\n return [];\n }\n var value = arguments[0];\n return isArray(value) ? value : [value];\n }\n\n /**\n * Creates a shallow clone of `value`.\n *\n * **Note:** This method is loosely based on the\n * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)\n * and supports cloning arrays, array buffers, booleans, date objects, maps,\n * numbers, `Object` objects, regexes, sets, strings, symbols, and typed\n * arrays. The own enumerable properties of `arguments` objects are cloned\n * as plain objects. An empty object is returned for uncloneable values such\n * as error objects, functions, DOM nodes, and WeakMaps.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to clone.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeep\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var shallow = _.clone(objects);\n * console.log(shallow[0] === objects[0]);\n * // => true\n */\n function clone(value) {\n return baseClone(value, CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.clone` except that it accepts `customizer` which\n * is invoked to produce the cloned value. If `customizer` returns `undefined`,\n * cloning is handled by the method instead. The `customizer` is invoked with\n * up to four arguments; (value [, index|key, object, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeepWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(false);\n * }\n * }\n *\n * var el = _.cloneWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 0\n */\n function cloneWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\n function cloneDeep(value) {\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.cloneWith` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the deep cloned value.\n * @see _.cloneWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(true);\n * }\n * }\n *\n * var el = _.cloneDeepWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 20\n */\n function cloneDeepWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * Checks if `object` conforms to `source` by invoking the predicate\n * properties of `source` with the corresponding property values of `object`.\n *\n * **Note:** This method is equivalent to `_.conforms` when `source` is\n * partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 1; } });\n * // => true\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 2; } });\n * // => false\n */\n function conformsTo(object, source) {\n return source == null || baseConformsTo(object, source, keys(source));\n }\n\n /**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\n function eq(value, other) {\n return value === other || (value !== value && other !== other);\n }\n\n /**\n * Checks if `value` is greater than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n * @see _.lt\n * @example\n *\n * _.gt(3, 1);\n * // => true\n *\n * _.gt(3, 3);\n * // => false\n *\n * _.gt(1, 3);\n * // => false\n */\n var gt = createRelationalOperation(baseGt);\n\n /**\n * Checks if `value` is greater than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than or equal to\n * `other`, else `false`.\n * @see _.lte\n * @example\n *\n * _.gte(3, 1);\n * // => true\n *\n * _.gte(3, 3);\n * // => true\n *\n * _.gte(1, 3);\n * // => false\n */\n var gte = createRelationalOperation(function(value, other) {\n return value >= other;\n });\n\n /**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\n var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n };\n\n /**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\n var isArray = Array.isArray;\n\n /**\n * Checks if `value` is classified as an `ArrayBuffer` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n * @example\n *\n * _.isArrayBuffer(new ArrayBuffer(2));\n * // => true\n *\n * _.isArrayBuffer(new Array(2));\n * // => false\n */\n var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;\n\n /**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\n function isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n }\n\n /**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n * else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\n function isArrayLikeObject(value) {\n return isObjectLike(value) && isArrayLike(value);\n }\n\n /**\n * Checks if `value` is classified as a boolean primitive or object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.\n * @example\n *\n * _.isBoolean(false);\n * // => true\n *\n * _.isBoolean(null);\n * // => false\n */\n function isBoolean(value) {\n return value === true || value === false ||\n (isObjectLike(value) && baseGetTag(value) == boolTag);\n }\n\n /**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\n var isBuffer = nativeIsBuffer || stubFalse;\n\n /**\n * Checks if `value` is classified as a `Date` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n * @example\n *\n * _.isDate(new Date);\n * // => true\n *\n * _.isDate('Mon April 23 2012');\n * // => false\n */\n var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;\n\n /**\n * Checks if `value` is likely a DOM element.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.\n * @example\n *\n * _.isElement(document.body);\n * // => true\n *\n * _.isElement('');\n * // => false\n */\n function isElement(value) {\n return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);\n }\n\n /**\n * Checks if `value` is an empty object, collection, map, or set.\n *\n * Objects are considered empty if they have no own enumerable string keyed\n * properties.\n *\n * Array-like values such as `arguments` objects, arrays, buffers, strings, or\n * jQuery-like collections are considered empty if they have a `length` of `0`.\n * Similarly, maps and sets are considered empty if they have a `size` of `0`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is empty, else `false`.\n * @example\n *\n * _.isEmpty(null);\n * // => true\n *\n * _.isEmpty(true);\n * // => true\n *\n * _.isEmpty(1);\n * // => true\n *\n * _.isEmpty([1, 2, 3]);\n * // => false\n *\n * _.isEmpty({ 'a': 1 });\n * // => false\n */\n function isEmpty(value) {\n if (value == null) {\n return true;\n }\n if (isArrayLike(value) &&\n (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||\n isBuffer(value) || isTypedArray(value) || isArguments(value))) {\n return !value.length;\n }\n var tag = getTag(value);\n if (tag == mapTag || tag == setTag) {\n return !value.size;\n }\n if (isPrototype(value)) {\n return !baseKeys(value).length;\n }\n for (var key in value) {\n if (hasOwnProperty.call(value, key)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\n function isEqual(value, other) {\n return baseIsEqual(value, other);\n }\n\n /**\n * This method is like `_.isEqual` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with up to\n * six arguments: (objValue, othValue [, index|key, object, other, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, othValue) {\n * if (isGreeting(objValue) && isGreeting(othValue)) {\n * return true;\n * }\n * }\n *\n * var array = ['hello', 'goodbye'];\n * var other = ['hi', 'goodbye'];\n *\n * _.isEqualWith(array, other, customizer);\n * // => true\n */\n function isEqualWith(value, other, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n var result = customizer ? customizer(value, other) : undefined;\n return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;\n }\n\n /**\n * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,\n * `SyntaxError`, `TypeError`, or `URIError` object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an error object, else `false`.\n * @example\n *\n * _.isError(new Error);\n * // => true\n *\n * _.isError(Error);\n * // => false\n */\n function isError(value) {\n if (!isObjectLike(value)) {\n return false;\n }\n var tag = baseGetTag(value);\n return tag == errorTag || tag == domExcTag ||\n (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));\n }\n\n /**\n * Checks if `value` is a finite primitive number.\n *\n * **Note:** This method is based on\n * [`Number.isFinite`](https://mdn.io/Number/isFinite).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.\n * @example\n *\n * _.isFinite(3);\n * // => true\n *\n * _.isFinite(Number.MIN_VALUE);\n * // => true\n *\n * _.isFinite(Infinity);\n * // => false\n *\n * _.isFinite('3');\n * // => false\n */\n function isFinite(value) {\n return typeof value == 'number' && nativeIsFinite(value);\n }\n\n /**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\n function isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n }\n\n /**\n * Checks if `value` is an integer.\n *\n * **Note:** This method is based on\n * [`Number.isInteger`](https://mdn.io/Number/isInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an integer, else `false`.\n * @example\n *\n * _.isInteger(3);\n * // => true\n *\n * _.isInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isInteger(Infinity);\n * // => false\n *\n * _.isInteger('3');\n * // => false\n */\n function isInteger(value) {\n return typeof value == 'number' && value == toInteger(value);\n }\n\n /**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\n function isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\n function isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n }\n\n /**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\n function isObjectLike(value) {\n return value != null && typeof value == 'object';\n }\n\n /**\n * Checks if `value` is classified as a `Map` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n * @example\n *\n * _.isMap(new Map);\n * // => true\n *\n * _.isMap(new WeakMap);\n * // => false\n */\n var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;\n\n /**\n * Performs a partial deep comparison between `object` and `source` to\n * determine if `object` contains equivalent property values.\n *\n * **Note:** This method is equivalent to `_.matches` when `source` is\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.isMatch(object, { 'b': 2 });\n * // => true\n *\n * _.isMatch(object, { 'b': 1 });\n * // => false\n */\n function isMatch(object, source) {\n return object === source || baseIsMatch(object, source, getMatchData(source));\n }\n\n /**\n * This method is like `_.isMatch` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with five\n * arguments: (objValue, srcValue, index|key, object, source).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, srcValue) {\n * if (isGreeting(objValue) && isGreeting(srcValue)) {\n * return true;\n * }\n * }\n *\n * var object = { 'greeting': 'hello' };\n * var source = { 'greeting': 'hi' };\n *\n * _.isMatchWith(object, source, customizer);\n * // => true\n */\n function isMatchWith(object, source, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseIsMatch(object, source, getMatchData(source), customizer);\n }\n\n /**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\n function isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n }\n\n /**\n * Checks if `value` is a pristine native function.\n *\n * **Note:** This method can't reliably detect native functions in the presence\n * of the core-js package because core-js circumvents this kind of detection.\n * Despite multiple requests, the core-js maintainer has made it clear: any\n * attempt to fix the detection will be obstructed. As a result, we're left\n * with little choice but to throw an error. Unfortunately, this also affects\n * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),\n * which rely on core-js.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n * @example\n *\n * _.isNative(Array.prototype.push);\n * // => true\n *\n * _.isNative(_);\n * // => false\n */\n function isNative(value) {\n if (isMaskable(value)) {\n throw new Error(CORE_ERROR_TEXT);\n }\n return baseIsNative(value);\n }\n\n /**\n * Checks if `value` is `null`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `null`, else `false`.\n * @example\n *\n * _.isNull(null);\n * // => true\n *\n * _.isNull(void 0);\n * // => false\n */\n function isNull(value) {\n return value === null;\n }\n\n /**\n * Checks if `value` is `null` or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is nullish, else `false`.\n * @example\n *\n * _.isNil(null);\n * // => true\n *\n * _.isNil(void 0);\n * // => true\n *\n * _.isNil(NaN);\n * // => false\n */\n function isNil(value) {\n return value == null;\n }\n\n /**\n * Checks if `value` is classified as a `Number` primitive or object.\n *\n * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are\n * classified as numbers, use the `_.isFinite` method.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a number, else `false`.\n * @example\n *\n * _.isNumber(3);\n * // => true\n *\n * _.isNumber(Number.MIN_VALUE);\n * // => true\n *\n * _.isNumber(Infinity);\n * // => true\n *\n * _.isNumber('3');\n * // => false\n */\n function isNumber(value) {\n return typeof value == 'number' ||\n (isObjectLike(value) && baseGetTag(value) == numberTag);\n }\n\n /**\n * Checks if `value` is a plain object, that is, an object created by the\n * `Object` constructor or one with a `[[Prototype]]` of `null`.\n *\n * @static\n * @memberOf _\n * @since 0.8.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * _.isPlainObject(new Foo);\n * // => false\n *\n * _.isPlainObject([1, 2, 3]);\n * // => false\n *\n * _.isPlainObject({ 'x': 0, 'y': 0 });\n * // => true\n *\n * _.isPlainObject(Object.create(null));\n * // => true\n */\n function isPlainObject(value) {\n if (!isObjectLike(value) || baseGetTag(value) != objectTag) {\n return false;\n }\n var proto = getPrototype(value);\n if (proto === null) {\n return true;\n }\n var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;\n return typeof Ctor == 'function' && Ctor instanceof Ctor &&\n funcToString.call(Ctor) == objectCtorString;\n }\n\n /**\n * Checks if `value` is classified as a `RegExp` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n * @example\n *\n * _.isRegExp(/abc/);\n * // => true\n *\n * _.isRegExp('/abc/');\n * // => false\n */\n var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;\n\n /**\n * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754\n * double precision number which isn't the result of a rounded unsafe integer.\n *\n * **Note:** This method is based on\n * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.\n * @example\n *\n * _.isSafeInteger(3);\n * // => true\n *\n * _.isSafeInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isSafeInteger(Infinity);\n * // => false\n *\n * _.isSafeInteger('3');\n * // => false\n */\n function isSafeInteger(value) {\n return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is classified as a `Set` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n * @example\n *\n * _.isSet(new Set);\n * // => true\n *\n * _.isSet(new WeakSet);\n * // => false\n */\n var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;\n\n /**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\n function isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n }\n\n /**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\n function isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n }\n\n /**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\n var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n /**\n * Checks if `value` is `undefined`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.\n * @example\n *\n * _.isUndefined(void 0);\n * // => true\n *\n * _.isUndefined(null);\n * // => false\n */\n function isUndefined(value) {\n return value === undefined;\n }\n\n /**\n * Checks if `value` is classified as a `WeakMap` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.\n * @example\n *\n * _.isWeakMap(new WeakMap);\n * // => true\n *\n * _.isWeakMap(new Map);\n * // => false\n */\n function isWeakMap(value) {\n return isObjectLike(value) && getTag(value) == weakMapTag;\n }\n\n /**\n * Checks if `value` is classified as a `WeakSet` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.\n * @example\n *\n * _.isWeakSet(new WeakSet);\n * // => true\n *\n * _.isWeakSet(new Set);\n * // => false\n */\n function isWeakSet(value) {\n return isObjectLike(value) && baseGetTag(value) == weakSetTag;\n }\n\n /**\n * Checks if `value` is less than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n * @see _.gt\n * @example\n *\n * _.lt(1, 3);\n * // => true\n *\n * _.lt(3, 3);\n * // => false\n *\n * _.lt(3, 1);\n * // => false\n */\n var lt = createRelationalOperation(baseLt);\n\n /**\n * Checks if `value` is less than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than or equal to\n * `other`, else `false`.\n * @see _.gte\n * @example\n *\n * _.lte(1, 3);\n * // => true\n *\n * _.lte(3, 3);\n * // => true\n *\n * _.lte(3, 1);\n * // => false\n */\n var lte = createRelationalOperation(function(value, other) {\n return value <= other;\n });\n\n /**\n * Converts `value` to an array.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Array} Returns the converted array.\n * @example\n *\n * _.toArray({ 'a': 1, 'b': 2 });\n * // => [1, 2]\n *\n * _.toArray('abc');\n * // => ['a', 'b', 'c']\n *\n * _.toArray(1);\n * // => []\n *\n * _.toArray(null);\n * // => []\n */\n function toArray(value) {\n if (!value) {\n return [];\n }\n if (isArrayLike(value)) {\n return isString(value) ? stringToArray(value) : copyArray(value);\n }\n if (symIterator && value[symIterator]) {\n return iteratorToArray(value[symIterator]());\n }\n var tag = getTag(value),\n func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);\n\n return func(value);\n }\n\n /**\n * Converts `value` to a finite number.\n *\n * @static\n * @memberOf _\n * @since 4.12.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted number.\n * @example\n *\n * _.toFinite(3.2);\n * // => 3.2\n *\n * _.toFinite(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toFinite(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toFinite('3.2');\n * // => 3.2\n */\n function toFinite(value) {\n if (!value) {\n return value === 0 ? value : 0;\n }\n value = toNumber(value);\n if (value === INFINITY || value === -INFINITY) {\n var sign = (value < 0 ? -1 : 1);\n return sign * MAX_INTEGER;\n }\n return value === value ? value : 0;\n }\n\n /**\n * Converts `value` to an integer.\n *\n * **Note:** This method is loosely based on\n * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toInteger(3.2);\n * // => 3\n *\n * _.toInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toInteger(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toInteger('3.2');\n * // => 3\n */\n function toInteger(value) {\n var result = toFinite(value),\n remainder = result % 1;\n\n return result === result ? (remainder ? result - remainder : result) : 0;\n }\n\n /**\n * Converts `value` to an integer suitable for use as the length of an\n * array-like object.\n *\n * **Note:** This method is based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toLength(3.2);\n * // => 3\n *\n * _.toLength(Number.MIN_VALUE);\n * // => 0\n *\n * _.toLength(Infinity);\n * // => 4294967295\n *\n * _.toLength('3.2');\n * // => 3\n */\n function toLength(value) {\n return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;\n }\n\n /**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\n function toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = value.replace(reTrim, '');\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n }\n\n /**\n * Converts `value` to a plain object flattening inherited enumerable string\n * keyed properties of `value` to own properties of the plain object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Object} Returns the converted plain object.\n * @example\n *\n * function Foo() {\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.assign({ 'a': 1 }, new Foo);\n * // => { 'a': 1, 'b': 2 }\n *\n * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));\n * // => { 'a': 1, 'b': 2, 'c': 3 }\n */\n function toPlainObject(value) {\n return copyObject(value, keysIn(value));\n }\n\n /**\n * Converts `value` to a safe integer. A safe integer can be compared and\n * represented correctly.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toSafeInteger(3.2);\n * // => 3\n *\n * _.toSafeInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toSafeInteger(Infinity);\n * // => 9007199254740991\n *\n * _.toSafeInteger('3.2');\n * // => 3\n */\n function toSafeInteger(value) {\n return value\n ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)\n : (value === 0 ? value : 0);\n }\n\n /**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\n function toString(value) {\n return value == null ? '' : baseToString(value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Assigns own enumerable string keyed properties of source objects to the\n * destination object. Source objects are applied from left to right.\n * Subsequent sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object` and is loosely based on\n * [`Object.assign`](https://mdn.io/Object/assign).\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assignIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assign({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'c': 3 }\n */\n var assign = createAssigner(function(object, source) {\n if (isPrototype(source) || isArrayLike(source)) {\n copyObject(source, keys(source), object);\n return;\n }\n for (var key in source) {\n if (hasOwnProperty.call(source, key)) {\n assignValue(object, key, source[key]);\n }\n }\n });\n\n /**\n * This method is like `_.assign` except that it iterates over own and\n * inherited source properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extend\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assign\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assignIn({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }\n */\n var assignIn = createAssigner(function(object, source) {\n copyObject(source, keysIn(source), object);\n });\n\n /**\n * This method is like `_.assignIn` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extendWith\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignInWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keysIn(source), object, customizer);\n });\n\n /**\n * This method is like `_.assign` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignInWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keys(source), object, customizer);\n });\n\n /**\n * Creates an array of values corresponding to `paths` of `object`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Array} Returns the picked values.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _.at(object, ['a[0].b.c', 'a[1]']);\n * // => [3, 4]\n */\n var at = flatRest(baseAt);\n\n /**\n * Creates an object that inherits from the `prototype` object. If a\n * `properties` object is given, its own enumerable string keyed properties\n * are assigned to the created object.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Object\n * @param {Object} prototype The object to inherit from.\n * @param {Object} [properties] The properties to assign to the object.\n * @returns {Object} Returns the new object.\n * @example\n *\n * function Shape() {\n * this.x = 0;\n * this.y = 0;\n * }\n *\n * function Circle() {\n * Shape.call(this);\n * }\n *\n * Circle.prototype = _.create(Shape.prototype, {\n * 'constructor': Circle\n * });\n *\n * var circle = new Circle;\n * circle instanceof Circle;\n * // => true\n *\n * circle instanceof Shape;\n * // => true\n */\n function create(prototype, properties) {\n var result = baseCreate(prototype);\n return properties == null ? result : baseAssign(result, properties);\n }\n\n /**\n * Assigns own and inherited enumerable string keyed properties of source\n * objects to the destination object for all destination properties that\n * resolve to `undefined`. Source objects are applied from left to right.\n * Once a property is set, additional values of the same property are ignored.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaultsDeep\n * @example\n *\n * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var defaults = baseRest(function(object, sources) {\n object = Object(object);\n\n var index = -1;\n var length = sources.length;\n var guard = length > 2 ? sources[2] : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n length = 1;\n }\n\n while (++index < length) {\n var source = sources[index];\n var props = keysIn(source);\n var propsIndex = -1;\n var propsLength = props.length;\n\n while (++propsIndex < propsLength) {\n var key = props[propsIndex];\n var value = object[key];\n\n if (value === undefined ||\n (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n object[key] = source[key];\n }\n }\n }\n\n return object;\n });\n\n /**\n * This method is like `_.defaults` except that it recursively assigns\n * default properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaults\n * @example\n *\n * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });\n * // => { 'a': { 'b': 2, 'c': 3 } }\n */\n var defaultsDeep = baseRest(function(args) {\n args.push(undefined, customDefaultsMerge);\n return apply(mergeWith, undefined, args);\n });\n\n /**\n * This method is like `_.find` except that it returns the key of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findKey(users, function(o) { return o.age < 40; });\n * // => 'barney' (iteration order is not guaranteed)\n *\n * // The `_.matches` iteratee shorthand.\n * _.findKey(users, { 'age': 1, 'active': true });\n * // => 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findKey(users, 'active');\n * // => 'barney'\n */\n function findKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);\n }\n\n /**\n * This method is like `_.findKey` except that it iterates over elements of\n * a collection in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findLastKey(users, function(o) { return o.age < 40; });\n * // => returns 'pebbles' assuming `_.findKey` returns 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastKey(users, { 'age': 36, 'active': true });\n * // => 'barney'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastKey(users, 'active');\n * // => 'pebbles'\n */\n function findLastKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);\n }\n\n /**\n * Iterates over own and inherited enumerable string keyed properties of an\n * object and invokes `iteratee` for each property. The iteratee is invoked\n * with three arguments: (value, key, object). Iteratee functions may exit\n * iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forInRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forIn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).\n */\n function forIn(object, iteratee) {\n return object == null\n ? object\n : baseFor(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * This method is like `_.forIn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forInRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.\n */\n function forInRight(object, iteratee) {\n return object == null\n ? object\n : baseForRight(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * Iterates over own enumerable string keyed properties of an object and\n * invokes `iteratee` for each property. The iteratee is invoked with three\n * arguments: (value, key, object). Iteratee functions may exit iteration\n * early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwnRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forOwn(object, iteratee) {\n return object && baseForOwn(object, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forOwn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwnRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.\n */\n function forOwnRight(object, iteratee) {\n return object && baseForOwnRight(object, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an array of function property names from own enumerable properties\n * of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functionsIn\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functions(new Foo);\n * // => ['a', 'b']\n */\n function functions(object) {\n return object == null ? [] : baseFunctions(object, keys(object));\n }\n\n /**\n * Creates an array of function property names from own and inherited\n * enumerable properties of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functions\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functionsIn(new Foo);\n * // => ['a', 'b', 'c']\n */\n function functionsIn(object) {\n return object == null ? [] : baseFunctions(object, keysIn(object));\n }\n\n /**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\n function get(object, path, defaultValue) {\n var result = object == null ? undefined : baseGet(object, path);\n return result === undefined ? defaultValue : result;\n }\n\n /**\n * Checks if `path` is a direct property of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = { 'a': { 'b': 2 } };\n * var other = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.has(object, 'a');\n * // => true\n *\n * _.has(object, 'a.b');\n * // => true\n *\n * _.has(object, ['a', 'b']);\n * // => true\n *\n * _.has(other, 'a');\n * // => false\n */\n function has(object, path) {\n return object != null && hasPath(object, path, baseHas);\n }\n\n /**\n * Checks if `path` is a direct or inherited property of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.hasIn(object, 'a');\n * // => true\n *\n * _.hasIn(object, 'a.b');\n * // => true\n *\n * _.hasIn(object, ['a', 'b']);\n * // => true\n *\n * _.hasIn(object, 'b');\n * // => false\n */\n function hasIn(object, path) {\n return object != null && hasPath(object, path, baseHasIn);\n }\n\n /**\n * Creates an object composed of the inverted keys and values of `object`.\n * If `object` contains duplicate values, subsequent values overwrite\n * property assignments of previous values.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Object\n * @param {Object} object The object to invert.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invert(object);\n * // => { '1': 'c', '2': 'b' }\n */\n var invert = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n result[value] = key;\n }, constant(identity));\n\n /**\n * This method is like `_.invert` except that the inverted object is generated\n * from the results of running each element of `object` thru `iteratee`. The\n * corresponding inverted value of each inverted key is an array of keys\n * responsible for generating the inverted value. The iteratee is invoked\n * with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Object\n * @param {Object} object The object to invert.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invertBy(object);\n * // => { '1': ['a', 'c'], '2': ['b'] }\n *\n * _.invertBy(object, function(value) {\n * return 'group' + value;\n * });\n * // => { 'group1': ['a', 'c'], 'group2': ['b'] }\n */\n var invertBy = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }, getIteratee);\n\n /**\n * Invokes the method at `path` of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };\n *\n * _.invoke(object, 'a[0].b.c.slice', 1, 3);\n * // => [2, 3]\n */\n var invoke = baseRest(baseInvoke);\n\n /**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\n function keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n }\n\n /**\n * Creates an array of the own and inherited enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keysIn(new Foo);\n * // => ['a', 'b', 'c'] (iteration order is not guaranteed)\n */\n function keysIn(object) {\n return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);\n }\n\n /**\n * The opposite of `_.mapValues`; this method creates an object with the\n * same values as `object` and keys generated by running each own enumerable\n * string keyed property of `object` thru `iteratee`. The iteratee is invoked\n * with three arguments: (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapValues\n * @example\n *\n * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {\n * return key + value;\n * });\n * // => { 'a1': 1, 'b2': 2 }\n */\n function mapKeys(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, iteratee(value, key, object), value);\n });\n return result;\n }\n\n /**\n * Creates an object with the same keys as `object` and values generated\n * by running each own enumerable string keyed property of `object` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapKeys\n * @example\n *\n * var users = {\n * 'fred': { 'user': 'fred', 'age': 40 },\n * 'pebbles': { 'user': 'pebbles', 'age': 1 }\n * };\n *\n * _.mapValues(users, function(o) { return o.age; });\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n *\n * // The `_.property` iteratee shorthand.\n * _.mapValues(users, 'age');\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n */\n function mapValues(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, key, iteratee(value, key, object));\n });\n return result;\n }\n\n /**\n * This method is like `_.assign` except that it recursively merges own and\n * inherited enumerable string keyed properties of source objects into the\n * destination object. Source properties that resolve to `undefined` are\n * skipped if a destination value exists. Array and plain object properties\n * are merged recursively. Other objects and value types are overridden by\n * assignment. Source objects are applied from left to right. Subsequent\n * sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {\n * 'a': [{ 'b': 2 }, { 'd': 4 }]\n * };\n *\n * var other = {\n * 'a': [{ 'c': 3 }, { 'e': 5 }]\n * };\n *\n * _.merge(object, other);\n * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }\n */\n var merge = createAssigner(function(object, source, srcIndex) {\n baseMerge(object, source, srcIndex);\n });\n\n /**\n * This method is like `_.merge` except that it accepts `customizer` which\n * is invoked to produce the merged values of the destination and source\n * properties. If `customizer` returns `undefined`, merging is handled by the\n * method instead. The `customizer` is invoked with six arguments:\n * (objValue, srcValue, key, object, source, stack).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} customizer The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * function customizer(objValue, srcValue) {\n * if (_.isArray(objValue)) {\n * return objValue.concat(srcValue);\n * }\n * }\n *\n * var object = { 'a': [1], 'b': [2] };\n * var other = { 'a': [3], 'b': [4] };\n *\n * _.mergeWith(object, other, customizer);\n * // => { 'a': [1, 3], 'b': [2, 4] }\n */\n var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {\n baseMerge(object, source, srcIndex, customizer);\n });\n\n /**\n * The opposite of `_.pick`; this method creates an object composed of the\n * own and inherited enumerable property paths of `object` that are not omitted.\n *\n * **Note:** This method is considerably slower than `_.pick`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to omit.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omit(object, ['a', 'c']);\n * // => { 'b': '2' }\n */\n var omit = flatRest(function(object, paths) {\n var result = {};\n if (object == null) {\n return result;\n }\n var isDeep = false;\n paths = arrayMap(paths, function(path) {\n path = castPath(path, object);\n isDeep || (isDeep = path.length > 1);\n return path;\n });\n copyObject(object, getAllKeysIn(object), result);\n if (isDeep) {\n result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);\n }\n var length = paths.length;\n while (length--) {\n baseUnset(result, paths[length]);\n }\n return result;\n });\n\n /**\n * The opposite of `_.pickBy`; this method creates an object composed of\n * the own and inherited enumerable string keyed properties of `object` that\n * `predicate` doesn't return truthy for. The predicate is invoked with two\n * arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omitBy(object, _.isNumber);\n * // => { 'b': '2' }\n */\n function omitBy(object, predicate) {\n return pickBy(object, negate(getIteratee(predicate)));\n }\n\n /**\n * Creates an object composed of the picked `object` properties.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pick(object, ['a', 'c']);\n * // => { 'a': 1, 'c': 3 }\n */\n var pick = flatRest(function(object, paths) {\n return object == null ? {} : basePick(object, paths);\n });\n\n /**\n * Creates an object composed of the `object` properties `predicate` returns\n * truthy for. The predicate is invoked with two arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pickBy(object, _.isNumber);\n * // => { 'a': 1, 'c': 3 }\n */\n function pickBy(object, predicate) {\n if (object == null) {\n return {};\n }\n var props = arrayMap(getAllKeysIn(object), function(prop) {\n return [prop];\n });\n predicate = getIteratee(predicate);\n return basePickBy(object, props, function(value, path) {\n return predicate(value, path[0]);\n });\n }\n\n /**\n * This method is like `_.get` except that if the resolved value is a\n * function it's invoked with the `this` binding of its parent object and\n * its result is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to resolve.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };\n *\n * _.result(object, 'a[0].b.c1');\n * // => 3\n *\n * _.result(object, 'a[0].b.c2');\n * // => 4\n *\n * _.result(object, 'a[0].b.c3', 'default');\n * // => 'default'\n *\n * _.result(object, 'a[0].b.c3', _.constant('default'));\n * // => 'default'\n */\n function result(object, path, defaultValue) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length;\n\n // Ensure the loop is entered when path is empty.\n if (!length) {\n length = 1;\n object = undefined;\n }\n while (++index < length) {\n var value = object == null ? undefined : object[toKey(path[index])];\n if (value === undefined) {\n index = length;\n value = defaultValue;\n }\n object = isFunction(value) ? value.call(object) : value;\n }\n return object;\n }\n\n /**\n * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,\n * it's created. Arrays are created for missing index properties while objects\n * are created for all other missing properties. Use `_.setWith` to customize\n * `path` creation.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.set(object, 'a[0].b.c', 4);\n * console.log(object.a[0].b.c);\n * // => 4\n *\n * _.set(object, ['x', '0', 'y', 'z'], 5);\n * console.log(object.x[0].y.z);\n * // => 5\n */\n function set(object, path, value) {\n return object == null ? object : baseSet(object, path, value);\n }\n\n /**\n * This method is like `_.set` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.setWith(object, '[0][1]', 'a', Object);\n * // => { '0': { '1': 'a' } }\n */\n function setWith(object, path, value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseSet(object, path, value, customizer);\n }\n\n /**\n * Creates an array of own enumerable string keyed-value pairs for `object`\n * which can be consumed by `_.fromPairs`. If `object` is a map or set, its\n * entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entries\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairs(new Foo);\n * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)\n */\n var toPairs = createToPairs(keys);\n\n /**\n * Creates an array of own and inherited enumerable string keyed-value pairs\n * for `object` which can be consumed by `_.fromPairs`. If `object` is a map\n * or set, its entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entriesIn\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairsIn(new Foo);\n * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)\n */\n var toPairsIn = createToPairs(keysIn);\n\n /**\n * An alternative to `_.reduce`; this method transforms `object` to a new\n * `accumulator` object which is the result of running each of its own\n * enumerable string keyed properties thru `iteratee`, with each invocation\n * potentially mutating the `accumulator` object. If `accumulator` is not\n * provided, a new object with the same `[[Prototype]]` will be used. The\n * iteratee is invoked with four arguments: (accumulator, value, key, object).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The custom accumulator value.\n * @returns {*} Returns the accumulated value.\n * @example\n *\n * _.transform([2, 3, 4], function(result, n) {\n * result.push(n *= n);\n * return n % 2 == 0;\n * }, []);\n * // => [4, 9]\n *\n * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] }\n */\n function transform(object, iteratee, accumulator) {\n var isArr = isArray(object),\n isArrLike = isArr || isBuffer(object) || isTypedArray(object);\n\n iteratee = getIteratee(iteratee, 4);\n if (accumulator == null) {\n var Ctor = object && object.constructor;\n if (isArrLike) {\n accumulator = isArr ? new Ctor : [];\n }\n else if (isObject(object)) {\n accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};\n }\n else {\n accumulator = {};\n }\n }\n (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {\n return iteratee(accumulator, value, index, object);\n });\n return accumulator;\n }\n\n /**\n * Removes the property at `path` of `object`.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 7 } }] };\n * _.unset(object, 'a[0].b.c');\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n *\n * _.unset(object, ['a', '0', 'b', 'c']);\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n */\n function unset(object, path) {\n return object == null ? true : baseUnset(object, path);\n }\n\n /**\n * This method is like `_.set` except that accepts `updater` to produce the\n * value to set. Use `_.updateWith` to customize `path` creation. The `updater`\n * is invoked with one argument: (value).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.update(object, 'a[0].b.c', function(n) { return n * n; });\n * console.log(object.a[0].b.c);\n * // => 9\n *\n * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });\n * console.log(object.x[0].y.z);\n * // => 0\n */\n function update(object, path, updater) {\n return object == null ? object : baseUpdate(object, path, castFunction(updater));\n }\n\n /**\n * This method is like `_.update` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.updateWith(object, '[0][1]', _.constant('a'), Object);\n * // => { '0': { '1': 'a' } }\n */\n function updateWith(object, path, updater, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);\n }\n\n /**\n * Creates an array of the own enumerable string keyed property values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.values(new Foo);\n * // => [1, 2] (iteration order is not guaranteed)\n *\n * _.values('hi');\n * // => ['h', 'i']\n */\n function values(object) {\n return object == null ? [] : baseValues(object, keys(object));\n }\n\n /**\n * Creates an array of the own and inherited enumerable string keyed property\n * values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.valuesIn(new Foo);\n * // => [1, 2, 3] (iteration order is not guaranteed)\n */\n function valuesIn(object) {\n return object == null ? [] : baseValues(object, keysIn(object));\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Clamps `number` within the inclusive `lower` and `upper` bounds.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Number\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n * @example\n *\n * _.clamp(-10, -5, 5);\n * // => -5\n *\n * _.clamp(10, -5, 5);\n * // => 5\n */\n function clamp(number, lower, upper) {\n if (upper === undefined) {\n upper = lower;\n lower = undefined;\n }\n if (upper !== undefined) {\n upper = toNumber(upper);\n upper = upper === upper ? upper : 0;\n }\n if (lower !== undefined) {\n lower = toNumber(lower);\n lower = lower === lower ? lower : 0;\n }\n return baseClamp(toNumber(number), lower, upper);\n }\n\n /**\n * Checks if `n` is between `start` and up to, but not including, `end`. If\n * `end` is not specified, it's set to `start` with `start` then set to `0`.\n * If `start` is greater than `end` the params are swapped to support\n * negative ranges.\n *\n * @static\n * @memberOf _\n * @since 3.3.0\n * @category Number\n * @param {number} number The number to check.\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n * @see _.range, _.rangeRight\n * @example\n *\n * _.inRange(3, 2, 4);\n * // => true\n *\n * _.inRange(4, 8);\n * // => true\n *\n * _.inRange(4, 2);\n * // => false\n *\n * _.inRange(2, 2);\n * // => false\n *\n * _.inRange(1.2, 2);\n * // => true\n *\n * _.inRange(5.2, 4);\n * // => false\n *\n * _.inRange(-3, -2, -6);\n * // => true\n */\n function inRange(number, start, end) {\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n number = toNumber(number);\n return baseInRange(number, start, end);\n }\n\n /**\n * Produces a random number between the inclusive `lower` and `upper` bounds.\n * If only one argument is provided a number between `0` and the given number\n * is returned. If `floating` is `true`, or either `lower` or `upper` are\n * floats, a floating-point number is returned instead of an integer.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Number\n * @param {number} [lower=0] The lower bound.\n * @param {number} [upper=1] The upper bound.\n * @param {boolean} [floating] Specify returning a floating-point number.\n * @returns {number} Returns the random number.\n * @example\n *\n * _.random(0, 5);\n * // => an integer between 0 and 5\n *\n * _.random(5);\n * // => also an integer between 0 and 5\n *\n * _.random(5, true);\n * // => a floating-point number between 0 and 5\n *\n * _.random(1.2, 5.2);\n * // => a floating-point number between 1.2 and 5.2\n */\n function random(lower, upper, floating) {\n if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {\n upper = floating = undefined;\n }\n if (floating === undefined) {\n if (typeof upper == 'boolean') {\n floating = upper;\n upper = undefined;\n }\n else if (typeof lower == 'boolean') {\n floating = lower;\n lower = undefined;\n }\n }\n if (lower === undefined && upper === undefined) {\n lower = 0;\n upper = 1;\n }\n else {\n lower = toFinite(lower);\n if (upper === undefined) {\n upper = lower;\n lower = 0;\n } else {\n upper = toFinite(upper);\n }\n }\n if (lower > upper) {\n var temp = lower;\n lower = upper;\n upper = temp;\n }\n if (floating || lower % 1 || upper % 1) {\n var rand = nativeRandom();\n return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);\n }\n return baseRandom(lower, upper);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the camel cased string.\n * @example\n *\n * _.camelCase('Foo Bar');\n * // => 'fooBar'\n *\n * _.camelCase('--foo-bar--');\n * // => 'fooBar'\n *\n * _.camelCase('__FOO_BAR__');\n * // => 'fooBar'\n */\n var camelCase = createCompounder(function(result, word, index) {\n word = word.toLowerCase();\n return result + (index ? capitalize(word) : word);\n });\n\n /**\n * Converts the first character of `string` to upper case and the remaining\n * to lower case.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to capitalize.\n * @returns {string} Returns the capitalized string.\n * @example\n *\n * _.capitalize('FRED');\n * // => 'Fred'\n */\n function capitalize(string) {\n return upperFirst(toString(string).toLowerCase());\n }\n\n /**\n * Deburrs `string` by converting\n * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)\n * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)\n * letters to basic Latin letters and removing\n * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to deburr.\n * @returns {string} Returns the deburred string.\n * @example\n *\n * _.deburr('déjà vu');\n * // => 'deja vu'\n */\n function deburr(string) {\n string = toString(string);\n return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');\n }\n\n /**\n * Checks if `string` ends with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=string.length] The position to search up to.\n * @returns {boolean} Returns `true` if `string` ends with `target`,\n * else `false`.\n * @example\n *\n * _.endsWith('abc', 'c');\n * // => true\n *\n * _.endsWith('abc', 'b');\n * // => false\n *\n * _.endsWith('abc', 'b', 2);\n * // => true\n */\n function endsWith(string, target, position) {\n string = toString(string);\n target = baseToString(target);\n\n var length = string.length;\n position = position === undefined\n ? length\n : baseClamp(toInteger(position), 0, length);\n\n var end = position;\n position -= target.length;\n return position >= 0 && string.slice(position, end) == target;\n }\n\n /**\n * Converts the characters \"&\", \"<\", \">\", '\"', and \"'\" in `string` to their\n * corresponding HTML entities.\n *\n * **Note:** No other characters are escaped. To escape additional\n * characters use a third-party library like [_he_](https://mths.be/he).\n *\n * Though the \">\" character is escaped for symmetry, characters like\n * \">\" and \"/\" don't need escaping in HTML and have no special meaning\n * unless they're part of a tag or unquoted attribute value. See\n * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)\n * (under \"semi-related fun fact\") for more details.\n *\n * When working with HTML you should always\n * [quote attribute values](http://wonko.com/post/html-escaping) to reduce\n * XSS vectors.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escape('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles'\n */\n function escape(string) {\n string = toString(string);\n return (string && reHasUnescapedHtml.test(string))\n ? string.replace(reUnescapedHtml, escapeHtmlChar)\n : string;\n }\n\n /**\n * Escapes the `RegExp` special characters \"^\", \"$\", \"\\\", \".\", \"*\", \"+\",\n * \"?\", \"(\", \")\", \"[\", \"]\", \"{\", \"}\", and \"|\" in `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escapeRegExp('[lodash](https://lodash.com/)');\n * // => '\\[lodash\\]\\(https://lodash\\.com/\\)'\n */\n function escapeRegExp(string) {\n string = toString(string);\n return (string && reHasRegExpChar.test(string))\n ? string.replace(reRegExpChar, '\\\\$&')\n : string;\n }\n\n /**\n * Converts `string` to\n * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the kebab cased string.\n * @example\n *\n * _.kebabCase('Foo Bar');\n * // => 'foo-bar'\n *\n * _.kebabCase('fooBar');\n * // => 'foo-bar'\n *\n * _.kebabCase('__FOO_BAR__');\n * // => 'foo-bar'\n */\n var kebabCase = createCompounder(function(result, word, index) {\n return result + (index ? '-' : '') + word.toLowerCase();\n });\n\n /**\n * Converts `string`, as space separated words, to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.lowerCase('--Foo-Bar--');\n * // => 'foo bar'\n *\n * _.lowerCase('fooBar');\n * // => 'foo bar'\n *\n * _.lowerCase('__FOO_BAR__');\n * // => 'foo bar'\n */\n var lowerCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toLowerCase();\n });\n\n /**\n * Converts the first character of `string` to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.lowerFirst('Fred');\n * // => 'fred'\n *\n * _.lowerFirst('FRED');\n * // => 'fRED'\n */\n var lowerFirst = createCaseFirst('toLowerCase');\n\n /**\n * Pads `string` on the left and right sides if it's shorter than `length`.\n * Padding characters are truncated if they can't be evenly divided by `length`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.pad('abc', 8);\n * // => ' abc '\n *\n * _.pad('abc', 8, '_-');\n * // => '_-abc_-_'\n *\n * _.pad('abc', 3);\n * // => 'abc'\n */\n function pad(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n if (!length || strLength >= length) {\n return string;\n }\n var mid = (length - strLength) / 2;\n return (\n createPadding(nativeFloor(mid), chars) +\n string +\n createPadding(nativeCeil(mid), chars)\n );\n }\n\n /**\n * Pads `string` on the right side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padEnd('abc', 6);\n * // => 'abc '\n *\n * _.padEnd('abc', 6, '_-');\n * // => 'abc_-_'\n *\n * _.padEnd('abc', 3);\n * // => 'abc'\n */\n function padEnd(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (string + createPadding(length - strLength, chars))\n : string;\n }\n\n /**\n * Pads `string` on the left side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padStart('abc', 6);\n * // => ' abc'\n *\n * _.padStart('abc', 6, '_-');\n * // => '_-_abc'\n *\n * _.padStart('abc', 3);\n * // => 'abc'\n */\n function padStart(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (createPadding(length - strLength, chars) + string)\n : string;\n }\n\n /**\n * Converts `string` to an integer of the specified radix. If `radix` is\n * `undefined` or `0`, a `radix` of `10` is used unless `value` is a\n * hexadecimal, in which case a `radix` of `16` is used.\n *\n * **Note:** This method aligns with the\n * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category String\n * @param {string} string The string to convert.\n * @param {number} [radix=10] The radix to interpret `value` by.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.parseInt('08');\n * // => 8\n *\n * _.map(['6', '08', '10'], _.parseInt);\n * // => [6, 8, 10]\n */\n function parseInt(string, radix, guard) {\n if (guard || radix == null) {\n radix = 0;\n } else if (radix) {\n radix = +radix;\n }\n return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);\n }\n\n /**\n * Repeats the given string `n` times.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to repeat.\n * @param {number} [n=1] The number of times to repeat the string.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the repeated string.\n * @example\n *\n * _.repeat('*', 3);\n * // => '***'\n *\n * _.repeat('abc', 2);\n * // => 'abcabc'\n *\n * _.repeat('abc', 0);\n * // => ''\n */\n function repeat(string, n, guard) {\n if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n return baseRepeat(toString(string), n);\n }\n\n /**\n * Replaces matches for `pattern` in `string` with `replacement`.\n *\n * **Note:** This method is based on\n * [`String#replace`](https://mdn.io/String/replace).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to modify.\n * @param {RegExp|string} pattern The pattern to replace.\n * @param {Function|string} replacement The match replacement.\n * @returns {string} Returns the modified string.\n * @example\n *\n * _.replace('Hi Fred', 'Fred', 'Barney');\n * // => 'Hi Barney'\n */\n function replace() {\n var args = arguments,\n string = toString(args[0]);\n\n return args.length < 3 ? string : string.replace(args[1], args[2]);\n }\n\n /**\n * Converts `string` to\n * [snake case](https://en.wikipedia.org/wiki/Snake_case).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the snake cased string.\n * @example\n *\n * _.snakeCase('Foo Bar');\n * // => 'foo_bar'\n *\n * _.snakeCase('fooBar');\n * // => 'foo_bar'\n *\n * _.snakeCase('--FOO-BAR--');\n * // => 'foo_bar'\n */\n var snakeCase = createCompounder(function(result, word, index) {\n return result + (index ? '_' : '') + word.toLowerCase();\n });\n\n /**\n * Splits `string` by `separator`.\n *\n * **Note:** This method is based on\n * [`String#split`](https://mdn.io/String/split).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to split.\n * @param {RegExp|string} separator The separator pattern to split by.\n * @param {number} [limit] The length to truncate results to.\n * @returns {Array} Returns the string segments.\n * @example\n *\n * _.split('a-b-c', '-', 2);\n * // => ['a', 'b']\n */\n function split(string, separator, limit) {\n if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {\n separator = limit = undefined;\n }\n limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;\n if (!limit) {\n return [];\n }\n string = toString(string);\n if (string && (\n typeof separator == 'string' ||\n (separator != null && !isRegExp(separator))\n )) {\n separator = baseToString(separator);\n if (!separator && hasUnicode(string)) {\n return castSlice(stringToArray(string), 0, limit);\n }\n }\n return string.split(separator, limit);\n }\n\n /**\n * Converts `string` to\n * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).\n *\n * @static\n * @memberOf _\n * @since 3.1.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the start cased string.\n * @example\n *\n * _.startCase('--foo-bar--');\n * // => 'Foo Bar'\n *\n * _.startCase('fooBar');\n * // => 'Foo Bar'\n *\n * _.startCase('__FOO_BAR__');\n * // => 'FOO BAR'\n */\n var startCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + upperFirst(word);\n });\n\n /**\n * Checks if `string` starts with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=0] The position to search from.\n * @returns {boolean} Returns `true` if `string` starts with `target`,\n * else `false`.\n * @example\n *\n * _.startsWith('abc', 'a');\n * // => true\n *\n * _.startsWith('abc', 'b');\n * // => false\n *\n * _.startsWith('abc', 'b', 1);\n * // => true\n */\n function startsWith(string, target, position) {\n string = toString(string);\n position = position == null\n ? 0\n : baseClamp(toInteger(position), 0, string.length);\n\n target = baseToString(target);\n return string.slice(position, position + target.length) == target;\n }\n\n /**\n * Creates a compiled template function that can interpolate data properties\n * in \"interpolate\" delimiters, HTML-escape interpolated data properties in\n * \"escape\" delimiters, and execute JavaScript in \"evaluate\" delimiters. Data\n * properties may be accessed as free variables in the template. If a setting\n * object is given, it takes precedence over `_.templateSettings` values.\n *\n * **Note:** In the development build `_.template` utilizes\n * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)\n * for easier debugging.\n *\n * For more information on precompiling templates see\n * [lodash's custom builds documentation](https://lodash.com/custom-builds).\n *\n * For more information on Chrome extension sandboxes see\n * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The template string.\n * @param {Object} [options={}] The options object.\n * @param {RegExp} [options.escape=_.templateSettings.escape]\n * The HTML \"escape\" delimiter.\n * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]\n * The \"evaluate\" delimiter.\n * @param {Object} [options.imports=_.templateSettings.imports]\n * An object to import into the template as free variables.\n * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]\n * The \"interpolate\" delimiter.\n * @param {string} [options.sourceURL='lodash.templateSources[n]']\n * The sourceURL of the compiled template.\n * @param {string} [options.variable='obj']\n * The data object variable name.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the compiled template function.\n * @example\n *\n * // Use the \"interpolate\" delimiter to create a compiled template.\n * var compiled = _.template('hello <%= user %>!');\n * compiled({ 'user': 'fred' });\n * // => 'hello fred!'\n *\n * // Use the HTML \"escape\" delimiter to escape data property values.\n * var compiled = _.template('<%- value %>');\n * compiled({ 'value': '